From eeb3c18d16c1722808f84f731738bd49abc36644 Mon Sep 17 00:00:00 2001 From: dcq Date: Tue, 17 Feb 2004 15:01:13 +0000 Subject: [PATCH] DCQ : Add Animation Functions. --- INSTALL | 4 +- Makefile.in | 6 + bin/VERSION | 2 +- doc/html/INPUT/doxyfile | 2 +- doc/html/INPUT/sources/static/tree.js | 2 +- doc/html/Makefile.in | 1 + idl/GEOM_Gen.idl | 19 + idl/GEOM_Kinematic.idl | 195 +++++ idl/Makefile.in | 1 + resources/GEOM_en.xml | 45 +- resources/animation.png | Bin 0 -> 276 bytes resources/assembly.png | Bin 0 -> 285 bytes resources/contact.png | Bin 0 -> 209 bytes resources/tree_animation.png | Bin 0 -> 163 bytes resources/tree_assembly.png | Bin 0 -> 151 bytes resources/tree_contact.png | Bin 0 -> 144 bytes src/BasicGUI/Makefile.in | 2 +- src/BooleanGUI/BooleanGUI_CommonDlg.cxx | 5 - src/BooleanGUI/BooleanGUI_CommonDlg.h | 2 - src/BooleanGUI/BooleanGUI_CutDlg.cxx | 5 - src/BooleanGUI/BooleanGUI_CutDlg.h | 2 - src/BooleanGUI/BooleanGUI_FuseDlg.cxx | 5 - src/BooleanGUI/BooleanGUI_FuseDlg.h | 2 - src/BooleanGUI/BooleanGUI_SectionDlg.cxx | 5 - src/BooleanGUI/BooleanGUI_SectionDlg.h | 2 - src/BooleanGUI/Makefile.in | 2 +- src/BuildGUI/Makefile.in | 2 +- src/DisplayGUI/DisplayGUI.cxx | 6 + src/DisplayGUI/Makefile.in | 2 +- src/EntityGUI/EntityGUI_SubShapeDlg.cxx | 2 +- src/EntityGUI/Makefile.in | 2 +- src/GEOM/GEOM_Animation_i.cc | 174 +++++ src/GEOM/GEOM_Animation_i.hh | 97 +++ src/GEOM/GEOM_Assembly_i.cc | 160 ++++ src/GEOM/GEOM_Assembly_i.hh | 89 +++ src/GEOM/GEOM_Contact_i.cc | 212 ++++++ src/GEOM/GEOM_Contact_i.hh | 106 +++ src/GEOM/GEOM_Gen_i.cc | 137 +++- src/GEOM/GEOM_Gen_i.hh | 22 + src/GEOM/GEOM_Position_i.cc | 147 ++++ src/GEOM/GEOM_Position_i.hh | 84 +++ src/GEOM/GEOM_Rotation_i.cc | 135 ++++ src/GEOM/GEOM_Rotation_i.hh | 85 +++ src/GEOM/GEOM_Translation_i.cc | 101 +++ src/GEOM/GEOM_Translation_i.hh | 70 ++ src/GEOM/Makefile.in | 8 +- src/GEOMBase/GEOMBase.cxx | 145 +++- src/GEOMBase/GEOMBase.h | 6 + src/GEOMBase/Makefile.in | 3 +- src/GEOMClient/Makefile.in | 2 +- src/GEOMContext/GEOM_icons.po | 24 + src/GEOMContext/GEOM_msg_en.po | 72 ++ src/GEOMContext/Makefile.in | 2 +- src/GEOMDS/GEOMDS_Commands.cxx | 206 +++++ src/GEOMDS/GEOMDS_Commands.hxx | 16 + src/GEOMDS/GEOMDS_Commands.jxx | 2 +- src/GEOMFiltersSelection/Makefile.in | 2 +- src/GEOMGUI/GeometryGUI.cxx | 40 + src/GEOMGUI/Makefile.in | 3 +- src/GEOMToolsGUI/GEOMToolsGUI.cxx | 29 +- src/GEOMToolsGUI/GEOMToolsGUI_NbIsosDlg.cxx | 14 +- src/GEOMToolsGUI/GEOMToolsGUI_NbIsosDlg.h | 16 +- .../GEOMToolsGUI_TransparencyDlg.cxx | 37 +- .../GEOMToolsGUI_TransparencyDlg.h | 12 +- src/GEOMToolsGUI/Makefile.in | 2 +- src/GEOM_SWIG/Makefile.in | 1 + src/GEOM_SWIG/geompy.py | 4 +- src/GenerationGUI/Makefile.in | 2 +- src/KINEMATIC/Kinematic_Animation.cxx | 240 ++++++ src/KINEMATIC/Kinematic_Animation.hxx | 80 ++ src/KINEMATIC/Kinematic_Assembly.cxx | 69 ++ src/KINEMATIC/Kinematic_Assembly.hxx | 52 ++ src/KINEMATIC/Kinematic_Contact.cxx | 133 ++++ src/KINEMATIC/Kinematic_Contact.hxx | 80 ++ src/KINEMATIC/Kinematic_Position.cxx | 107 +++ src/KINEMATIC/Kinematic_Position.hxx | 70 ++ src/KINEMATIC/Kinematic_Rotation.cxx | 60 ++ src/KINEMATIC/Kinematic_Rotation.hxx | 65 ++ src/KINEMATIC/Kinematic_Translation.cxx | 56 ++ src/KINEMATIC/Kinematic_Translation.hxx | 55 ++ src/KINEMATIC/Makefile.in | 61 ++ src/KinematicGUI/KinematicGUI.cxx | 708 ++++++++++++++++++ src/KinematicGUI/KinematicGUI.h | 89 +++ src/KinematicGUI/KinematicGUI_12Spin.cxx | 87 +++ src/KinematicGUI/KinematicGUI_12Spin.h | 58 ++ src/KinematicGUI/KinematicGUI_12Spin_QTD.cxx | 213 ++++++ src/KinematicGUI/KinematicGUI_12Spin_QTD.h | 66 ++ .../KinematicGUI_2Sel2Spin1Check.cxx | 57 ++ .../KinematicGUI_2Sel2Spin1Check.h | 48 ++ .../KinematicGUI_2Sel2Spin1Check_QTD.cxx | 122 +++ .../KinematicGUI_2Sel2Spin1Check_QTD.h | 53 ++ src/KinematicGUI/KinematicGUI_3List3Spin.cxx | 60 ++ src/KinematicGUI/KinematicGUI_3List3Spin.h | 49 ++ .../KinematicGUI_3List3Spin_QTD.cxx | 125 ++++ .../KinematicGUI_3List3Spin_QTD.h | 51 ++ .../KinematicGUI_3Sel1List_QTD.cxx | 117 +++ src/KinematicGUI/KinematicGUI_3Sel1List_QTD.h | 51 ++ src/KinematicGUI/KinematicGUI_3Sel1Spin.cxx | 54 ++ src/KinematicGUI/KinematicGUI_3Sel1Spin.h | 47 ++ .../KinematicGUI_3Sel1Spin_QTD.cxx | 121 +++ src/KinematicGUI/KinematicGUI_3Sel1Spin_QTD.h | 52 ++ .../KinematicGUI_AnimationDlg.cxx | 284 +++++++ src/KinematicGUI/KinematicGUI_AnimationDlg.h | 75 ++ src/KinematicGUI/KinematicGUI_ContactDlg.cxx | 294 ++++++++ src/KinematicGUI/KinematicGUI_ContactDlg.h | 76 ++ src/KinematicGUI/KinematicGUI_ContactHDlg.cxx | 286 +++++++ src/KinematicGUI/KinematicGUI_ContactHDlg.h | 76 ++ src/KinematicGUI/KinematicGUI_PositionDlg.cxx | 278 +++++++ src/KinematicGUI/KinematicGUI_PositionDlg.h | 72 ++ src/KinematicGUI/KinematicGUI_RotationDlg.cxx | 320 ++++++++ src/KinematicGUI/KinematicGUI_RotationDlg.h | 77 ++ .../KinematicGUI_TranslationDlg.cxx | 199 +++++ .../KinematicGUI_TranslationDlg.h | 71 ++ src/KinematicGUI/Makefile.in | 89 +++ .../UIFiles/KinematicGUI_12Spin_QTD.ui | 495 ++++++++++++ .../KinematicGUI_2Sel2Spin1Check_QTD.ui | 239 ++++++ .../UIFiles/KinematicGUI_3List3Spin_QTD.ui | 263 +++++++ .../UIFiles/KinematicGUI_3Sel1List_QTD.ui | 223 ++++++ .../UIFiles/KinematicGUI_3Sel1Spin_QTD.ui | 239 ++++++ src/KinematicGUI/UIFiles/ui_to_cxx | 16 + src/Makefile.in | 2 +- src/MeasureGUI/Makefile.in | 2 +- src/OBJECT/GEOM_AISShape.cxx | 10 +- src/OBJECT/GEOM_Actor.cxx | 8 +- src/OBJECT/GEOM_Actor.h | 4 +- src/OBJECT/GEOM_AssemblyBuilder.cxx | 8 +- src/OperationGUI/Makefile.in | 2 +- .../OperationGUI_PartitionDlg.cxx | 13 +- src/PARTITION/Partition_Inter2d.cxx | 7 +- src/PARTITION/Partition_Inter3d.cxx | 39 +- src/PARTITION/Partition_Spliter.cdl | 1 + src/PARTITION/Partition_Spliter.cxx | 55 +- src/PARTITION/Partition_Spliter.hxx | 1 + src/PrimitiveGUI/Makefile.in | 2 +- src/RepairGUI/Makefile.in | 2 +- src/RepairGUI/RepairGUI_FillingHoleDlg.cxx | 2 + src/SKETCHER/Makefile.in | 2 +- src/TransformationGUI/Makefile.in | 2 +- 138 files changed, 9611 insertions(+), 169 deletions(-) create mode 100644 idl/GEOM_Kinematic.idl create mode 100644 resources/animation.png create mode 100644 resources/assembly.png create mode 100644 resources/contact.png create mode 100644 resources/tree_animation.png create mode 100644 resources/tree_assembly.png create mode 100644 resources/tree_contact.png create mode 100644 src/GEOM/GEOM_Animation_i.cc create mode 100644 src/GEOM/GEOM_Animation_i.hh create mode 100644 src/GEOM/GEOM_Assembly_i.cc create mode 100644 src/GEOM/GEOM_Assembly_i.hh create mode 100644 src/GEOM/GEOM_Contact_i.cc create mode 100644 src/GEOM/GEOM_Contact_i.hh create mode 100644 src/GEOM/GEOM_Position_i.cc create mode 100644 src/GEOM/GEOM_Position_i.hh create mode 100644 src/GEOM/GEOM_Rotation_i.cc create mode 100644 src/GEOM/GEOM_Rotation_i.hh create mode 100644 src/GEOM/GEOM_Translation_i.cc create mode 100644 src/GEOM/GEOM_Translation_i.hh create mode 100644 src/KINEMATIC/Kinematic_Animation.cxx create mode 100644 src/KINEMATIC/Kinematic_Animation.hxx create mode 100644 src/KINEMATIC/Kinematic_Assembly.cxx create mode 100644 src/KINEMATIC/Kinematic_Assembly.hxx create mode 100644 src/KINEMATIC/Kinematic_Contact.cxx create mode 100644 src/KINEMATIC/Kinematic_Contact.hxx create mode 100644 src/KINEMATIC/Kinematic_Position.cxx create mode 100644 src/KINEMATIC/Kinematic_Position.hxx create mode 100644 src/KINEMATIC/Kinematic_Rotation.cxx create mode 100644 src/KINEMATIC/Kinematic_Rotation.hxx create mode 100644 src/KINEMATIC/Kinematic_Translation.cxx create mode 100644 src/KINEMATIC/Kinematic_Translation.hxx create mode 100644 src/KINEMATIC/Makefile.in create mode 100644 src/KinematicGUI/KinematicGUI.cxx create mode 100644 src/KinematicGUI/KinematicGUI.h create mode 100644 src/KinematicGUI/KinematicGUI_12Spin.cxx create mode 100644 src/KinematicGUI/KinematicGUI_12Spin.h create mode 100644 src/KinematicGUI/KinematicGUI_12Spin_QTD.cxx create mode 100644 src/KinematicGUI/KinematicGUI_12Spin_QTD.h create mode 100644 src/KinematicGUI/KinematicGUI_2Sel2Spin1Check.cxx create mode 100644 src/KinematicGUI/KinematicGUI_2Sel2Spin1Check.h create mode 100644 src/KinematicGUI/KinematicGUI_2Sel2Spin1Check_QTD.cxx create mode 100644 src/KinematicGUI/KinematicGUI_2Sel2Spin1Check_QTD.h create mode 100644 src/KinematicGUI/KinematicGUI_3List3Spin.cxx create mode 100644 src/KinematicGUI/KinematicGUI_3List3Spin.h create mode 100644 src/KinematicGUI/KinematicGUI_3List3Spin_QTD.cxx create mode 100644 src/KinematicGUI/KinematicGUI_3List3Spin_QTD.h create mode 100644 src/KinematicGUI/KinematicGUI_3Sel1List_QTD.cxx create mode 100644 src/KinematicGUI/KinematicGUI_3Sel1List_QTD.h create mode 100644 src/KinematicGUI/KinematicGUI_3Sel1Spin.cxx create mode 100644 src/KinematicGUI/KinematicGUI_3Sel1Spin.h create mode 100644 src/KinematicGUI/KinematicGUI_3Sel1Spin_QTD.cxx create mode 100644 src/KinematicGUI/KinematicGUI_3Sel1Spin_QTD.h create mode 100644 src/KinematicGUI/KinematicGUI_AnimationDlg.cxx create mode 100644 src/KinematicGUI/KinematicGUI_AnimationDlg.h create mode 100644 src/KinematicGUI/KinematicGUI_ContactDlg.cxx create mode 100644 src/KinematicGUI/KinematicGUI_ContactDlg.h create mode 100644 src/KinematicGUI/KinematicGUI_ContactHDlg.cxx create mode 100644 src/KinematicGUI/KinematicGUI_ContactHDlg.h create mode 100644 src/KinematicGUI/KinematicGUI_PositionDlg.cxx create mode 100644 src/KinematicGUI/KinematicGUI_PositionDlg.h create mode 100644 src/KinematicGUI/KinematicGUI_RotationDlg.cxx create mode 100644 src/KinematicGUI/KinematicGUI_RotationDlg.h create mode 100644 src/KinematicGUI/KinematicGUI_TranslationDlg.cxx create mode 100644 src/KinematicGUI/KinematicGUI_TranslationDlg.h create mode 100644 src/KinematicGUI/Makefile.in create mode 100644 src/KinematicGUI/UIFiles/KinematicGUI_12Spin_QTD.ui create mode 100644 src/KinematicGUI/UIFiles/KinematicGUI_2Sel2Spin1Check_QTD.ui create mode 100644 src/KinematicGUI/UIFiles/KinematicGUI_3List3Spin_QTD.ui create mode 100644 src/KinematicGUI/UIFiles/KinematicGUI_3Sel1List_QTD.ui create mode 100644 src/KinematicGUI/UIFiles/KinematicGUI_3Sel1Spin_QTD.ui create mode 100755 src/KinematicGUI/UIFiles/ui_to_cxx diff --git a/INSTALL b/INSTALL index 2b4b66d6e..6fe7d777b 100644 --- a/INSTALL +++ b/INSTALL @@ -1,3 +1,3 @@ -This is the version 1.3.0 of GEOM +This is the version 1.4.0 of GEOM Compatible with : - - KERNEL 1.3.0 + - KERNEL 1.4.0 diff --git a/Makefile.in b/Makefile.in index 3657e2248..65bc47c44 100644 --- a/Makefile.in +++ b/Makefile.in @@ -21,8 +21,10 @@ GEOM_en.xml \ GEOM_fr.xml \ GEOMCatalog.xml \ GEOMDS_Resources \ +animation.png \ arc.png \ archimede.png \ +assembly.png \ axisinertia.png \ basicproperties.png \ bounding.png \ @@ -47,6 +49,7 @@ common.png \ cone.png \ conedxyz.png \ conepointvector.png \ +contact.png \ cut.png \ cylinder.png \ cylinderdxyz.png \ @@ -109,8 +112,11 @@ torus.png \ torusdxyz.png \ toruspointvector.png \ translation.png \ +tree_animation.png \ +tree_assembly.png \ tree_compound.png \ tree_compsolid.png \ +tree_contact.png \ tree_edge.png \ tree_face.png \ tree_shape.png \ diff --git a/bin/VERSION b/bin/VERSION index 6156fe3ca..1b77509ae 100755 --- a/bin/VERSION +++ b/bin/VERSION @@ -1 +1 @@ -THIS IS SALOME - GEOM VERSION: 1.3.0 +THIS IS SALOME - GEOM VERSION: 1.4.0 diff --git a/doc/html/INPUT/doxyfile b/doc/html/INPUT/doxyfile index 90395f67f..2a891be10 100755 --- a/doc/html/INPUT/doxyfile +++ b/doc/html/INPUT/doxyfile @@ -3,7 +3,7 @@ #--------------------------------------------------------------------------- # General configuration options #--------------------------------------------------------------------------- -PROJECT_NAME = "SALOME - GEOM - v.1.3.0" +PROJECT_NAME = "SALOME - GEOM - v.1.4.0" PROJECT_NUMBER = id#1.1 OUTPUT_DIRECTORY = ../ OUTPUT_LANGUAGE = English diff --git a/doc/html/INPUT/sources/static/tree.js b/doc/html/INPUT/sources/static/tree.js index c744f4641..3fb69102c 100755 --- a/doc/html/INPUT/sources/static/tree.js +++ b/doc/html/INPUT/sources/static/tree.js @@ -1,4 +1,4 @@ -foldersTree = gFld("SALOME v.1.3.0 ", "", "") +foldersTree = gFld("SALOME v.1.4.0 ", "", "") insDoc(foldersTree, gLnk("Main Page", "", "main.html")) aux1 = insFld(foldersTree, gFld("TUI Reference Guide", "")) diff --git a/doc/html/Makefile.in b/doc/html/Makefile.in index 9a87b93ab..135b2daef 100644 --- a/doc/html/Makefile.in +++ b/doc/html/Makefile.in @@ -32,6 +32,7 @@ distclean: clean rm -rf INPUT install: + $(INSTALL) -d $(docdir); \ cp -rf html $(docdir) uninstall: diff --git a/idl/GEOM_Gen.idl b/idl/GEOM_Gen.idl index 12eff04d7..b9374bfc7 100644 --- a/idl/GEOM_Gen.idl +++ b/idl/GEOM_Gen.idl @@ -29,6 +29,7 @@ #include "SALOME_Component.idl" #include "SALOMEDS.idl" #include "GEOM_Shape.idl" +#include "GEOM_Kinematic.idl" module GEOM { @@ -315,11 +316,29 @@ module GEOM void ExportIGES(in string filename,in GEOM_Shape theShape) raises (SALOME::SALOME_Exception) ; void ExportBREP(in string filename,in GEOM_Shape theShape) raises (SALOME::SALOME_Exception) ; void ExportSTEP(in string filename,in GEOM_Shape theShape) raises (SALOME::SALOME_Exception) ; + //-----------------------------------------------------------// // Check Shape // //-----------------------------------------------------------// boolean CheckShape(in GEOM_Shape shape) raises (SALOME::SALOME_Exception) ; + //-----------------------------------------------------------// + // Kinematic // + //-----------------------------------------------------------// + GEOM_Assembly InitAssembly() raises (SALOME::SALOME_Exception) ; + + GEOM_Contact AddContact(in GEOM_Assembly Ass, + in GEOM_Shape Shape1, + in GEOM_Shape Shape2, + in short type, + in double step) raises (SALOME::SALOME_Exception) ; + + GEOM_Animation AddAnimation(in GEOM_Assembly Ass, + in GEOM_Shape Shape1, + in double Duration, + in short NbSeq, + in boolean IsInLoop) raises (SALOME::SALOME_Exception) ; + }; }; diff --git a/idl/GEOM_Kinematic.idl b/idl/GEOM_Kinematic.idl new file mode 100644 index 000000000..671597ac1 --- /dev/null +++ b/idl/GEOM_Kinematic.idl @@ -0,0 +1,195 @@ +// Copyright (C) 2003 OPEN CASCADE, EADS/CCR, LIP6, CEA/DEN, +// CEDRAT, EDF R&D, LEG, PRINCIPIA R&D, BUREAU VERITAS +// +// This library is free software; you can redistribute it and/or +// modify it under the terms of the GNU Lesser General Public +// License as published by the Free Software Foundation; either +// version 2.1 of the License. +// +// This library is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU +// Lesser General Public License for more details. +// +// You should have received a copy of the GNU Lesser General Public +// License along with this library; if not, write to the Free Software +// Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307 USA +// +// See http://www.opencascade.org/SALOME/ or email : webmaster.salome@opencascade.org +// +// +// +// File : GEOM_Kinematic.idl +// Author : Damien COQUERET + +#ifndef __GEOM_Kinematic__ +#define __GEOM_Kinematic__ + +#include "SALOME_Exception.idl" +#include "GEOM_Shape.idl" + +module GEOM +{ + + interface GEOM_Contact; + typedef sequence ListOfContact; + + //-----------------------------------------------------------------// + // interface GEOM_Position methods // + //-----------------------------------------------------------------// + interface GEOM_Position { + + void SetOrigin(in GEOM::PointStruct P0) + raises (SALOME::SALOME_Exception); + + void SetVX(in GEOM::DirStruct Vect) + raises (SALOME::SALOME_Exception); + + void SetVY(in GEOM::DirStruct Vect) + raises (SALOME::SALOME_Exception); + + void SetVZ(in GEOM::DirStruct Vect) + raises (SALOME::SALOME_Exception); + + GEOM::PointStruct GetOrigin() + raises (SALOME::SALOME_Exception); + + GEOM::DirStruct GetVX() + raises (SALOME::SALOME_Exception); + + GEOM::DirStruct GetVY() + raises (SALOME::SALOME_Exception); + + GEOM::DirStruct GetVZ() + raises (SALOME::SALOME_Exception); + + }; + + //-----------------------------------------------------------------// + // interface GEOM_Rotation methods // + //-----------------------------------------------------------------// + interface GEOM_Rotation { + + void SetRotation(in long Rot1, in long Rot2, in long Rot3, + in double Val1, in double Val2, in double Val3) + raises (SALOME::SALOME_Exception); + + long GetRot1() + raises (SALOME::SALOME_Exception); + long GetRot2() + raises (SALOME::SALOME_Exception); + long GetRot3() + raises (SALOME::SALOME_Exception); + + double GetVal1() + raises (SALOME::SALOME_Exception); + double GetVal2() + raises (SALOME::SALOME_Exception); + double GetVal3() + raises (SALOME::SALOME_Exception); + + }; + + //-----------------------------------------------------------------// + // interface GEOM_Translation methods // + //-----------------------------------------------------------------// + interface GEOM_Translation { + + void SetTranslation(in double Val1, in double Val2, in double Val3) + raises (SALOME::SALOME_Exception); + + double GetVal1() + raises (SALOME::SALOME_Exception); + double GetVal2() + raises (SALOME::SALOME_Exception); + double GetVal3() + raises (SALOME::SALOME_Exception); + + }; + + //-----------------------------------------------------------------// + // interface GEOM_Assembly methods // + //-----------------------------------------------------------------// + interface GEOM_Assembly { + + void AddContact(in GEOM::GEOM_Contact aContact) + raises (SALOME::SALOME_Exception); + + GEOM::ListOfContact GetContactList() + raises (SALOME::SALOME_Exception); + + long NbContacts() + raises (SALOME::SALOME_Exception); + + attribute string Name; + attribute string ShapeId; + attribute string StudyShapeId; + + GEOM_Gen Engine(); + + }; + + //-----------------------------------------------------------------// + // interface GEOM_Contact methods // + //-----------------------------------------------------------------// + interface GEOM_Contact { + + long GetType() + raises (SALOME::SALOME_Exception); + + GEOM::GEOM_Shape GetShape1() + raises (SALOME::SALOME_Exception); + + GEOM::GEOM_Shape GetShape2() + raises (SALOME::SALOME_Exception); + + double GetStep() + raises (SALOME::SALOME_Exception); + + GEOM::GEOM_Position GetPosition() + raises (SALOME::SALOME_Exception); + + GEOM::GEOM_Rotation GetRotation() + raises (SALOME::SALOME_Exception); + + GEOM::GEOM_Translation GetTranslation() + raises (SALOME::SALOME_Exception); + + attribute string Name; + attribute string ShapeId; + attribute string StudyShapeId; + + GEOM_Gen Engine(); + + }; + + //-----------------------------------------------------------------// + // interface GEOM_Animation methods // + //-----------------------------------------------------------------// + interface GEOM_Animation { + + GEOM::GEOM_Assembly GetAssembly() + raises (SALOME::SALOME_Exception); + + GEOM::GEOM_Shape GetFrame() + raises (SALOME::SALOME_Exception); + + double GetDuration() + raises (SALOME::SALOME_Exception); + + long GetNbSeq() + raises (SALOME::SALOME_Exception); + + boolean GetIsInLoop() + raises (SALOME::SALOME_Exception); + + attribute string Name; + attribute string ShapeId; + attribute string StudyShapeId; + + GEOM_Gen Engine(); + + }; + +}; +#endif diff --git a/idl/Makefile.in b/idl/Makefile.in index 1d0b5c6cc..802d6f857 100644 --- a/idl/Makefile.in +++ b/idl/Makefile.in @@ -12,6 +12,7 @@ VPATH=.:$(srcdir):${KERNEL_ROOT_DIR}/idl/salome IDL_FILES = \ GEOM_Shape.idl \ + GEOM_Kinematic.idl \ GEOM_Gen.idl PY_CLIENT_IDL = $(IDL_FILES) diff --git a/resources/GEOM_en.xml b/resources/GEOM_en.xml index 1b6fdcc20..4a0727573 100644 --- a/resources/GEOM_en.xml +++ b/resources/GEOM_en.xml @@ -136,8 +136,29 @@ + + + + + + + + + + + + + + + + + + + + + - + @@ -155,6 +176,7 @@ + @@ -175,6 +197,7 @@ + @@ -257,6 +280,26 @@ + + + + + + + + + + + + + + + + + + + + diff --git a/resources/animation.png b/resources/animation.png new file mode 100644 index 0000000000000000000000000000000000000000..545ac6c700742f473ac61d33d688c8e896b942ca GIT binary patch literal 276 zcmeAS@N?(olHy`uVBq!ia0vp^A|TAc1|)ksWqE-VXMsm#F#`kNVGw3Kp1&dmD0s}% z#WAE}&eqA^e1{cyTxx&JW9W@g2=jR6vA1ux#=>PY{4b{%a?kl-v`yW`sbu9l_E(qv zYPnP=J{0ZK*VA2r*)wUle@8w7YM_3j=TlMbew8Ql!rXN_J XHK#sriQ;Ml`iQ~P)z4*}Q$iB}krZ$X literal 0 HcmV?d00001 diff --git a/resources/assembly.png b/resources/assembly.png new file mode 100644 index 0000000000000000000000000000000000000000..87c6bdd52c4795f590b6dd6821c12ada7d999774 GIT binary patch literal 285 zcmeAS@N?(olHy`uVBq!ia0vp^A|TAc1|)ksWqE-VXMsm#F#`kNVGw3Kp1&dmD0tq} z#WAE}&e~u{zGefS(~rM1iF`FET=m2*^ZrRbR<6jTRk`gR9a7hC^mTOpDLr=h<=68q zO5ZfrCol6bX4G6L?>>#|1Vhx7fW(E182Yy*F6J)@yzH7=yN`7LO)mfd literal 0 HcmV?d00001 diff --git a/resources/tree_animation.png b/resources/tree_animation.png new file mode 100644 index 0000000000000000000000000000000000000000..874f02f18a30b00c9f658335c1ee6440c4b09c57 GIT binary patch literal 163 zcmeAS@N?(olHy`uVBq!ia0vp^d?3uh1|;P@bT0xa&H|6fVxZVz5N14{zaj-F80zWb z7*a7OIpN3o0}f(tPaPs#js%z(8T`qgS@yR6^p?7G~Udm?I1xmE^oDF@JEpz+h=X%{k tV@jvd+yI+NBC1oeRZPDMEbW*j#TdQhR_z%d)-Ir-44$rjF6*2UngH&PFMI$1 literal 0 HcmV?d00001 diff --git a/resources/tree_contact.png b/resources/tree_contact.png new file mode 100644 index 0000000000000000000000000000000000000000..be3238d2722be4aba737b619e7fd445cef4cffbe GIT binary patch literal 144 zcmeAS@N?(olHy`uVBq!ia0vp^d?3uh1|;P@bT0xa&H|6fVxZVz5N14{zaj-F=;Z0* z7*a7OIpN3o0}f)#*1Ab_tMu~l{EuE1`}@ApTd7rPv$9m~u6)ted8xx+xXmr*+@aNi n;R+Z0l-G4E(|8&Xtjw?@;nLol4;*TMrZITB`njxgN@xNAJi;)_ literal 0 HcmV?d00001 diff --git a/src/BasicGUI/Makefile.in b/src/BasicGUI/Makefile.in index 2dc8edf1b..0c1125f60 100644 --- a/src/BasicGUI/Makefile.in +++ b/src/BasicGUI/Makefile.in @@ -61,7 +61,7 @@ LIB_MOC = \ BasicGUI_PlaneDlg.h \ BasicGUI_WorkingPlaneDlg.h -LIB_CLIENT_IDL = +LIB_CLIENT_IDL = GEOM_Kinematic.idl LIB_SERVER_IDL = diff --git a/src/BooleanGUI/BooleanGUI_CommonDlg.cxx b/src/BooleanGUI/BooleanGUI_CommonDlg.cxx index 7e881536f..db7b47d14 100644 --- a/src/BooleanGUI/BooleanGUI_CommonDlg.cxx +++ b/src/BooleanGUI/BooleanGUI_CommonDlg.cxx @@ -85,9 +85,6 @@ void BooleanGUI_CommonDlg::Init() { /* init variables */ myEditCurrentArgument = GroupCommon->LineEdit1; - - myShape1.Nullify(); - myShape2.Nullify(); myOkShape1 = myOkShape2 = false; /* signals and slots connections */ @@ -167,7 +164,6 @@ void BooleanGUI_CommonDlg::SelectionIntoArgument() myGeomShape1 = myGeomBase->ConvertIOinGEOMShape(IO, testResult); if(!testResult) return; - myShape1 = S; GroupCommon->LineEdit1->setText(aString); myOkShape1 = true; } @@ -175,7 +171,6 @@ void BooleanGUI_CommonDlg::SelectionIntoArgument() myGeomShape2 = myGeomBase->ConvertIOinGEOMShape(IO, testResult); if(!testResult) return; - myShape2 = S; GroupCommon->LineEdit2->setText(aString); myOkShape2 = true; } diff --git a/src/BooleanGUI/BooleanGUI_CommonDlg.h b/src/BooleanGUI/BooleanGUI_CommonDlg.h index f592e6df0..cb3b805f5 100644 --- a/src/BooleanGUI/BooleanGUI_CommonDlg.h +++ b/src/BooleanGUI/BooleanGUI_CommonDlg.h @@ -54,8 +54,6 @@ private: BooleanGUI* myBooleanGUI; - TopoDS_Shape myShape1; /* topology used */ - TopoDS_Shape myShape2; /* topology used */ GEOM::GEOM_Shape_var myGeomShape1; /* is myShape1 */ GEOM::GEOM_Shape_var myGeomShape2; /* is myShape2 */ bool myOkShape1; diff --git a/src/BooleanGUI/BooleanGUI_CutDlg.cxx b/src/BooleanGUI/BooleanGUI_CutDlg.cxx index d3aaf9785..1cc08269d 100644 --- a/src/BooleanGUI/BooleanGUI_CutDlg.cxx +++ b/src/BooleanGUI/BooleanGUI_CutDlg.cxx @@ -84,9 +84,6 @@ void BooleanGUI_CutDlg::Init() { /* init variables */ myEditCurrentArgument = GroupCut->LineEdit1; - - myShape1.Nullify(); - myShape2.Nullify(); myOkShape1 = myOkShape2 = false; /* signals and slots connections */ @@ -166,7 +163,6 @@ void BooleanGUI_CutDlg::SelectionIntoArgument() myGeomShape1 = myGeomBase->ConvertIOinGEOMShape(IO, testResult); if(!testResult) return; - myShape1 = S; GroupCut->LineEdit1->setText(aString); myOkShape1 = true; } @@ -174,7 +170,6 @@ void BooleanGUI_CutDlg::SelectionIntoArgument() myGeomShape2 = myGeomBase->ConvertIOinGEOMShape(IO, testResult); if(!testResult) return; - myShape2 = S; GroupCut->LineEdit2->setText(aString); myOkShape2 = true; } diff --git a/src/BooleanGUI/BooleanGUI_CutDlg.h b/src/BooleanGUI/BooleanGUI_CutDlg.h index 46738f7f3..212bdb176 100644 --- a/src/BooleanGUI/BooleanGUI_CutDlg.h +++ b/src/BooleanGUI/BooleanGUI_CutDlg.h @@ -54,8 +54,6 @@ private: BooleanGUI* myBooleanGUI; - TopoDS_Shape myShape1; /* topology used to fuse */ - TopoDS_Shape myShape2; /* topology used to fuse */ GEOM::GEOM_Shape_var myGeomShape1; /* is myShape1 */ GEOM::GEOM_Shape_var myGeomShape2; /* is myShape2 */ bool myOkShape1; /* to check when arguments are defined */ diff --git a/src/BooleanGUI/BooleanGUI_FuseDlg.cxx b/src/BooleanGUI/BooleanGUI_FuseDlg.cxx index 14a741cc3..ea9ae1b3a 100644 --- a/src/BooleanGUI/BooleanGUI_FuseDlg.cxx +++ b/src/BooleanGUI/BooleanGUI_FuseDlg.cxx @@ -84,9 +84,6 @@ void BooleanGUI_FuseDlg::Init() { /* init variables */ myEditCurrentArgument = GroupFuse->LineEdit1; - - myShape1.Nullify(); - myShape2.Nullify(); myOkShape1 = myOkShape2 = false; /* signals and slots connections */ @@ -166,7 +163,6 @@ void BooleanGUI_FuseDlg::SelectionIntoArgument() myGeomShape1 = myGeomBase->ConvertIOinGEOMShape(IO, testResult); if(!testResult) return; - myShape1 = S; GroupFuse->LineEdit1->setText(aString); myOkShape1 = true; } @@ -174,7 +170,6 @@ void BooleanGUI_FuseDlg::SelectionIntoArgument() myGeomShape2 = myGeomBase->ConvertIOinGEOMShape(IO, testResult); if(!testResult) return; - myShape2 = S; GroupFuse->LineEdit2->setText(aString); myOkShape2 = true; } diff --git a/src/BooleanGUI/BooleanGUI_FuseDlg.h b/src/BooleanGUI/BooleanGUI_FuseDlg.h index 799eb0b9d..6898e64aa 100644 --- a/src/BooleanGUI/BooleanGUI_FuseDlg.h +++ b/src/BooleanGUI/BooleanGUI_FuseDlg.h @@ -54,8 +54,6 @@ private: BooleanGUI* myBooleanGUI; - TopoDS_Shape myShape1; /* topology used to fuse */ - TopoDS_Shape myShape2; /* topology used to fuse */ GEOM::GEOM_Shape_var myGeomShape1; /* is myShape1 */ GEOM::GEOM_Shape_var myGeomShape2; /* is myShape2 */ bool myOkShape1; /* to check when arguments are defined */ diff --git a/src/BooleanGUI/BooleanGUI_SectionDlg.cxx b/src/BooleanGUI/BooleanGUI_SectionDlg.cxx index d2c1c6a4a..51bae1f9e 100644 --- a/src/BooleanGUI/BooleanGUI_SectionDlg.cxx +++ b/src/BooleanGUI/BooleanGUI_SectionDlg.cxx @@ -85,9 +85,6 @@ void BooleanGUI_SectionDlg::Init() { /* init variables */ myEditCurrentArgument = GroupSection->LineEdit1; - - myShape1.Nullify(); - myShape2.Nullify(); myOkShape1 = myOkShape2 = false; /* signals and slots connections */ @@ -167,7 +164,6 @@ void BooleanGUI_SectionDlg::SelectionIntoArgument() myGeomShape1 = myGeomBase->ConvertIOinGEOMShape(IO, testResult); if(!testResult) return; - myShape1 = S; GroupSection->LineEdit1->setText(aString); myOkShape1 = true; } @@ -175,7 +171,6 @@ void BooleanGUI_SectionDlg::SelectionIntoArgument() myGeomShape2 = myGeomBase->ConvertIOinGEOMShape(IO, testResult); if(!testResult) return; - myShape2 = S; GroupSection->LineEdit2->setText(aString); myOkShape2 = true; } diff --git a/src/BooleanGUI/BooleanGUI_SectionDlg.h b/src/BooleanGUI/BooleanGUI_SectionDlg.h index badf2afdf..ef1f35282 100644 --- a/src/BooleanGUI/BooleanGUI_SectionDlg.h +++ b/src/BooleanGUI/BooleanGUI_SectionDlg.h @@ -54,8 +54,6 @@ private: BooleanGUI* myBooleanGUI; - TopoDS_Shape myShape1; /* topology used to fuse */ - TopoDS_Shape myShape2; /* topology used to fuse */ GEOM::GEOM_Shape_var myGeomShape1; /* is myShape1 */ GEOM::GEOM_Shape_var myGeomShape2; /* is myShape2 */ bool myOkShape1; /* to check when arguments are defined */ diff --git a/src/BooleanGUI/Makefile.in b/src/BooleanGUI/Makefile.in index 92de526ff..ae4412ecc 100644 --- a/src/BooleanGUI/Makefile.in +++ b/src/BooleanGUI/Makefile.in @@ -53,7 +53,7 @@ LIB_MOC = \ BooleanGUI_CutDlg.h \ BooleanGUI_SectionDlg.h -LIB_CLIENT_IDL = +LIB_CLIENT_IDL = GEOM_Kinematic.idl LIB_SERVER_IDL = diff --git a/src/BuildGUI/Makefile.in b/src/BuildGUI/Makefile.in index 3b29f7b59..e85330400 100644 --- a/src/BuildGUI/Makefile.in +++ b/src/BuildGUI/Makefile.in @@ -57,7 +57,7 @@ LIB_MOC = \ BuildGUI_SolidDlg.h \ BuildGUI_CompoundDlg.h -LIB_CLIENT_IDL = +LIB_CLIENT_IDL = GEOM_Kinematic.idl LIB_SERVER_IDL = diff --git a/src/DisplayGUI/DisplayGUI.cxx b/src/DisplayGUI/DisplayGUI.cxx index b42972f89..45dc97b16 100644 --- a/src/DisplayGUI/DisplayGUI.cxx +++ b/src/DisplayGUI/DisplayGUI.cxx @@ -232,6 +232,11 @@ void DisplayGUI::BuildPresentation(const Handle(SALOME_InteractiveObject)& theIO if(theIO.IsNull()) MESSAGE("BuildPresentation(): null SALOME_InteractiveObject passed") + Standard_Boolean testResult; + GEOM::GEOM_Shape_var myGeomShape = myDisplayGUI->myGeomBase->ConvertIOinGEOMShape(theIO, testResult); + if(!testResult) + return; + if(QAD_Application::getDesktop()->getActiveStudy()->getActiveStudyFrame()->getTypeView() == VIEW_VTK) { // VTK @@ -440,6 +445,7 @@ void DisplayGUI::BuildPresentation(const Handle(SALOME_InteractiveObject)& theIO } Handle(GEOM_AISShape) aSh = new GEOM_AISShape(Shape, aName->Value()); aSh->SetShadingColor(myDisplayGUI->myGeomBase->myShadingColor); + aSh->SetInfiniteState(Shape.Infinite()); Handle(GEOM_InteractiveObject) IO = new GEOM_InteractiveObject(anIOR->Value(), myDisplayGUI->myGeomGUI->GetFatherior(), "GEOM"); IO->setEntry(obj->GetID()); aSh->setIO(IO); diff --git a/src/DisplayGUI/Makefile.in b/src/DisplayGUI/Makefile.in index d1cd6aa6a..8be49b7af 100644 --- a/src/DisplayGUI/Makefile.in +++ b/src/DisplayGUI/Makefile.in @@ -45,7 +45,7 @@ LIB_SRC = DisplayGUI.cxx LIB_MOC = \ DisplayGUI.h -LIB_CLIENT_IDL = SALOME_Exception.idl +LIB_CLIENT_IDL = SALOME_Exception.idl GEOM_Kinematic.idl LIB_SERVER_IDL = diff --git a/src/EntityGUI/EntityGUI_SubShapeDlg.cxx b/src/EntityGUI/EntityGUI_SubShapeDlg.cxx index 28923363f..b782a2bd2 100644 --- a/src/EntityGUI/EntityGUI_SubShapeDlg.cxx +++ b/src/EntityGUI/EntityGUI_SubShapeDlg.cxx @@ -198,7 +198,7 @@ void EntityGUI_SubShapeDlg::ClickOnApply() QAD_Application::getDesktop()->putInfo(tr("GEOM_PRP_DONE")); /* Reset all arguments and local context to allow user a new selection ...*/ - this->ResetStateOfDialog(); + //this->ResetStateOfDialog(); return; } diff --git a/src/EntityGUI/Makefile.in b/src/EntityGUI/Makefile.in index 3883eebab..7a82dddd1 100644 --- a/src/EntityGUI/Makefile.in +++ b/src/EntityGUI/Makefile.in @@ -47,7 +47,7 @@ LIB_MOC = \ EntityGUI.h \ EntityGUI_SubShapeDlg.h -LIB_CLIENT_IDL = +LIB_CLIENT_IDL = GEOM_Kinematic.idl LIB_SERVER_IDL = diff --git a/src/GEOM/GEOM_Animation_i.cc b/src/GEOM/GEOM_Animation_i.cc new file mode 100644 index 000000000..2710a7fb4 --- /dev/null +++ b/src/GEOM/GEOM_Animation_i.cc @@ -0,0 +1,174 @@ +// GEOM GEOM : +// +// Copyright (C) 2003 OPEN CASCADE, EADS/CCR, LIP6, CEA/DEN, +// CEDRAT, EDF R&D, LEG, PRINCIPIA R&D, BUREAU VERITAS +// +// This library is free software; you can redistribute it and/or +// modify it under the terms of the GNU Lesser General Public +// License as published by the Free Software Foundation; either +// version 2.1 of the License. +// +// This library is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU +// Lesser General Public License for more details. +// +// You should have received a copy of the GNU Lesser General Public +// License along with this library; if not, write to the Free Software +// Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307 USA +// +// See http://www.opencascade.org/SALOME/ or email : webmaster.salome@opencascade.org +// +// +// +// File : GEOM_Animation_i.cc +// Author : Damien COQUERET +// Module : GEOM +// $Header$ + +using namespace std; +#include "GEOM_Animation_i.hh" + +//================================================================================= +// function : GEOM_Animation_i() constructor (no arguments) +// purpose : for what now ? +//================================================================================= +GEOM_Animation_i::GEOM_Animation_i() +{ +} + + +//================================================================================= +// function : constructor +// purpose : constructor for servant creation +//================================================================================= +GEOM_Animation_i::GEOM_Animation_i(Kinematic_Animation* Animation, + GEOM::GEOM_Assembly_ptr Ass, + GEOM::GEOM_Shape_ptr Frame, + CORBA::ORB_ptr orb, + GEOM::GEOM_Gen_ptr engine) +{ + _Animation = Animation; + _Ass = GEOM::GEOM_Assembly::_duplicate(Ass); + _Frame = GEOM::GEOM_Shape::_duplicate(Frame); + + _orb = orb; + _engine = engine; + + _shapeid = ""; + _studyshapeid = ""; + + _name = ""; +} + + +//================================================================================= +// function : destructor +// purpose : +//================================================================================= +GEOM_Animation_i::~GEOM_Animation_i() { delete &_Animation; } + + +//================================================================================= +// function : GetAssembly() +// purpose : +//================================================================================= +GEOM::GEOM_Assembly_ptr GEOM_Animation_i::GetAssembly() throw(SALOME::SALOME_Exception) +{ + return GEOM::GEOM_Assembly::_duplicate(_Ass); +} + + +//================================================================================= +// function : GetFrame() +// purpose : +//================================================================================= +GEOM::GEOM_Shape_ptr GEOM_Animation_i::GetFrame() throw(SALOME::SALOME_Exception) +{ + return GEOM::GEOM_Shape::_duplicate(_Frame); +} + + +//================================================================================= +// function : GetDuration() +// purpose : +//================================================================================= +CORBA::Double GEOM_Animation_i::GetDuration() throw(SALOME::SALOME_Exception) +{ + return _Animation->Duration(); +} + + +//================================================================================= +// function : GetDuration() +// purpose : +//================================================================================= +CORBA::Long GEOM_Animation_i::GetNbSeq() throw(SALOME::SALOME_Exception) +{ + return _Animation->NbSeq(); +} + + +//================================================================================= +// function : GetDuration() +// purpose : +//================================================================================= +CORBA::Boolean GEOM_Animation_i::GetIsInLoop() throw(SALOME::SALOME_Exception) +{ + return _Animation->IsInLoop(); +} + + +//================================================================================= +// function : Name (set method) +// purpose : to set the attribute 'name'. +// : WARNING : Register to naming service actually removed ! +//================================================================================= +void GEOM_Animation_i::Name(const char* name) +{ + _name = strdup(name); + GEOM::GEOM_Animation_ptr g = GEOM::GEOM_Animation::_narrow(_this()); +} + + +//================================================================================= +// function : Name (get method) +// purpose : to get the attribute 'name' of this shape +//================================================================================= +char* GEOM_Animation_i::Name() { return strdup(_name); } + + +//================================================================================= +// function : ShapeId +// purpose : to get the id of this shape from GEOM (OCAF entry) +//================================================================================= +char* GEOM_Animation_i::ShapeId() { return strdup(_shapeid); } + + +//================================================================================= +// function : ShapeId (set method) +// purpose : to set the id of this shape in GEOM/OCAF doc +//================================================================================= +void GEOM_Animation_i::ShapeId(const char * shapeid) { _shapeid = strdup(shapeid); } + + +//================================================================================= +// function : StudyShapeId (get method) +// purpose : to get the id of this shape from the study document (OCAF entry) +//================================================================================= +char* GEOM_Animation_i::StudyShapeId() { return strdup(_studyshapeid) ; } + + +//================================================================================= +// function : StudyShapeId (set method) +// purpose : to set the id of this shape in the Study document (OCAF entry) +//================================================================================= +void GEOM_Animation_i::StudyShapeId(const char * studyshapeid) +{ _studyshapeid = strdup(studyshapeid); } + + +//======================================================================= +//function : Engine +//purpose : return generator engine +//======================================================================= +GEOM::GEOM_Gen_ptr GEOM_Animation_i::Engine() { return _engine; } diff --git a/src/GEOM/GEOM_Animation_i.hh b/src/GEOM/GEOM_Animation_i.hh new file mode 100644 index 000000000..24f6a1113 --- /dev/null +++ b/src/GEOM/GEOM_Animation_i.hh @@ -0,0 +1,97 @@ +// GEOM GEOM : +// +// Copyright (C) 2003 OPEN CASCADE, EADS/CCR, LIP6, CEA/DEN, +// CEDRAT, EDF R&D, LEG, PRINCIPIA R&D, BUREAU VERITAS +// +// This library is free software; you can redistribute it and/or +// modify it under the terms of the GNU Lesser General Public +// License as published by the Free Software Foundation; either +// version 2.1 of the License. +// +// This library is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU +// Lesser General Public License for more details. +// +// You should have received a copy of the GNU Lesser General Public +// License along with this library; if not, write to the Free Software +// Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307 USA +// +// See http://www.opencascade.org/SALOME/ or email : webmaster.salome@opencascade.org +// +// +// +// File : GEOM_Animation_i.hh +// Author : Damien COQUERET +// Module : GEOM +// $Header$ + +#ifndef __GEOM_ANIMATION_I_H__ +#define __GEOM_ANIMATION_I_H__ + +// IDL headers +#include +#include CORBA_SERVER_HEADER(GEOM_Gen) +#include CORBA_SERVER_HEADER(GEOM_Shape) +#include CORBA_SERVER_HEADER(GEOM_Kinematic) + +#include "GEOM_Shape_i.hh" +#include "Kinematic_Animation.hxx" + +//===================================================================== +// GEOM_Animation_i : class definition +//===================================================================== +class GEOM_Animation_i: + public POA_GEOM::GEOM_Animation +{ +public: + GEOM_Animation_i(); + GEOM_Animation_i(Kinematic_Animation* Animation, + GEOM::GEOM_Assembly_ptr Ass, + GEOM::GEOM_Shape_ptr Frame, + CORBA::ORB_ptr orb, + GEOM::GEOM_Gen_ptr engine); + + ~GEOM_Animation_i(); + +private: + Kinematic_Animation* _Animation; + GEOM::GEOM_Assembly_ptr _Ass; + GEOM::GEOM_Shape_ptr _Frame; + CORBA::ORB_ptr _orb; + GEOM::GEOM_Gen_ptr _engine; + + char* _name; + char* _shapeid; + char* _studyshapeid; // exists only if added in the study document + +public: + GEOM::GEOM_Assembly_ptr GetAssembly() + throw (SALOME::SALOME_Exception); + + GEOM::GEOM_Shape_ptr GetFrame() + throw (SALOME::SALOME_Exception); + + CORBA::Double GetDuration() + throw (SALOME::SALOME_Exception); + + CORBA::Long GetNbSeq() + throw (SALOME::SALOME_Exception); + + CORBA::Boolean GetIsInLoop() + throw (SALOME::SALOME_Exception); + + char* Name(); + void Name(const char* name); + + char* ShapeId(); + void ShapeId(const char* shapeid); + + char* StudyShapeId(); + void StudyShapeId(const char* studyshapeid); + + GEOM::GEOM_Gen_ptr Engine(); + +}; + +#endif diff --git a/src/GEOM/GEOM_Assembly_i.cc b/src/GEOM/GEOM_Assembly_i.cc new file mode 100644 index 000000000..45dac4868 --- /dev/null +++ b/src/GEOM/GEOM_Assembly_i.cc @@ -0,0 +1,160 @@ +// GEOM GEOM : +// +// Copyright (C) 2003 OPEN CASCADE, EADS/CCR, LIP6, CEA/DEN, +// CEDRAT, EDF R&D, LEG, PRINCIPIA R&D, BUREAU VERITAS +// +// This library is free software; you can redistribute it and/or +// modify it under the terms of the GNU Lesser General Public +// License as published by the Free Software Foundation; either +// version 2.1 of the License. +// +// This library is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU +// Lesser General Public License for more details. +// +// You should have received a copy of the GNU Lesser General Public +// License along with this library; if not, write to the Free Software +// Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307 USA +// +// See http://www.opencascade.org/SALOME/ or email : webmaster.salome@opencascade.org +// +// +// +// File : GEOM_Assembly_i.cc +// Author : Damien COQUERET +// Module : GEOM +// $Header$ + +using namespace std; +#include "GEOM_Assembly_i.hh" + +//================================================================================= +// function : GEOM_Assembly_i() constructor (no arguments) +// purpose : for what now ? +//================================================================================= +GEOM_Assembly_i::GEOM_Assembly_i() +{ +} + + +//================================================================================= +// function : constructor +// purpose : constructor for servant creation +//================================================================================= +GEOM_Assembly_i::GEOM_Assembly_i(Kinematic_Assembly* Ass, + CORBA::ORB_ptr orb, + GEOM::GEOM_Gen_ptr engine) +{ + _Ass = Ass; + _orb = orb; + _engine = engine; + + _aContactList.length(0); + _NbContact = 0; + + _shapeid = ""; + _studyshapeid = ""; + + _name = ""; +} + + +//================================================================================= +// function : destructor +// purpose : +//================================================================================= +GEOM_Assembly_i::~GEOM_Assembly_i() { delete &_Ass; } + + +//================================================================================= +// function : AddContact() +// purpose : +//================================================================================= +void GEOM_Assembly_i::AddContact(GEOM::GEOM_Contact_ptr aContact) throw(SALOME::SALOME_Exception) +{ + _aContactList.length(_NbContact + 1); + _aContactList[_NbContact] = GEOM::GEOM_Contact::_duplicate(aContact); + _NbContact++; + + return; +} + +//================================================================================= +// function : GetContactList() +// purpose : +//================================================================================= +GEOM::ListOfContact* GEOM_Assembly_i::GetContactList() throw(SALOME::SALOME_Exception) +{ + GEOM::ListOfContact_var aContactList = new GEOM::ListOfContact; + aContactList->length(_aContactList.length()); + for(int i = 0; i < _NbContact; i++) { + aContactList[i] = GEOM::GEOM_Contact::_duplicate(_aContactList[i]); + } + return aContactList._retn(); +} + + +//================================================================================= +// function : NbContacts() +// purpose : +//================================================================================= +CORBA::Long GEOM_Assembly_i::NbContacts() throw(SALOME::SALOME_Exception) +{ + return _NbContact; +} + + +//================================================================================= +// function : Name (set method) +// purpose : to set the attribute 'name'. +// : WARNING : Register to naming service actually removed ! +//================================================================================= +void GEOM_Assembly_i::Name(const char* name) +{ + _name = strdup(name); + GEOM::GEOM_Assembly_ptr g = GEOM::GEOM_Assembly::_narrow(_this()); +} + + +//================================================================================= +// function : Name (get method) +// purpose : to get the attribute 'name' of this shape +//================================================================================= +char* GEOM_Assembly_i::Name() { return strdup(_name); } + + +//================================================================================= +// function : ShapeId +// purpose : to get the id of this shape from GEOM (OCAF entry) +//================================================================================= +char* GEOM_Assembly_i::ShapeId() { return strdup(_shapeid); } + + +//================================================================================= +// function : ShapeId (set method) +// purpose : to set the id of this shape in GEOM/OCAF doc +//================================================================================= +void GEOM_Assembly_i::ShapeId(const char * shapeid) { _shapeid = strdup(shapeid); } + + +//================================================================================= +// function : StudyShapeId (get method) +// purpose : to get the id of this shape from the study document (OCAF entry) +//================================================================================= +char* GEOM_Assembly_i::StudyShapeId() { return strdup(_studyshapeid) ; } + + +//================================================================================= +// function : StudyShapeId (set method) +// purpose : to set the id of this shape in the Study document (OCAF entry) +//================================================================================= +void GEOM_Assembly_i::StudyShapeId(const char * studyshapeid) +{ _studyshapeid = strdup(studyshapeid); } + + +//======================================================================= +//function : Engine +//purpose : return generator engine +//======================================================================= +GEOM::GEOM_Gen_ptr GEOM_Assembly_i::Engine() { return _engine; } diff --git a/src/GEOM/GEOM_Assembly_i.hh b/src/GEOM/GEOM_Assembly_i.hh new file mode 100644 index 000000000..c6348f890 --- /dev/null +++ b/src/GEOM/GEOM_Assembly_i.hh @@ -0,0 +1,89 @@ +// GEOM GEOM : +// +// Copyright (C) 2003 OPEN CASCADE, EADS/CCR, LIP6, CEA/DEN, +// CEDRAT, EDF R&D, LEG, PRINCIPIA R&D, BUREAU VERITAS +// +// This library is free software; you can redistribute it and/or +// modify it under the terms of the GNU Lesser General Public +// License as published by the Free Software Foundation; either +// version 2.1 of the License. +// +// This library is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU +// Lesser General Public License for more details. +// +// You should have received a copy of the GNU Lesser General Public +// License along with this library; if not, write to the Free Software +// Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307 USA +// +// See http://www.opencascade.org/SALOME/ or email : webmaster.salome@opencascade.org +// +// +// +// File : GEOM_Assembly_i.hh +// Author : Damien COQUERET +// Module : GEOM +// $Header$ + +#ifndef __GEOM_ASSEMBLY_I_H__ +#define __GEOM_ASSEMBLY_I_H__ + +// IDL headers +#include +#include CORBA_SERVER_HEADER(GEOM_Gen) +#include CORBA_SERVER_HEADER(GEOM_Shape) +#include CORBA_SERVER_HEADER(GEOM_Kinematic) + +#include "Kinematic_Assembly.hxx" + +//===================================================================== +// GEOM_Assembly_i : class definition +//===================================================================== +class GEOM_Assembly_i: + public POA_GEOM::GEOM_Assembly +{ +public: + GEOM_Assembly_i(); + GEOM_Assembly_i(Kinematic_Assembly* Ass, + CORBA::ORB_ptr orb, + GEOM::GEOM_Gen_ptr engine); + + ~GEOM_Assembly_i(); + +private: + Kinematic_Assembly* _Ass; + CORBA::ORB_ptr _orb; + GEOM::GEOM_Gen_ptr _engine; + + GEOM::ListOfContact _aContactList; + CORBA::Long _NbContact; + + char* _name; + char* _shapeid; + char* _studyshapeid; // exists only if added in the study document + +public: + void AddContact(GEOM::GEOM_Contact_ptr aContact) + throw (SALOME::SALOME_Exception); + + GEOM::ListOfContact* GetContactList() + throw (SALOME::SALOME_Exception); + + CORBA::Long NbContacts() + throw (SALOME::SALOME_Exception); + + char* Name(); + void Name(const char* name); + + char* ShapeId(); + void ShapeId(const char* shapeid); + + char* StudyShapeId(); + void StudyShapeId(const char* studyshapeid); + + GEOM::GEOM_Gen_ptr Engine(); + +}; + +#endif diff --git a/src/GEOM/GEOM_Contact_i.cc b/src/GEOM/GEOM_Contact_i.cc new file mode 100644 index 000000000..72fea1773 --- /dev/null +++ b/src/GEOM/GEOM_Contact_i.cc @@ -0,0 +1,212 @@ +// GEOM GEOM : +// +// Copyright (C) 2003 OPEN CASCADE, EADS/CCR, LIP6, CEA/DEN, +// CEDRAT, EDF R&D, LEG, PRINCIPIA R&D, BUREAU VERITAS +// +// This library is free software; you can redistribute it and/or +// modify it under the terms of the GNU Lesser General Public +// License as published by the Free Software Foundation; either +// version 2.1 of the License. +// +// This library is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU +// Lesser General Public License for more details. +// +// You should have received a copy of the GNU Lesser General Public +// License along with this library; if not, write to the Free Software +// Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307 USA +// +// See http://www.opencascade.org/SALOME/ or email : webmaster.salome@opencascade.org +// +// +// +// File : GEOM_Contact_i.cc +// Author : Damien COQUERET +// Module : GEOM +// $Header$ + +using namespace std; +#include "GEOM_Contact_i.hh" +#include "GEOM_Position_i.hh" +#include "GEOM_Rotation_i.hh" +#include "GEOM_Translation_i.hh" + +//================================================================================= +// function : GEOM_Contact_i() constructor (no arguments) +// purpose : for what now ? +//================================================================================= +GEOM_Contact_i::GEOM_Contact_i() +{ +} + + +//================================================================================= +// function : constructor +// purpose : constructor for servant creation +//================================================================================= +GEOM_Contact_i::GEOM_Contact_i(Kinematic_Contact* Contact, + GEOM::GEOM_Shape_ptr Shape1, + GEOM::GEOM_Shape_ptr Shape2, + CORBA::ORB_ptr orb, + GEOM::GEOM_Gen_ptr engine) +{ + _Contact = Contact; + _Shape1 = GEOM::GEOM_Shape::_duplicate(Shape1); + _Shape2 = GEOM::GEOM_Shape::_duplicate(Shape2); + + GEOM::PointStruct p0 = engine->MakePointStruct(0, 0, 0); + GEOM::PointStruct pX = engine->MakePointStruct(1, 0, 0); + GEOM::PointStruct pY = engine->MakePointStruct(0, 1, 0); + GEOM::PointStruct pZ = engine->MakePointStruct(0, 0, 1); + GEOM::DirStruct VX = engine->MakeDirection(pX); + GEOM::DirStruct VY = engine->MakeDirection(pY); + GEOM::DirStruct VZ = engine->MakeDirection(pZ); + GEOM_Position_i * Position_servant = new GEOM_Position_i(p0, VX, VY, VZ); + _Position = GEOM::GEOM_Position::_narrow(Position_servant->_this()); + + GEOM_Rotation_i * Rotation_servant = new GEOM_Rotation_i(1, 2, 3, 0, 0, 0); + _Rotation = GEOM::GEOM_Rotation::_narrow(Rotation_servant->_this()); + GEOM_Translation_i * Translation_servant = new GEOM_Translation_i(0, 0, 0); + _Translation = GEOM::GEOM_Translation::_narrow(Translation_servant->_this()); + + _orb = orb; + _engine = engine; + + _shapeid = ""; + _studyshapeid = ""; + + _name = ""; +} + + +//================================================================================= +// function : destructor +// purpose : +//================================================================================= +GEOM_Contact_i::~GEOM_Contact_i() { delete &_Contact; } + + +//================================================================================= +// function : GetType() +// purpose : +//================================================================================= +CORBA::Long GEOM_Contact_i::GetType() throw(SALOME::SALOME_Exception) +{ + return _Contact->Type(); +} + + +//================================================================================= +// function : GetShape1() +// purpose : +//================================================================================= +GEOM::GEOM_Shape_ptr GEOM_Contact_i::GetShape1() throw(SALOME::SALOME_Exception) +{ + return GEOM::GEOM_Shape::_duplicate(_Shape1); +} + + +//================================================================================= +// function : GetShape2() +// purpose : +//================================================================================= +GEOM::GEOM_Shape_ptr GEOM_Contact_i::GetShape2() throw(SALOME::SALOME_Exception) +{ + return GEOM::GEOM_Shape::_duplicate(_Shape2); +} + + +//================================================================================= +// function : GetPosition() +// purpose : +//================================================================================= +GEOM::GEOM_Position_ptr GEOM_Contact_i::GetPosition() throw(SALOME::SALOME_Exception) +{ + return GEOM::GEOM_Position::_duplicate(_Position); +} + + +//================================================================================= +// function : GetRotation() +// purpose : +//================================================================================= +GEOM::GEOM_Rotation_ptr GEOM_Contact_i::GetRotation() throw(SALOME::SALOME_Exception) +{ + return GEOM::GEOM_Rotation::_duplicate(_Rotation); +} + + +//================================================================================= +// function : GetTranslation() +// purpose : +//================================================================================= +GEOM::GEOM_Translation_ptr GEOM_Contact_i::GetTranslation() throw(SALOME::SALOME_Exception) +{ + return GEOM::GEOM_Translation::_duplicate(_Translation); +} + + +//================================================================================= +// function : GetStep() +// purpose : +//================================================================================= +CORBA::Double GEOM_Contact_i::GetStep() throw(SALOME::SALOME_Exception) +{ + return _Contact->Step(); +} + + +//================================================================================= +// function : Name (set method) +// purpose : to set the attribute 'name'. +// : WARNING : Register to naming service actually removed ! +//================================================================================= +void GEOM_Contact_i::Name(const char* name) +{ + _name = strdup(name); + GEOM::GEOM_Contact_ptr g = GEOM::GEOM_Contact::_narrow(_this()); +} + + +//================================================================================= +// function : Name (get method) +// purpose : to get the attribute 'name' of this shape +//================================================================================= +char* GEOM_Contact_i::Name() { return strdup(_name); } + + +//================================================================================= +// function : ShapeId +// purpose : to get the id of this shape from GEOM (OCAF entry) +//================================================================================= +char* GEOM_Contact_i::ShapeId() { return strdup(_shapeid); } + + +//================================================================================= +// function : ShapeId (set method) +// purpose : to set the id of this shape in GEOM/OCAF doc +//================================================================================= +void GEOM_Contact_i::ShapeId(const char * shapeid) { _shapeid = strdup(shapeid); } + + +//================================================================================= +// function : StudyShapeId (get method) +// purpose : to get the id of this shape from the study document (OCAF entry) +//================================================================================= +char* GEOM_Contact_i::StudyShapeId() { return strdup(_studyshapeid) ; } + + +//================================================================================= +// function : StudyShapeId (set method) +// purpose : to set the id of this shape in the Study document (OCAF entry) +//================================================================================= +void GEOM_Contact_i::StudyShapeId(const char * studyshapeid) +{ _studyshapeid = strdup(studyshapeid); } + + +//======================================================================= +//function : Engine +//purpose : return generator engine +//======================================================================= +GEOM::GEOM_Gen_ptr GEOM_Contact_i::Engine() { return _engine; } diff --git a/src/GEOM/GEOM_Contact_i.hh b/src/GEOM/GEOM_Contact_i.hh new file mode 100644 index 000000000..e60008405 --- /dev/null +++ b/src/GEOM/GEOM_Contact_i.hh @@ -0,0 +1,106 @@ +// GEOM GEOM : +// +// Copyright (C) 2003 OPEN CASCADE, EADS/CCR, LIP6, CEA/DEN, +// CEDRAT, EDF R&D, LEG, PRINCIPIA R&D, BUREAU VERITAS +// +// This library is free software; you can redistribute it and/or +// modify it under the terms of the GNU Lesser General Public +// License as published by the Free Software Foundation; either +// version 2.1 of the License. +// +// This library is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU +// Lesser General Public License for more details. +// +// You should have received a copy of the GNU Lesser General Public +// License along with this library; if not, write to the Free Software +// Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307 USA +// +// See http://www.opencascade.org/SALOME/ or email : webmaster.salome@opencascade.org +// +// +// +// File : GEOM_Contact_i.hh +// Author : Damien COQUERET +// Module : GEOM +// $Header$ + +#ifndef __GEOM_CONTACT_I_H__ +#define __GEOM_CONTACT_I_H__ + +// IDL headers +#include +#include CORBA_SERVER_HEADER(GEOM_Gen) +#include CORBA_SERVER_HEADER(GEOM_Shape) +#include CORBA_SERVER_HEADER(GEOM_Kinematic) + +#include "GEOM_Shape_i.hh" +#include "Kinematic_Contact.hxx" + +//===================================================================== +// GEOM_Contact_i : class definition +//===================================================================== +class GEOM_Contact_i: + public POA_GEOM::GEOM_Contact +{ +public: + GEOM_Contact_i(); + GEOM_Contact_i(Kinematic_Contact* Contact, + GEOM::GEOM_Shape_ptr Shape1, + GEOM::GEOM_Shape_ptr Shape2, + CORBA::ORB_ptr orb, + GEOM::GEOM_Gen_ptr engine); + + ~GEOM_Contact_i(); + +private: + Kinematic_Contact* _Contact; + GEOM::GEOM_Shape_ptr _Shape1; + GEOM::GEOM_Shape_ptr _Shape2; + GEOM::GEOM_Position_ptr _Position; + GEOM::GEOM_Rotation_ptr _Rotation; + GEOM::GEOM_Translation_ptr _Translation; + CORBA::ORB_ptr _orb; + GEOM::GEOM_Gen_ptr _engine; + + char* _name; + char* _shapeid; + char* _studyshapeid; // exists only if added in the study document + +public: + CORBA::Long GetType() + throw (SALOME::SALOME_Exception); + + GEOM::GEOM_Shape_ptr GetShape1() + throw (SALOME::SALOME_Exception); + + GEOM::GEOM_Shape_ptr GetShape2() + throw (SALOME::SALOME_Exception); + + GEOM::GEOM_Position_ptr GetPosition() + throw (SALOME::SALOME_Exception); + + GEOM::GEOM_Rotation_ptr GetRotation() + throw (SALOME::SALOME_Exception); + + GEOM::GEOM_Translation_ptr GetTranslation() + throw (SALOME::SALOME_Exception); + + CORBA::Double GetStep() + throw (SALOME::SALOME_Exception); + + char* Name(); + void Name(const char* name); + + char* ShapeId(); + void ShapeId(const char* shapeid); + + char* StudyShapeId(); + void StudyShapeId(const char* studyshapeid); + + GEOM::GEOM_Gen_ptr Engine(); + +}; + +#endif diff --git a/src/GEOM/GEOM_Gen_i.cc b/src/GEOM/GEOM_Gen_i.cc index 3816897ae..f53710189 100644 --- a/src/GEOM/GEOM_Gen_i.cc +++ b/src/GEOM/GEOM_Gen_i.cc @@ -145,6 +145,8 @@ using namespace std; #include #include #include +#include +#include #include #include #include @@ -452,7 +454,9 @@ SALOMEDS::TMPFile* GEOM_Gen_i::Save(SALOMEDS::SComponent_ptr theComponent, SALOMEDS::ListOfFileNames_var aSeq = new SALOMEDS::ListOfFileNames; aSeq->length(1); // Prepare a file name to open - TCollection_AsciiString aNameWithExt(SALOMEDS_Tool::GetNameFromPath(theComponent->GetStudy()->URL())); + TCollection_AsciiString aNameWithExt(""); + if (isMultiFile) + aNameWithExt = TCollection_AsciiString(SALOMEDS_Tool::GetNameFromPath(theComponent->GetStudy()->URL())); aNameWithExt += TCollection_AsciiString("_GEOM.sgd"); aSeq[0] = CORBA::string_dup(aNameWithExt.ToCString()); // Build a full file name of temporary file @@ -493,7 +497,10 @@ CORBA::Boolean GEOM_Gen_i::Load(SALOMEDS::SComponent_ptr theComponent, isMultiFile); // Prepare a file name to open - TCollection_AsciiString aNameWithExt(aSeq[0]); + TCollection_AsciiString aNameWithExt(""); + if (isMultiFile) + aNameWithExt = TCollection_AsciiString(SALOMEDS_Tool::GetNameFromPath(theComponent->GetStudy()->URL())); + aNameWithExt += TCollection_AsciiString("_GEOM.sgd"); TCollection_AsciiString aFullName = aTmpDir + aNameWithExt; // Open document @@ -5025,6 +5032,132 @@ void GEOM_Gen_i::ExportSTEP(const char* filename,GEOM::GEOM_Shape_ptr theShape) } +//================================================================================= +// function : InitAssembly() +// purpose : +//================================================================================= +GEOM::GEOM_Assembly_ptr GEOM_Gen_i::InitAssembly() throw (SALOME::SALOME_Exception) +{ + Kinematic_Assembly* tds; + + try { + tds = new Kinematic_Assembly(); + } + catch(Standard_Failure) + THROW_SALOME_CORBA_EXCEPTION("Exception catched in GEOM_Gen_i::InitAssembly", SALOME::BAD_PARAM); + + /* Create the CORBA servant holding the TopoDS_Shape */ + GEOM::GEOM_Gen_ptr engine = POA_GEOM::GEOM_Gen::_this(); + GEOM_Assembly_i * Assembly_servant = new GEOM_Assembly_i(tds, _orb, engine); + GEOM::GEOM_Assembly_var Assembly = GEOM::GEOM_Assembly::_narrow(Assembly_servant->_this()); + + /* Create and set the name (IOR of shape converted into a string) */ + string name_ior = _orb->object_to_string(Assembly); + Assembly->Name(name_ior.c_str()); + + GEOMDS_Commands GC(myCurrentOCAFDoc->Main()); + /* add attributs S and mystr in a new label */ + TDF_Label Lab = GC.AddAssembly(*tds, Assembly->Name()); + + TCollection_AsciiString entry; + TDF_Tool::Entry(Lab, entry); + const char *ent = entry.ToCString(); + + Assembly->ShapeId(ent); + return Assembly; +} + + +//================================================================================= +// function : AddContact() +// purpose : +//================================================================================= +GEOM::GEOM_Contact_ptr GEOM_Gen_i::AddContact(GEOM::GEOM_Assembly_ptr Ass, + GEOM::GEOM_Shape_ptr Shape1, + GEOM::GEOM_Shape_ptr Shape2, + const short type, + CORBA::Double step) + throw (SALOME::SALOME_Exception) +{ + Kinematic_Contact* tds; + TDF_Label mainRefLab; + TDF_Tool::Label(myCurrentOCAFDoc->GetData(), Ass->ShapeId(), mainRefLab); + + try { + TopoDS_Shape aShape1 = GetTopoShape(Shape1); + TopoDS_Shape aShape2 = GetTopoShape(Shape2); + tds = new Kinematic_Contact(aShape1, aShape2, type, step); + } + catch(Standard_Failure) + THROW_SALOME_CORBA_EXCEPTION("Exception catched in GEOM_Gen_i::AddContact", SALOME::BAD_PARAM); + + /* Create the CORBA servant holding the TopoDS_Shape */ + GEOM::GEOM_Gen_ptr engine = POA_GEOM::GEOM_Gen::_this(); + GEOM_Contact_i * Contact_servant = new GEOM_Contact_i(tds, Shape1, Shape2, _orb, engine); + GEOM::GEOM_Contact_var Contact = GEOM::GEOM_Contact::_narrow(Contact_servant->_this()); + + /* Create and set the name (IOR of shape converted into a string) */ + string name_ior = _orb->object_to_string(Contact); + Contact->Name(name_ior.c_str()); + + GEOMDS_Commands GC(myCurrentOCAFDoc->Main()); + /* add attributs S and mystr in a new label */ + TDF_Label LabContact = GC.AddContact(*tds, mainRefLab, Contact->Name()); + + TCollection_AsciiString entry; + TDF_Tool::Entry(LabContact, entry); + Contact->ShapeId(entry.ToCString()); + + return Contact; +} + + +//================================================================================= +// function : AddAnimation() +// purpose : +//================================================================================= +GEOM::GEOM_Animation_ptr GEOM_Gen_i::AddAnimation(GEOM::GEOM_Assembly_ptr Ass, + GEOM::GEOM_Shape_ptr Shape1, + CORBA::Double Duration, + const short NbSeq, + CORBA::Boolean IsInLoop) + throw (SALOME::SALOME_Exception) +{ + Kinematic_Animation* tds; + TDF_Label mainRefLab; + TDF_Tool::Label(myCurrentOCAFDoc->GetData(), Ass->ShapeId(), mainRefLab); + GEOMDS_Commands GC(myCurrentOCAFDoc->Main()); + + try { + Kinematic_Assembly* aAss = new Kinematic_Assembly(); + Standard_Boolean test = GC.GetAssembly(mainRefLab, *aAss); + TopoDS_Shape aShape1 = GetTopoShape(Shape1); + tds = new Kinematic_Animation(aAss, aShape1, Duration, NbSeq, IsInLoop); + } + catch(Standard_Failure) + THROW_SALOME_CORBA_EXCEPTION("Exception catched in GEOM_Gen_i::AddAnimation", SALOME::BAD_PARAM); + + /* Create the CORBA servant holding the TopoDS_Shape */ + GEOM::GEOM_Gen_ptr engine = POA_GEOM::GEOM_Gen::_this(); + GEOM_Animation_i * Animation_servant = new GEOM_Animation_i(tds, Ass, Shape1, _orb, engine); + GEOM::GEOM_Animation_var Animation = GEOM::GEOM_Animation::_narrow(Animation_servant->_this()); + + /* Create and set the name (IOR of shape converted into a string) */ + string name_ior = _orb->object_to_string(Animation); + Animation->Name(name_ior.c_str()); + + /* add attributs S and mystr in a new label */ + TDF_Label Lab = GC.AddAnimation(*tds, Animation->Name()); + + TCollection_AsciiString entry; + TDF_Tool::Entry(Lab, entry); + const char *ent = entry.ToCString(); + + Animation->ShapeId(ent); + return Animation; +} + + //===================================================================================== // EXPORTED METHODS //===================================================================================== diff --git a/src/GEOM/GEOM_Gen_i.hh b/src/GEOM/GEOM_Gen_i.hh index 753e98e89..1a5aed19f 100644 --- a/src/GEOM/GEOM_Gen_i.hh +++ b/src/GEOM/GEOM_Gen_i.hh @@ -44,10 +44,14 @@ #include #include CORBA_SERVER_HEADER(GEOM_Gen) #include CORBA_SERVER_HEADER(GEOM_Shape) +#include CORBA_SERVER_HEADER(GEOM_Kinematic) #include CORBA_SERVER_HEADER(SALOMEDS) #include "SALOME_Component_i.hxx" #include "GEOM_Shape_i.hh" +#include "GEOM_Assembly_i.hh" +#include "GEOM_Contact_i.hh" +#include "GEOM_Animation_i.hh" #include "SALOME_NamingService.hxx" #include @@ -601,6 +605,24 @@ class GEOM_Gen_i: public POA_GEOM::GEOM_Gen, CORBA::Double aMeshingDeflection) throw (SALOME::SALOME_Exception) ; + //-------------------------------------------------------------------// + // Specific method Kinematic // + //-------------------------------------------------------------------// + GEOM::GEOM_Assembly_ptr InitAssembly() + throw (SALOME::SALOME_Exception) ; + GEOM::GEOM_Contact_ptr AddContact(GEOM::GEOM_Assembly_ptr Ass, + GEOM::GEOM_Shape_ptr Shape1, + GEOM::GEOM_Shape_ptr Shape2, + const short type, + CORBA::Double step) + throw (SALOME::SALOME_Exception) ; + GEOM::GEOM_Animation_ptr AddAnimation(GEOM::GEOM_Assembly_ptr Ass, + GEOM::GEOM_Shape_ptr Shape1, + CORBA::Double Duration, + const short NbSeq, + CORBA::Boolean IsInLoop) + throw (SALOME::SALOME_Exception) ; + }; #endif diff --git a/src/GEOM/GEOM_Position_i.cc b/src/GEOM/GEOM_Position_i.cc new file mode 100644 index 000000000..3db2cf744 --- /dev/null +++ b/src/GEOM/GEOM_Position_i.cc @@ -0,0 +1,147 @@ +// GEOM GEOM : +// +// Copyright (C) 2003 OPEN CASCADE, EADS/CCR, LIP6, CEA/DEN, +// CEDRAT, EDF R&D, LEG, PRINCIPIA R&D, BUREAU VERITAS +// +// This library is free software; you can redistribute it and/or +// modify it under the terms of the GNU Lesser General Public +// License as published by the Free Software Foundation; either +// version 2.1 of the License. +// +// This library is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU +// Lesser General Public License for more details. +// +// You should have received a copy of the GNU Lesser General Public +// License along with this library; if not, write to the Free Software +// Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307 USA +// +// See http://www.opencascade.org/SALOME/ or email : webmaster.salome@opencascade.org +// +// +// +// File : GEOM_Position_i.cc +// Author : Damien COQUERET +// Module : GEOM +// $Header$ + +using namespace std; +#include "GEOM_Position_i.hh" + +//================================================================================= +// function : GEOM_Position_i() constructor (no arguments) +// purpose : for what now ? +//================================================================================= +GEOM_Position_i::GEOM_Position_i() +{ +} + + +//================================================================================= +// function : constructor +// purpose : constructor for servant creation +//================================================================================= +GEOM_Position_i::GEOM_Position_i(const GEOM::PointStruct& P0, const GEOM::DirStruct& VX, + const GEOM::DirStruct& VY, const GEOM::DirStruct& VZ) +{ + + SetOrigin(P0); + SetVX(VX); + SetVY(VY); + SetVZ(VZ); + return; + +} + + +//================================================================================= +// function : destructor +// purpose : +//================================================================================= +GEOM_Position_i::~GEOM_Position_i() {} + + +//================================================================================= +// function : SetOrigin() +// purpose : +//================================================================================= +void GEOM_Position_i::SetOrigin(const GEOM::PointStruct& P0) + throw(SALOME::SALOME_Exception) +{ + _P0 = P0; + return; +} + +//================================================================================= +// function : SetVX() +// purpose : +//================================================================================= +void GEOM_Position_i::SetVX(const GEOM::DirStruct& Vect) + throw(SALOME::SALOME_Exception) +{ + _VX = Vect; + return; +} + +//================================================================================= +// function : SetVY() +// purpose : +//================================================================================= +void GEOM_Position_i::SetVY(const GEOM::DirStruct& Vect) + throw(SALOME::SALOME_Exception) +{ + _VY = Vect; + return; +} + +//================================================================================= +// function : SetVZ() +// purpose : +//================================================================================= +void GEOM_Position_i::SetVZ(const GEOM::DirStruct& Vect) + throw(SALOME::SALOME_Exception) +{ + _VZ = Vect; + return; +} + +//================================================================================= +// function : GetOrigin() +// purpose : +//================================================================================= +GEOM::PointStruct GEOM_Position_i::GetOrigin() + throw(SALOME::SALOME_Exception) +{ + return _P0; +} + +//================================================================================= +// function : GetVX() +// purpose : +//================================================================================= +GEOM::DirStruct GEOM_Position_i::GetVX() + throw(SALOME::SALOME_Exception) +{ + return _VX; +} + +//================================================================================= +// function : GetVY() +// purpose : +//================================================================================= +GEOM::DirStruct GEOM_Position_i::GetVY() + throw(SALOME::SALOME_Exception) +{ + return _VY; +} + +//================================================================================= +// function : GetVZ() +// purpose : +//================================================================================= +GEOM::DirStruct GEOM_Position_i::GetVZ() + throw(SALOME::SALOME_Exception) +{ + return _VZ; +} diff --git a/src/GEOM/GEOM_Position_i.hh b/src/GEOM/GEOM_Position_i.hh new file mode 100644 index 000000000..57b66a0f0 --- /dev/null +++ b/src/GEOM/GEOM_Position_i.hh @@ -0,0 +1,84 @@ +// GEOM GEOM : +// +// Copyright (C) 2003 OPEN CASCADE, EADS/CCR, LIP6, CEA/DEN, +// CEDRAT, EDF R&D, LEG, PRINCIPIA R&D, BUREAU VERITAS +// +// This library is free software; you can redistribute it and/or +// modify it under the terms of the GNU Lesser General Public +// License as published by the Free Software Foundation; either +// version 2.1 of the License. +// +// This library is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU +// Lesser General Public License for more details. +// +// You should have received a copy of the GNU Lesser General Public +// License along with this library; if not, write to the Free Software +// Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307 USA +// +// See http://www.opencascade.org/SALOME/ or email : webmaster.salome@opencascade.org +// +// +// +// File : GEOM_Position_i.hh +// Author : Damien COQUERET +// Module : GEOM +// $Header$ + +#ifndef __GEOM_POSITION_I_H__ +#define __GEOM_POSITION_I_H__ + +// IDL headers +#include +#include CORBA_SERVER_HEADER(GEOM_Gen) +#include CORBA_SERVER_HEADER(GEOM_Shape) +#include CORBA_SERVER_HEADER(GEOM_Kinematic) + +//===================================================================== +// GEOM_Position_i : class definition +//===================================================================== +class GEOM_Position_i: + public POA_GEOM::GEOM_Position +{ +public: + GEOM_Position_i(); + GEOM_Position_i(const GEOM::PointStruct& P0, const GEOM::DirStruct& VX, + const GEOM::DirStruct& VY, const GEOM::DirStruct& VZ); + + ~GEOM_Position_i(); + +private: + GEOM::PointStruct _P0; + GEOM::DirStruct _VX; + GEOM::DirStruct _VY; + GEOM::DirStruct _VZ; + +public: + void SetOrigin(const GEOM::PointStruct& P0) + throw (SALOME::SALOME_Exception); + + void SetVX(const GEOM::DirStruct& Vect) + throw (SALOME::SALOME_Exception); + + void SetVY(const GEOM::DirStruct& Vect) + throw (SALOME::SALOME_Exception); + + void SetVZ(const GEOM::DirStruct& Vect) + throw (SALOME::SALOME_Exception); + + GEOM::PointStruct GetOrigin() + throw (SALOME::SALOME_Exception); + + GEOM::DirStruct GetVX() + throw (SALOME::SALOME_Exception); + + GEOM::DirStruct GetVY() + throw (SALOME::SALOME_Exception); + + GEOM::DirStruct GetVZ() + throw (SALOME::SALOME_Exception); + +}; + +#endif diff --git a/src/GEOM/GEOM_Rotation_i.cc b/src/GEOM/GEOM_Rotation_i.cc new file mode 100644 index 000000000..c0fa00432 --- /dev/null +++ b/src/GEOM/GEOM_Rotation_i.cc @@ -0,0 +1,135 @@ +// GEOM GEOM : +// +// Copyright (C) 2003 OPEN CASCADE, EADS/CCR, LIP6, CEA/DEN, +// CEDRAT, EDF R&D, LEG, PRINCIPIA R&D, BUREAU VERITAS +// +// This library is free software; you can redistribute it and/or +// modify it under the terms of the GNU Lesser General Public +// License as published by the Free Software Foundation; either +// version 2.1 of the License. +// +// This library is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU +// Lesser General Public License for more details. +// +// You should have received a copy of the GNU Lesser General Public +// License along with this library; if not, write to the Free Software +// Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307 USA +// +// See http://www.opencascade.org/SALOME/ or email : webmaster.salome@opencascade.org +// +// +// +// File : GEOM_Rotation_i.cc +// Author : Damien COQUERET +// Module : GEOM +// $Header$ + +using namespace std; +#include "GEOM_Rotation_i.hh" + +//================================================================================= +// function : GEOM_Rotation_i() constructor (no arguments) +// purpose : for what now ? +//================================================================================= +GEOM_Rotation_i::GEOM_Rotation_i() +{ +} + + +//================================================================================= +// function : constructor +// purpose : constructor for servant creation +//================================================================================= +GEOM_Rotation_i::GEOM_Rotation_i(CORBA::Long Rot1, CORBA::Long Rot2, CORBA::Long Rot3, + CORBA::Double Val1, CORBA::Double Val2, CORBA::Double Val3) +{ + + SetRotation(Rot1, Rot2, Rot3, Val1, Val2, Val3); + return; + +} + + +//================================================================================= +// function : destructor +// purpose : +//================================================================================= +GEOM_Rotation_i::~GEOM_Rotation_i() {} + + +//================================================================================= +// function : SetRotation() +// purpose : +//================================================================================= +void GEOM_Rotation_i::SetRotation(CORBA::Long Rot1, CORBA::Long Rot2, CORBA::Long Rot3, + CORBA::Double Val1, CORBA::Double Val2, CORBA::Double Val3) + throw(SALOME::SALOME_Exception) +{ + + _Rot1 = Rot1; + _Rot2 = Rot2; + _Rot3 = Rot3; + + _Val1 = Val1; + _Val2 = Val2; + _Val3 = Val3; + + return; + +} + +//================================================================================= +// function : GetRot1() +// purpose : +//================================================================================= +CORBA::Long GEOM_Rotation_i::GetRot1() throw(SALOME::SALOME_Exception) +{ + return _Rot1; +} + +//================================================================================= +// function : GetRot2() +// purpose : +//================================================================================= +CORBA::Long GEOM_Rotation_i::GetRot2() throw(SALOME::SALOME_Exception) +{ + return _Rot2; +} + +//================================================================================= +// function : GetRot3() +// purpose : +//================================================================================= +CORBA::Long GEOM_Rotation_i::GetRot3() throw(SALOME::SALOME_Exception) +{ + return _Rot3; +} + +//================================================================================= +// function : GetVal1() +// purpose : +//================================================================================= +CORBA::Double GEOM_Rotation_i::GetVal1() throw(SALOME::SALOME_Exception) +{ + return _Val1; +} + +//================================================================================= +// function : GetVal2() +// purpose : +//================================================================================= +CORBA::Double GEOM_Rotation_i::GetVal2() throw(SALOME::SALOME_Exception) +{ + return _Val2; +} + +//================================================================================= +// function : GetVal3() +// purpose : +//================================================================================= +CORBA::Double GEOM_Rotation_i::GetVal3() throw(SALOME::SALOME_Exception) +{ + return _Val3; +} diff --git a/src/GEOM/GEOM_Rotation_i.hh b/src/GEOM/GEOM_Rotation_i.hh new file mode 100644 index 000000000..598073005 --- /dev/null +++ b/src/GEOM/GEOM_Rotation_i.hh @@ -0,0 +1,85 @@ +// GEOM GEOM : +// +// Copyright (C) 2003 OPEN CASCADE, EADS/CCR, LIP6, CEA/DEN, +// CEDRAT, EDF R&D, LEG, PRINCIPIA R&D, BUREAU VERITAS +// +// This library is free software; you can redistribute it and/or +// modify it under the terms of the GNU Lesser General Public +// License as published by the Free Software Foundation; either +// version 2.1 of the License. +// +// This library is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU +// Lesser General Public License for more details. +// +// You should have received a copy of the GNU Lesser General Public +// License along with this library; if not, write to the Free Software +// Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307 USA +// +// See http://www.opencascade.org/SALOME/ or email : webmaster.salome@opencascade.org +// +// +// +// File : GEOM_Rotation_i.hh +// Author : Damien COQUERET +// Module : GEOM +// $Header$ + +#ifndef __GEOM_ROTATION_I_H__ +#define __GEOM_ROTATION_I_H__ + +// IDL headers +#include +#include CORBA_SERVER_HEADER(GEOM_Gen) +#include CORBA_SERVER_HEADER(GEOM_Shape) +#include CORBA_SERVER_HEADER(GEOM_Kinematic) + +//===================================================================== +// GEOM_Rotation_i : class definition +//===================================================================== +class GEOM_Rotation_i: + public POA_GEOM::GEOM_Rotation +{ +public: + GEOM_Rotation_i(); + GEOM_Rotation_i(CORBA::Long Rot1, CORBA::Long Rot2, CORBA::Long Rot3, + CORBA::Double Val1, CORBA::Double Val2, CORBA::Double Val3); + + ~GEOM_Rotation_i(); + +private: + CORBA::Long _Rot1; + CORBA::Long _Rot2; + CORBA::Long _Rot3; + + CORBA::Double _Val1; + CORBA::Double _Val2; + CORBA::Double _Val3; + +public: + void SetRotation(CORBA::Long Rot1, CORBA::Long Rot2, CORBA::Long Rot3, + CORBA::Double Val1, CORBA::Double Val2, CORBA::Double Val3) + throw (SALOME::SALOME_Exception); + + CORBA::Long GetRot1() + throw (SALOME::SALOME_Exception); + + CORBA::Long GetRot2() + throw (SALOME::SALOME_Exception); + + CORBA::Long GetRot3() + throw (SALOME::SALOME_Exception); + + CORBA::Double GetVal1() + throw (SALOME::SALOME_Exception); + + CORBA::Double GetVal2() + throw (SALOME::SALOME_Exception); + + CORBA::Double GetVal3() + throw (SALOME::SALOME_Exception); + +}; + +#endif diff --git a/src/GEOM/GEOM_Translation_i.cc b/src/GEOM/GEOM_Translation_i.cc new file mode 100644 index 000000000..2c25166da --- /dev/null +++ b/src/GEOM/GEOM_Translation_i.cc @@ -0,0 +1,101 @@ +// GEOM GEOM : +// +// Copyright (C) 2003 OPEN CASCADE, EADS/CCR, LIP6, CEA/DEN, +// CEDRAT, EDF R&D, LEG, PRINCIPIA R&D, BUREAU VERITAS +// +// This library is free software; you can redistribute it and/or +// modify it under the terms of the GNU Lesser General Public +// License as published by the Free Software Foundation; either +// version 2.1 of the License. +// +// This library is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU +// Lesser General Public License for more details. +// +// You should have received a copy of the GNU Lesser General Public +// License along with this library; if not, write to the Free Software +// Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307 USA +// +// See http://www.opencascade.org/SALOME/ or email : webmaster.salome@opencascade.org +// +// +// +// File : GEOM_Translation_i.cc +// Author : Damien COQUERET +// Module : GEOM +// $Header$ + +using namespace std; +#include "GEOM_Translation_i.hh" + +//================================================================================= +// function : GEOM_Translation_i() constructor (no arguments) +// purpose : for what now ? +//================================================================================= +GEOM_Translation_i::GEOM_Translation_i() +{ +} + + +//================================================================================= +// function : constructor +// purpose : constructor for servant creation +//================================================================================= +GEOM_Translation_i::GEOM_Translation_i(CORBA::Double Val1, CORBA::Double Val2, CORBA::Double Val3) +{ + + SetTranslation(Val1, Val2, Val3); + return; + +} + + +//================================================================================= +// function : destructor +// purpose : +//================================================================================= +GEOM_Translation_i::~GEOM_Translation_i() {} + + +//================================================================================= +// function : SetTranslation() +// purpose : +//================================================================================= +void GEOM_Translation_i::SetTranslation(CORBA::Double Val1, CORBA::Double Val2, CORBA::Double Val3) + throw(SALOME::SALOME_Exception) +{ + + _Val1 = Val1; + _Val2 = Val2; + _Val3 = Val3; + return; + +} + +//================================================================================= +// function : GetVal1() +// purpose : +//================================================================================= +CORBA::Double GEOM_Translation_i::GetVal1() throw(SALOME::SALOME_Exception) +{ + return _Val1; +} + +//================================================================================= +// function : GetVal2() +// purpose : +//================================================================================= +CORBA::Double GEOM_Translation_i::GetVal2() throw(SALOME::SALOME_Exception) +{ + return _Val2; +} + +//================================================================================= +// function : GetVal3() +// purpose : +//================================================================================= +CORBA::Double GEOM_Translation_i::GetVal3() throw(SALOME::SALOME_Exception) +{ + return _Val3; +} diff --git a/src/GEOM/GEOM_Translation_i.hh b/src/GEOM/GEOM_Translation_i.hh new file mode 100644 index 000000000..45cea50bf --- /dev/null +++ b/src/GEOM/GEOM_Translation_i.hh @@ -0,0 +1,70 @@ +// GEOM GEOM : +// +// Copyright (C) 2003 OPEN CASCADE, EADS/CCR, LIP6, CEA/DEN, +// CEDRAT, EDF R&D, LEG, PRINCIPIA R&D, BUREAU VERITAS +// +// This library is free software; you can redistribute it and/or +// modify it under the terms of the GNU Lesser General Public +// License as published by the Free Software Foundation; either +// version 2.1 of the License. +// +// This library is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU +// Lesser General Public License for more details. +// +// You should have received a copy of the GNU Lesser General Public +// License along with this library; if not, write to the Free Software +// Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307 USA +// +// See http://www.opencascade.org/SALOME/ or email : webmaster.salome@opencascade.org +// +// +// +// File : GEOM_Translation_i.hh +// Author : Damien COQUERET +// Module : GEOM +// $Header$ + +#ifndef __GEOM_TRANSLATION_I_H__ +#define __GEOM_TRANSLATION_I_H__ + +// IDL headers +#include +#include CORBA_SERVER_HEADER(GEOM_Gen) +#include CORBA_SERVER_HEADER(GEOM_Shape) +#include CORBA_SERVER_HEADER(GEOM_Kinematic) + +//===================================================================== +// GEOM_Translation_i : class definition +//===================================================================== +class GEOM_Translation_i: + public POA_GEOM::GEOM_Translation +{ +public: + GEOM_Translation_i(); + GEOM_Translation_i(CORBA::Double Val1, CORBA::Double Val2, CORBA::Double Val3); + + ~GEOM_Translation_i(); + +private: + CORBA::Double _Val1; + CORBA::Double _Val2; + CORBA::Double _Val3; + +public: + void SetTranslation(CORBA::Double Val1, CORBA::Double Val2, CORBA::Double Val3) + throw (SALOME::SALOME_Exception); + + CORBA::Double GetVal1() + throw (SALOME::SALOME_Exception); + + CORBA::Double GetVal2() + throw (SALOME::SALOME_Exception); + + CORBA::Double GetVal3() + throw (SALOME::SALOME_Exception); + +}; + +#endif diff --git a/src/GEOM/Makefile.in b/src/GEOM/Makefile.in index 738e9ae64..33ba31328 100644 --- a/src/GEOM/Makefile.in +++ b/src/GEOM/Makefile.in @@ -37,8 +37,8 @@ VPATH=.:@srcdir@:@top_srcdir@/idl # Libraries targets LIB = libGEOMEngine.la -LIB_SRC = GEOM_Shape_i.cc GEOM_Gen_i.cc -LIB_SERVER_IDL = SALOME_Component.idl SALOMEDS.idl SALOME_Exception.idl GEOM_Gen.idl GEOM_Shape.idl +LIB_SRC = GEOM_Shape_i.cc GEOM_Position_i.cc GEOM_Rotation_i.cc GEOM_Translation_i.cc GEOM_Contact_i.cc GEOM_Assembly_i.cc GEOM_Animation_i.cc GEOM_Gen_i.cc +LIB_SERVER_IDL = SALOME_Component.idl SALOMEDS.idl SALOME_Exception.idl GEOM_Gen.idl GEOM_Shape.idl GEOM_Kinematic.idl # Executables targets BIN = @@ -46,12 +46,12 @@ BIN_SRC = BIN_CLIENT_IDL = BIN_SERVER_IDL = -EXPORT_HEADERS = +EXPORT_HEADERS = # additionnal information to compil and link file CPPFLAGS += $(OCC_INCLUDES) -I${KERNEL_ROOT_DIR}/include/salome CXXFLAGS += $(OCC_CXXFLAGS) -I${KERNEL_ROOT_DIR}/include/salome -LDFLAGS += -lGEOMDS -lTOOLSDS -lSalomeNS -lSalomeContainer -lGEOMPartition -lGEOMArchimede $(CAS_LDPATH) -lTKIGES -lTKSTEP -lTKFillet -lTKOffset -L${KERNEL_ROOT_DIR}/lib/salome +LDFLAGS += -lGEOMDS -lTOOLSDS -lSalomeNS -lSalomeContainer -lGEOMPartition -lGEOMArchimede -lGEOMKinematic $(CAS_LDPATH) -lTKIGES -lTKSTEP -lTKFillet -lTKOffset -L${KERNEL_ROOT_DIR}/lib/salome # additional file to be cleaned MOSTLYCLEAN = diff --git a/src/GEOMBase/GEOMBase.cxx b/src/GEOMBase/GEOMBase.cxx index 438a1e541..bcc6dd11b 100644 --- a/src/GEOMBase/GEOMBase.cxx +++ b/src/GEOMBase/GEOMBase.cxx @@ -206,7 +206,28 @@ bool GEOMBase::CustomPopup(QAD_Desktop* parent, QPopupMenu* popup, const QString int id = popup->idAt(0); // separator if(id < 0) popup->removeItem(id); - + + if(theObject.compare("Assembly") == 0 || theObject.compare("Animation") == 0) { + popup->removeItem(QAD_DisplayOnly_Popup_ID); + popup->removeItem(QAD_Display_Popup_ID); + popup->removeItem(QAD_Erase_Popup_ID); + return true; + } + else if(theObject.compare("Contact") == 0) { + Standard_Boolean testResult; + Handle(SALOME_InteractiveObject) IO = Sel->firstIObject(); + GEOM::GEOM_Contact_ptr myGeomContact = myGeomBase->ConvertIOinContact(IO, testResult); + int type = myGeomContact->GetType(); + if(type == 0 || type == 2) //EMBEDDING || SLIDE + popup->removeItem(6132); //ROTATION + if(type == 0 || type == 1 || type == 4) //EMBEDDING || PIVOT || SPHERICAL + popup->removeItem(6133); //TRANSLATION + popup->removeItem(QAD_DisplayOnly_Popup_ID); + popup->removeItem(QAD_Display_Popup_ID); + popup->removeItem(QAD_Erase_Popup_ID); + return true; + } + // checking for GEOM label in the selected list SALOME_ListIteratorOfListIO It(Sel->StoredIObjects()); Handle(SALOME_InteractiveObject) anIObject; @@ -348,6 +369,27 @@ bool GEOMBase::CustomPopup(QAD_Desktop* parent, QPopupMenu* popup, const QString if(id < 0) popup->removeItem(id); + if(theObject.compare("Assembly") == 0 || theObject.compare("Animation") == 0) { + popup->removeItem(QAD_DisplayOnly_Popup_ID); + popup->removeItem(QAD_Display_Popup_ID); + popup->removeItem(QAD_Erase_Popup_ID); + return true; + } + else if(theObject.compare("Contact") == 0) { + Standard_Boolean testResult; + Handle(SALOME_InteractiveObject) IO = Sel->firstIObject(); + GEOM::GEOM_Contact_ptr myGeomContact = myGeomBase->ConvertIOinContact(IO, testResult); + int type = myGeomContact->GetType(); + if(type == 0 || type == 2) //EMBEDDING || SLIDE + popup->removeItem(6132); //ROTATION + if(type == 0 || type == 1 || type == 4) //EMBEDDING || PIVOT || SPHERICAL + popup->removeItem(6133); //TRANSLATION + popup->removeItem(QAD_DisplayOnly_Popup_ID); + popup->removeItem(QAD_Display_Popup_ID); + popup->removeItem(QAD_Erase_Popup_ID); + return true; + } + // checking for GEOM label in the selected list SALOME_ListIteratorOfListIO It(Sel->StoredIObjects()); Handle(SALOME_InteractiveObject) anIObject; @@ -490,13 +532,13 @@ bool GEOMBase::Display(GEOM::GEOM_Shape_ptr aShape, Standard_CString name) anAttr = aStudyBuilder->FindOrCreateAttribute(father, "AttributePixMap"); aPixmap = SALOMEDS::AttributePixMap::_narrow(anAttr); aPixmap->SetPixMap("ICON_OBJBROWSER_Geometry"); + aStudyBuilder->DefineComponentInstance(father, myGeom); QAD_Application::getDesktop()->getActiveStudy()->updateObjBrowser(); if(aLocked) aStudy->GetProperties()->SetLocked(true); op->finish(); } - aStudyBuilder->DefineComponentInstance(father, myGeom); father->ComponentIOR(myGeomGUI->GetFatherior()); TCollection_AsciiString nameG(""); @@ -540,6 +582,7 @@ bool GEOMBase::Display(GEOM::GEOM_Shape_ptr aShape, Standard_CString name) OCCViewer_Viewer3d* v3d = ((OCCViewer_ViewFrame*)QAD_Application::getDesktop()->getActiveStudy()->getActiveStudyFrame()->getRightFrame()->getViewFrame())->getViewer(); Handle(AIS_InteractiveContext) ic = v3d->getAISContext(); Handle(GEOM_AISShape) theResult = new GEOM_AISShape(shape, nameG.ToCString()); + theResult->SetInfiniteState(shape.Infinite()); theResult->SetShadingColor(myShadingColor); IO = new GEOM_InteractiveObject(aShape->Name(), myGeomGUI->GetFatherior(), "GEOM"); theResult->setIO(IO); @@ -595,12 +638,12 @@ bool GEOMBase::AddInStudy(bool selection, const Handle(SALOME_InteractiveObject) anAttr = aStudyBuilder->FindOrCreateAttribute(father, "AttributePixMap"); aPixmap = SALOMEDS::AttributePixMap::_narrow(anAttr); aPixmap->SetPixMap("ICON_OBJBROWSER_Geometry"); + aStudyBuilder->DefineComponentInstance(father, myGeom); if (aLocked) aStudy->GetProperties()->SetLocked(true); op->finish(); } - aStudyBuilder->DefineComponentInstance(father, myGeom); father->ComponentIOR(myGeomGUI->GetFatherior()); SALOMEDS::SObject_var fatherSF = aStudy->FindObjectID(QAD_Application::getDesktop()->getActiveStudy()->getActiveStudyFrame()->entry()); @@ -1184,6 +1227,102 @@ GEOM::GEOM_Shape_ptr GEOMBase::ConvertIOinGEOMShape(const Handle(SALOME_Interact } +//======================================================================= +// function : ConvertIOinAssembly() +// purpose : +//======================================================================= +GEOM::GEOM_Assembly_ptr GEOMBase::ConvertIOinAssembly(const Handle(SALOME_InteractiveObject)& IO, Standard_Boolean& testResult) +{ + GEOM::GEOM_Assembly_var aAss; + testResult = false; + + /* case SObject */ + if(IO->hasEntry()) { + SALOMEDS::Study_var aStudy = QAD_Application::getDesktop()->getActiveStudy()->getStudyDocument(); + SALOMEDS::SObject_var obj = aStudy->FindObjectID(IO->getEntry()); + SALOMEDS::GenericAttribute_var anAttr; + SALOMEDS::AttributeIOR_var anIOR; + if(!obj->_is_nil()) { + if(obj->FindAttribute(anAttr, "AttributeIOR")) { + anIOR = SALOMEDS::AttributeIOR::_narrow(anAttr); + if(strcmp(anIOR->Value(),"") != 0){ + CORBA::Object_var anObject = aStudy->ConvertIORToObject(anIOR->Value()); + if(!CORBA::is_nil(anObject)) + aAss = GEOM::GEOM_Assembly::_narrow(anObject.in()); + } + if(!CORBA::is_nil(aAss)) + testResult = true; + } + } + } + return aAss._retn(); +} + + +//======================================================================= +// function : ConvertIOinContact() +// purpose : +//======================================================================= +GEOM::GEOM_Contact_ptr GEOMBase::ConvertIOinContact(const Handle(SALOME_InteractiveObject)& IO, Standard_Boolean& testResult) +{ + GEOM::GEOM_Contact_var aContact; + testResult = false; + + /* case SObject */ + if(IO->hasEntry()) { + SALOMEDS::Study_var aStudy = QAD_Application::getDesktop()->getActiveStudy()->getStudyDocument(); + SALOMEDS::SObject_var obj = aStudy->FindObjectID(IO->getEntry()); + SALOMEDS::GenericAttribute_var anAttr; + SALOMEDS::AttributeIOR_var anIOR; + if(!obj->_is_nil()) { + if(obj->FindAttribute(anAttr, "AttributeIOR")) { + anIOR = SALOMEDS::AttributeIOR::_narrow(anAttr); + if(strcmp(anIOR->Value(),"") != 0){ + CORBA::Object_var anObject = aStudy->ConvertIORToObject(anIOR->Value()); + if(!CORBA::is_nil(anObject)) + aContact = GEOM::GEOM_Contact::_narrow(anObject.in()); + } + if(!CORBA::is_nil(aContact)) + testResult = true; + } + } + } + return aContact._retn(); +} + + +//======================================================================= +// function : ConvertIOinContact() +// purpose : +//======================================================================= +GEOM::GEOM_Animation_ptr GEOMBase::ConvertIOinAnimation(const Handle(SALOME_InteractiveObject)& IO, Standard_Boolean& testResult) +{ + GEOM::GEOM_Animation_var aAnimation; + testResult = false; + + /* case SObject */ + if(IO->hasEntry()) { + SALOMEDS::Study_var aStudy = QAD_Application::getDesktop()->getActiveStudy()->getStudyDocument(); + SALOMEDS::SObject_var obj = aStudy->FindObjectID(IO->getEntry()); + SALOMEDS::GenericAttribute_var anAttr; + SALOMEDS::AttributeIOR_var anIOR; + if(!obj->_is_nil()) { + if(obj->FindAttribute(anAttr, "AttributeIOR")) { + anIOR = SALOMEDS::AttributeIOR::_narrow(anAttr); + if(strcmp(anIOR->Value(),"") != 0){ + CORBA::Object_var anObject = aStudy->ConvertIORToObject(anIOR->Value()); + if(!CORBA::is_nil(anObject)) + aAnimation = GEOM::GEOM_Animation::_narrow(anObject.in()); + } + if(!CORBA::is_nil(aAnimation)) + testResult = true; + } + } + } + return aAnimation._retn(); +} + + //======================================================================= // function : ConvertListOfIOInListOfIOR() // purpose : diff --git a/src/GEOMBase/GEOMBase.h b/src/GEOMBase/GEOMBase.h index db3bb1daa..12cbd728f 100644 --- a/src/GEOMBase/GEOMBase.h +++ b/src/GEOMBase/GEOMBase.h @@ -72,6 +72,12 @@ public : bool GetShapeTypeString(const TopoDS_Shape& aShape, Standard_CString& aTypeString); /* Convertions */ + GEOM::GEOM_Assembly_ptr ConvertIOinAssembly(const Handle(SALOME_InteractiveObject)& IO, + Standard_Boolean& testResult); + GEOM::GEOM_Contact_ptr ConvertIOinContact(const Handle(SALOME_InteractiveObject)& IO, + Standard_Boolean& testResult); + GEOM::GEOM_Animation_ptr ConvertIOinAnimation(const Handle(SALOME_InteractiveObject)& IO, + Standard_Boolean& testResult); GEOM::GEOM_Shape_ptr ConvertIOinGEOMShape(const Handle(SALOME_InteractiveObject)& IO, Standard_Boolean& testResult); Handle(GEOM_AISShape) ConvertIOinGEOMAISShape(const Handle(SALOME_InteractiveObject)& IO, diff --git a/src/GEOMBase/Makefile.in b/src/GEOMBase/Makefile.in index 42082e5fe..0ce139cad 100644 --- a/src/GEOMBase/Makefile.in +++ b/src/GEOMBase/Makefile.in @@ -52,7 +52,8 @@ LIB_MOC = \ LIB_CLIENT_IDL = SALOME_Exception.idl \ SALOMEDS.idl \ - SALOMEDS_Attributes.idl + SALOMEDS_Attributes.idl \ + GEOM_Kinematic.idl LIB_SERVER_IDL = diff --git a/src/GEOMClient/Makefile.in b/src/GEOMClient/Makefile.in index 32db3e220..726c35a98 100644 --- a/src/GEOMClient/Makefile.in +++ b/src/GEOMClient/Makefile.in @@ -42,7 +42,7 @@ EXPORT_HEADERS = \ LIB = libGEOMClient.la LIB_SRC = GEOM_Client.cxx -LIB_SERVER_IDL = SALOME_Component.idl SALOMEDS.idl SALOME_Exception.idl GEOM_Shape.idl GEOM_Gen.idl +LIB_SERVER_IDL = SALOME_Component.idl SALOMEDS.idl SALOME_Exception.idl GEOM_Shape.idl GEOM_Gen.idl GEOM_Kinematic.idl # Executables targets BIN = diff --git a/src/GEOMContext/GEOM_icons.po b/src/GEOMContext/GEOM_icons.po index ed64a379c..bea2c564c 100644 --- a/src/GEOMContext/GEOM_icons.po +++ b/src/GEOMContext/GEOM_icons.po @@ -18,6 +18,30 @@ msgstr "select1.png" msgid "ICON_OBJBROWSER_Geometry" msgstr "geometry.png" +#: +msgid "ICON_ANIMATION" +msgstr "animation.png" + +#: +msgid "ICON_ASSEMBLY" +msgstr "assembly.png" + +#: +msgid "ICON_CONTACT" +msgstr "contact.png" + +#: +msgid "ICON_OBJBROWSER_ANIMATION" +msgstr "tree_animation.png" + +#: +msgid "ICON_OBJBROWSER_ASSEMBLY" +msgstr "tree_assembly.png" + +#: +msgid "ICON_OBJBROWSER_CONTACT" +msgstr "tree_contact.png" + #: QAD_ObjectBrowser.cxx:140 msgid "ICON_OBJBROWSER_COMPOUND" msgstr "tree_compound.png" diff --git a/src/GEOMContext/GEOM_msg_en.po b/src/GEOMContext/GEOM_msg_en.po index 1b91d57f8..895143100 100644 --- a/src/GEOMContext/GEOM_msg_en.po +++ b/src/GEOMContext/GEOM_msg_en.po @@ -1299,3 +1299,75 @@ msgstr "Values" msgid "GEOM_SKETCHER_TYPE" msgstr "Type" + +msgid "GEOM_CONTACT_TITLE" +msgstr "Add Contact" + +msgid "GEOM_ASSEMBLY" +msgstr "Assembly" + +msgid "GEOM_CONTACT" +msgstr "Contact" + +msgid "GEOM_TYPE" +msgstr "Type" + +msgid "GEOM_KROTATION_TITLE" +msgstr "Edit Rotation" + +msgid "GEOM_KTRANSLATION_TITLE" +msgstr "Edit Translation" + +msgid "GEOM_KROTATION" +msgstr "Rotation" + +msgid "GEOM_KTRANSLATION" +msgstr "Translation" + +msgid "GEOM_VALUE" +msgstr "Value" + +msgid "GEOM_1ROT" +msgstr "1st Rot." + +msgid "GEOM_2ROT" +msgstr "2nd Rot." + +msgid "GEOM_3ROT" +msgstr "3rd Rot." + +msgid "GEOM_KPOSITION_TITLE" +msgstr "Set Position" + +msgid "GEOM_KPOSITION" +msgstr "Position" + +msgid "GEOM_POS" +msgstr "Position :" + +msgid "GEOM_VX" +msgstr "VX :" + +msgid "GEOM_VY" +msgstr "VY :" + +msgid "GEOM_VZ" +msgstr "VZ :" + +msgid "GEOM_ANIMATION_TITLE" +msgstr "Add Animation" + +msgid "GEOM_ANIMATION" +msgstr "Animation" + +msgid "GEOM_FRAME" +msgstr "Frame" + +msgid "GEOM_DURATION" +msgstr "Duration" + +msgid "GEOM_NBSEQ" +msgstr "Nb. Sequences" + +msgid "GEOM_IS_IN_LOOP" +msgstr "In Loop" diff --git a/src/GEOMContext/Makefile.in b/src/GEOMContext/Makefile.in index ffb273015..9215429ea 100644 --- a/src/GEOMContext/Makefile.in +++ b/src/GEOMContext/Makefile.in @@ -51,7 +51,7 @@ LIB_SRC = GEOMContext.cxx LIB_MOC = \ GEOMContext.h -LIB_CLIENT_IDL = SALOME_Exception.idl +LIB_CLIENT_IDL = SALOME_Exception.idl GEOM_Kinematic.idl LIB_SERVER_IDL = diff --git a/src/GEOMDS/GEOMDS_Commands.cxx b/src/GEOMDS/GEOMDS_Commands.cxx index 17f7e5764..b2f0b52ca 100644 --- a/src/GEOMDS/GEOMDS_Commands.cxx +++ b/src/GEOMDS/GEOMDS_Commands.cxx @@ -34,9 +34,16 @@ using namespace std; #include #include #include +#include +#include +#include #include #include #include +#include + +#include "Kinematic_Contact.hxx" +#include "Kinematic_Animation.hxx" //======================================================================= @@ -300,3 +307,202 @@ Standard_Boolean GEOMDS_Commands::ReturnNameIOR(const TDF_Label& aLabel, return true ; } } + + +//======================================================================= +// function : AddAssembly() +// purpose : +//======================================================================= +TDF_Label GEOMDS_Commands::AddAssembly(Kinematic_Assembly& KAss, + const TCollection_ExtendedString& Name) +{ + TDF_Label LabAssembly = myLab.NewChild(); + TDataStd_Name::Set(LabAssembly, Name); + return LabAssembly; +} + + +//======================================================================= +// function : AddContact() +// purpose : +//======================================================================= +TDF_Label GEOMDS_Commands::AddContact(Kinematic_Contact& KContact, + const TDF_Label& mainRefLab, + const TCollection_ExtendedString& Name) +{ + TDF_Label LabContact = mainRefLab.NewChild(); + TDataStd_Name::Set(LabContact, Name); + + TDF_Label LabType = LabContact.NewChild(); + TDataStd_Integer::Set(LabType, KContact.Type()); + + TDF_Label NewLab1 = LabContact.NewChild(); + TNaming_Builder B1(NewLab1); + B1.Select(KContact.Shape1(), KContact.Shape1()); +// TDF_Label RefLab1 = TNaming_Tool::Label(myLab, KContact.Shape1()); +// TDF_Reference::Set(NewLab1, RefLab1); + + TDF_Label NewLab2 = LabContact.NewChild(); + TNaming_Builder B2(NewLab2); + B2.Select(KContact.Shape2(), KContact.Shape2()); +// TDF_Label RefLab2 = TNaming_Tool::Label(myLab, KContact.Shape2()); +// TDF_Reference::Set(NewLab2, RefLab2); + + TDF_Label LabPosition = LabContact.NewChild(); + Handle(TDataStd_RealArray) RealArrayP = TDataStd_RealArray::Set(LabPosition, 1, 12); + RealArrayP->SetValue(1, KContact.Position().Origin().X()); + RealArrayP->SetValue(2, KContact.Position().Origin().Y()); + RealArrayP->SetValue(3, KContact.Position().Origin().Z()); + RealArrayP->SetValue(4, KContact.Position().DirX().X()); + RealArrayP->SetValue(5, KContact.Position().DirX().Y()); + RealArrayP->SetValue(6, KContact.Position().DirX().Z()); + RealArrayP->SetValue(7, KContact.Position().DirY().X()); + RealArrayP->SetValue(8, KContact.Position().DirY().Y()); + RealArrayP->SetValue(9, KContact.Position().DirY().Z()); + RealArrayP->SetValue(10, KContact.Position().DirZ().X()); + RealArrayP->SetValue(11, KContact.Position().DirZ().Y()); + RealArrayP->SetValue(12, KContact.Position().DirZ().Z()); + + TDF_Label LabRotation1 = LabContact.NewChild(); + Handle(TDataStd_IntegerArray) IntegerArrayR = TDataStd_IntegerArray::Set(LabRotation1, 1, 3); + IntegerArrayR->SetValue(1, KContact.Rotation().Rot1()); + IntegerArrayR->SetValue(2, KContact.Rotation().Rot2()); + IntegerArrayR->SetValue(3, KContact.Rotation().Rot3()); + + TDF_Label LabRotation2 = LabContact.NewChild(); + Handle(TDataStd_RealArray) RealArrayR = TDataStd_RealArray::Set(LabRotation2, 1, 3); + RealArrayR->SetValue(1, KContact.Rotation().ValX()); + RealArrayR->SetValue(2, KContact.Rotation().ValY()); + RealArrayR->SetValue(3, KContact.Rotation().ValZ()); + + TDF_Label LabTranslation = LabContact.NewChild(); + Handle(TDataStd_RealArray) RealArrayT = TDataStd_RealArray::Set(LabTranslation, 1, 3); + RealArrayT->SetValue(1, KContact.Translation().ValX()); + RealArrayT->SetValue(2, KContact.Translation().ValY()); + RealArrayT->SetValue(3, KContact.Translation().ValZ()); + + TDF_Label LabStep = LabContact.NewChild(); + TDataStd_Real::Set(LabStep, KContact.Step()); + + return LabContact; +} + + +//======================================================================= +// function : AddAnimation() +// purpose : +//======================================================================= +TDF_Label GEOMDS_Commands::AddAnimation(Kinematic_Animation& KAnimation, + const TCollection_ExtendedString& Name) +{ + TDF_Label LabAnimation = myLab.NewChild(); + TDataStd_Name::Set(LabAnimation, Name); + + Standard_Real duration = double(KAnimation.Duration()); + + TDF_Label LabDuration = LabAnimation.NewChild(); + TDataStd_Real::Set(LabDuration, duration); + + TDF_Label LabNbSeq = LabAnimation.NewChild(); + TDataStd_Integer::Set(LabNbSeq, KAnimation.NbSeq()); + + TDF_Label LabIsInLoop = LabAnimation.NewChild(); + TDataStd_Integer::Set(LabIsInLoop, KAnimation.IsInLoop()); + + return LabAnimation; +} + + +//======================================================================= +// function : GetAssembly() +// purpose : +//======================================================================= +Standard_Boolean GEOMDS_Commands::GetAssembly(const TDF_Label& aLabel, + Kinematic_Assembly& returnAss) +{ + Kinematic_Assembly* Ass = new Kinematic_Assembly(); + Handle(TDataStd_Name) anAttName; + if(!aLabel.FindAttribute(TDataStd_Name::GetID(), anAttName)) + return false; + else { + TDF_ChildIterator it; + for(it.Initialize(aLabel, Standard_False); it.More(); it.Next()) { + TDF_Label L = it.Value(); + Kinematic_Contact* aContact = new Kinematic_Contact(); + Standard_Boolean test = GetContact(L, *aContact); + Ass->AddContact(aContact); + } + returnAss = *Ass; + return true; + } +} + + +//======================================================================= +// function : GetContact() +// purpose : +//======================================================================= +Standard_Boolean GEOMDS_Commands::GetContact(const TDF_Label& aLabel, + Kinematic_Contact& returnContact) +{ + Kinematic_Contact* Contact = new Kinematic_Contact(); + Handle(TDataStd_Name) anAttName; + if(!aLabel.FindAttribute(TDataStd_Name::GetID(), anAttName)) + return false; + else { + TDF_ChildIterator it; + int i = 1; + for(it.Initialize(aLabel, Standard_False); it.More(); it.Next()) { + TDF_Label L = it.Value(); + Handle(TNaming_NamedShape) anAttTopo1; + Handle(TNaming_NamedShape) anAttTopo2; + Handle(TDataStd_Integer) anAttInteger; + Handle(TDataStd_Real) anAttReal; + Handle(TDataStd_IntegerArray) anAttIntegerArrayR; + Handle(TDataStd_RealArray) anAttRealArrayP; + Handle(TDataStd_RealArray) anAttRealArrayR; + Handle(TDataStd_RealArray) anAttRealArrayT; + + if(i == 1 && L.FindAttribute(TDataStd_Integer::GetID(), anAttInteger)) { + Contact->Type(anAttInteger->Get()); + } + if(i == 2 && L.FindAttribute(TNaming_NamedShape::GetID(), anAttTopo1)) { + Contact->Shape1(TNaming_Tool::GetShape(anAttTopo1)); + } + if(i == 3 && L.FindAttribute(TNaming_NamedShape::GetID(), anAttTopo2)) { + Contact->Shape2(TNaming_Tool::GetShape(anAttTopo2)); + } + if(i == 4 && L.FindAttribute(TDataStd_RealArray::GetID(), anAttRealArrayP)) { + gp_Pnt Center(anAttRealArrayP->Value(1), anAttRealArrayP->Value(2), anAttRealArrayP->Value(3)); + gp_Dir aDirX(anAttRealArrayP->Value(4), anAttRealArrayP->Value(5), anAttRealArrayP->Value(6)); + gp_Dir aDirY(anAttRealArrayP->Value(7), anAttRealArrayP->Value(8), anAttRealArrayP->Value(9)); + gp_Dir aDirZ(anAttRealArrayP->Value(10), anAttRealArrayP->Value(11), anAttRealArrayP->Value(12)); + Contact->Position().Origin(Center); + Contact->Position().DirX(aDirX); + Contact->Position().DirY(aDirY); + Contact->Position().DirZ(aDirZ); + } + if(i == 5 && L.FindAttribute(TDataStd_IntegerArray::GetID(), anAttIntegerArrayR)) { + Contact->Rotation().Rot1(anAttIntegerArrayR->Value(1)); + Contact->Rotation().Rot2(anAttIntegerArrayR->Value(2)); + Contact->Rotation().Rot3(anAttIntegerArrayR->Value(3)); + } + if(i == 6 && L.FindAttribute(TDataStd_RealArray::GetID(), anAttRealArrayR)) { + Contact->Rotation().ValX(anAttRealArrayR->Value(1)); + Contact->Rotation().ValY(anAttRealArrayR->Value(2)); + Contact->Rotation().ValZ(anAttRealArrayR->Value(3)); + } + if(i == 7 && L.FindAttribute(TDataStd_RealArray::GetID(), anAttRealArrayT)) { + Contact->Translation().ValX(anAttRealArrayT->Value(1)); + Contact->Translation().ValY(anAttRealArrayT->Value(2)); + Contact->Translation().ValZ(anAttRealArrayT->Value(3)); + } + if(i == 8 && L.FindAttribute(TDataStd_Real::GetID(), anAttReal)) { + Contact->Step(anAttReal->Get()); + } + i++; + } + returnContact = *Contact; + return true; + } +} diff --git a/src/GEOMDS/GEOMDS_Commands.hxx b/src/GEOMDS/GEOMDS_Commands.hxx index 0e2403920..5602028c8 100644 --- a/src/GEOMDS/GEOMDS_Commands.hxx +++ b/src/GEOMDS/GEOMDS_Commands.hxx @@ -34,6 +34,9 @@ #endif class TDF_Label; class TopoDS_Shape; +class Kinematic_Assembly; +class Kinematic_Contact; +class Kinematic_Animation; class TCollection_ExtendedString; @@ -123,6 +126,19 @@ public: Standard_EXPORT Standard_Boolean ReturnNameIOR(const TDF_Label& aLabel, TCollection_ExtendedString& returnNameIOR) ; + /* Kinematic */ + Standard_EXPORT TDF_Label AddAssembly(Kinematic_Assembly& KAss, + const TCollection_ExtendedString& Name) ; + Standard_EXPORT TDF_Label AddContact(Kinematic_Contact& KContact, + const TDF_Label& mainRefLab, + const TCollection_ExtendedString& Name) ; + Standard_EXPORT TDF_Label AddAnimation(Kinematic_Animation& KAnimation, + const TCollection_ExtendedString& Name) ; + Standard_EXPORT Standard_Boolean GetAssembly(const TDF_Label& aLabel, + Kinematic_Assembly& returnAss) ; + Standard_EXPORT Standard_Boolean GetContact(const TDF_Label& aLabel, + Kinematic_Contact& returnContact) ; + protected: // Methods PROTECTED diff --git a/src/GEOMDS/GEOMDS_Commands.jxx b/src/GEOMDS/GEOMDS_Commands.jxx index 017dcd329..8d4cccf10 100644 --- a/src/GEOMDS/GEOMDS_Commands.jxx +++ b/src/GEOMDS/GEOMDS_Commands.jxx @@ -35,4 +35,4 @@ #endif #ifndef _GEOMDS_Commands_HeaderFile #include "GEOMDS_Commands.hxx" -#endif \ No newline at end of file +#endif diff --git a/src/GEOMFiltersSelection/Makefile.in b/src/GEOMFiltersSelection/Makefile.in index 851695357..99a6ed3a8 100644 --- a/src/GEOMFiltersSelection/Makefile.in +++ b/src/GEOMFiltersSelection/Makefile.in @@ -41,7 +41,7 @@ LIB_SRC = GEOM_ShapeTypeFilter.cxx \ GEOM_FaceFilter.cxx \ GEOM_EdgeFilter.cxx -LIB_CLIENT_IDL = SALOME_Component.idl SALOMEDS.idl SALOMEDS_Attributes.idl SALOME_Exception.idl GEOM_Shape.idl GEOM_Gen.idl +LIB_CLIENT_IDL = SALOME_Component.idl SALOMEDS.idl SALOMEDS_Attributes.idl SALOME_Exception.idl GEOM_Shape.idl GEOM_Gen.idl GEOM_Kinematic.idl # header files EXPORT_HEADERS= GEOM_ShapeTypeFilter.hxx \ diff --git a/src/GEOMGUI/GeometryGUI.cxx b/src/GEOMGUI/GeometryGUI.cxx index 357507e17..d0521d3cb 100644 --- a/src/GEOMGUI/GeometryGUI.cxx +++ b/src/GEOMGUI/GeometryGUI.cxx @@ -43,6 +43,11 @@ using namespace std; #include "SALOME_Selection.h" +// IDL Headers +#include +#include CORBA_SERVER_HEADER(SALOMEDS) +#include CORBA_SERVER_HEADER(SALOMEDS_Attributes) + /* The object itself created in the static method 'GetOrCreateGEOMBase()' */ static GEOMContext* GeomGUI = 0; @@ -238,6 +243,25 @@ bool GeometryGUI::OnGUIEvent(int theCommandID, QAD_Desktop* parent) if(!GeomGUI->LoadLibrary("libRepairGUI.so")) return false; } + else if(theCommandID == 611 || // MENU KINEMATIC - ASSEMBLY + theCommandID == 61201 || // MENU KINEMATIC - EMBEDDING + theCommandID == 61202 || // MENU KINEMATIC - PIVOT + theCommandID == 61203 || // MENU KINEMATIC - SLIDE + theCommandID == 61204 || // MENU KINEMATIC - SLIDING PIVOT + theCommandID == 61205 || // MENU KINEMATIC - SPHERICAL + theCommandID == 61206 || // MENU KINEMATIC - PLANE + theCommandID == 61207 || // MENU KINEMATIC - ANNULAR + theCommandID == 61208 || // MENU KINEMATIC - RECTILINEAR + theCommandID == 61209 || // MENU KINEMATIC - PONCTUAL + theCommandID == 61210 || // MENU KINEMATIC - HELICOIDAL + theCommandID == 6131 || // MENU KINEMATIC - POSITION + theCommandID == 6132 || // MENU KINEMATIC - ROTATION + theCommandID == 6133 || // MENU KINEMATIC - TRANSLATION + theCommandID == 614 || // MENU KINEMATIC - ANIMATION + theCommandID == 6141) { // MENU KINEMATIC - RUN ANIMATION + if(!GeomGUI->LoadLibrary("libKinematicGUI.so")) + return false; + } else if(theCommandID == 701 || // MENU MEASURE - PROPERTIES theCommandID == 702 || // MENU MEASURE - CDG theCommandID == 703 || // MENU MEASURE - INERTIA @@ -443,7 +467,23 @@ void GeometryGUI::DefinePopup(QString & theContext, QString & theParent, QString if(strcmp(scomp->GetID(), IO->getEntry()) == 0) { // component is selected theObject = "Component"; + return; } + + SALOMEDS::Study_var aStudy = QAD_Application::getDesktop()->getActiveStudy()->getStudyDocument(); + SALOMEDS::StudyBuilder_var aStudyBuilder = aStudy->NewBuilder(); + SALOMEDS::GenericAttribute_var anAttr; + SALOMEDS::AttributeComment_var aType; + anAttr = aStudyBuilder->FindOrCreateAttribute(sobj, "AttributeComment"); + aType = SALOMEDS::AttributeComment::_narrow(anAttr); + QString val = QString(strdup(aType->Value())); + if(val == "Kinematic_Assembly") + theObject = "Assembly"; + else if(val == "Kinematic_Contact") + theObject = "Contact"; + else if(val == "Kinematic_Animation") + theObject = "Animation"; + return; } } } diff --git a/src/GEOMGUI/Makefile.in b/src/GEOMGUI/Makefile.in index 9576c2d35..1a1f35d64 100644 --- a/src/GEOMGUI/Makefile.in +++ b/src/GEOMGUI/Makefile.in @@ -48,7 +48,8 @@ LIB_MOC = \ LIB_CLIENT_IDL = SALOME_Exception.idl \ SALOMEDS.idl \ - SALOMEDS_Attributes.idl + SALOMEDS_Attributes.idl \ + GEOM_Kinematic.idl LIB_SERVER_IDL = diff --git a/src/GEOMToolsGUI/GEOMToolsGUI.cxx b/src/GEOMToolsGUI/GEOMToolsGUI.cxx index fe0e3cc9c..8f19eee04 100644 --- a/src/GEOMToolsGUI/GEOMToolsGUI.cxx +++ b/src/GEOMToolsGUI/GEOMToolsGUI.cxx @@ -21,7 +21,7 @@ // // // -// File : GEOMBase_Tools.cxx +// File : GEOMToolsGUI.cxx // Author : Damien COQUERET // Module : GEOM // $Header: @@ -213,7 +213,7 @@ bool GEOMToolsGUI::OnGUIEvent(int theCommandID, QAD_Desktop* parent) else IsoV = "1"; - GEOMBase_NbIsosDlg* NbIsosDlg = new GEOMBase_NbIsosDlg(QAD_Application::getDesktop(), tr("GEOM_MEN_ISOS"), TRUE); + GEOMToolsGUI_NbIsosDlg* NbIsosDlg = new GEOMToolsGUI_NbIsosDlg(QAD_Application::getDesktop(), tr("GEOM_MEN_ISOS"), TRUE); int UIso = IsoU.toInt(); int VIso = IsoV.toInt(); @@ -313,7 +313,7 @@ bool GEOMToolsGUI::OnGUIEvent(int theCommandID, QAD_Desktop* parent) { QAD_PyEditor* PyEditor = QAD_Application::getDesktop()->getActiveStudy()->getActiveStudyFrame()->getRightFrame()->getPyEditor(); PyEditor->setText("from GEOM_usinggeom import *\n"); - PyEditor->setText(">>> "); + //PyEditor->setText(">>> "); PyEditor->handleReturn(); break; } @@ -396,13 +396,12 @@ bool GEOMToolsGUI::OnGUIEvent(int theCommandID, QAD_Desktop* parent) } case 8033: // TRANSPARENCY - POPUP VIEWER { - OCCViewer_Viewer3d* v3d; Handle(AIS_InteractiveContext) ic; - if(QAD_Application::getDesktop()->getActiveStudy()->getActiveStudyFrame()->getTypeView() > VIEW_OCC) { + if(QAD_Application::getDesktop()->getActiveStudy()->getActiveStudyFrame()->getTypeView() == VIEW_OCC) { OCCViewer_Viewer3d* v3d = ((OCCViewer_ViewFrame*)QAD_Application::getDesktop()->getActiveStudy()->getActiveStudyFrame()->getRightFrame()->getViewFrame())->getViewer(); - Handle (AIS_InteractiveContext) ic = v3d->getAISContext(); + ic = v3d->getAISContext(); } - GEOMBase_TransparencyDlg *aDlg = new GEOMBase_TransparencyDlg(parent, "", Sel, ic); + GEOMToolsGUI_TransparencyDlg *aDlg = new GEOMToolsGUI_TransparencyDlg(parent, "", Sel, ic); break; } case 8034: // ISOS - POPUP VIEWER @@ -428,8 +427,8 @@ bool GEOMToolsGUI::OnGUIEvent(int theCommandID, QAD_Desktop* parent) else IsoV = "1"; - GEOMBase_NbIsosDlg * NbIsosDlg = - new GEOMBase_NbIsosDlg(QAD_Application::getDesktop(), tr("GEOM_MEN_ISOS"), TRUE); + GEOMToolsGUI_NbIsosDlg * NbIsosDlg = + new GEOMToolsGUI_NbIsosDlg(QAD_Application::getDesktop(), tr("GEOM_MEN_ISOS"), TRUE); NbIsosDlg->SpinBoxU->setValue(IsoU.toInt()); NbIsosDlg->SpinBoxV->setValue(IsoV.toInt()); @@ -533,6 +532,9 @@ void GEOMToolsGUI::OnEditDelete() SALOMEDS::AttributeIOR_var anIOR; SALOME_ListIteratorOfListIO It(Sel->StoredIObjects()); + QAD_Operation* op = new SALOMEGUI_ImportOperation( QAD_Application::getDesktop()->getActiveStudy() ); + op->start(); + Standard_Boolean deleted = false; for(;It.More();It.Next()) { Handle(SALOME_InteractiveObject) IObject = It.Value(); if(IObject->hasEntry()) { @@ -598,15 +600,16 @@ void GEOMToolsGUI::OnEditDelete() /* Erase objects in Study */ SALOMEDS::SObject_var obj = aStudy->FindObjectID(IObject->getEntry()); if(!obj->_is_nil()) { - QAD_Operation* op = new SALOMEGUI_ImportOperation(QAD_Application::getDesktop()->getActiveStudy()); - op->start(); aStudyBuilder->RemoveObject(obj); - op->finish(); + deleted = true; } } /* IObject->hasEntry() */ } /* more/next */ + if (deleted) op->finish(); + else op->abort(); + /* Clear any previous selection */ Sel->ClearIObjects(); QAD_Application::getDesktop()->getActiveStudy()->updateObjBrowser(); @@ -742,11 +745,11 @@ bool GEOMToolsGUI::Import(int aState) anAttr = aStudyBuilder->FindOrCreateAttribute(father, "AttributePixMap"); aPixmap = SALOMEDS::AttributePixMap::_narrow(anAttr); aPixmap->SetPixMap( "ICON_OBJBROWSER_Geometry" ); + aStudyBuilder->DefineComponentInstance( father, myGeom ); if (aLocked) aStudy->GetProperties()->SetLocked(true); op->finish(); } // if (aLocked) return false; - aStudyBuilder->DefineComponentInstance( father, myGeom ); father->ComponentIOR(myGeomGUI->GetFatherior()); QString nameShape = QAD_Tools::getFileNameFromPath(file,false) + QString("_%1").arg(myGeomGUI->GetNbGeom()++); diff --git a/src/GEOMToolsGUI/GEOMToolsGUI_NbIsosDlg.cxx b/src/GEOMToolsGUI/GEOMToolsGUI_NbIsosDlg.cxx index 5ef80f650..842332015 100644 --- a/src/GEOMToolsGUI/GEOMToolsGUI_NbIsosDlg.cxx +++ b/src/GEOMToolsGUI/GEOMToolsGUI_NbIsosDlg.cxx @@ -21,7 +21,7 @@ // // // -// File : GEOMBase_NbIsosDlg.cxx +// File : GEOMToolsGUI_NbIsosDlg.cxx // Author : // Module : GEOM // $Header: @@ -37,17 +37,17 @@ using namespace std; #include //================================================================================= -// class : GEOMBase_NbIsosDlg() -// purpose : Constructs a GEOMBase_NbIsosDlg which is a child of 'parent', with the +// class : GEOMToolsGUI_NbIsosDlg() +// purpose : Constructs a GEOMToolsGUI_NbIsosDlg which is a child of 'parent', with the // name 'name' and widget flags set to 'f'. // The dialog will by default be modeless, unless you set 'modal' to // TRUE to construct a modal dialog. //================================================================================= -GEOMBase_NbIsosDlg::GEOMBase_NbIsosDlg(QWidget* parent, const char* name, bool modal, WFlags fl) +GEOMToolsGUI_NbIsosDlg::GEOMToolsGUI_NbIsosDlg(QWidget* parent, const char* name, bool modal, WFlags fl) :QDialog( parent, name, modal, WStyle_Customize | WStyle_NormalBorder | WStyle_Title | WStyle_SysMenu) { if( !name ) - setName("GEOMBase_NbIsosDlg"); + setName("GEOMToolsGUI_NbIsosDlg"); setCaption(name); setSizeGripEnabled(TRUE); QGridLayout* MyDialogLayout = new QGridLayout(this); @@ -122,10 +122,10 @@ GEOMBase_NbIsosDlg::GEOMBase_NbIsosDlg(QWidget* parent, const char* name, bool m //================================================================================= -// function : ~GEOMBase_NbIsosDlg() +// function : ~GEOMToolsGUI_NbIsosDlg() // purpose : Destroys the object and frees any allocated resources //================================================================================= -GEOMBase_NbIsosDlg::~GEOMBase_NbIsosDlg() +GEOMToolsGUI_NbIsosDlg::~GEOMToolsGUI_NbIsosDlg() { // no need to delete child widgets, Qt does it all for us } diff --git a/src/GEOMToolsGUI/GEOMToolsGUI_NbIsosDlg.h b/src/GEOMToolsGUI/GEOMToolsGUI_NbIsosDlg.h index 48c70c563..07e471200 100644 --- a/src/GEOMToolsGUI/GEOMToolsGUI_NbIsosDlg.h +++ b/src/GEOMToolsGUI/GEOMToolsGUI_NbIsosDlg.h @@ -21,13 +21,13 @@ // // // -// File : GEOMBase_NbIsosDlg.h +// File : GEOMToolsGUI_NbIsosDlg.h // Author : // Module : GEOM // $Header: -#ifndef GEOMBASE_NBISOSDLG_H -#define GEOMBASE_NBISOSDLG_H +#ifndef GEOMTOOLSGUI_NBISOSDLG_H +#define GEOMTOOLSGUI_NBISOSDLG_H #include @@ -36,16 +36,16 @@ class QSpinBox; class QPushButton; //================================================================================= -// class : GEOMBase_NbIsosDlg +// class : GEOMToolsGUI_NbIsosDlg // purpose : //================================================================================= -class GEOMBase_NbIsosDlg : public QDialog +class GEOMToolsGUI_NbIsosDlg : public QDialog { Q_OBJECT public: - GEOMBase_NbIsosDlg(QWidget* parent = 0, const char* name = 0, bool modal = FALSE, WFlags fl = 0); - ~GEOMBase_NbIsosDlg(); + GEOMToolsGUI_NbIsosDlg(QWidget* parent = 0, const char* name = 0, bool modal = FALSE, WFlags fl = 0); + ~GEOMToolsGUI_NbIsosDlg(); QPushButton* buttonOk; QPushButton* buttonCancel; @@ -56,4 +56,4 @@ public: }; -#endif // GEOMETRYGUI_NBISOSDLG_H +#endif // GEOMTOOLSGUI_NBISOSDLG_H diff --git a/src/GEOMToolsGUI/GEOMToolsGUI_TransparencyDlg.cxx b/src/GEOMToolsGUI/GEOMToolsGUI_TransparencyDlg.cxx index 6fab217a5..c524a0b3d 100644 --- a/src/GEOMToolsGUI/GEOMToolsGUI_TransparencyDlg.cxx +++ b/src/GEOMToolsGUI/GEOMToolsGUI_TransparencyDlg.cxx @@ -21,7 +21,7 @@ // // // -// File : GEOMBase_TransparencyDlg.cxx +// File : GEOMToolsGUI_TransparencyDlg.cxx // Author : Lucien PIGNOLONI // Module : GEOM @@ -30,6 +30,7 @@ using namespace std; #include "QAD_RightFrame.h" #include "SALOME_ListIteratorOfListIO.hxx" +#include "OCCViewer_Viewer3d.h" #include #include @@ -47,24 +48,24 @@ using namespace std; #include "VTKViewer_RenderWindowInteractor.h" //================================================================================= -// class : GEOMBase_TransparencyDlg() +// class : GEOMToolsGUI_TransparencyDlg() // purpose : Constructs a GEOMBase_SUBSHAPE which is a child of 'parent', with the // name 'name' and widget flags set to 'f'. // // : WARNING : this dialog is modal ! // //================================================================================= -GEOMBase_TransparencyDlg::GEOMBase_TransparencyDlg(QWidget* parent, const char* name, SALOME_Selection* Sel, const Handle(AIS_InteractiveContext)& ic, bool modal, WFlags fl) +GEOMToolsGUI_TransparencyDlg::GEOMToolsGUI_TransparencyDlg(QWidget* parent, const char* name, SALOME_Selection* Sel, const Handle(AIS_InteractiveContext)& ic, bool modal, WFlags fl) :QDialog(parent, name, modal, WStyle_Customize | WStyle_NormalBorder | WStyle_Title | WStyle_SysMenu) { if(!name) - setName("GEOMBase_TransparencyDlg"); + setName("GEOMToolsGUI_TransparencyDlg"); resize(152, 107); setCaption(tr("GEOM_TRANSPARENCY_TITLE")); setSizeGripEnabled(TRUE); - GEOMBase_TransparencyDlgLayout = new QGridLayout(this); - GEOMBase_TransparencyDlgLayout->setSpacing(6); - GEOMBase_TransparencyDlgLayout->setMargin(11); + GEOMToolsGUI_TransparencyDlgLayout = new QGridLayout(this); + GEOMToolsGUI_TransparencyDlgLayout->setSpacing(6); + GEOMToolsGUI_TransparencyDlgLayout->setMargin(11); /*************************************************************************/ QGroupBox* GroupButtons = new QGroupBox( this, "GroupButtons" ); @@ -111,8 +112,8 @@ GEOMBase_TransparencyDlg::GEOMBase_TransparencyDlg(QWidget* parent, const char* GroupC1Layout->addMultiCellWidget( Slider1, 1, 1, 0, 2 ); /*************************************************************************/ - GEOMBase_TransparencyDlgLayout->addWidget(GroupC1, 0, 0); - GEOMBase_TransparencyDlgLayout->addWidget(GroupButtons, 1, 0); + GEOMToolsGUI_TransparencyDlgLayout->addWidget(GroupC1, 0, 0); + GEOMToolsGUI_TransparencyDlgLayout->addWidget(GroupButtons, 1, 0); /* Initialisations */ this->myGeomGUI = GEOMContext::GetGeomGUI(); @@ -140,10 +141,10 @@ GEOMBase_TransparencyDlg::GEOMBase_TransparencyDlg(QWidget* parent, const char* //================================================================================= -// function : ~GEOMBase_TransparencyDlg() +// function : ~GEOMToolsGUI_TransparencyDlg() // purpose : //================================================================================= -GEOMBase_TransparencyDlg::~GEOMBase_TransparencyDlg() +GEOMToolsGUI_TransparencyDlg::~GEOMToolsGUI_TransparencyDlg() { // no need to delete child widgets, Qt does it all for us } @@ -153,7 +154,7 @@ GEOMBase_TransparencyDlg::~GEOMBase_TransparencyDlg() // function : ClickOnOk() // purpose : //======================================================================= -void GEOMBase_TransparencyDlg::ClickOnOk() +void GEOMToolsGUI_TransparencyDlg::ClickOnOk() { accept(); return; @@ -164,7 +165,7 @@ void GEOMBase_TransparencyDlg::ClickOnOk() // function : ClickOnClose() // purpose : //======================================================================= -void GEOMBase_TransparencyDlg::ClickOnClose() +void GEOMToolsGUI_TransparencyDlg::ClickOnClose() { accept(); return; @@ -176,7 +177,7 @@ void GEOMBase_TransparencyDlg::ClickOnClose() // purpose : Called when value of slider change // : or the first time as initilisation //================================================================================= -void GEOMBase_TransparencyDlg::ValueHasChanged(int newValue) +void GEOMToolsGUI_TransparencyDlg::ValueHasChanged(int newValue) { if(QAD_Application::getDesktop()->getActiveStudy()->getActiveStudyFrame()->getTypeView() == VIEW_VTK) { // VTK @@ -221,6 +222,8 @@ void GEOMBase_TransparencyDlg::ValueHasChanged(int newValue) } QApplication::setOverrideCursor(Qt::waitCursor); + OCCViewer_Viewer3d* v3d = ((OCCViewer_ViewFrame*)QAD_Application::getDesktop()->getActiveStudy()->getActiveStudyFrame()->getRightFrame()->getViewFrame())->getViewer(); + Handle (AIS_InteractiveContext) ic = v3d->getAISContext(); for(;It.More(); It.Next()) { Handle(SALOME_InteractiveObject) IObject = It.Value(); Standard_Boolean found; @@ -229,10 +232,10 @@ void GEOMBase_TransparencyDlg::ValueHasChanged(int newValue) QApplication::restoreOverrideCursor(); return; } - this->myIc->SetTransparency(Shape, newValue / 10.0, false); - myIc->Redisplay(Shape, Standard_False, Standard_True); + ic->SetTransparency(Shape, newValue / 10.0, false); + ic->Redisplay(Shape, Standard_False, Standard_True); } - myIc->UpdateCurrentViewer(); + ic->UpdateCurrentViewer(); } QApplication::restoreOverrideCursor(); return; diff --git a/src/GEOMToolsGUI/GEOMToolsGUI_TransparencyDlg.h b/src/GEOMToolsGUI/GEOMToolsGUI_TransparencyDlg.h index fbcc4efcd..8ae122d1b 100644 --- a/src/GEOMToolsGUI/GEOMToolsGUI_TransparencyDlg.h +++ b/src/GEOMToolsGUI/GEOMToolsGUI_TransparencyDlg.h @@ -21,7 +21,7 @@ // // // -// File : GEOMBase_TransparencyDlg.h +// File : GEOMToolsGUI_TransparencyDlg.h // Author : Lucien PIGNOLONI // Module : GEOM // $Header$ @@ -51,23 +51,23 @@ class QSlider; //================================================================================= -// class : GEOMBase_TransparencyDlg +// class : GEOMToolsGUI_TransparencyDlg // purpose : // : WARNING : that is a MODAL dialog. //================================================================================= -class GEOMBase_TransparencyDlg : public QDialog +class GEOMToolsGUI_TransparencyDlg : public QDialog { Q_OBJECT public: - GEOMBase_TransparencyDlg( QWidget* parent = 0, + GEOMToolsGUI_TransparencyDlg( QWidget* parent = 0, const char* name = 0, SALOME_Selection* Sel = 0, const Handle(AIS_InteractiveContext)& ic = 0, bool modal = TRUE, WFlags fl = 0 ); - ~GEOMBase_TransparencyDlg(); + ~GEOMToolsGUI_TransparencyDlg(); private : @@ -89,7 +89,7 @@ public slots: void ValueHasChanged( int newValue ) ; protected: - QGridLayout* GEOMBase_TransparencyDlgLayout; + QGridLayout* GEOMToolsGUI_TransparencyDlgLayout; QHBoxLayout* Layout1; QHBoxLayout* Layout2; }; diff --git a/src/GEOMToolsGUI/Makefile.in b/src/GEOMToolsGUI/Makefile.in index 95cc8b8f8..45aae6e3a 100644 --- a/src/GEOMToolsGUI/Makefile.in +++ b/src/GEOMToolsGUI/Makefile.in @@ -49,7 +49,7 @@ LIB_MOC = \ GEOMToolsGUI_NbIsosDlg.h \ GEOMToolsGUI_TransparencyDlg.h -LIB_CLIENT_IDL = SALOMEDS_Attributes.idl +LIB_CLIENT_IDL = SALOMEDS_Attributes.idl GEOM_Kinematic.idl LIB_SERVER_IDL = diff --git a/src/GEOM_SWIG/Makefile.in b/src/GEOM_SWIG/Makefile.in index 6ea27169e..5984c7dce 100644 --- a/src/GEOM_SWIG/Makefile.in +++ b/src/GEOM_SWIG/Makefile.in @@ -58,6 +58,7 @@ LIB_CLIENT_IDL = SALOMEDS.idl \ SALOME_Exception.idl \ GEOM_Gen.idl \ GEOM_Shape.idl \ + GEOM_Kinematic.idl \ SALOME_Component.idl EXPORT_SHAREDPYSCRIPTS=\ diff --git a/src/GEOM_SWIG/geompy.py b/src/GEOM_SWIG/geompy.py index 1e74b2938..4cfc0184f 100644 --- a/src/GEOM_SWIG/geompy.py +++ b/src/GEOM_SWIG/geompy.py @@ -115,7 +115,7 @@ def addToStudy(aShape, aName): #NRI : BugID 1682 : sg = SALOMEGUI_Swig() #NRI : BugID 1682 : sg.updateObjBrowser(0) - salome.sg.updateObjBrowser(0) +# salome.sg.updateObjBrowser(0) return id def addToStudyInFather(aFather, aShape, aName): @@ -141,7 +141,7 @@ def addToStudyInFather(aFather, aShape, aName): addArguments( aShape ) #NRI : BugID 1682 : sg.updateObjBrowser(0) - salome.sg.updateObjBrowser(0) +# salome.sg.updateObjBrowser(0) return id # ----------------------------------------------------------------------------- diff --git a/src/GenerationGUI/Makefile.in b/src/GenerationGUI/Makefile.in index 06eb796c0..f0da705f0 100644 --- a/src/GenerationGUI/Makefile.in +++ b/src/GenerationGUI/Makefile.in @@ -53,7 +53,7 @@ LIB_MOC = \ GenerationGUI_FillingDlg.h \ GenerationGUI_PipeDlg.h -LIB_CLIENT_IDL = +LIB_CLIENT_IDL = GEOM_Kinematic.idl LIB_SERVER_IDL = diff --git a/src/KINEMATIC/Kinematic_Animation.cxx b/src/KINEMATIC/Kinematic_Animation.cxx new file mode 100644 index 000000000..4b397f5f1 --- /dev/null +++ b/src/KINEMATIC/Kinematic_Animation.cxx @@ -0,0 +1,240 @@ +// GEOM KINEMATIC +// +// Copyright (C) 2003 OPEN CASCADE, EADS/CCR, LIP6, CEA/DEN, +// CEDRAT, EDF R&D, LEG, PRINCIPIA R&D, BUREAU VERITAS +// +// This library is free software; you can redistribute it and/or +// modify it under the terms of the GNU Lesser General Public +// License as published by the Free Software Foundation; either +// version 2.1 of the License. +// +// This library is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU +// Lesser General Public License for more details. +// +// You should have received a copy of the GNU Lesser General Public +// License along with this library; if not, write to the Free Software +// Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307 USA +// +// See http://www.opencascade.org/SALOME/ or email : webmaster.salome@opencascade.org +// +// +// +// File : Kinematic_Animation.cxx +// Author : Damien COQUERET +// Module : GEOM +// $Header: + +using namespace std; +#include "Kinematic_Animation.hxx" + +#include +#include +#include + +//======================================================================= +// profile +// command to build a profile +//======================================================================= +Kinematic_Animation::Kinematic_Animation(){} + + +//======================================================================= +// profile +// command to build a profile +//======================================================================= +Kinematic_Animation::Kinematic_Animation(Kinematic_Assembly* Ass, TopoDS_Shape frame, + double duration, int nbseq, bool isinloop) +{ + myAss = Ass; + myFrame = frame; + myDuration = duration; + myNbSeq = nbseq; + myIsInLoop = isinloop; + IsCreated = false; + myNbAIS = 1; + this->SetMap(); + + return; +} + + +//================================================================================= +// function : ~Kinematic_Animation() +// purpose : Destroys the object and frees any allocated resources +//================================================================================= +Kinematic_Animation::~Kinematic_Animation() {} + + +//================================================================================= +// function : SetMap() +// purpose : +//================================================================================= +void Kinematic_Animation::SetMap() +{ + list ContactList = myAss->GetContactList(); + Kinematic_Contact* aContact; + + list ::const_iterator it = ContactList.begin(); + while(it != ContactList.end()) { + aContact = *it; + if(!myIndexToShape.Contains(aContact->Shape1())) + myIndexToShape.Add(aContact->Shape1()); + + if(!myIndexToShape.Contains(aContact->Shape2())) + myIndexToShape.Add(aContact->Shape2()); + + it++; + } + + for(int i = 1; i <= myIndexToShape.Extent(); i++) { + it = ContactList.begin(); + list ContactListOfShape; + TopoDS_Shape myShape = myIndexToShape.FindKey(i); + while(it != ContactList.end()) { + aContact = *it; + if(myShape == aContact->Shape1() || myShape == aContact->Shape2()) + ContactListOfShape.push_back(aContact); + it++; + } + myStlMapofShapeListOfContact[i] = ContactListOfShape; + } + + return; +} + + +//================================================================================= +// function : Animate() +// purpose : +//================================================================================= +void Kinematic_Animation::Animate(const Handle(AIS_InteractiveContext)& ic) +{ + bool IsOk = false; + for(int cpt = 1; cpt <= myIndexToShape.Extent(); cpt++) { + TopoDS_Shape myShape = myIndexToShape.FindKey(cpt); + if(myShape == myFrame) + IsOk = true; + } + if(!IsOk) + return; + + myMovedShape.Clear(); + myMovedShape.Add(myFrame); + + IsCreated = false; + gp_Trsf aLoc; + GetNextShape(ic, aLoc, myFrame, 1); + IsCreated = true; + + Handle(AIS_Shape) mySimulationShape; + mySimulationShape = new AIS_Shape(TopoDS_Shape()); + mySimulationShape->Set(myFrame); + mySimulationShape->SetColor(Quantity_NOC_RED); + ic->Deactivate(mySimulationShape); + ic->Display(mySimulationShape, Standard_False); + ic->UpdateCurrentViewer(); + + double Step, Val; + Step = 1.0 / myNbSeq; + for(int i = 0; i <= myNbSeq; i++) { + Val = i * Step; + + myMovedShape.Clear(); + myMovedShape.Add(myFrame); + + myNbAIS = 1; + GetNextShape(ic, aLoc, myFrame, Val); + + ic->UpdateCurrentViewer(); + usleep(myDuration / myNbSeq * 1e6); + } + + ic->Erase(mySimulationShape, Standard_True, Standard_False); + ic->ClearPrs(mySimulationShape); + + for(int i = 1; i <= myNbAIS; i++) { + Handle(AIS_Shape) myShape = Handle(AIS_Shape)::DownCast(ListOfAIS.Value(i)); + ic->Erase(myShape, Standard_True, Standard_False); + ic->ClearPrs(myShape); + } + + ic->UpdateCurrentViewer(); + + return; +} + + +//================================================================================= +// function : GetNextShape() +// purpose : +//================================================================================= +void Kinematic_Animation::GetNextShape(const Handle(AIS_InteractiveContext)& ic, + gp_Trsf& aLoc, TopoDS_Shape Shape1, double Step) +{ + int j = 0; + list ContactListOfShape; + Kinematic_Contact* aContact; + TopoDS_Shape myShape, myShape2, aNewShape; + + for(int i = 1; i <= myIndexToShape.Extent(); i++) { + myShape = myIndexToShape.FindKey(i); + if(myShape == Shape1) { + gp_Trsf aNewLoc = aLoc; + ContactListOfShape = myStlMapofShapeListOfContact[i]; + list ::const_iterator it = ContactListOfShape.begin(); + while(it != ContactListOfShape.end()) { + aContact = *it; + if(aContact->Shape1() == Shape1) + myShape2 = aContact->Shape2(); + else if(aContact->Shape2() == Shape1) + myShape2 = aContact->Shape1(); + + if(!myMovedShape.Contains(myShape2)) { + myMovedShape.Add(myShape2); + + if(!IsCreated) { + Handle(AIS_Shape) mySimulationShape; + mySimulationShape = new AIS_Shape(TopoDS_Shape()); + mySimulationShape->Set(myShape2); + mySimulationShape->SetColor(Quantity_NOC_GREEN); + ic->Deactivate(mySimulationShape); + ListOfAIS.Append(mySimulationShape); + } + else + MoveShape(ic, aLoc, aContact, Step); + + GetNextShape(ic, aLoc, myShape2, Step); + } + aLoc = aNewLoc; + it++; + } + return; + } + } + return; +} + + +//================================================================================= +// function : CreateShape() +// purpose : +//================================================================================= +void Kinematic_Animation::MoveShape(const Handle(AIS_InteractiveContext)& ic, + gp_Trsf& aLoc, Kinematic_Contact* aContact, + double Step) +{ + gp_Trsf aTrans = aContact->GetTransformation(Step); + aLoc = aLoc * aTrans; + + Handle(AIS_Shape) mySimulationShape = Handle(AIS_Shape)::DownCast(ListOfAIS.Value(myNbAIS)); + Handle(Geom_Transformation) aGTrans = new Geom_Transformation(); + aGTrans->SetTrsf(aLoc); + mySimulationShape->SetTransformation(aGTrans, false, false); + + ic->Display(mySimulationShape, Standard_False); + + myNbAIS++; + return; +} diff --git a/src/KINEMATIC/Kinematic_Animation.hxx b/src/KINEMATIC/Kinematic_Animation.hxx new file mode 100644 index 000000000..8bac2acc6 --- /dev/null +++ b/src/KINEMATIC/Kinematic_Animation.hxx @@ -0,0 +1,80 @@ +// GEOM KINEMATIC +// +// Copyright (C) 2003 OPEN CASCADE, EADS/CCR, LIP6, CEA/DEN, +// CEDRAT, EDF R&D, LEG, PRINCIPIA R&D, BUREAU VERITAS +// +// This library is free software; you can redistribute it and/or +// modify it under the terms of the GNU Lesser General Public +// License as published by the Free Software Foundation; either +// version 2.1 of the License. +// +// This library is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU +// Lesser General Public License for more details. +// +// You should have received a copy of the GNU Lesser General Public +// License along with this library; if not, write to the Free Software +// Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307 USA +// +// See http://www.opencascade.org/SALOME/ or email : webmaster.salome@opencascade.org +// +// +// +// File : Kinematic_Animation.hxx +// Author : Damien COQUERET +// Module : GEOM +// $Header: + +#ifndef _KINEMATIC_ANIMATION_HXX +#define _KINEMATIC_ANIMATION_HXX + +#include "Kinematic_Assembly.hxx" + +#include +#include +#include +#include +#include + +#include +#include + +class Kinematic_Animation +{ +public: + Kinematic_Animation(); + Kinematic_Animation(Kinematic_Assembly* Ass, TopoDS_Shape frame, + double duration, int nbseq, bool isinloop); + ~Kinematic_Animation(); + +private: + AIS_SequenceOfInteractive ListOfAIS; + TopTools_IndexedMapOfShape myIndexToShape; + TopTools_IndexedMapOfShape myMovedShape; + map > myStlMapofShapeListOfContact; + Kinematic_Assembly* myAss; + TopoDS_Shape myFrame; + double myDuration; + int myNbSeq; + int myNbAIS; + bool myIsInLoop; + bool IsCreated; + +public: + void SetMap(); + void Animate(const Handle(AIS_InteractiveContext)& ic); + void GetNextShape(const Handle (AIS_InteractiveContext)& ic, + gp_Trsf& aLoc, TopoDS_Shape Shape1, double Step); + void MoveShape(const Handle(AIS_InteractiveContext)& ic, + gp_Trsf& aLoc, Kinematic_Contact* aContact, + double Step); + + TopoDS_Shape& Frame(){return myFrame;}; + double& Duration(){return myDuration;}; + int& NbSeq(){return myNbSeq;}; + bool& IsInLoop(){return myIsInLoop;}; + +}; + +#endif diff --git a/src/KINEMATIC/Kinematic_Assembly.cxx b/src/KINEMATIC/Kinematic_Assembly.cxx new file mode 100644 index 000000000..461630481 --- /dev/null +++ b/src/KINEMATIC/Kinematic_Assembly.cxx @@ -0,0 +1,69 @@ +// GEOM KINEMATIC +// +// Copyright (C) 2003 OPEN CASCADE, EADS/CCR, LIP6, CEA/DEN, +// CEDRAT, EDF R&D, LEG, PRINCIPIA R&D, BUREAU VERITAS +// +// This library is free software; you can redistribute it and/or +// modify it under the terms of the GNU Lesser General Public +// License as published by the Free Software Foundation; either +// version 2.1 of the License. +// +// This library is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU +// Lesser General Public License for more details. +// +// You should have received a copy of the GNU Lesser General Public +// License along with this library; if not, write to the Free Software +// Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307 USA +// +// See http://www.opencascade.org/SALOME/ or email : webmaster.salome@opencascade.org +// +// +// +// File : Kinematic_Assembly.cxx +// Author : Damien COQUERET +// Module : GEOM +// $Header: + +using namespace std; +#include "Kinematic_Assembly.hxx" + + +//======================================================================= +// profile +// command to build a profile +//======================================================================= +Kinematic_Assembly::Kinematic_Assembly() +{ + +} + + +//================================================================================= +// function : ~Kinematic_Assembly() +// purpose : Destroys the object and frees any allocated resources +//================================================================================= +Kinematic_Assembly::~Kinematic_Assembly() +{ +} + + +//================================================================================= +// function : GetContactList() +// purpose : +//================================================================================= +list Kinematic_Assembly::GetContactList() +{ + return ContactList; +} + + +//================================================================================= +// function : AddContact() +// purpose : +//================================================================================= +void Kinematic_Assembly::AddContact(Kinematic_Contact* aContact) +{ + ContactList.push_back(aContact); +} diff --git a/src/KINEMATIC/Kinematic_Assembly.hxx b/src/KINEMATIC/Kinematic_Assembly.hxx new file mode 100644 index 000000000..ecd5d047f --- /dev/null +++ b/src/KINEMATIC/Kinematic_Assembly.hxx @@ -0,0 +1,52 @@ +// GEOM KINEMATIC +// +// Copyright (C) 2003 OPEN CASCADE, EADS/CCR, LIP6, CEA/DEN, +// CEDRAT, EDF R&D, LEG, PRINCIPIA R&D, BUREAU VERITAS +// +// This library is free software; you can redistribute it and/or +// modify it under the terms of the GNU Lesser General Public +// License as published by the Free Software Foundation; either +// version 2.1 of the License. +// +// This library is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU +// Lesser General Public License for more details. +// +// You should have received a copy of the GNU Lesser General Public +// License along with this library; if not, write to the Free Software +// Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307 USA +// +// See http://www.opencascade.org/SALOME/ or email : webmaster.salome@opencascade.org +// +// +// +// File : Kinematic_Assembly.hxx +// Author : Damien COQUERET +// Module : GEOM +// $Header: + +#ifndef _KINEMATIC_ASSEMBLY_HXX +#define _KINEMATIC_ASSEMBLY_HXX + +#include "Kinematic_Contact.hxx" + +#include + +class Kinematic_Assembly +{ + +public: + Kinematic_Assembly(); + ~Kinematic_Assembly(); + +private: + list ContactList; + +public: + list GetContactList(); + void AddContact(Kinematic_Contact* aContact); + +}; + +#endif diff --git a/src/KINEMATIC/Kinematic_Contact.cxx b/src/KINEMATIC/Kinematic_Contact.cxx new file mode 100644 index 000000000..e4c8cebe4 --- /dev/null +++ b/src/KINEMATIC/Kinematic_Contact.cxx @@ -0,0 +1,133 @@ +// GEOM KINEMATIC +// +// Copyright (C) 2003 OPEN CASCADE, EADS/CCR, LIP6, CEA/DEN, +// CEDRAT, EDF R&D, LEG, PRINCIPIA R&D, BUREAU VERITAS +// +// This library is free software; you can redistribute it and/or +// modify it under the terms of the GNU Lesser General Public +// License as published by the Free Software Foundation; either +// version 2.1 of the License. +// +// This library is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU +// Lesser General Public License for more details. +// +// You should have received a copy of the GNU Lesser General Public +// License along with this library; if not, write to the Free Software +// Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307 USA +// +// See http://www.opencascade.org/SALOME/ or email : webmaster.salome@opencascade.org +// +// +// +// File : Kinematic_Contact.cxx +// Author : Damien COQUERET +// Module : GEOM +// $Header: + +using namespace std; +#include "Kinematic_Contact.hxx" + +//======================================================================= +// profile +// command to build a profile +//======================================================================= +Kinematic_Contact::Kinematic_Contact(){} + + +//======================================================================= +// profile +// command to build a profile +//======================================================================= +Kinematic_Contact::Kinematic_Contact(TopoDS_Shape Shape1, TopoDS_Shape Shape2, + int type, double step) +{ + myType = type; + myShape1 = Shape1; + myShape2 = Shape2; + myStep = step; + + gp_Pnt Origin(0, 0, 0); + gp_Dir DirX(1, 0, 0); + gp_Dir DirY(0, 1, 0); + gp_Dir DirZ(0, 0, 1); + + Kinematic_Position Pos(Origin, DirX, DirY, DirZ); + Kinematic_Rotation Rot(1, 2, 3, 0, 0, 0); + Kinematic_Translation Trans(0, 0, 0); + + myPosition = Pos; + myRotation = Rot; + myTranslation = Trans; +} + + +//================================================================================= +// function : ~Kinematic_Contact() +// purpose : Destroys the object and frees any allocated resources +//================================================================================= +Kinematic_Contact::~Kinematic_Contact() {} + + +//================================================================================= +// function : GetTransformation() +// purpose : +//================================================================================= +gp_Trsf Kinematic_Contact::GetTransformation(double Step) +{ + gp_Vec aVect; + gp_Trsf aTransformation, aRot, aRot1, aRot2, aRot3; + + aVect.SetCoord(Step * myTranslation.ValX(), Step * myTranslation.ValY(), Step * myTranslation.ValZ()); + aTransformation.SetTranslation(aVect); + + if(myRotation.Rot1() == 1) { //Axe X + aRot1.SetRotation(myPosition.AxeX(), Step * myRotation.ValX() * PI / 180); + if(myRotation.Rot2() == 2) { + aRot2.SetRotation(myPosition.AxeY(), Step * myRotation.ValY() * PI / 180); + aRot3.SetRotation(myPosition.AxeZ(), Step * myRotation.ValZ() * PI / 180); + } else { + aRot2.SetRotation(myPosition.AxeZ(), Step * myRotation.ValZ() * PI / 180); + aRot3.SetRotation(myPosition.AxeY(), Step * myRotation.ValY() * PI / 180); + } + } else if(myRotation.Rot1() == 2) { //Axe Y + aRot1.SetRotation(myPosition.AxeY(), Step * myRotation.ValY() * PI / 180); + if(myRotation.Rot2() == 1) { + aRot2.SetRotation(myPosition.AxeX(), Step * myRotation.ValX() * PI / 180); + aRot3.SetRotation(myPosition.AxeZ(), Step * myRotation.ValZ() * PI / 180); + } else { + aRot2.SetRotation(myPosition.AxeZ(), Step * myRotation.ValZ() * PI / 180); + aRot3.SetRotation(myPosition.AxeX(), Step * myRotation.ValX() * PI / 180); + } + } else if(myRotation.Rot1() == 3) { //Axe Z + aRot1.SetRotation(myPosition.AxeZ(), Step * myRotation.ValZ() * PI / 180); + if(myRotation.Rot2() == 1) { + aRot2.SetRotation(myPosition.AxeX(), Step * myRotation.ValX() * PI / 180); + aRot3.SetRotation(myPosition.AxeY(), Step * myRotation.ValY() * PI / 180); + } else { + aRot2.SetRotation(myPosition.AxeY(), Step * myRotation.ValY() * PI / 180); + aRot3.SetRotation(myPosition.AxeX(), Step * myRotation.ValX() * PI / 180); + } + } + + aRot = aRot1 * aRot2 * aRot3; + aTransformation = aTransformation * aRot; + + return aTransformation; +} + + +//================================================================================= +// function : GetLocation() +// purpose : +//================================================================================= +TopLoc_Location Kinematic_Contact::GetLocation() +{ + gp_Trsf aTrans; + + aTrans.SetTransformation(myPosition.Axe3()); + TopLoc_Location aLoc(aTrans); + + return aLoc; +} diff --git a/src/KINEMATIC/Kinematic_Contact.hxx b/src/KINEMATIC/Kinematic_Contact.hxx new file mode 100644 index 000000000..ac5678e52 --- /dev/null +++ b/src/KINEMATIC/Kinematic_Contact.hxx @@ -0,0 +1,80 @@ +// GEOM KINEMATIC +// +// Copyright (C) 2003 OPEN CASCADE, EADS/CCR, LIP6, CEA/DEN, +// CEDRAT, EDF R&D, LEG, PRINCIPIA R&D, BUREAU VERITAS +// +// This library is free software; you can redistribute it and/or +// modify it under the terms of the GNU Lesser General Public +// License as published by the Free Software Foundation; either +// version 2.1 of the License. +// +// This library is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU +// Lesser General Public License for more details. +// +// You should have received a copy of the GNU Lesser General Public +// License along with this library; if not, write to the Free Software +// Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307 USA +// +// See http://www.opencascade.org/SALOME/ or email : webmaster.salome@opencascade.org +// +// +// +// File : Kinematic_Contact.hxx +// Author : Damien COQUERET +// Module : GEOM +// $Header: + +#ifndef _KINEMATIC_CONTACT_HXX +#define _KINEMATIC_CONTACT_HXX + +#include +#include +#include +#include + +#include "Kinematic_Position.hxx" +#include "Kinematic_Rotation.hxx" +#include "Kinematic_Translation.hxx" + +class Kinematic_Contact +{ +public: + Kinematic_Contact(); + Kinematic_Contact(TopoDS_Shape Shape1, TopoDS_Shape Shape2, + int type, double step); + ~Kinematic_Contact(); + +private: + int myType; + TopoDS_Shape myShape1; + TopoDS_Shape myShape2; + double myStep; + Kinematic_Position myPosition; + Kinematic_Rotation myRotation; + Kinematic_Translation myTranslation; + +public: + gp_Trsf GetTransformation(double Step = 1); + TopLoc_Location GetLocation(); + + void Type(int Type){myType = Type;}; + void Shape1(TopoDS_Shape Shape1){myShape1 = Shape1;}; + void Shape2(TopoDS_Shape Shape2){myShape2 = Shape2;}; + void Step(double Step){myStep = Step;}; + void Position(Kinematic_Position& Position){myPosition = Position;}; + void Rotation(Kinematic_Rotation& Rotation){myRotation = Rotation;}; + void Translation(Kinematic_Translation& Translation){myTranslation = Translation;}; + + int& Type(){return myType;}; + TopoDS_Shape& Shape1(){return myShape1;}; + TopoDS_Shape& Shape2(){return myShape2;}; + double& Step(){return myStep;}; + Kinematic_Position& Position(){return myPosition;}; + Kinematic_Rotation& Rotation(){return myRotation;}; + Kinematic_Translation& Translation(){return myTranslation;}; + +}; + +#endif diff --git a/src/KINEMATIC/Kinematic_Position.cxx b/src/KINEMATIC/Kinematic_Position.cxx new file mode 100644 index 000000000..926fd2e67 --- /dev/null +++ b/src/KINEMATIC/Kinematic_Position.cxx @@ -0,0 +1,107 @@ +// GEOM KINEMATIC +// +// Copyright (C) 2003 OPEN CASCADE, EADS/CCR, LIP6, CEA/DEN, +// CEDRAT, EDF R&D, LEG, PRINCIPIA R&D, BUREAU VERITAS +// +// This library is free software; you can redistribute it and/or +// modify it under the terms of the GNU Lesser General Public +// License as published by the Free Software Foundation; either +// version 2.1 of the License. +// +// This library is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU +// Lesser General Public License for more details. +// +// You should have received a copy of the GNU Lesser General Public +// License along with this library; if not, write to the Free Software +// Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307 USA +// +// See http://www.opencascade.org/SALOME/ or email : webmaster.salome@opencascade.org +// +// +// +// File : Kinematic_Position.cxx +// Author : Damien COQUERET +// Module : GEOM +// $Header: + +using namespace std; +#include "Kinematic_Position.hxx" + + +//======================================================================= +// profile +// command to build a profile +//======================================================================= +Kinematic_Position::Kinematic_Position(){} + + +//======================================================================= +// profile +// command to build a profile +//======================================================================= +Kinematic_Position::Kinematic_Position(gp_Pnt Origin, gp_Dir DirX, gp_Dir DirY, gp_Dir DirZ) +{ + myOrigin = Origin; + myDirX = DirX; + myDirY = DirY; + myDirZ = DirZ; +} + + +//================================================================================= +// function : ~Kinematic_Position() +// purpose : Destroys the object and frees any allocated resources +//================================================================================= +Kinematic_Position::~Kinematic_Position() {} + + +//================================================================================= +// function : AxeX() +// purpose : +//================================================================================= +gp_Ax1 Kinematic_Position::AxeX() +{ + gp_Ax1 anAxe; + anAxe.SetLocation(myOrigin); + anAxe.SetDirection(myDirX); + return anAxe; +} + + +//================================================================================= +// function : AxeY() +// purpose : +//================================================================================= +gp_Ax1 Kinematic_Position::AxeY() +{ + gp_Ax1 anAxe; + anAxe.SetLocation(myOrigin); + anAxe.SetDirection(myDirY); + return anAxe; +} + + +//================================================================================= +// function : AxeZ() +// purpose : +//================================================================================= +gp_Ax1 Kinematic_Position::AxeZ() +{ + gp_Ax1 anAxe; + anAxe.SetLocation(myOrigin); + anAxe.SetDirection(myDirZ); + return anAxe; +} + + +//================================================================================= +// function : Axe3() +// purpose : +//================================================================================= +gp_Ax3 Kinematic_Position::Axe3() +{ + gp_Ax3 anAxe3(myOrigin, myDirZ, myDirX); + return anAxe3; +} diff --git a/src/KINEMATIC/Kinematic_Position.hxx b/src/KINEMATIC/Kinematic_Position.hxx new file mode 100644 index 000000000..b03fd9a1e --- /dev/null +++ b/src/KINEMATIC/Kinematic_Position.hxx @@ -0,0 +1,70 @@ +// GEOM KINEMATIC +// +// Copyright (C) 2003 OPEN CASCADE, EADS/CCR, LIP6, CEA/DEN, +// CEDRAT, EDF R&D, LEG, PRINCIPIA R&D, BUREAU VERITAS +// +// This library is free software; you can redistribute it and/or +// modify it under the terms of the GNU Lesser General Public +// License as published by the Free Software Foundation; either +// version 2.1 of the License. +// +// This library is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU +// Lesser General Public License for more details. +// +// You should have received a copy of the GNU Lesser General Public +// License along with this library; if not, write to the Free Software +// Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307 USA +// +// See http://www.opencascade.org/SALOME/ or email : webmaster.salome@opencascade.org +// +// +// +// File : Kinematic_Position.hxx +// Author : Damien COQUERET +// Module : GEOM +// $Header: + +#ifndef _KINEMATIC_POSITION_HXX +#define _KINEMATIC_POSITION_HXX + +#include +#include +#include +#include +#include + +class Kinematic_Position +{ +public: + Kinematic_Position(); + Kinematic_Position(gp_Pnt Origin, gp_Dir DirX, gp_Dir DirY, gp_Dir DirZ); + ~Kinematic_Position(); + +private: + gp_Pnt myOrigin; + gp_Dir myDirX; + gp_Dir myDirY; + gp_Dir myDirZ; + +public: + void Origin(const gp_Pnt& Origin){myOrigin = Origin;}; + void DirX(const gp_Dir& DirX){myDirX = DirX;}; + void DirY(const gp_Dir& DirY){myDirY = DirY;}; + void DirZ(const gp_Dir& DirZ){myDirZ = DirZ;}; + + gp_Pnt& Origin(){return myOrigin;}; + gp_Dir& DirX(){return myDirX;}; + gp_Dir& DirY(){return myDirY;}; + gp_Dir& DirZ(){return myDirZ;}; + + gp_Ax1 AxeX(); + gp_Ax1 AxeY(); + gp_Ax1 AxeZ(); + + gp_Ax3 Axe3(); + +}; + +#endif diff --git a/src/KINEMATIC/Kinematic_Rotation.cxx b/src/KINEMATIC/Kinematic_Rotation.cxx new file mode 100644 index 000000000..6a789555a --- /dev/null +++ b/src/KINEMATIC/Kinematic_Rotation.cxx @@ -0,0 +1,60 @@ +// GEOM KINEMATIC +// +// Copyright (C) 2003 OPEN CASCADE, EADS/CCR, LIP6, CEA/DEN, +// CEDRAT, EDF R&D, LEG, PRINCIPIA R&D, BUREAU VERITAS +// +// This library is free software; you can redistribute it and/or +// modify it under the terms of the GNU Lesser General Public +// License as published by the Free Software Foundation; either +// version 2.1 of the License. +// +// This library is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU +// Lesser General Public License for more details. +// +// You should have received a copy of the GNU Lesser General Public +// License along with this library; if not, write to the Free Software +// Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307 USA +// +// See http://www.opencascade.org/SALOME/ or email : webmaster.salome@opencascade.org +// +// +// +// File : Kinematic_Rotation.cxx +// Author : Damien COQUERET +// Module : GEOM +// $Header: + +using namespace std; +#include "Kinematic_Rotation.hxx" + + +//======================================================================= +// profile +// command to build a profile +//======================================================================= +Kinematic_Rotation::Kinematic_Rotation(){} + + +//======================================================================= +// profile +// command to build a profile +//======================================================================= +Kinematic_Rotation::Kinematic_Rotation(int Rot1, int Rot2, int Rot3, double ValX, double ValY, double ValZ) +{ + myRot1 = Rot1; + myRot2 = Rot2; + myRot3 = Rot3; + + myValX = ValX; + myValY = ValY; + myValZ = ValZ; +} + + +//================================================================================= +// function : ~Kinematic_Rotation() +// purpose : Destroys the object and frees any allocated resources +//================================================================================= +Kinematic_Rotation::~Kinematic_Rotation() {} diff --git a/src/KINEMATIC/Kinematic_Rotation.hxx b/src/KINEMATIC/Kinematic_Rotation.hxx new file mode 100644 index 000000000..c6018e625 --- /dev/null +++ b/src/KINEMATIC/Kinematic_Rotation.hxx @@ -0,0 +1,65 @@ +// GEOM KINEMATIC +// +// Copyright (C) 2003 OPEN CASCADE, EADS/CCR, LIP6, CEA/DEN, +// CEDRAT, EDF R&D, LEG, PRINCIPIA R&D, BUREAU VERITAS +// +// This library is free software; you can redistribute it and/or +// modify it under the terms of the GNU Lesser General Public +// License as published by the Free Software Foundation; either +// version 2.1 of the License. +// +// This library is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU +// Lesser General Public License for more details. +// +// You should have received a copy of the GNU Lesser General Public +// License along with this library; if not, write to the Free Software +// Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307 USA +// +// See http://www.opencascade.org/SALOME/ or email : webmaster.salome@opencascade.org +// +// +// +// File : Kinematic_Rotation.hxx +// Author : Damien COQUERET +// Module : GEOM +// $Header: + +#ifndef _KINEMATIC_ROTATION_HXX +#define _KINEMATIC_ROTATION_HXX + +class Kinematic_Rotation +{ +public: + Kinematic_Rotation(); + Kinematic_Rotation(int Rot1, int Rot2, int Rot3, double ValX, double ValY, double ValZ); + ~Kinematic_Rotation(); + +private: + int myRot1; + int myRot2; + int myRot3; + + double myValX; + double myValY; + double myValZ; + +public: + void Rot1(int Rot1){myRot1 = Rot1;}; + void Rot2(int Rot2){myRot2 = Rot2;}; + void Rot3(int Rot3){myRot3 = Rot3;}; + void ValX(double ValX){myValX = ValX;}; + void ValY(double ValY){myValY = ValY;}; + void ValZ(double ValZ){myValZ = ValZ;}; + + int& Rot1(){return myRot1;}; + int& Rot2(){return myRot2;}; + int& Rot3(){return myRot3;}; + double& ValX(){return myValX;}; + double& ValY(){return myValY;}; + double& ValZ(){return myValZ;}; + +}; + +#endif diff --git a/src/KINEMATIC/Kinematic_Translation.cxx b/src/KINEMATIC/Kinematic_Translation.cxx new file mode 100644 index 000000000..7b8914a11 --- /dev/null +++ b/src/KINEMATIC/Kinematic_Translation.cxx @@ -0,0 +1,56 @@ +// GEOM KINEMATIC +// +// Copyright (C) 2003 OPEN CASCADE, EADS/CCR, LIP6, CEA/DEN, +// CEDRAT, EDF R&D, LEG, PRINCIPIA R&D, BUREAU VERITAS +// +// This library is free software; you can redistribute it and/or +// modify it under the terms of the GNU Lesser General Public +// License as published by the Free Software Foundation; either +// version 2.1 of the License. +// +// This library is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU +// Lesser General Public License for more details. +// +// You should have received a copy of the GNU Lesser General Public +// License along with this library; if not, write to the Free Software +// Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307 USA +// +// See http://www.opencascade.org/SALOME/ or email : webmaster.salome@opencascade.org +// +// +// +// File : Kinematic_Translation.cxx +// Author : Damien COQUERET +// Module : GEOM +// $Header: + +using namespace std; +#include "Kinematic_Translation.hxx" + + +//======================================================================= +// profile +// command to build a profile +//======================================================================= +Kinematic_Translation::Kinematic_Translation(){} + + +//======================================================================= +// profile +// command to build a profile +//======================================================================= +Kinematic_Translation::Kinematic_Translation(double ValX, double ValY, double ValZ) +{ + myValX = ValX; + myValY = ValY; + myValZ = ValZ; +} + + +//================================================================================= +// function : ~Kinematic_Translation() +// purpose : Destroys the object and frees any allocated resources +//================================================================================= +Kinematic_Translation::~Kinematic_Translation() {} diff --git a/src/KINEMATIC/Kinematic_Translation.hxx b/src/KINEMATIC/Kinematic_Translation.hxx new file mode 100644 index 000000000..de5faa8c1 --- /dev/null +++ b/src/KINEMATIC/Kinematic_Translation.hxx @@ -0,0 +1,55 @@ +// GEOM KINEMATIC +// +// Copyright (C) 2003 OPEN CASCADE, EADS/CCR, LIP6, CEA/DEN, +// CEDRAT, EDF R&D, LEG, PRINCIPIA R&D, BUREAU VERITAS +// +// This library is free software; you can redistribute it and/or +// modify it under the terms of the GNU Lesser General Public +// License as published by the Free Software Foundation; either +// version 2.1 of the License. +// +// This library is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU +// Lesser General Public License for more details. +// +// You should have received a copy of the GNU Lesser General Public +// License along with this library; if not, write to the Free Software +// Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307 USA +// +// See http://www.opencascade.org/SALOME/ or email : webmaster.salome@opencascade.org +// +// +// +// File : Kinematic_Translation.hxx +// Author : Damien COQUERET +// Module : GEOM +// $Header: + +#ifndef _KINEMATIC_TRANSLATION_HXX +#define _KINEMATIC_TRANSLATION_HXX + +class Kinematic_Translation +{ +public: + Kinematic_Translation(); + Kinematic_Translation(double ValX, double ValY, double ValZ); + ~Kinematic_Translation(); + +private: + double myValX; + double myValY; + double myValZ; + +public: + void ValX(double ValX){myValX = ValX;}; + void ValY(double ValY){myValY = ValY;}; + void ValZ(double ValZ){myValZ = ValZ;}; + + double& ValX(){return myValX;}; + double& ValY(){return myValY;}; + double& ValZ(){return myValZ;}; + +}; + +#endif diff --git a/src/KINEMATIC/Makefile.in b/src/KINEMATIC/Makefile.in new file mode 100644 index 000000000..7a7c360ff --- /dev/null +++ b/src/KINEMATIC/Makefile.in @@ -0,0 +1,61 @@ +# GEOM GEOMBASE : +# +# Copyright (C) 2003 OPEN CASCADE, EADS/CCR, LIP6, CEA/DEN, +# CEDRAT, EDF R&D, LEG, PRINCIPIA R&D, BUREAU VERITAS +# +# This library is free software; you can redistribute it and/or +# modify it under the terms of the GNU Lesser General Public +# License as published by the Free Software Foundation; either +# version 2.1 of the License. +# +# This library is distributed in the hope that it will be useful, +# but WITHOUT ANY WARRANTY; without even the implied warranty of +# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU +# Lesser General Public License for more details. +# +# You should have received a copy of the GNU Lesser General Public +# License along with this library; if not, write to the Free Software +# Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307 USA +# +# See http://www.opencascade.org/SALOME/ or email : webmaster.salome@opencascade.org +# +# +# +# File : Makefile.in +# Author : Damien COQUERET (OCC) +# Module : GEOM +# $Header: + +top_srcdir=@top_srcdir@ +top_builddir=../.. +srcdir=@srcdir@ +VPATH=.:@srcdir@:@top_srcdir@/idl + + +@COMMENCE@ + +# Libraries targets +LIB = libGEOMKinematic.la +LIB_SRC = Kinematic_Position.cxx \ + Kinematic_Rotation.cxx \ + Kinematic_Translation.cxx \ + Kinematic_Contact.cxx \ + Kinematic_Assembly.cxx \ + Kinematic_Animation.cxx +LIB_CLIENT_IDL = + +# header files +EXPORT_HEADERS = Kinematic_Position.hxx \ + Kinematic_Rotation.hxx \ + Kinematic_Translation.hxx \ + Kinematic_Contact.hxx \ + Kinematic_Assembly.hxx \ + Kinematic_Animation.hxx + +# additionnal information to compil and link file +CPPFLAGS += $(OCC_INCLUDES) -I${KERNEL_ROOT_DIR}/include/salome +CXXFLAGS += $(OCC_CXXFLAGS) -I${KERNEL_ROOT_DIR}/include/salome + +LDFLAGS += -L${KERNEL_ROOT_DIR}/lib/salome + +@CONCLUDE@ diff --git a/src/KinematicGUI/KinematicGUI.cxx b/src/KinematicGUI/KinematicGUI.cxx new file mode 100644 index 000000000..cb2af440e --- /dev/null +++ b/src/KinematicGUI/KinematicGUI.cxx @@ -0,0 +1,708 @@ +// GEOM GEOMGUI : GUI for Geometry component +// +// Copyright (C) 2003 OPEN CASCADE, EADS/CCR, LIP6, CEA/DEN, +// CEDRAT, EDF R&D, LEG, PRINCIPIA R&D, BUREAU VERITAS +// +// This library is free software; you can redistribute it and/or +// modify it under the terms of the GNU Lesser General Public +// License as published by the Free Software Foundation; either +// version 2.1 of the License. +// +// This library is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU +// Lesser General Public License for more details. +// +// You should have received a copy of the GNU Lesser General Public +// License along with this library; if not, write to the Free Software +// Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307 USA +// +// See http://www.opencascade.org/SALOME/ or email : webmaster.salome@opencascade.org +// +// +// +// File : KinematicGUI.cxx +// Author : Damien COQUERET +// Module : GEOM +// $Header: + +using namespace std; +#include "KinematicGUI.h" + +#include "QAD_RightFrame.h" +#include "OCCViewer_Viewer3d.h" +#include "SALOMEGUI_QtCatchCorbaException.hxx" +#include "SALOMEGUI_ImportOperation.h" + +#include +#include + +#include "KinematicGUI_ContactDlg.h" // Method CONTACT +#include "KinematicGUI_ContactHDlg.h" // Method CONTACT HELICOIDAL +#include "KinematicGUI_PositionDlg.h" // Method POSITION +#include "KinematicGUI_RotationDlg.h" // Method ROTATION +#include "KinematicGUI_TranslationDlg.h" // Method TRANSLATION +#include "KinematicGUI_AnimationDlg.h" // Method ANIMATION + +//======================================================================= +// function : KinematicGUI() +// purpose : Constructor +//======================================================================= +KinematicGUI::KinematicGUI() : + QObject() +{ + myGeomBase = new GEOMBase(); + myGeomGUI = GEOMContext::GetGeomGUI(); + myGeom = myGeomGUI->myComponentGeom; +} + + +//======================================================================= +// function : ~KinematicGUI() +// purpose : Destructor +//======================================================================= +KinematicGUI::~KinematicGUI() +{ +} + + +//======================================================================= +// function : OnGUIEvent() +// purpose : +//======================================================================= +bool KinematicGUI::OnGUIEvent(int theCommandID, QAD_Desktop* parent) +{ + KinematicGUI* myKinematicGUI = new KinematicGUI(); + myKinematicGUI->myGeomGUI->EmitSignalDeactivateDialog(); + SALOME_Selection* Sel = SALOME_Selection::Selection(QAD_Application::getDesktop()->getActiveStudy()->getSelection()); + + switch (theCommandID) + { + case 611: // ASSEMBLY + { + myKinematicGUI->AddNewAssembly(); + break; + } + case 61201: // EMBEDDING + { + KinematicGUI_ContactDlg *aDlg = new KinematicGUI_ContactDlg(parent, "", myKinematicGUI, Sel, 0); + break; + } + case 61202: // PIVOT + { + KinematicGUI_ContactDlg *aDlg = new KinematicGUI_ContactDlg(parent, "", myKinematicGUI, Sel, 1); + break; + } + case 61203: // SLIDE + { + KinematicGUI_ContactDlg *aDlg = new KinematicGUI_ContactDlg(parent, "", myKinematicGUI, Sel, 2); + break; + } + case 61204: // SLIDING PIVOT + { + KinematicGUI_ContactDlg *aDlg = new KinematicGUI_ContactDlg(parent, "", myKinematicGUI, Sel, 3); + break; + } + case 61205: // SPHERICAL + { + KinematicGUI_ContactDlg *aDlg = new KinematicGUI_ContactDlg(parent, "", myKinematicGUI, Sel, 4); + break; + } + case 61206: // PLANE + { + KinematicGUI_ContactDlg *aDlg = new KinematicGUI_ContactDlg(parent, "", myKinematicGUI, Sel, 5); + break; + } + case 61207: // ANNULAR + { + KinematicGUI_ContactDlg *aDlg = new KinematicGUI_ContactDlg(parent, "", myKinematicGUI, Sel, 6); + break; + } + case 61208: // RECTILINEAR + { + KinematicGUI_ContactDlg *aDlg = new KinematicGUI_ContactDlg(parent, "", myKinematicGUI, Sel, 7); + break; + } + case 61209: // PONCTUAL + { + KinematicGUI_ContactDlg *aDlg = new KinematicGUI_ContactDlg(parent, "", myKinematicGUI, Sel, 8); + break; + } + case 61210: // HELICOIDAL + { + KinematicGUI_ContactHDlg *aDlg = new KinematicGUI_ContactHDlg(parent, "", myKinematicGUI, Sel); + break; + } + case 6131: // ROTATION + { + KinematicGUI_PositionDlg *aDlg = new KinematicGUI_PositionDlg(parent, "", myKinematicGUI, Sel, true); + break; + } + case 6132: // ROTATION + { + KinematicGUI_RotationDlg *aDlg = new KinematicGUI_RotationDlg(parent, "", myKinematicGUI, Sel, true); + break; + } + case 6133: // TRANSLATION + { + KinematicGUI_TranslationDlg *aDlg = new KinematicGUI_TranslationDlg(parent, "", myKinematicGUI, Sel, true); + break; + } + case 614: // ANIMATION + { + KinematicGUI_AnimationDlg *aDlg = new KinematicGUI_AnimationDlg(parent, "", myKinematicGUI, Sel); + break; + } + case 6141: // RUN ANIMATION + { + if(QAD_Application::getDesktop()->getActiveStudy()->getActiveStudyFrame()->getTypeView() != VIEW_OCC) + break; + myKinematicGUI->RunAnimation(Sel); + break; + } + default: + { + parent->putInfo(tr("GEOM_PRP_COMMAND").arg(theCommandID)); + break; + } + } + return true; +} + + +//======================================================================= +// function : AddNewAssembly() +// purpose : +//======================================================================= +void KinematicGUI::AddNewAssembly() +{ + try { + GEOM::GEOM_Assembly_ptr result = myGeom->InitAssembly(); + if(result->_is_nil()) { + QAD_Application::getDesktop()->putInfo(tr("GEOM_PRP_NULLSHAPE")); + return; + } + + if(this->AddAssemblyInStudy(result)) + QAD_Application::getDesktop()->putInfo(tr("GEOM_PRP_DONE")); + } + catch(const SALOME::SALOME_Exception& S_ex) { + QtCatchCorbaException(S_ex); + } + return; +} + + +//======================================================================= +// function : AddContact() +// purpose : +//======================================================================= +void KinematicGUI::AddContact(GEOM::GEOM_Assembly_ptr Ass, GEOM::GEOM_Shape_ptr Shape1, + GEOM::GEOM_Shape_ptr Shape2, int type, double step) +{ + try { + GEOM::GEOM_Contact_ptr result = myGeom->AddContact(Ass, Shape1, Shape2, type, step); + if(result->_is_nil()) { + QAD_Application::getDesktop()->putInfo(tr("GEOM_PRP_NULLSHAPE")); + return; + } + + Ass->AddContact(result); + if(this->AddContactInStudy(Ass, result)) + QAD_Application::getDesktop()->putInfo(tr("GEOM_PRP_DONE")); + } + catch(const SALOME::SALOME_Exception& S_ex) { + QtCatchCorbaException(S_ex); + } + return; +} + + +//======================================================================= +// function : AddAnimation() +// purpose : +//======================================================================= +void KinematicGUI::AddAnimation(GEOM::GEOM_Assembly_ptr Ass, GEOM::GEOM_Shape_ptr Shape1, + double Duration, int NbSeq, bool IsInLoop) +{ + try { + GEOM::GEOM_Animation_ptr result = myGeom->AddAnimation(Ass, Shape1, Duration, NbSeq, IsInLoop); + if(result->_is_nil()) { + QAD_Application::getDesktop()->putInfo(tr("GEOM_PRP_NULLSHAPE")); + return; + } + + if(this->AddAnimationInStudy(result)) + QAD_Application::getDesktop()->putInfo(tr("GEOM_PRP_DONE")); + } + catch(const SALOME::SALOME_Exception& S_ex) { + QtCatchCorbaException(S_ex); + } + return; +} + + +//===================================================================================== +// function : AddAssemblyInStudy() +// purpose : +//===================================================================================== +bool KinematicGUI::AddAssemblyInStudy(GEOM::GEOM_Assembly_ptr aAssembly) +{ + SALOMEDS::Study_var aStudy = QAD_Application::getDesktop()->getActiveStudy()->getStudyDocument(); + SALOMEDS::StudyBuilder_var aStudyBuilder = aStudy->NewBuilder(); + SALOMEDS::GenericAttribute_var anAttr; + SALOMEDS::AttributeName_var aName; + SALOMEDS::AttributePixMap_var aPixmap; + SALOMEDS::AttributeIOR_var anIOR; + SALOMEDS::AttributeComment_var aType; + + SALOMEDS::SComponent_var father = aStudy->FindComponent("GEOM"); + int aLocked = false; + if(father->_is_nil()) { + QAD_Operation* op = new SALOMEGUI_ImportOperation(QAD_Application::getDesktop()->getActiveStudy()); + op->start(); + aLocked = aStudy->GetProperties()->IsLocked(); + if(aLocked) + aStudy->GetProperties()->SetLocked(false); + father = aStudyBuilder->NewComponent("GEOM"); + anAttr = aStudyBuilder->FindOrCreateAttribute(father, "AttributeName"); + aName = SALOMEDS::AttributeName::_narrow(anAttr); + aName->SetValue(QAD_Application::getDesktop()->getComponentUserName("GEOM")); + anAttr = aStudyBuilder->FindOrCreateAttribute(father, "AttributePixMap"); + aPixmap = SALOMEDS::AttributePixMap::_narrow(anAttr); + aPixmap->SetPixMap("ICON_OBJBROWSER_Geometry"); + if(aLocked) + aStudy->GetProperties()->SetLocked(true); + op->finish(); + } + + aStudyBuilder->DefineComponentInstance(father, myGeom); + father->ComponentIOR(myGeomGUI->GetFatherior()); + + SALOMEDS::SObject_var fatherSF = aStudy->FindObjectID(QAD_Application::getDesktop()->getActiveStudy()->getActiveStudyFrame()->entry()); + + TCollection_AsciiString nameG("Assembly_"); + nameG += TCollection_AsciiString(myGeomGUI->GetNbGeom()++) + TCollection_AsciiString("\0"); + + // open transaction + QAD_Operation* op = new SALOMEGUI_ImportOperation(QAD_Application::getDesktop()->getActiveStudy()); + op->start(); + + SALOMEDS::SObject_var newObj = aStudyBuilder->NewObject(father); + /* For the shape inserted into the study we set its field 'studyshapeid' */ + /* so the shape will contain its corresponding entry in the study Ocaf doc. */ + aAssembly->StudyShapeId(newObj->GetID()); + + anAttr = aStudyBuilder->FindOrCreateAttribute(newObj, "AttributeIOR"); + anIOR = SALOMEDS::AttributeIOR::_narrow(anAttr); + anIOR->SetValue(aAssembly->Name()); + + anAttr = aStudyBuilder->FindOrCreateAttribute(newObj, "AttributeName"); + aName = SALOMEDS::AttributeName::_narrow(anAttr); + aName->SetValue(nameG.ToCString()); + + anAttr = aStudyBuilder->FindOrCreateAttribute(newObj, "AttributeComment"); + aType = SALOMEDS::AttributeComment::_narrow(anAttr); + aType->SetValue("Kinematic_Assembly"); + + anAttr = aStudyBuilder->FindOrCreateAttribute(newObj, "AttributePixMap"); + aPixmap = SALOMEDS::AttributePixMap::_narrow(anAttr); + aPixmap->SetPixMap("ICON_OBJBROWSER_ASSEMBLY"); + + SALOMEDS::SObject_var newObj1 = aStudyBuilder->NewObject(fatherSF); + aStudyBuilder->Addreference(newObj1, newObj); + + op->finish(); + + QAD_Application::getDesktop()->getActiveStudy()->updateObjBrowser(); + return true; +} + + +//===================================================================================== +// function : AddContactInStudy() +// purpose : +//===================================================================================== +bool KinematicGUI::AddContactInStudy(GEOM::GEOM_Assembly_ptr Ass, GEOM::GEOM_Contact_ptr aContact) +{ + SALOMEDS::Study_var aStudy = QAD_Application::getDesktop()->getActiveStudy()->getStudyDocument(); + SALOMEDS::StudyBuilder_var aStudyBuilder = aStudy->NewBuilder(); + SALOMEDS::GenericAttribute_var anAttr; + SALOMEDS::AttributeName_var aName; + SALOMEDS::AttributeName_var aTypeName; + SALOMEDS::AttributePixMap_var aPixmap; + SALOMEDS::AttributeIOR_var anIOR; + SALOMEDS::AttributeComment_var aType; + SALOMEDS::AttributeSelectable_var aSelAttr; + + SALOMEDS::SObject_var fatherSF = aStudy->FindObjectID(QAD_Application::getDesktop()->getActiveStudy()->getActiveStudyFrame()->entry()); + + TCollection_AsciiString nameG("Contact_"); + nameG += TCollection_AsciiString(myGeomGUI->GetNbGeom()++) + TCollection_AsciiString("\0"); + + // open transaction + QAD_Operation* op = new SALOMEGUI_ImportOperation(QAD_Application::getDesktop()->getActiveStudy()); + op->start(); + + Standard_CString AssIOR = aStudy->ConvertObjectToIOR(Ass); + SALOMEDS::SObject_var theAss = aStudy->FindObjectIOR(AssIOR); + SALOMEDS::SObject_var newObj = aStudyBuilder->NewObject(theAss); + /* For the shape inserted into the study we set its field 'studyshapeid' */ + /* so the shape will contain its corresponding entry in the study Ocaf doc. */ + aContact->StudyShapeId(newObj->GetID()); + + anAttr = aStudyBuilder->FindOrCreateAttribute(newObj, "AttributeIOR"); + anIOR = SALOMEDS::AttributeIOR::_narrow(anAttr); + anIOR->SetValue(aContact->Name()); + + anAttr = aStudyBuilder->FindOrCreateAttribute(newObj, "AttributeName"); + aName = SALOMEDS::AttributeName::_narrow(anAttr); + aName->SetValue(nameG.ToCString()); + + anAttr = aStudyBuilder->FindOrCreateAttribute(newObj, "AttributeComment"); + aType = SALOMEDS::AttributeComment::_narrow(anAttr); + aType->SetValue("Kinematic_Contact"); + + anAttr = aStudyBuilder->FindOrCreateAttribute(newObj, "AttributePixMap"); + aPixmap = SALOMEDS::AttributePixMap::_narrow(anAttr); + aPixmap->SetPixMap("ICON_OBJBROWSER_CONTACT"); + + SALOMEDS::SObject_var RefType = aStudyBuilder->NewObject(newObj); + anAttr = aStudyBuilder->FindOrCreateAttribute(RefType, "AttributeName"); + aTypeName = SALOMEDS::AttributeName::_narrow(anAttr); + aTypeName->SetValue(this->GetNameFromType(aContact->GetType()).ToCString()); + anAttr = aStudyBuilder->FindOrCreateAttribute(RefType, "AttributeSelectable"); + aSelAttr = SALOMEDS::AttributeSelectable::_narrow(anAttr); + aSelAttr->SetSelectable(false); + + Standard_CString Shape1IOR = aStudy->ConvertObjectToIOR(aContact->GetShape1()); + SALOMEDS::SObject_var theSh1 = aStudy->FindObjectIOR(Shape1IOR); + if(!theSh1->_is_nil()) { + SALOMEDS::SObject_var RefObject1 = aStudyBuilder->NewObject(newObj); + aStudyBuilder->Addreference(RefObject1, theSh1); + } + + Standard_CString Shape2IOR = aStudy->ConvertObjectToIOR(aContact->GetShape2()); + SALOMEDS::SObject_var theSh2 = aStudy->FindObjectIOR(Shape2IOR); + if(!theSh2->_is_nil()) { + SALOMEDS::SObject_var RefObject2 = aStudyBuilder->NewObject(newObj); + aStudyBuilder->Addreference(RefObject2, theSh2); + } + + SALOMEDS::SObject_var newObj1 = aStudyBuilder->NewObject(fatherSF); + aStudyBuilder->Addreference(newObj1, newObj); + + op->finish(); + + QAD_Application::getDesktop()->getActiveStudy()->updateObjBrowser(); + return true; +} + + +//===================================================================================== +// function : AddAnimationInStudy() +// purpose : +//===================================================================================== +bool KinematicGUI::AddAnimationInStudy(GEOM::GEOM_Animation_ptr aAnimation) +{ + SALOMEDS::Study_var aStudy = QAD_Application::getDesktop()->getActiveStudy()->getStudyDocument(); + SALOMEDS::StudyBuilder_var aStudyBuilder = aStudy->NewBuilder(); + SALOMEDS::GenericAttribute_var anAttr; + SALOMEDS::AttributeName_var aName; + SALOMEDS::AttributePixMap_var aPixmap; + SALOMEDS::AttributeIOR_var anIOR; + SALOMEDS::AttributeComment_var aType; + + SALOMEDS::SComponent_var father = aStudy->FindComponent("GEOM"); + aStudyBuilder->DefineComponentInstance(father, myGeom); + father->ComponentIOR(myGeomGUI->GetFatherior()); + + SALOMEDS::SObject_var fatherSF = aStudy->FindObjectID(QAD_Application::getDesktop()->getActiveStudy()->getActiveStudyFrame()->entry()); + + TCollection_AsciiString nameG("Animation_"); + nameG += TCollection_AsciiString(myGeomGUI->GetNbGeom()++) + TCollection_AsciiString("\0"); + + // open transaction + QAD_Operation* op = new SALOMEGUI_ImportOperation(QAD_Application::getDesktop()->getActiveStudy()); + op->start(); + + SALOMEDS::SObject_var newObj = aStudyBuilder->NewObject(father); + /* For the shape inserted into the study we set its field 'studyshapeid' */ + /* so the shape will contain its corresponding entry in the study Ocaf doc. */ + aAnimation->StudyShapeId(newObj->GetID()); + + anAttr = aStudyBuilder->FindOrCreateAttribute(newObj, "AttributeIOR"); + anIOR = SALOMEDS::AttributeIOR::_narrow(anAttr); + anIOR->SetValue(aAnimation->Name()); + + anAttr = aStudyBuilder->FindOrCreateAttribute(newObj, "AttributeName"); + aName = SALOMEDS::AttributeName::_narrow(anAttr); + aName->SetValue(nameG.ToCString()); + + anAttr = aStudyBuilder->FindOrCreateAttribute(newObj, "AttributeComment"); + aType = SALOMEDS::AttributeComment::_narrow(anAttr); + aType->SetValue("Kinematic_Animation"); + + anAttr = aStudyBuilder->FindOrCreateAttribute(newObj, "AttributePixMap"); + aPixmap = SALOMEDS::AttributePixMap::_narrow(anAttr); + aPixmap->SetPixMap("ICON_OBJBROWSER_ANIMATION"); + + Standard_CString assIOR = aStudy->ConvertObjectToIOR(aAnimation->GetAssembly()); + SALOMEDS::SObject_var theAss = aStudy->FindObjectIOR(assIOR); + if(!theAss->_is_nil()) { + SALOMEDS::SObject_var RefObject = aStudyBuilder->NewObject(newObj); + aStudyBuilder->Addreference(RefObject, theAss); + } + + Standard_CString Shape1IOR = aStudy->ConvertObjectToIOR(aAnimation->GetFrame()); + SALOMEDS::SObject_var theSh1 = aStudy->FindObjectIOR(Shape1IOR); + if(!theSh1->_is_nil()) { + SALOMEDS::SObject_var RefObject1 = aStudyBuilder->NewObject(newObj); + aStudyBuilder->Addreference(RefObject1, theSh1); + } + + SALOMEDS::SObject_var newObj1 = aStudyBuilder->NewObject(fatherSF); + aStudyBuilder->Addreference(newObj1, newObj); + + op->finish(); + + QAD_Application::getDesktop()->getActiveStudy()->updateObjBrowser(); + return true; +} + + +//======================================================================= +// function : SetPosition() +// purpose : +//======================================================================= +void KinematicGUI::SetPosition(GEOM::GEOM_Contact_ptr aContact, GEOM::PointStruct P0, + GEOM::DirStruct VX, GEOM::DirStruct VY, GEOM::DirStruct VZ) +{ + try { + GEOM::GEOM_Position_var myGeomPosition = GEOM::GEOM_Position::_narrow(aContact->GetPosition()); + myGeomPosition->SetOrigin(P0); + myGeomPosition->SetVX(VX); + myGeomPosition->SetVY(VY); + myGeomPosition->SetVZ(VZ); + } + catch(const SALOME::SALOME_Exception& S_ex) { + QtCatchCorbaException(S_ex); + } + return; +} + + +//======================================================================= +// function : SetRotation() +// purpose : +//======================================================================= +void KinematicGUI::SetRotation(GEOM::GEOM_Contact_ptr aContact, + int Rot1, int Rot2, int Rot3, + double Val1, double Val2, double Val3) +{ + try { + GEOM::GEOM_Rotation_var myGeomRotation = GEOM::GEOM_Rotation::_narrow(aContact->GetRotation()); + myGeomRotation->SetRotation(Rot1, Rot2, Rot3, Val1, Val2, Val3); + int type = aContact->GetType(); + if(type == 9) { //HELICOIDAL + GEOM::GEOM_Translation_var myGeomTranslation = GEOM::GEOM_Translation::_narrow(aContact->GetTranslation()); + double aVal2 = myGeomTranslation->GetVal2(); + double aVal3 = myGeomTranslation->GetVal3(); + double aStep = aContact->GetStep(); + double aVal1 = aStep * Val1 / 360; + myGeomTranslation->SetTranslation(aVal1, aVal2, aVal3); + } + } + catch(const SALOME::SALOME_Exception& S_ex) { + QtCatchCorbaException(S_ex); + } + return; +} + + +//======================================================================= +// function : SetTranslation() +// purpose : +//======================================================================= +void KinematicGUI::SetTranslation(GEOM::GEOM_Contact_ptr aContact, + double Val1, double Val2, double Val3) +{ + try { + GEOM::GEOM_Translation_var myGeomTranslation = GEOM::GEOM_Translation::_narrow(aContact->GetTranslation()); + myGeomTranslation->SetTranslation(Val1, Val2, Val3); + int type = aContact->GetType(); + if(type == 9) { //HELICOIDAL + GEOM::GEOM_Rotation_var myGeomRotation = GEOM::GEOM_Rotation::_narrow(aContact->GetRotation()); + int aRot1 = myGeomRotation->GetRot1(); + int aRot2 = myGeomRotation->GetRot2(); + int aRot3 = myGeomRotation->GetRot3(); + double aVal2 = myGeomRotation->GetVal2(); + double aVal3 = myGeomRotation->GetVal3(); + double aStep = aContact->GetStep(); + double aVal1 = 360 * Val1 / aStep; + myGeomRotation->SetRotation(aRot1, aRot2, aRot3, aVal1, aVal2, aVal3); + } + } + catch(const SALOME::SALOME_Exception& S_ex) { + QtCatchCorbaException(S_ex); + } + return; +} + + +//===================================================================================== +// function : AddContactInStudy() +// purpose : +//===================================================================================== +TCollection_AsciiString KinematicGUI::GetNameFromType(int type) +{ + TCollection_AsciiString name(""); + switch (type) + { + case 0: + { name = "Embedding"; break; } + case 1: + { name = "Pivot"; break; } + case 2: + { name = "Slide"; break; } + case 3: + { name = "Sliding Pivot"; break; } + case 4: + { name = "Spherical"; break; } + case 5: + { name = "Plane"; break; } + case 6: + { name = "Annular"; break; } + case 7: + { name = "Rectilinear"; break; } + case 8: + { name = "Ponctual"; break; } + case 9: + { name = "Helicoidal"; break; } + default: + { name = "Contact"; break; } + } + return name; +} + + +//======================================================================= +// function : RunAnimation() +// purpose : +//======================================================================= +void KinematicGUI::RunAnimation(SALOME_Selection* Sel) +{ + QApplication::setOverrideCursor(Qt::waitCursor); + Standard_Boolean testResult; + Handle(SALOME_InteractiveObject) IO = Sel->firstIObject(); + + GEOM::GEOM_Animation_var myGeomAnimation = myGeomBase->ConvertIOinAnimation(IO, testResult); + if(!testResult) + return; + + Handle(AIS_InteractiveContext) ic; + OCCViewer_Viewer3d* v3d = ((OCCViewer_ViewFrame*)QAD_Application::getDesktop()->getActiveStudy()->getActiveStudyFrame()->getRightFrame()->getViewFrame())->getViewer(); + ic = v3d->getAISContext(); + + Kinematic_Animation* KAnimation = CreateAnimation(myGeomAnimation); + KAnimation->Animate(ic); + QApplication::restoreOverrideCursor(); + + return; +} + + +//======================================================================= +// function : CreateContact() +// purpose : +//======================================================================= +Kinematic_Contact* KinematicGUI::CreateContact(GEOM::GEOM_Contact_ptr aContact) +{ + GEOM::GEOM_Shape_var myShape1 = aContact->GetShape1(); + GEOM::GEOM_Shape_var myShape2 = aContact->GetShape2(); + GEOM::GEOM_Position_var myPosition = aContact->GetPosition(); + GEOM::GEOM_Rotation_var myRotation = aContact->GetRotation(); + GEOM::GEOM_Translation_var myTranslation = aContact->GetTranslation(); + int Type = aContact->GetType(); + double Step = aContact->GetStep(); + + TopoDS_Shape aShape1 = myGeomGUI->GetShapeReader().GetShape(myGeom, myShape1); + TopoDS_Shape aShape2 = myGeomGUI->GetShapeReader().GetShape(myGeom, myShape2); + Kinematic_Contact* KContact = new Kinematic_Contact(aShape1, aShape2, Type, Step); + + gp_Pnt Origin(myPosition->GetOrigin().x, myPosition->GetOrigin().y, myPosition->GetOrigin().z); + gp_Dir aDirX(myPosition->GetVX().PS.x, myPosition->GetVX().PS.y, myPosition->GetVX().PS.z); + gp_Dir aDirY(myPosition->GetVY().PS.x, myPosition->GetVY().PS.y, myPosition->GetVY().PS.z); + gp_Dir aDirZ(myPosition->GetVZ().PS.x, myPosition->GetVZ().PS.y, myPosition->GetVZ().PS.z); + + KContact->Position().Origin(Origin); + KContact->Position().DirX(aDirX); + KContact->Position().DirY(aDirY); + KContact->Position().DirZ(aDirZ); + + KContact->Rotation().Rot1(myRotation->GetRot1()); + KContact->Rotation().Rot2(myRotation->GetRot2()); + KContact->Rotation().Rot3(myRotation->GetRot3()); + + KContact->Rotation().ValX(myRotation->GetVal1()); + KContact->Rotation().ValY(myRotation->GetVal2()); + KContact->Rotation().ValZ(myRotation->GetVal3()); + + KContact->Translation().ValX(myTranslation->GetVal1()); + KContact->Translation().ValY(myTranslation->GetVal2()); + KContact->Translation().ValZ(myTranslation->GetVal3()); + + return KContact; +} + + +//======================================================================= +// function : CreateAssembly() +// purpose : +//======================================================================= +Kinematic_Assembly* KinematicGUI::CreateAssembly(GEOM::GEOM_Assembly_ptr aAssembly) +{ + int NbContact = aAssembly->NbContacts(); + GEOM::ListOfContact_var aContactList = aAssembly->GetContactList(); + + Kinematic_Assembly* KAssembly = new Kinematic_Assembly(); + + for(int i = 0; i < NbContact; i++) { + GEOM::GEOM_Contact_var myContact = aContactList[i]; + Kinematic_Contact* KContact = CreateContact(myContact); + KAssembly->AddContact(KContact); + } + + return KAssembly; +} + + +//======================================================================= +// function : () +// purpose : +//======================================================================= +Kinematic_Animation* KinematicGUI::CreateAnimation(GEOM::GEOM_Animation_ptr aAnimation) +{ + GEOM::GEOM_Shape_var aFrame = aAnimation->GetFrame(); + double Duration = aAnimation->GetDuration(); + int NbSeq = aAnimation->GetNbSeq(); + bool IsInLoop = aAnimation->GetIsInLoop(); + + GEOM::GEOM_Assembly_var myAssembly = aAnimation->GetAssembly(); + Kinematic_Assembly* KAssembly = CreateAssembly(myAssembly); + + TopoDS_Shape myFrame = myGeomGUI->GetShapeReader().GetShape(myGeom, aFrame); + Kinematic_Animation* KAnimation = new Kinematic_Animation(KAssembly, myFrame, Duration, NbSeq, IsInLoop); + + return KAnimation; +} + + +//===================================================================================== +// EXPORTED METHODS +//===================================================================================== +extern "C" +{ + bool OnGUIEvent(int theCommandID, QAD_Desktop* parent) + {return KinematicGUI::OnGUIEvent(theCommandID, parent);} +} diff --git a/src/KinematicGUI/KinematicGUI.h b/src/KinematicGUI/KinematicGUI.h new file mode 100644 index 000000000..8ff220514 --- /dev/null +++ b/src/KinematicGUI/KinematicGUI.h @@ -0,0 +1,89 @@ +// GEOM GEOMGUI : GUI for Geometry component +// +// Copyright (C) 2003 OPEN CASCADE, EADS/CCR, LIP6, CEA/DEN, +// CEDRAT, EDF R&D, LEG, PRINCIPIA R&D, BUREAU VERITAS +// +// This library is free software; you can redistribute it and/or +// modify it under the terms of the GNU Lesser General Public +// License as published by the Free Software Foundation; either +// version 2.1 of the License. +// +// This library is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU +// Lesser General Public License for more details. +// +// You should have received a copy of the GNU Lesser General Public +// License along with this library; if not, write to the Free Software +// Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307 USA +// +// See http://www.opencascade.org/SALOME/ or email : webmaster.salome@opencascade.org +// +// +// +// File : KinematicGUI.h +// Author : Damien COQUERET +// Module : GEOM +// $Header: + +#ifndef KINEMATICGUI_H +#define KINEMATICGUI_H + +#include "GEOMBase.h" + +// IDL headers +#include +#include CORBA_SERVER_HEADER(GEOM_Gen) +#include CORBA_SERVER_HEADER(GEOM_Shape) +#include CORBA_SERVER_HEADER(GEOM_Kinematic) + +#include "Kinematic_Animation.hxx" +#include "Kinematic_Contact.hxx" + +//================================================================================= +// class : KinematicGUI +// purpose : +//================================================================================= +class KinematicGUI : public QObject +{ + Q_OBJECT /* for QT compatibility */ + +public : + KinematicGUI(); + ~KinematicGUI(); + + static bool OnGUIEvent(int theCommandID, QAD_Desktop* parent); + + void AddNewAssembly(); + void AddContact(GEOM::GEOM_Assembly_ptr Ass, GEOM::GEOM_Shape_ptr Shape1, + GEOM::GEOM_Shape_ptr Shape2, int type, double step = 0); + void AddAnimation(GEOM::GEOM_Assembly_ptr Ass, GEOM::GEOM_Shape_ptr Shape1, + double Duration, int NbSeq, bool IsInLoop); + + bool AddContactInStudy(GEOM::GEOM_Assembly_ptr Ass, + GEOM::GEOM_Contact_ptr aContact); + bool AddAssemblyInStudy(GEOM::GEOM_Assembly_ptr aAssembly); + bool AddAnimationInStudy(GEOM::GEOM_Animation_ptr aAnimation); + TCollection_AsciiString GetNameFromType(int type); + + void SetPosition(GEOM::GEOM_Contact_ptr aContact, GEOM::PointStruct P0, + GEOM::DirStruct VX, GEOM::DirStruct VY, GEOM::DirStruct VZ); + void SetRotation(GEOM::GEOM_Contact_ptr aContact, + int Rot1, int Rot2, int Rot3, + double Val1, double Val2, double Val3); + void SetTranslation(GEOM::GEOM_Contact_ptr aContact, + double Val1, double Val2, double Val3); + + void RunAnimation(SALOME_Selection* Sel); + + Kinematic_Contact* CreateContact(GEOM::GEOM_Contact_ptr aContact); + Kinematic_Assembly* CreateAssembly(GEOM::GEOM_Assembly_ptr aAssembly); + Kinematic_Animation* CreateAnimation(GEOM::GEOM_Animation_ptr aAnimation); + + GEOMBase* myGeomBase; + GEOMContext* myGeomGUI; + GEOM::GEOM_Gen_var myGeom; /* Current Geom Component */ + +}; + +#endif diff --git a/src/KinematicGUI/KinematicGUI_12Spin.cxx b/src/KinematicGUI/KinematicGUI_12Spin.cxx new file mode 100644 index 000000000..7cee18fd6 --- /dev/null +++ b/src/KinematicGUI/KinematicGUI_12Spin.cxx @@ -0,0 +1,87 @@ +// GEOM GEOMGUI : GUI for Geometry component +// +// Copyright (C) 2003 OPEN CASCADE, EADS/CCR, LIP6, CEA/DEN, +// CEDRAT, EDF R&D, LEG, PRINCIPIA R&D, BUREAU VERITAS +// +// This library is free software; you can redistribute it and/or +// modify it under the terms of the GNU Lesser General Public +// License as published by the Free Software Foundation; either +// version 2.1 of the License. +// +// This library is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU +// Lesser General Public License for more details. +// +// You should have received a copy of the GNU Lesser General Public +// License along with this library; if not, write to the Free Software +// Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307 USA +// +// See http://www.opencascade.org/SALOME/ or email : webmaster.salome@opencascade.org +// +// +// +// File : KinematicGUI_12Spin.cxx +// Author : Damien COQUERET +// Module : GEOM +// $Header: + +#include "KinematicGUI_12Spin.h" + +#include +#include +#include + +/* + * Constructs a KinematicGUI_12Spin which is a child of 'parent', with the + * name 'name' and widget flags set to 'f' + */ +KinematicGUI_12Spin::KinematicGUI_12Spin(QWidget* parent, const char* name, WFlags fl) + :KinematicGUI_12Spin_QTD(parent, name, fl) +{ + SpinBox1->close(TRUE); + SpinBox2->close(TRUE); + SpinBox3->close(TRUE); + SpinBox4->close(TRUE); + SpinBox5->close(TRUE); + SpinBox6->close(TRUE); + SpinBox7->close(TRUE); + SpinBox8->close(TRUE); + SpinBox9->close(TRUE); + SpinBox10->close(TRUE); + SpinBox11->close(TRUE); + SpinBox12->close(TRUE); + SpinBox_11 = new DlgRef_SpinBox(GroupBox1, "SpinBox_11"); + SpinBox_12 = new DlgRef_SpinBox(GroupBox1, "SpinBox_12"); + SpinBox_13 = new DlgRef_SpinBox(GroupBox1, "SpinBox_13"); + SpinBox_21 = new DlgRef_SpinBox(GroupBox1, "SpinBox_21"); + SpinBox_22 = new DlgRef_SpinBox(GroupBox1, "SpinBox_22"); + SpinBox_23 = new DlgRef_SpinBox(GroupBox1, "SpinBox_23"); + SpinBox_31 = new DlgRef_SpinBox(GroupBox1, "SpinBox_31"); + SpinBox_32 = new DlgRef_SpinBox(GroupBox1, "SpinBox_32"); + SpinBox_33 = new DlgRef_SpinBox(GroupBox1, "SpinBox_33"); + SpinBox_41 = new DlgRef_SpinBox(GroupBox1, "SpinBox_41"); + SpinBox_42 = new DlgRef_SpinBox(GroupBox1, "SpinBox_42"); + SpinBox_43 = new DlgRef_SpinBox(GroupBox1, "SpinBox_43"); + Layout1->addWidget(SpinBox_11, 0, 2); + Layout1->addWidget(SpinBox_12, 0, 4); + Layout1->addWidget(SpinBox_13, 0, 6); + Layout1->addWidget(SpinBox_21, 1, 2); + Layout1->addWidget(SpinBox_22, 1, 4); + Layout1->addWidget(SpinBox_23, 1, 6); + Layout1->addWidget(SpinBox_31, 2, 2); + Layout1->addWidget(SpinBox_32, 2, 4); + Layout1->addWidget(SpinBox_33, 2, 6); + Layout1->addWidget(SpinBox_41, 3, 2); + Layout1->addWidget(SpinBox_42, 3, 4); + Layout1->addWidget(SpinBox_43, 3, 6); +} + + +/* + * Destroys the object and frees any allocated resources + */ +KinematicGUI_12Spin::~KinematicGUI_12Spin() +{ + // no need to delete child widgets, Qt does it all for us +} diff --git a/src/KinematicGUI/KinematicGUI_12Spin.h b/src/KinematicGUI/KinematicGUI_12Spin.h new file mode 100644 index 000000000..8f399895f --- /dev/null +++ b/src/KinematicGUI/KinematicGUI_12Spin.h @@ -0,0 +1,58 @@ +// GEOM GEOMGUI : GUI for Geometry component +// +// Copyright (C) 2003 OPEN CASCADE, EADS/CCR, LIP6, CEA/DEN, +// CEDRAT, EDF R&D, LEG, PRINCIPIA R&D, BUREAU VERITAS +// +// This library is free software; you can redistribute it and/or +// modify it under the terms of the GNU Lesser General Public +// License as published by the Free Software Foundation; either +// version 2.1 of the License. +// +// This library is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU +// Lesser General Public License for more details. +// +// You should have received a copy of the GNU Lesser General Public +// License along with this library; if not, write to the Free Software +// Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307 USA +// +// See http://www.opencascade.org/SALOME/ or email : webmaster.salome@opencascade.org +// +// +// +// File : KinematicGUI_12Spin.h +// Author : Damien COQUERET +// Module : GEOM +// $Header: + +#ifndef KINEMATICGUI_12SPIN_H +#define KINEMATICGUI_12SPIN_H + +#include "KinematicGUI_12Spin_QTD.h" +#include "DlgRef_SpinBox.h" + +class KinematicGUI_12Spin : public KinematicGUI_12Spin_QTD +{ + Q_OBJECT + +public: + KinematicGUI_12Spin( QWidget* parent = 0, const char* name = 0, WFlags fl = 0 ); + ~KinematicGUI_12Spin(); + + DlgRef_SpinBox* SpinBox_11; + DlgRef_SpinBox* SpinBox_12; + DlgRef_SpinBox* SpinBox_13; + DlgRef_SpinBox* SpinBox_21; + DlgRef_SpinBox* SpinBox_22; + DlgRef_SpinBox* SpinBox_23; + DlgRef_SpinBox* SpinBox_31; + DlgRef_SpinBox* SpinBox_32; + DlgRef_SpinBox* SpinBox_33; + DlgRef_SpinBox* SpinBox_41; + DlgRef_SpinBox* SpinBox_42; + DlgRef_SpinBox* SpinBox_43; + +}; + +#endif // KINEMATICGUI_12SPIN_H diff --git a/src/KinematicGUI/KinematicGUI_12Spin_QTD.cxx b/src/KinematicGUI/KinematicGUI_12Spin_QTD.cxx new file mode 100644 index 000000000..302079d62 --- /dev/null +++ b/src/KinematicGUI/KinematicGUI_12Spin_QTD.cxx @@ -0,0 +1,213 @@ +/**************************************************************************** +** Form implementation generated from reading ui file 'KinematicGUI_12Spin_QTD.ui' +** +** Created: ven fév 6 12:39:44 2004 +** by: The User Interface Compiler (uic) +** +** WARNING! All changes made in this file will be lost! +****************************************************************************/ +#include "KinematicGUI_12Spin_QTD.h" + +#include +#include +#include +#include +#include +#include +#include +#include + +/* + * Constructs a KinematicGUI_12Spin_QTD which is a child of 'parent', with the + * name 'name' and widget flags set to 'f'. + */ +KinematicGUI_12Spin_QTD::KinematicGUI_12Spin_QTD( QWidget* parent, const char* name, WFlags fl ) + : QWidget( parent, name, fl ) +{ + if ( !name ) + setName( "KinematicGUI_12Spin_QTD" ); + resize( 396, 139 ); + setCaption( trUtf8( "KinematicGUI_12Spin_QTD" ) ); + KinematicGUI_12Spin_QTDLayout = new QGridLayout( this, 1, 1, 0, 6, "KinematicGUI_12Spin_QTDLayout"); + + GroupBox1 = new QGroupBox( this, "GroupBox1" ); + GroupBox1->setTitle( trUtf8( "" ) ); + GroupBox1->setColumnLayout(0, Qt::Vertical ); + GroupBox1->layout()->setSpacing( 6 ); + GroupBox1->layout()->setMargin( 11 ); + GroupBox1Layout = new QGridLayout( GroupBox1->layout() ); + GroupBox1Layout->setAlignment( Qt::AlignTop ); + + Layout1 = new QGridLayout( 0, 1, 1, 0, 6, "Layout1"); + + TextLabel15 = new QLabel( GroupBox1, "TextLabel15" ); + TextLabel15->setSizePolicy( QSizePolicy( (QSizePolicy::SizeType)0, (QSizePolicy::SizeType)0, 0, 0, TextLabel15->sizePolicy().hasHeightForWidth() ) ); + TextLabel15->setText( trUtf8( "TL15" ) ); + + Layout1->addWidget( TextLabel15, 3, 3 ); + QSpacerItem* spacer = new QSpacerItem( 0, 80, QSizePolicy::Minimum, QSizePolicy::Expanding ); + Layout1->addItem( spacer, 4, 4 ); + + TextLabel14 = new QLabel( GroupBox1, "TextLabel14" ); + TextLabel14->setSizePolicy( QSizePolicy( (QSizePolicy::SizeType)0, (QSizePolicy::SizeType)0, 0, 0, TextLabel14->sizePolicy().hasHeightForWidth() ) ); + TextLabel14->setText( trUtf8( "TL14" ) ); + + Layout1->addWidget( TextLabel14, 3, 1 ); + + SpinBox5 = new QSpinBox( GroupBox1, "SpinBox5" ); + SpinBox5->setSizePolicy( QSizePolicy( (QSizePolicy::SizeType)7, (QSizePolicy::SizeType)0, 0, 0, SpinBox5->sizePolicy().hasHeightForWidth() ) ); + + Layout1->addWidget( SpinBox5, 1, 4 ); + + TextLabel3 = new QLabel( GroupBox1, "TextLabel3" ); + TextLabel3->setSizePolicy( QSizePolicy( (QSizePolicy::SizeType)0, (QSizePolicy::SizeType)0, 0, 0, TextLabel3->sizePolicy().hasHeightForWidth() ) ); + TextLabel3->setText( trUtf8( "TL3" ) ); + + Layout1->addWidget( TextLabel3, 0, 3 ); + + TextLabel11 = new QLabel( GroupBox1, "TextLabel11" ); + TextLabel11->setSizePolicy( QSizePolicy( (QSizePolicy::SizeType)0, (QSizePolicy::SizeType)0, 0, 0, TextLabel11->sizePolicy().hasHeightForWidth() ) ); + TextLabel11->setText( trUtf8( "TL11" ) ); + + Layout1->addWidget( TextLabel11, 2, 3 ); + + TextLabel8 = new QLabel( GroupBox1, "TextLabel8" ); + TextLabel8->setSizePolicy( QSizePolicy( (QSizePolicy::SizeType)0, (QSizePolicy::SizeType)0, 0, 0, TextLabel8->sizePolicy().hasHeightForWidth() ) ); + TextLabel8->setText( trUtf8( "TL8" ) ); + + Layout1->addWidget( TextLabel8, 1, 5 ); + + TextLabel4 = new QLabel( GroupBox1, "TextLabel4" ); + TextLabel4->setSizePolicy( QSizePolicy( (QSizePolicy::SizeType)0, (QSizePolicy::SizeType)0, 0, 0, TextLabel4->sizePolicy().hasHeightForWidth() ) ); + TextLabel4->setText( trUtf8( "TL4" ) ); + + Layout1->addWidget( TextLabel4, 0, 5 ); + + TextLabel7 = new QLabel( GroupBox1, "TextLabel7" ); + TextLabel7->setSizePolicy( QSizePolicy( (QSizePolicy::SizeType)0, (QSizePolicy::SizeType)0, 0, 0, TextLabel7->sizePolicy().hasHeightForWidth() ) ); + TextLabel7->setText( trUtf8( "TL7" ) ); + + Layout1->addWidget( TextLabel7, 1, 3 ); + + TextLabel12 = new QLabel( GroupBox1, "TextLabel12" ); + TextLabel12->setSizePolicy( QSizePolicy( (QSizePolicy::SizeType)0, (QSizePolicy::SizeType)0, 0, 0, TextLabel12->sizePolicy().hasHeightForWidth() ) ); + TextLabel12->setText( trUtf8( "TL12" ) ); + + Layout1->addWidget( TextLabel12, 2, 5 ); + + TextLabel13 = new QLabel( GroupBox1, "TextLabel13" ); + TextLabel13->setSizePolicy( QSizePolicy( (QSizePolicy::SizeType)0, (QSizePolicy::SizeType)0, 0, 0, TextLabel13->sizePolicy().hasHeightForWidth() ) ); + TextLabel13->setText( trUtf8( "TL13" ) ); + + Layout1->addWidget( TextLabel13, 3, 0 ); + + SpinBox12 = new QSpinBox( GroupBox1, "SpinBox12" ); + SpinBox12->setSizePolicy( QSizePolicy( (QSizePolicy::SizeType)7, (QSizePolicy::SizeType)0, 0, 0, SpinBox12->sizePolicy().hasHeightForWidth() ) ); + + Layout1->addWidget( SpinBox12, 3, 6 ); + + SpinBox11 = new QSpinBox( GroupBox1, "SpinBox11" ); + SpinBox11->setSizePolicy( QSizePolicy( (QSizePolicy::SizeType)7, (QSizePolicy::SizeType)0, 0, 0, SpinBox11->sizePolicy().hasHeightForWidth() ) ); + + Layout1->addWidget( SpinBox11, 3, 4 ); + + SpinBox9 = new QSpinBox( GroupBox1, "SpinBox9" ); + SpinBox9->setSizePolicy( QSizePolicy( (QSizePolicy::SizeType)7, (QSizePolicy::SizeType)0, 0, 0, SpinBox9->sizePolicy().hasHeightForWidth() ) ); + + Layout1->addWidget( SpinBox9, 2, 6 ); + + SpinBox8 = new QSpinBox( GroupBox1, "SpinBox8" ); + SpinBox8->setSizePolicy( QSizePolicy( (QSizePolicy::SizeType)7, (QSizePolicy::SizeType)0, 0, 0, SpinBox8->sizePolicy().hasHeightForWidth() ) ); + + Layout1->addWidget( SpinBox8, 2, 4 ); + + SpinBox7 = new QSpinBox( GroupBox1, "SpinBox7" ); + SpinBox7->setSizePolicy( QSizePolicy( (QSizePolicy::SizeType)7, (QSizePolicy::SizeType)0, 0, 0, SpinBox7->sizePolicy().hasHeightForWidth() ) ); + + Layout1->addWidget( SpinBox7, 2, 2 ); + + SpinBox6 = new QSpinBox( GroupBox1, "SpinBox6" ); + SpinBox6->setSizePolicy( QSizePolicy( (QSizePolicy::SizeType)7, (QSizePolicy::SizeType)0, 0, 0, SpinBox6->sizePolicy().hasHeightForWidth() ) ); + + Layout1->addWidget( SpinBox6, 1, 6 ); + + SpinBox3 = new QSpinBox( GroupBox1, "SpinBox3" ); + SpinBox3->setSizePolicy( QSizePolicy( (QSizePolicy::SizeType)7, (QSizePolicy::SizeType)0, 0, 0, SpinBox3->sizePolicy().hasHeightForWidth() ) ); + + Layout1->addWidget( SpinBox3, 0, 6 ); + + TextLabel16 = new QLabel( GroupBox1, "TextLabel16" ); + TextLabel16->setSizePolicy( QSizePolicy( (QSizePolicy::SizeType)0, (QSizePolicy::SizeType)0, 0, 0, TextLabel16->sizePolicy().hasHeightForWidth() ) ); + TextLabel16->setText( trUtf8( "TL16" ) ); + + Layout1->addWidget( TextLabel16, 3, 5 ); + + TextLabel1 = new QLabel( GroupBox1, "TextLabel1" ); + TextLabel1->setSizePolicy( QSizePolicy( (QSizePolicy::SizeType)0, (QSizePolicy::SizeType)0, 0, 0, TextLabel1->sizePolicy().hasHeightForWidth() ) ); + TextLabel1->setText( trUtf8( "TL1" ) ); + + Layout1->addWidget( TextLabel1, 0, 0 ); + + TextLabel10 = new QLabel( GroupBox1, "TextLabel10" ); + TextLabel10->setSizePolicy( QSizePolicy( (QSizePolicy::SizeType)0, (QSizePolicy::SizeType)0, 0, 0, TextLabel10->sizePolicy().hasHeightForWidth() ) ); + TextLabel10->setText( trUtf8( "TL10" ) ); + + Layout1->addWidget( TextLabel10, 2, 1 ); + + SpinBox4 = new QSpinBox( GroupBox1, "SpinBox4" ); + SpinBox4->setSizePolicy( QSizePolicy( (QSizePolicy::SizeType)7, (QSizePolicy::SizeType)0, 0, 0, SpinBox4->sizePolicy().hasHeightForWidth() ) ); + + Layout1->addWidget( SpinBox4, 1, 2 ); + + TextLabel6 = new QLabel( GroupBox1, "TextLabel6" ); + TextLabel6->setSizePolicy( QSizePolicy( (QSizePolicy::SizeType)0, (QSizePolicy::SizeType)0, 0, 0, TextLabel6->sizePolicy().hasHeightForWidth() ) ); + TextLabel6->setText( trUtf8( "TL6" ) ); + + Layout1->addWidget( TextLabel6, 1, 1 ); + + SpinBox10 = new QSpinBox( GroupBox1, "SpinBox10" ); + SpinBox10->setSizePolicy( QSizePolicy( (QSizePolicy::SizeType)7, (QSizePolicy::SizeType)0, 0, 0, SpinBox10->sizePolicy().hasHeightForWidth() ) ); + + Layout1->addWidget( SpinBox10, 3, 2 ); + + SpinBox2 = new QSpinBox( GroupBox1, "SpinBox2" ); + SpinBox2->setSizePolicy( QSizePolicy( (QSizePolicy::SizeType)7, (QSizePolicy::SizeType)0, 0, 0, SpinBox2->sizePolicy().hasHeightForWidth() ) ); + + Layout1->addWidget( SpinBox2, 0, 4 ); + + TextLabel2 = new QLabel( GroupBox1, "TextLabel2" ); + TextLabel2->setSizePolicy( QSizePolicy( (QSizePolicy::SizeType)0, (QSizePolicy::SizeType)0, 0, 0, TextLabel2->sizePolicy().hasHeightForWidth() ) ); + TextLabel2->setText( trUtf8( "TL2" ) ); + + Layout1->addWidget( TextLabel2, 0, 1 ); + + TextLabel9 = new QLabel( GroupBox1, "TextLabel9" ); + TextLabel9->setSizePolicy( QSizePolicy( (QSizePolicy::SizeType)0, (QSizePolicy::SizeType)0, 0, 0, TextLabel9->sizePolicy().hasHeightForWidth() ) ); + TextLabel9->setText( trUtf8( "TL9" ) ); + + Layout1->addWidget( TextLabel9, 2, 0 ); + + TextLabel5 = new QLabel( GroupBox1, "TextLabel5" ); + TextLabel5->setSizePolicy( QSizePolicy( (QSizePolicy::SizeType)0, (QSizePolicy::SizeType)0, 0, 0, TextLabel5->sizePolicy().hasHeightForWidth() ) ); + TextLabel5->setText( trUtf8( "TL5" ) ); + + Layout1->addWidget( TextLabel5, 1, 0 ); + + SpinBox1 = new QSpinBox( GroupBox1, "SpinBox1" ); + SpinBox1->setSizePolicy( QSizePolicy( (QSizePolicy::SizeType)7, (QSizePolicy::SizeType)0, 0, 0, SpinBox1->sizePolicy().hasHeightForWidth() ) ); + + Layout1->addWidget( SpinBox1, 0, 2 ); + + GroupBox1Layout->addLayout( Layout1, 0, 0 ); + + KinematicGUI_12Spin_QTDLayout->addWidget( GroupBox1, 0, 0 ); +} + +/* + * Destroys the object and frees any allocated resources + */ +KinematicGUI_12Spin_QTD::~KinematicGUI_12Spin_QTD() +{ + // no need to delete child widgets, Qt does it all for us +} + diff --git a/src/KinematicGUI/KinematicGUI_12Spin_QTD.h b/src/KinematicGUI/KinematicGUI_12Spin_QTD.h new file mode 100644 index 000000000..2b2f0412a --- /dev/null +++ b/src/KinematicGUI/KinematicGUI_12Spin_QTD.h @@ -0,0 +1,66 @@ +/**************************************************************************** +** Form interface generated from reading ui file 'KinematicGUI_12Spin_QTD.ui' +** +** Created: ven fév 6 12:39:44 2004 +** by: The User Interface Compiler (uic) +** +** WARNING! All changes made in this file will be lost! +****************************************************************************/ +#ifndef KINEMATICGUI_12SPIN_QTD_H +#define KINEMATICGUI_12SPIN_QTD_H + +#include +#include +class QVBoxLayout; +class QHBoxLayout; +class QGridLayout; +class QGroupBox; +class QLabel; +class QSpinBox; + +class KinematicGUI_12Spin_QTD : public QWidget +{ + Q_OBJECT + +public: + KinematicGUI_12Spin_QTD( QWidget* parent = 0, const char* name = 0, WFlags fl = 0 ); + ~KinematicGUI_12Spin_QTD(); + + QGroupBox* GroupBox1; + QLabel* TextLabel15; + QLabel* TextLabel14; + QSpinBox* SpinBox5; + QLabel* TextLabel3; + QLabel* TextLabel11; + QLabel* TextLabel8; + QLabel* TextLabel4; + QLabel* TextLabel7; + QLabel* TextLabel12; + QLabel* TextLabel13; + QSpinBox* SpinBox12; + QSpinBox* SpinBox11; + QSpinBox* SpinBox9; + QSpinBox* SpinBox8; + QSpinBox* SpinBox7; + QSpinBox* SpinBox6; + QSpinBox* SpinBox3; + QLabel* TextLabel16; + QLabel* TextLabel1; + QLabel* TextLabel10; + QSpinBox* SpinBox4; + QLabel* TextLabel6; + QSpinBox* SpinBox10; + QSpinBox* SpinBox2; + QLabel* TextLabel2; + QLabel* TextLabel9; + QLabel* TextLabel5; + QSpinBox* SpinBox1; + + +protected: + QGridLayout* KinematicGUI_12Spin_QTDLayout; + QGridLayout* GroupBox1Layout; + QGridLayout* Layout1; +}; + +#endif // KINEMATICGUI_12SPIN_QTD_H diff --git a/src/KinematicGUI/KinematicGUI_2Sel2Spin1Check.cxx b/src/KinematicGUI/KinematicGUI_2Sel2Spin1Check.cxx new file mode 100644 index 000000000..62db3cad7 --- /dev/null +++ b/src/KinematicGUI/KinematicGUI_2Sel2Spin1Check.cxx @@ -0,0 +1,57 @@ +// GEOM GEOMGUI : GUI for Geometry component +// +// Copyright (C) 2003 OPEN CASCADE, EADS/CCR, LIP6, CEA/DEN, +// CEDRAT, EDF R&D, LEG, PRINCIPIA R&D, BUREAU VERITAS +// +// This library is free software; you can redistribute it and/or +// modify it under the terms of the GNU Lesser General Public +// License as published by the Free Software Foundation; either +// version 2.1 of the License. +// +// This library is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU +// Lesser General Public License for more details. +// +// You should have received a copy of the GNU Lesser General Public +// License along with this library; if not, write to the Free Software +// Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307 USA +// +// See http://www.opencascade.org/SALOME/ or email : webmaster.salome@opencascade.org +// +// +// +// File : KinematicGUI_2Sel2Spin1Check.cxx +// Author : Damien COQUERET +// Module : GEOM +// $Header: + +#include "KinematicGUI_2Sel2Spin1Check.h" + +#include +#include +#include + +/* + * Constructs a KinematicGUI_2Sel2Spin1Check which is a child of 'parent', with the + * name 'name' and widget flags set to 'f' + */ +KinematicGUI_2Sel2Spin1Check::KinematicGUI_2Sel2Spin1Check(QWidget* parent, const char* name, WFlags fl) + :KinematicGUI_2Sel2Spin1Check_QTD(parent, name, fl) +{ + SpinBox1->close(TRUE); + SpinBox2->close(TRUE); + SpinBox_DX = new DlgRef_SpinBox(GroupBox1, "SpinBox_DX"); + SpinBox_DY = new DlgRef_SpinBox(GroupBox1, "SpinBox_DY"); + Layout2->addWidget(SpinBox_DX, 0, 1); + Layout2->addWidget(SpinBox_DY, 1, 1); +} + + +/* + * Destroys the object and frees any allocated resources + */ +KinematicGUI_2Sel2Spin1Check::~KinematicGUI_2Sel2Spin1Check() +{ + // no need to delete child widgets, Qt does it all for us +} diff --git a/src/KinematicGUI/KinematicGUI_2Sel2Spin1Check.h b/src/KinematicGUI/KinematicGUI_2Sel2Spin1Check.h new file mode 100644 index 000000000..a078dc060 --- /dev/null +++ b/src/KinematicGUI/KinematicGUI_2Sel2Spin1Check.h @@ -0,0 +1,48 @@ +// GEOM GEOMGUI : GUI for Geometry component +// +// Copyright (C) 2003 OPEN CASCADE, EADS/CCR, LIP6, CEA/DEN, +// CEDRAT, EDF R&D, LEG, PRINCIPIA R&D, BUREAU VERITAS +// +// This library is free software; you can redistribute it and/or +// modify it under the terms of the GNU Lesser General Public +// License as published by the Free Software Foundation; either +// version 2.1 of the License. +// +// This library is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU +// Lesser General Public License for more details. +// +// You should have received a copy of the GNU Lesser General Public +// License along with this library; if not, write to the Free Software +// Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307 USA +// +// See http://www.opencascade.org/SALOME/ or email : webmaster.salome@opencascade.org +// +// +// +// File : KinematicGUI_2Sel2Spin1Check.h +// Author : Damien COQUERET +// Module : GEOM +// $Header: + +#ifndef KINEMATICGUI_2SEL2SPIN1CHECK_H +#define KINEMATICGUI_2SEL2SPIN1CHECK_H + +#include "KinematicGUI_2Sel2Spin1Check_QTD.h" +#include "DlgRef_SpinBox.h" + +class KinematicGUI_2Sel2Spin1Check : public KinematicGUI_2Sel2Spin1Check_QTD +{ + Q_OBJECT + +public: + KinematicGUI_2Sel2Spin1Check( QWidget* parent = 0, const char* name = 0, WFlags fl = 0 ); + ~KinematicGUI_2Sel2Spin1Check(); + + DlgRef_SpinBox* SpinBox_DX; + DlgRef_SpinBox* SpinBox_DY; + +}; + +#endif // KINEMATICGUI_2SEL2SPIN1CHECK_H diff --git a/src/KinematicGUI/KinematicGUI_2Sel2Spin1Check_QTD.cxx b/src/KinematicGUI/KinematicGUI_2Sel2Spin1Check_QTD.cxx new file mode 100644 index 000000000..0591edc94 --- /dev/null +++ b/src/KinematicGUI/KinematicGUI_2Sel2Spin1Check_QTD.cxx @@ -0,0 +1,122 @@ +/**************************************************************************** +** Form implementation generated from reading ui file 'KinematicGUI_2Sel2Spin1Check_QTD.ui' +** +** Created: ven fév 6 18:56:14 2004 +** by: The User Interface Compiler (uic) +** +** WARNING! All changes made in this file will be lost! +****************************************************************************/ +#include "KinematicGUI_2Sel2Spin1Check_QTD.h" + +#include +#include +#include +#include +#include +#include +#include +#include +#include +#include + +/* + * Constructs a KinematicGUI_2Sel2Spin1Check_QTD which is a child of 'parent', with the + * name 'name' and widget flags set to 'f'. + */ +KinematicGUI_2Sel2Spin1Check_QTD::KinematicGUI_2Sel2Spin1Check_QTD( QWidget* parent, const char* name, WFlags fl ) + : QWidget( parent, name, fl ) +{ + if ( !name ) + setName( "KinematicGUI_2Sel2Spin1Check_QTD" ); + resize( 129, 164 ); + setCaption( trUtf8( "KinematicGUI_2Sel2Spin1Check_QTD" ) ); + KinematicGUI_2Sel2Spin1Check_QTDLayout = new QGridLayout( this, 1, 1, 0, 6, "KinematicGUI_2Sel2Spin1Check_QTDLayout"); + + GroupBox1 = new QGroupBox( this, "GroupBox1" ); + GroupBox1->setTitle( trUtf8( "" ) ); + GroupBox1->setColumnLayout(0, Qt::Vertical ); + GroupBox1->layout()->setSpacing( 6 ); + GroupBox1->layout()->setMargin( 11 ); + GroupBox1Layout = new QGridLayout( GroupBox1->layout() ); + GroupBox1Layout->setAlignment( Qt::AlignTop ); + + Layout1 = new QGridLayout( 0, 1, 1, 0, 6, "Layout1"); + + CheckButton1 = new QRadioButton( GroupBox1, "CheckButton1" ); + CheckButton1->setText( trUtf8( "" ) ); + + Layout1->addMultiCellWidget( CheckButton1, 3, 3, 0, 2 ); + + LineEdit1 = new QLineEdit( GroupBox1, "LineEdit1" ); + + Layout1->addWidget( LineEdit1, 0, 2 ); + + TextLabel1 = new QLabel( GroupBox1, "TextLabel1" ); + TextLabel1->setSizePolicy( QSizePolicy( (QSizePolicy::SizeType)0, (QSizePolicy::SizeType)0, 0, 0, TextLabel1->sizePolicy().hasHeightForWidth() ) ); + TextLabel1->setText( trUtf8( "TL1" ) ); + + Layout1->addWidget( TextLabel1, 0, 0 ); + + PushButton2 = new QPushButton( GroupBox1, "PushButton2" ); + PushButton2->setSizePolicy( QSizePolicy( (QSizePolicy::SizeType)0, (QSizePolicy::SizeType)0, 0, 0, PushButton2->sizePolicy().hasHeightForWidth() ) ); + PushButton2->setText( trUtf8( "" ) ); + + Layout1->addWidget( PushButton2, 1, 1 ); + + Layout2 = new QGridLayout( 0, 1, 1, 0, 6, "Layout2"); + + SpinBox2 = new QSpinBox( GroupBox1, "SpinBox2" ); + SpinBox2->setSizePolicy( QSizePolicy( (QSizePolicy::SizeType)7, (QSizePolicy::SizeType)0, 0, 0, SpinBox2->sizePolicy().hasHeightForWidth() ) ); + + Layout2->addWidget( SpinBox2, 1, 1 ); + + SpinBox1 = new QSpinBox( GroupBox1, "SpinBox1" ); + SpinBox1->setSizePolicy( QSizePolicy( (QSizePolicy::SizeType)7, (QSizePolicy::SizeType)0, 0, 0, SpinBox1->sizePolicy().hasHeightForWidth() ) ); + + Layout2->addWidget( SpinBox1, 0, 1 ); + + TextLabel4 = new QLabel( GroupBox1, "TextLabel4" ); + TextLabel4->setSizePolicy( QSizePolicy( (QSizePolicy::SizeType)0, (QSizePolicy::SizeType)0, 0, 0, TextLabel4->sizePolicy().hasHeightForWidth() ) ); + TextLabel4->setText( trUtf8( "TL4" ) ); + + Layout2->addWidget( TextLabel4, 1, 0 ); + + TextLabel3 = new QLabel( GroupBox1, "TextLabel3" ); + TextLabel3->setSizePolicy( QSizePolicy( (QSizePolicy::SizeType)0, (QSizePolicy::SizeType)0, 0, 0, TextLabel3->sizePolicy().hasHeightForWidth() ) ); + TextLabel3->setText( trUtf8( "TL3" ) ); + + Layout2->addWidget( TextLabel3, 0, 0 ); + + Layout1->addMultiCellLayout( Layout2, 2, 2, 0, 2 ); + + PushButton1 = new QPushButton( GroupBox1, "PushButton1" ); + PushButton1->setSizePolicy( QSizePolicy( (QSizePolicy::SizeType)0, (QSizePolicy::SizeType)0, 0, 0, PushButton1->sizePolicy().hasHeightForWidth() ) ); + PushButton1->setText( trUtf8( "" ) ); + + Layout1->addWidget( PushButton1, 0, 1 ); + QSpacerItem* spacer = new QSpacerItem( 0, 120, QSizePolicy::Minimum, QSizePolicy::Expanding ); + Layout1->addItem( spacer, 4, 2 ); + + TextLabel2 = new QLabel( GroupBox1, "TextLabel2" ); + TextLabel2->setSizePolicy( QSizePolicy( (QSizePolicy::SizeType)0, (QSizePolicy::SizeType)0, 0, 0, TextLabel2->sizePolicy().hasHeightForWidth() ) ); + TextLabel2->setText( trUtf8( "TL2" ) ); + + Layout1->addWidget( TextLabel2, 1, 0 ); + + LineEdit2 = new QLineEdit( GroupBox1, "LineEdit2" ); + + Layout1->addWidget( LineEdit2, 1, 2 ); + + GroupBox1Layout->addLayout( Layout1, 0, 0 ); + + KinematicGUI_2Sel2Spin1Check_QTDLayout->addWidget( GroupBox1, 0, 0 ); +} + +/* + * Destroys the object and frees any allocated resources + */ +KinematicGUI_2Sel2Spin1Check_QTD::~KinematicGUI_2Sel2Spin1Check_QTD() +{ + // no need to delete child widgets, Qt does it all for us +} + diff --git a/src/KinematicGUI/KinematicGUI_2Sel2Spin1Check_QTD.h b/src/KinematicGUI/KinematicGUI_2Sel2Spin1Check_QTD.h new file mode 100644 index 000000000..c16fec81b --- /dev/null +++ b/src/KinematicGUI/KinematicGUI_2Sel2Spin1Check_QTD.h @@ -0,0 +1,53 @@ +/**************************************************************************** +** Form interface generated from reading ui file 'KinematicGUI_2Sel2Spin1Check_QTD.ui' +** +** Created: ven fév 6 18:56:14 2004 +** by: The User Interface Compiler (uic) +** +** WARNING! All changes made in this file will be lost! +****************************************************************************/ +#ifndef KINEMATICGUI_2SEL2SPIN1CHECK_QTD_H +#define KINEMATICGUI_2SEL2SPIN1CHECK_QTD_H + +#include +#include +class QVBoxLayout; +class QHBoxLayout; +class QGridLayout; +class QGroupBox; +class QLabel; +class QLineEdit; +class QPushButton; +class QRadioButton; +class QSpinBox; + +class KinematicGUI_2Sel2Spin1Check_QTD : public QWidget +{ + Q_OBJECT + +public: + KinematicGUI_2Sel2Spin1Check_QTD( QWidget* parent = 0, const char* name = 0, WFlags fl = 0 ); + ~KinematicGUI_2Sel2Spin1Check_QTD(); + + QGroupBox* GroupBox1; + QRadioButton* CheckButton1; + QLineEdit* LineEdit1; + QLabel* TextLabel1; + QPushButton* PushButton2; + QSpinBox* SpinBox2; + QSpinBox* SpinBox1; + QLabel* TextLabel4; + QLabel* TextLabel3; + QPushButton* PushButton1; + QLabel* TextLabel2; + QLineEdit* LineEdit2; + + +protected: + QGridLayout* KinematicGUI_2Sel2Spin1Check_QTDLayout; + QGridLayout* GroupBox1Layout; + QGridLayout* Layout1; + QGridLayout* Layout2; +}; + +#endif // KINEMATICGUI_2SEL2SPIN1CHECK_QTD_H diff --git a/src/KinematicGUI/KinematicGUI_3List3Spin.cxx b/src/KinematicGUI/KinematicGUI_3List3Spin.cxx new file mode 100644 index 000000000..7cbc46c3f --- /dev/null +++ b/src/KinematicGUI/KinematicGUI_3List3Spin.cxx @@ -0,0 +1,60 @@ +// GEOM GEOMGUI : GUI for Geometry component +// +// Copyright (C) 2003 OPEN CASCADE, EADS/CCR, LIP6, CEA/DEN, +// CEDRAT, EDF R&D, LEG, PRINCIPIA R&D, BUREAU VERITAS +// +// This library is free software; you can redistribute it and/or +// modify it under the terms of the GNU Lesser General Public +// License as published by the Free Software Foundation; either +// version 2.1 of the License. +// +// This library is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU +// Lesser General Public License for more details. +// +// You should have received a copy of the GNU Lesser General Public +// License along with this library; if not, write to the Free Software +// Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307 USA +// +// See http://www.opencascade.org/SALOME/ or email : webmaster.salome@opencascade.org +// +// +// +// File : KinematicGUI_3List3Spin.cxx +// Author : Damien COQUERET +// Module : GEOM +// $Header: + +#include "KinematicGUI_3List3Spin.h" + +#include +#include +#include + +/* + * Constructs a KinematicGUI_3List3Spin which is a child of 'parent', with the + * name 'name' and widget flags set to 'f' + */ +KinematicGUI_3List3Spin::KinematicGUI_3List3Spin(QWidget* parent, const char* name, WFlags fl) + :KinematicGUI_3List3Spin_QTD(parent, name, fl) +{ + SpinBox1->close(TRUE); + SpinBox2->close(TRUE); + SpinBox3->close(TRUE); + SpinBox_DX = new DlgRef_SpinBox(GroupBox1, "SpinBox_DX"); + SpinBox_DY = new DlgRef_SpinBox(GroupBox1, "SpinBox_DY"); + SpinBox_DZ = new DlgRef_SpinBox(GroupBox1, "SpinBox_DZ"); + Layout1->addWidget(SpinBox_DX, 0, 3); + Layout1->addWidget(SpinBox_DY, 1, 3); + Layout1->addWidget(SpinBox_DZ, 2, 3); +} + + +/* + * Destroys the object and frees any allocated resources + */ +KinematicGUI_3List3Spin::~KinematicGUI_3List3Spin() +{ + // no need to delete child widgets, Qt does it all for us +} diff --git a/src/KinematicGUI/KinematicGUI_3List3Spin.h b/src/KinematicGUI/KinematicGUI_3List3Spin.h new file mode 100644 index 000000000..c1363fafb --- /dev/null +++ b/src/KinematicGUI/KinematicGUI_3List3Spin.h @@ -0,0 +1,49 @@ +// GEOM GEOMGUI : GUI for Geometry component +// +// Copyright (C) 2003 OPEN CASCADE, EADS/CCR, LIP6, CEA/DEN, +// CEDRAT, EDF R&D, LEG, PRINCIPIA R&D, BUREAU VERITAS +// +// This library is free software; you can redistribute it and/or +// modify it under the terms of the GNU Lesser General Public +// License as published by the Free Software Foundation; either +// version 2.1 of the License. +// +// This library is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU +// Lesser General Public License for more details. +// +// You should have received a copy of the GNU Lesser General Public +// License along with this library; if not, write to the Free Software +// Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307 USA +// +// See http://www.opencascade.org/SALOME/ or email : webmaster.salome@opencascade.org +// +// +// +// File : KinematicGUI_3List3Spin.h +// Author : Damien COQUERET +// Module : GEOM +// $Header: + +#ifndef KINEMATICGUI_3LIST3SPIN_H +#define KINEMATICGUI_3LIST3SPIN_H + +#include "KinematicGUI_3List3Spin_QTD.h" +#include "DlgRef_SpinBox.h" + +class KinematicGUI_3List3Spin : public KinematicGUI_3List3Spin_QTD +{ + Q_OBJECT + +public: + KinematicGUI_3List3Spin( QWidget* parent = 0, const char* name = 0, WFlags fl = 0 ); + ~KinematicGUI_3List3Spin(); + + DlgRef_SpinBox* SpinBox_DX; + DlgRef_SpinBox* SpinBox_DY; + DlgRef_SpinBox* SpinBox_DZ; + +}; + +#endif // KINEMATICGUI_3LIST3SPIN_H diff --git a/src/KinematicGUI/KinematicGUI_3List3Spin_QTD.cxx b/src/KinematicGUI/KinematicGUI_3List3Spin_QTD.cxx new file mode 100644 index 000000000..70b92345e --- /dev/null +++ b/src/KinematicGUI/KinematicGUI_3List3Spin_QTD.cxx @@ -0,0 +1,125 @@ +/**************************************************************************** +** Form implementation generated from reading ui file 'KinematicGUI_3List3Spin_QTD.ui' +** +** Created: mer fév 4 16:57:37 2004 +** by: The User Interface Compiler (uic) +** +** WARNING! All changes made in this file will be lost! +****************************************************************************/ +#include "KinematicGUI_3List3Spin_QTD.h" + +#include +#include +#include +#include +#include +#include +#include +#include +#include + +/* + * Constructs a KinematicGUI_3List3Spin_QTD which is a child of 'parent', with the + * name 'name' and widget flags set to 'f'. + */ +KinematicGUI_3List3Spin_QTD::KinematicGUI_3List3Spin_QTD( QWidget* parent, const char* name, WFlags fl ) + : QWidget( parent, name, fl ) +{ + if ( !name ) + setName( "KinematicGUI_3List3Spin_QTD" ); + resize( 279, 111 ); + setMinimumSize( QSize( 100, 0 ) ); + setCaption( trUtf8( "KinematicGUI_3List3Spin_QTD" ) ); + KinematicGUI_3List3Spin_QTDLayout = new QGridLayout( this, 1, 1, 0, 6, "KinematicGUI_3List3Spin_QTDLayout"); + + GroupBox1 = new QGroupBox( this, "GroupBox1" ); + GroupBox1->setTitle( trUtf8( "" ) ); + GroupBox1->setColumnLayout(0, Qt::Vertical ); + GroupBox1->layout()->setSpacing( 6 ); + GroupBox1->layout()->setMargin( 11 ); + GroupBox1Layout = new QGridLayout( GroupBox1->layout() ); + GroupBox1Layout->setAlignment( Qt::AlignTop ); + + Layout1 = new QGridLayout( 0, 1, 1, 0, 6, "Layout1"); + + TextLabel2 = new QLabel( GroupBox1, "TextLabel2" ); + TextLabel2->setSizePolicy( QSizePolicy( (QSizePolicy::SizeType)0, (QSizePolicy::SizeType)0, 0, 0, TextLabel2->sizePolicy().hasHeightForWidth() ) ); + TextLabel2->setText( trUtf8( "TL2" ) ); + + Layout1->addWidget( TextLabel2, 0, 2 ); + QSpacerItem* spacer = new QSpacerItem( 0, 100, QSizePolicy::Minimum, QSizePolicy::Expanding ); + Layout1->addItem( spacer, 3, 3 ); + + SpinBox1 = new QSpinBox( GroupBox1, "SpinBox1" ); + SpinBox1->setSizePolicy( QSizePolicy( (QSizePolicy::SizeType)7, (QSizePolicy::SizeType)0, 0, 0, SpinBox1->sizePolicy().hasHeightForWidth() ) ); + + Layout1->addWidget( SpinBox1, 0, 3 ); + + TextLabel4 = new QLabel( GroupBox1, "TextLabel4" ); + TextLabel4->setSizePolicy( QSizePolicy( (QSizePolicy::SizeType)0, (QSizePolicy::SizeType)0, 0, 0, TextLabel4->sizePolicy().hasHeightForWidth() ) ); + TextLabel4->setText( trUtf8( "TL4" ) ); + + Layout1->addWidget( TextLabel4, 1, 2 ); + + TextLabel3 = new QLabel( GroupBox1, "TextLabel3" ); + TextLabel3->setSizePolicy( QSizePolicy( (QSizePolicy::SizeType)0, (QSizePolicy::SizeType)0, 0, 0, TextLabel3->sizePolicy().hasHeightForWidth() ) ); + TextLabel3->setText( trUtf8( "TL3" ) ); + + Layout1->addWidget( TextLabel3, 1, 0 ); + + TextLabel1 = new QLabel( GroupBox1, "TextLabel1" ); + TextLabel1->setSizePolicy( QSizePolicy( (QSizePolicy::SizeType)0, (QSizePolicy::SizeType)0, 0, 0, TextLabel1->sizePolicy().hasHeightForWidth() ) ); + TextLabel1->setText( trUtf8( "TL1" ) ); + + Layout1->addWidget( TextLabel1, 0, 0 ); + + ComboBox3 = new QComboBox( FALSE, GroupBox1, "ComboBox3" ); + ComboBox3->setSizePolicy( QSizePolicy( (QSizePolicy::SizeType)7, (QSizePolicy::SizeType)0, 0, 0, ComboBox3->sizePolicy().hasHeightForWidth() ) ); + + Layout1->addWidget( ComboBox3, 2, 1 ); + + SpinBox2 = new QSpinBox( GroupBox1, "SpinBox2" ); + SpinBox2->setSizePolicy( QSizePolicy( (QSizePolicy::SizeType)7, (QSizePolicy::SizeType)0, 0, 0, SpinBox2->sizePolicy().hasHeightForWidth() ) ); + + Layout1->addWidget( SpinBox2, 1, 3 ); + + SpinBox3 = new QSpinBox( GroupBox1, "SpinBox3" ); + SpinBox3->setSizePolicy( QSizePolicy( (QSizePolicy::SizeType)7, (QSizePolicy::SizeType)0, 0, 0, SpinBox3->sizePolicy().hasHeightForWidth() ) ); + + Layout1->addWidget( SpinBox3, 2, 3 ); + + TextLabel6 = new QLabel( GroupBox1, "TextLabel6" ); + TextLabel6->setSizePolicy( QSizePolicy( (QSizePolicy::SizeType)0, (QSizePolicy::SizeType)0, 0, 0, TextLabel6->sizePolicy().hasHeightForWidth() ) ); + TextLabel6->setText( trUtf8( "TL6" ) ); + + Layout1->addWidget( TextLabel6, 2, 2 ); + + ComboBox1 = new QComboBox( FALSE, GroupBox1, "ComboBox1" ); + ComboBox1->setSizePolicy( QSizePolicy( (QSizePolicy::SizeType)7, (QSizePolicy::SizeType)0, 0, 0, ComboBox1->sizePolicy().hasHeightForWidth() ) ); + + Layout1->addWidget( ComboBox1, 0, 1 ); + + ComboBox2 = new QComboBox( FALSE, GroupBox1, "ComboBox2" ); + ComboBox2->setSizePolicy( QSizePolicy( (QSizePolicy::SizeType)7, (QSizePolicy::SizeType)0, 0, 0, ComboBox2->sizePolicy().hasHeightForWidth() ) ); + + Layout1->addWidget( ComboBox2, 1, 1 ); + + TextLabel5 = new QLabel( GroupBox1, "TextLabel5" ); + TextLabel5->setSizePolicy( QSizePolicy( (QSizePolicy::SizeType)0, (QSizePolicy::SizeType)0, 0, 0, TextLabel5->sizePolicy().hasHeightForWidth() ) ); + TextLabel5->setText( trUtf8( "TL5" ) ); + + Layout1->addWidget( TextLabel5, 2, 0 ); + + GroupBox1Layout->addLayout( Layout1, 0, 0 ); + + KinematicGUI_3List3Spin_QTDLayout->addWidget( GroupBox1, 0, 0 ); +} + +/* + * Destroys the object and frees any allocated resources + */ +KinematicGUI_3List3Spin_QTD::~KinematicGUI_3List3Spin_QTD() +{ + // no need to delete child widgets, Qt does it all for us +} + diff --git a/src/KinematicGUI/KinematicGUI_3List3Spin_QTD.h b/src/KinematicGUI/KinematicGUI_3List3Spin_QTD.h new file mode 100644 index 000000000..9d8c70251 --- /dev/null +++ b/src/KinematicGUI/KinematicGUI_3List3Spin_QTD.h @@ -0,0 +1,51 @@ +/**************************************************************************** +** Form interface generated from reading ui file 'KinematicGUI_3List3Spin_QTD.ui' +** +** Created: mer fév 4 16:57:37 2004 +** by: The User Interface Compiler (uic) +** +** WARNING! All changes made in this file will be lost! +****************************************************************************/ +#ifndef KINEMATICGUI_3LIST3SPIN_QTD_H +#define KINEMATICGUI_3LIST3SPIN_QTD_H + +#include +#include +class QVBoxLayout; +class QHBoxLayout; +class QGridLayout; +class QComboBox; +class QGroupBox; +class QLabel; +class QSpinBox; + +class KinematicGUI_3List3Spin_QTD : public QWidget +{ + Q_OBJECT + +public: + KinematicGUI_3List3Spin_QTD( QWidget* parent = 0, const char* name = 0, WFlags fl = 0 ); + ~KinematicGUI_3List3Spin_QTD(); + + QGroupBox* GroupBox1; + QLabel* TextLabel2; + QSpinBox* SpinBox1; + QLabel* TextLabel4; + QLabel* TextLabel3; + QLabel* TextLabel1; + QComboBox* ComboBox3; + QSpinBox* SpinBox2; + QSpinBox* SpinBox3; + QLabel* TextLabel6; + QComboBox* ComboBox1; + QComboBox* ComboBox2; + QLabel* TextLabel5; + + +protected: + QGridLayout* KinematicGUI_3List3Spin_QTDLayout; + QGridLayout* GroupBox1Layout; + QGridLayout* Layout1; +}; + +#endif // KINEMATICGUI_3LIST3SPIN_QTD_H diff --git a/src/KinematicGUI/KinematicGUI_3Sel1List_QTD.cxx b/src/KinematicGUI/KinematicGUI_3Sel1List_QTD.cxx new file mode 100644 index 000000000..67ac66dd4 --- /dev/null +++ b/src/KinematicGUI/KinematicGUI_3Sel1List_QTD.cxx @@ -0,0 +1,117 @@ +/**************************************************************************** +** Form implementation generated from reading ui file 'KinematicGUI_3Sel1List_QTD.ui' +** +** Created: mer fév 4 13:09:40 2004 +** by: The User Interface Compiler (uic) +** +** WARNING! All changes made in this file will be lost! +****************************************************************************/ +#include "KinematicGUI_3Sel1List_QTD.h" + +#include +#include +#include +#include +#include +#include +#include +#include +#include + +/* + * Constructs a KinematicGUI_3Sel1List_QTD which is a child of 'parent', with the + * name 'name' and widget flags set to 'f'. + */ +KinematicGUI_3Sel1List_QTD::KinematicGUI_3Sel1List_QTD( QWidget* parent, const char* name, WFlags fl ) + : QWidget( parent, name, fl ) +{ + if ( !name ) + setName( "KinematicGUI_3Sel1List_QTD" ); + resize( 129, 145 ); + setCaption( trUtf8( "KinematicGUI_3Sel1List_QTD" ) ); + KinematicGUI_3Sel1List_QTDLayout = new QGridLayout( this, 1, 1, 0, 6, "KinematicGUI_3Sel1List_QTDLayout"); + + GroupBox1 = new QGroupBox( this, "GroupBox1" ); + GroupBox1->setTitle( trUtf8( "" ) ); + GroupBox1->setColumnLayout(0, Qt::Vertical ); + GroupBox1->layout()->setSpacing( 6 ); + GroupBox1->layout()->setMargin( 11 ); + GroupBox1Layout = new QGridLayout( GroupBox1->layout() ); + GroupBox1Layout->setAlignment( Qt::AlignTop ); + + Layout1 = new QGridLayout( 0, 1, 1, 0, 6, "Layout1"); + QSpacerItem* spacer = new QSpacerItem( 0, 90, QSizePolicy::Minimum, QSizePolicy::Expanding ); + Layout1->addItem( spacer, 4, 2 ); + + PushButton2 = new QPushButton( GroupBox1, "PushButton2" ); + PushButton2->setSizePolicy( QSizePolicy( (QSizePolicy::SizeType)0, (QSizePolicy::SizeType)0, 0, 0, PushButton2->sizePolicy().hasHeightForWidth() ) ); + PushButton2->setText( trUtf8( "" ) ); + + Layout1->addWidget( PushButton2, 2, 1 ); + + TextLabel1 = new QLabel( GroupBox1, "TextLabel1" ); + TextLabel1->setSizePolicy( QSizePolicy( (QSizePolicy::SizeType)0, (QSizePolicy::SizeType)0, 0, 0, TextLabel1->sizePolicy().hasHeightForWidth() ) ); + TextLabel1->setText( trUtf8( "TL1" ) ); + + Layout1->addWidget( TextLabel1, 0, 0 ); + + TextLabel4 = new QLabel( GroupBox1, "TextLabel4" ); + TextLabel4->setSizePolicy( QSizePolicy( (QSizePolicy::SizeType)0, (QSizePolicy::SizeType)0, 0, 0, TextLabel4->sizePolicy().hasHeightForWidth() ) ); + TextLabel4->setText( trUtf8( "TL4" ) ); + + Layout1->addWidget( TextLabel4, 3, 0 ); + + LineEdit1 = new QLineEdit( GroupBox1, "LineEdit1" ); + + Layout1->addWidget( LineEdit1, 0, 2 ); + + PushButton1 = new QPushButton( GroupBox1, "PushButton1" ); + PushButton1->setSizePolicy( QSizePolicy( (QSizePolicy::SizeType)0, (QSizePolicy::SizeType)0, 0, 0, PushButton1->sizePolicy().hasHeightForWidth() ) ); + PushButton1->setText( trUtf8( "" ) ); + + Layout1->addWidget( PushButton1, 0, 1 ); + + TextLabel3 = new QLabel( GroupBox1, "TextLabel3" ); + TextLabel3->setSizePolicy( QSizePolicy( (QSizePolicy::SizeType)0, (QSizePolicy::SizeType)0, 0, 0, TextLabel3->sizePolicy().hasHeightForWidth() ) ); + TextLabel3->setText( trUtf8( "TL3" ) ); + + Layout1->addWidget( TextLabel3, 2, 0 ); + + PushButton3 = new QPushButton( GroupBox1, "PushButton3" ); + PushButton3->setSizePolicy( QSizePolicy( (QSizePolicy::SizeType)0, (QSizePolicy::SizeType)0, 0, 0, PushButton3->sizePolicy().hasHeightForWidth() ) ); + PushButton3->setText( trUtf8( "" ) ); + + Layout1->addWidget( PushButton3, 3, 1 ); + + ComboBox1 = new QComboBox( FALSE, GroupBox1, "ComboBox1" ); + ComboBox1->setSizePolicy( QSizePolicy( (QSizePolicy::SizeType)7, (QSizePolicy::SizeType)0, 0, 0, ComboBox1->sizePolicy().hasHeightForWidth() ) ); + + Layout1->addWidget( ComboBox1, 1, 2 ); + + LineEdit2 = new QLineEdit( GroupBox1, "LineEdit2" ); + + Layout1->addWidget( LineEdit2, 2, 2 ); + + LineEdit3 = new QLineEdit( GroupBox1, "LineEdit3" ); + + Layout1->addWidget( LineEdit3, 3, 2 ); + + TextLabel2 = new QLabel( GroupBox1, "TextLabel2" ); + TextLabel2->setSizePolicy( QSizePolicy( (QSizePolicy::SizeType)0, (QSizePolicy::SizeType)0, 0, 0, TextLabel2->sizePolicy().hasHeightForWidth() ) ); + TextLabel2->setText( trUtf8( "TL2" ) ); + + Layout1->addWidget( TextLabel2, 1, 0 ); + + GroupBox1Layout->addLayout( Layout1, 0, 0 ); + + KinematicGUI_3Sel1List_QTDLayout->addWidget( GroupBox1, 0, 0 ); +} + +/* + * Destroys the object and frees any allocated resources + */ +KinematicGUI_3Sel1List_QTD::~KinematicGUI_3Sel1List_QTD() +{ + // no need to delete child widgets, Qt does it all for us +} + diff --git a/src/KinematicGUI/KinematicGUI_3Sel1List_QTD.h b/src/KinematicGUI/KinematicGUI_3Sel1List_QTD.h new file mode 100644 index 000000000..e9cbbe2b4 --- /dev/null +++ b/src/KinematicGUI/KinematicGUI_3Sel1List_QTD.h @@ -0,0 +1,51 @@ +/**************************************************************************** +** Form interface generated from reading ui file 'KinematicGUI_3Sel1List_QTD.ui' +** +** Created: mer fév 4 13:09:40 2004 +** by: The User Interface Compiler (uic) +** +** WARNING! All changes made in this file will be lost! +****************************************************************************/ +#ifndef KINEMATICGUI_3SEL1LIST_QTD_H +#define KINEMATICGUI_3SEL1LIST_QTD_H + +#include +#include +class QVBoxLayout; +class QHBoxLayout; +class QGridLayout; +class QComboBox; +class QGroupBox; +class QLabel; +class QLineEdit; +class QPushButton; + +class KinematicGUI_3Sel1List_QTD : public QWidget +{ + Q_OBJECT + +public: + KinematicGUI_3Sel1List_QTD( QWidget* parent = 0, const char* name = 0, WFlags fl = 0 ); + ~KinematicGUI_3Sel1List_QTD(); + + QGroupBox* GroupBox1; + QPushButton* PushButton2; + QLabel* TextLabel1; + QLabel* TextLabel4; + QLineEdit* LineEdit1; + QPushButton* PushButton1; + QLabel* TextLabel3; + QPushButton* PushButton3; + QComboBox* ComboBox1; + QLineEdit* LineEdit2; + QLineEdit* LineEdit3; + QLabel* TextLabel2; + + +protected: + QGridLayout* KinematicGUI_3Sel1List_QTDLayout; + QGridLayout* GroupBox1Layout; + QGridLayout* Layout1; +}; + +#endif // KINEMATICGUI_3SEL1LIST_QTD_H diff --git a/src/KinematicGUI/KinematicGUI_3Sel1Spin.cxx b/src/KinematicGUI/KinematicGUI_3Sel1Spin.cxx new file mode 100644 index 000000000..b4e46acd9 --- /dev/null +++ b/src/KinematicGUI/KinematicGUI_3Sel1Spin.cxx @@ -0,0 +1,54 @@ +// GEOM GEOMGUI : GUI for Geometry component +// +// Copyright (C) 2003 OPEN CASCADE, EADS/CCR, LIP6, CEA/DEN, +// CEDRAT, EDF R&D, LEG, PRINCIPIA R&D, BUREAU VERITAS +// +// This library is free software; you can redistribute it and/or +// modify it under the terms of the GNU Lesser General Public +// License as published by the Free Software Foundation; either +// version 2.1 of the License. +// +// This library is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU +// Lesser General Public License for more details. +// +// You should have received a copy of the GNU Lesser General Public +// License along with this library; if not, write to the Free Software +// Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307 USA +// +// See http://www.opencascade.org/SALOME/ or email : webmaster.salome@opencascade.org +// +// +// +// File : KinematicGUI_3Sel1Spin.cxx +// Author : Damien COQUERET +// Module : GEOM +// $Header: + +#include "KinematicGUI_3Sel1Spin.h" + +#include +#include +#include + +/* + * Constructs a KinematicGUI_3Sel1Spin which is a child of 'parent', with the + * name 'name' and widget flags set to 'f' + */ +KinematicGUI_3Sel1Spin::KinematicGUI_3Sel1Spin(QWidget* parent, const char* name, WFlags fl) + :KinematicGUI_3Sel1Spin_QTD(parent, name, fl) +{ + SpinBox1->close(TRUE); + SpinBox_DX = new DlgRef_SpinBox(GroupBox1, "SpinBox_DX"); + Layout2->addWidget(SpinBox_DX, 0, 1); +} + + +/* + * Destroys the object and frees any allocated resources + */ +KinematicGUI_3Sel1Spin::~KinematicGUI_3Sel1Spin() +{ + // no need to delete child widgets, Qt does it all for us +} diff --git a/src/KinematicGUI/KinematicGUI_3Sel1Spin.h b/src/KinematicGUI/KinematicGUI_3Sel1Spin.h new file mode 100644 index 000000000..143274ed2 --- /dev/null +++ b/src/KinematicGUI/KinematicGUI_3Sel1Spin.h @@ -0,0 +1,47 @@ +// GEOM GEOMGUI : GUI for Geometry component +// +// Copyright (C) 2003 OPEN CASCADE, EADS/CCR, LIP6, CEA/DEN, +// CEDRAT, EDF R&D, LEG, PRINCIPIA R&D, BUREAU VERITAS +// +// This library is free software; you can redistribute it and/or +// modify it under the terms of the GNU Lesser General Public +// License as published by the Free Software Foundation; either +// version 2.1 of the License. +// +// This library is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU +// Lesser General Public License for more details. +// +// You should have received a copy of the GNU Lesser General Public +// License along with this library; if not, write to the Free Software +// Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307 USA +// +// See http://www.opencascade.org/SALOME/ or email : webmaster.salome@opencascade.org +// +// +// +// File : KinematicGUI_3Sel1Spin.h +// Author : Damien COQUERET +// Module : GEOM +// $Header: + +#ifndef KINEMATICGUI_3SEL1SPIN_H +#define KINEMATICGUI_3SEL1SPIN_H + +#include "KinematicGUI_3Sel1Spin_QTD.h" +#include "DlgRef_SpinBox.h" + +class KinematicGUI_3Sel1Spin : public KinematicGUI_3Sel1Spin_QTD +{ + Q_OBJECT + +public: + KinematicGUI_3Sel1Spin( QWidget* parent = 0, const char* name = 0, WFlags fl = 0 ); + ~KinematicGUI_3Sel1Spin(); + + DlgRef_SpinBox* SpinBox_DX; + +}; + +#endif // KINEMATICGUI_3SEL1SPIN_H diff --git a/src/KinematicGUI/KinematicGUI_3Sel1Spin_QTD.cxx b/src/KinematicGUI/KinematicGUI_3Sel1Spin_QTD.cxx new file mode 100644 index 000000000..bb5c78728 --- /dev/null +++ b/src/KinematicGUI/KinematicGUI_3Sel1Spin_QTD.cxx @@ -0,0 +1,121 @@ +/**************************************************************************** +** Form implementation generated from reading ui file 'KinematicGUI_3Sel1Spin_QTD.ui' +** +** Created: mer fév 4 13:09:41 2004 +** by: The User Interface Compiler (uic) +** +** WARNING! All changes made in this file will be lost! +****************************************************************************/ +#include "KinematicGUI_3Sel1Spin_QTD.h" + +#include +#include +#include +#include +#include +#include +#include +#include +#include + +/* + * Constructs a KinematicGUI_3Sel1Spin_QTD which is a child of 'parent', with the + * name 'name' and widget flags set to 'f'. + */ +KinematicGUI_3Sel1Spin_QTD::KinematicGUI_3Sel1Spin_QTD( QWidget* parent, const char* name, WFlags fl ) + : QWidget( parent, name, fl ) +{ + if ( !name ) + setName( "KinematicGUI_3Sel1Spin_QTD" ); + resize( 129, 147 ); + setCaption( trUtf8( "KinematicGUI_3Sel1Spin_QTD" ) ); + KinematicGUI_3Sel1Spin_QTDLayout = new QGridLayout( this, 1, 1, 0, 6, "KinematicGUI_3Sel1Spin_QTDLayout"); + + GroupBox1 = new QGroupBox( this, "GroupBox1" ); + GroupBox1->setTitle( trUtf8( "" ) ); + GroupBox1->setColumnLayout(0, Qt::Vertical ); + GroupBox1->layout()->setSpacing( 6 ); + GroupBox1->layout()->setMargin( 11 ); + GroupBox1Layout = new QGridLayout( GroupBox1->layout() ); + GroupBox1Layout->setAlignment( Qt::AlignTop ); + + Layout1 = new QGridLayout( 0, 1, 1, 0, 6, "Layout1"); + + LineEdit1 = new QLineEdit( GroupBox1, "LineEdit1" ); + + Layout1->addWidget( LineEdit1, 0, 2 ); + + PushButton3 = new QPushButton( GroupBox1, "PushButton3" ); + PushButton3->setSizePolicy( QSizePolicy( (QSizePolicy::SizeType)0, (QSizePolicy::SizeType)0, 0, 0, PushButton3->sizePolicy().hasHeightForWidth() ) ); + PushButton3->setText( trUtf8( "" ) ); + + Layout1->addWidget( PushButton3, 2, 1 ); + + Layout2 = new QGridLayout( 0, 1, 1, 0, 6, "Layout2"); + + TextLabel4 = new QLabel( GroupBox1, "TextLabel4" ); + TextLabel4->setSizePolicy( QSizePolicy( (QSizePolicy::SizeType)0, (QSizePolicy::SizeType)0, 0, 0, TextLabel4->sizePolicy().hasHeightForWidth() ) ); + TextLabel4->setText( trUtf8( "TL4" ) ); + + Layout2->addWidget( TextLabel4, 0, 0 ); + + SpinBox1 = new QSpinBox( GroupBox1, "SpinBox1" ); + SpinBox1->setSizePolicy( QSizePolicy( (QSizePolicy::SizeType)7, (QSizePolicy::SizeType)0, 0, 0, SpinBox1->sizePolicy().hasHeightForWidth() ) ); + + Layout2->addWidget( SpinBox1, 0, 1 ); + + Layout1->addMultiCellLayout( Layout2, 3, 3, 0, 2 ); + + TextLabel3 = new QLabel( GroupBox1, "TextLabel3" ); + TextLabel3->setSizePolicy( QSizePolicy( (QSizePolicy::SizeType)0, (QSizePolicy::SizeType)0, 0, 0, TextLabel3->sizePolicy().hasHeightForWidth() ) ); + TextLabel3->setText( trUtf8( "TL3" ) ); + + Layout1->addWidget( TextLabel3, 2, 0 ); + + LineEdit3 = new QLineEdit( GroupBox1, "LineEdit3" ); + + Layout1->addWidget( LineEdit3, 2, 2 ); + + LineEdit2 = new QLineEdit( GroupBox1, "LineEdit2" ); + + Layout1->addWidget( LineEdit2, 1, 2 ); + + PushButton2 = new QPushButton( GroupBox1, "PushButton2" ); + PushButton2->setSizePolicy( QSizePolicy( (QSizePolicy::SizeType)0, (QSizePolicy::SizeType)0, 0, 0, PushButton2->sizePolicy().hasHeightForWidth() ) ); + PushButton2->setText( trUtf8( "" ) ); + + Layout1->addWidget( PushButton2, 1, 1 ); + + TextLabel2 = new QLabel( GroupBox1, "TextLabel2" ); + TextLabel2->setSizePolicy( QSizePolicy( (QSizePolicy::SizeType)0, (QSizePolicy::SizeType)0, 0, 0, TextLabel2->sizePolicy().hasHeightForWidth() ) ); + TextLabel2->setText( trUtf8( "TL2" ) ); + + Layout1->addWidget( TextLabel2, 1, 0 ); + QSpacerItem* spacer = new QSpacerItem( 0, 100, QSizePolicy::Minimum, QSizePolicy::Expanding ); + Layout1->addItem( spacer, 4, 2 ); + + TextLabel1 = new QLabel( GroupBox1, "TextLabel1" ); + TextLabel1->setSizePolicy( QSizePolicy( (QSizePolicy::SizeType)0, (QSizePolicy::SizeType)0, 0, 0, TextLabel1->sizePolicy().hasHeightForWidth() ) ); + TextLabel1->setText( trUtf8( "TL1" ) ); + + Layout1->addWidget( TextLabel1, 0, 0 ); + + PushButton1 = new QPushButton( GroupBox1, "PushButton1" ); + PushButton1->setSizePolicy( QSizePolicy( (QSizePolicy::SizeType)0, (QSizePolicy::SizeType)0, 0, 0, PushButton1->sizePolicy().hasHeightForWidth() ) ); + PushButton1->setText( trUtf8( "" ) ); + + Layout1->addWidget( PushButton1, 0, 1 ); + + GroupBox1Layout->addLayout( Layout1, 0, 0 ); + + KinematicGUI_3Sel1Spin_QTDLayout->addWidget( GroupBox1, 0, 0 ); +} + +/* + * Destroys the object and frees any allocated resources + */ +KinematicGUI_3Sel1Spin_QTD::~KinematicGUI_3Sel1Spin_QTD() +{ + // no need to delete child widgets, Qt does it all for us +} + diff --git a/src/KinematicGUI/KinematicGUI_3Sel1Spin_QTD.h b/src/KinematicGUI/KinematicGUI_3Sel1Spin_QTD.h new file mode 100644 index 000000000..dac9815e2 --- /dev/null +++ b/src/KinematicGUI/KinematicGUI_3Sel1Spin_QTD.h @@ -0,0 +1,52 @@ +/**************************************************************************** +** Form interface generated from reading ui file 'KinematicGUI_3Sel1Spin_QTD.ui' +** +** Created: mer fév 4 13:09:40 2004 +** by: The User Interface Compiler (uic) +** +** WARNING! All changes made in this file will be lost! +****************************************************************************/ +#ifndef KINEMATICGUI_3SEL1SPIN_QTD_H +#define KINEMATICGUI_3SEL1SPIN_QTD_H + +#include +#include +class QVBoxLayout; +class QHBoxLayout; +class QGridLayout; +class QGroupBox; +class QLabel; +class QLineEdit; +class QPushButton; +class QSpinBox; + +class KinematicGUI_3Sel1Spin_QTD : public QWidget +{ + Q_OBJECT + +public: + KinematicGUI_3Sel1Spin_QTD( QWidget* parent = 0, const char* name = 0, WFlags fl = 0 ); + ~KinematicGUI_3Sel1Spin_QTD(); + + QGroupBox* GroupBox1; + QLineEdit* LineEdit1; + QPushButton* PushButton3; + QLabel* TextLabel4; + QSpinBox* SpinBox1; + QLabel* TextLabel3; + QLineEdit* LineEdit3; + QLineEdit* LineEdit2; + QPushButton* PushButton2; + QLabel* TextLabel2; + QLabel* TextLabel1; + QPushButton* PushButton1; + + +protected: + QGridLayout* KinematicGUI_3Sel1Spin_QTDLayout; + QGridLayout* GroupBox1Layout; + QGridLayout* Layout1; + QGridLayout* Layout2; +}; + +#endif // KINEMATICGUI_3SEL1SPIN_QTD_H diff --git a/src/KinematicGUI/KinematicGUI_AnimationDlg.cxx b/src/KinematicGUI/KinematicGUI_AnimationDlg.cxx new file mode 100644 index 000000000..8e7d8c983 --- /dev/null +++ b/src/KinematicGUI/KinematicGUI_AnimationDlg.cxx @@ -0,0 +1,284 @@ +// GEOM GEOMGUI : GUI for Geometry component +// +// Copyright (C) 2003 OPEN CASCADE, EADS/CCR, LIP6, CEA/DEN, +// CEDRAT, EDF R&D, LEG, PRINCIPIA R&D, BUREAU VERITAS +// +// This library is free software; you can redistribute it and/or +// modify it under the terms of the GNU Lesser General Public +// License as published by the Free Software Foundation; either +// version 2.1 of the License. +// +// This library is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU +// Lesser General Public License for more details. +// +// You should have received a copy of the GNU Lesser General Public +// License along with this library; if not, write to the Free Software +// Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307 USA +// +// See http://www.opencascade.org/SALOME/ or email : webmaster.salome@opencascade.org +// +// +// +// File : KinematicGUI_AnimationDlg.cxx +// Author : Damien COQUERET +// Module : GEOM +// $Header: + +using namespace std; +#include "KinematicGUI_AnimationDlg.h" + +//================================================================================= +// class : KinematicGUI_AnimationDlg() +// purpose : Constructs a KinematicGUI_AnimationDlg which is a child of 'parent', with the +// name 'name' and widget flags set to 'f'. +// The dialog will by default be modeless, unless you set 'modal' to +// TRUE to construct a modal dialog. +//================================================================================= +KinematicGUI_AnimationDlg::KinematicGUI_AnimationDlg(QWidget* parent, const char* name, KinematicGUI* theKinematicGUI, SALOME_Selection* Sel, bool modal, WFlags fl) + :GEOMBase_Skeleton(parent, name, Sel, modal, WStyle_Customize | WStyle_NormalBorder | WStyle_Title | WStyle_SysMenu) +{ + QPixmap image0(QAD_Desktop::getResourceManager()->loadPixmap("GEOM",tr("ICON_ANIMATION"))); + QPixmap image1(QAD_Desktop::getResourceManager()->loadPixmap("GEOM",tr("ICON_SELECT"))); + + setCaption(tr("GEOM_ANIMATION_TITLE")); + + /***************************************************************/ + GroupConstructors->setTitle(tr("GEOM_ANIMATION")); + RadioButton1->setPixmap(image0); + RadioButton2->close(TRUE); + RadioButton3->close(TRUE); + + Group1 = new KinematicGUI_2Sel2Spin1Check(this, "Group1"); + Group1->GroupBox1->setTitle(tr("GEOM_ARGUMENTS")); + Group1->TextLabel1->setText(tr("GEOM_ASSEMBLY")); + Group1->TextLabel2->setText(tr("GEOM_FRAME")); + Group1->TextLabel3->setText(tr("GEOM_DURATION")); + Group1->TextLabel4->setText(tr("GEOM_NBSEQ")); + Group1->CheckButton1->setText(tr("GEOM_IS_IN_LOOP")); + Group1->PushButton1->setPixmap(image1); + Group1->PushButton2->setPixmap(image1); + + Layout1->addWidget(Group1, 1, 0); + /***************************************************************/ + + /* Initialisation */ + myKinematicGUI = theKinematicGUI; + Init(); +} + + +//================================================================================= +// function : ~KinematicGUI_AnimationDlg() +// purpose : Destroys the object and frees any allocated resources +//================================================================================= +KinematicGUI_AnimationDlg::~KinematicGUI_AnimationDlg() +{ + /* no need to delete child widgets, Qt does it all for us */ +} + + + +//================================================================================= +// function : Init() +// purpose : +//================================================================================= +void KinematicGUI_AnimationDlg::Init() +{ + /* init variables */ + myEditCurrentArgument = Group1->LineEdit1; + myOkAssembly = myOkShape1 = false; + + myDuration = 5.0; + myNbSeq = 50; + /* min, max, step and decimals for spin boxes & initial values */ + Group1->SpinBox_DX->RangeStepAndValidator(0.001, 99999.999, 0.1, 3); + Group1->SpinBox_DY->RangeStepAndValidator(1, 99999.999, 5, 3); + + Group1->SpinBox_DX->SetValue(myDuration); + Group1->SpinBox_DY->SetValue(myNbSeq); + + Group1->CheckButton1->setEnabled(false); + + /* signals and slots connections */ + connect(buttonOk, SIGNAL(clicked()), this, SLOT(ClickOnOk())); + connect(buttonApply, SIGNAL(clicked()), this, SLOT(ClickOnApply())); + + connect(Group1->LineEdit1, SIGNAL(returnPressed()), this, SLOT(LineEditReturnPressed())); + connect(Group1->LineEdit2, SIGNAL(returnPressed()), this, SLOT(LineEditReturnPressed())); + + connect(Group1->PushButton1, SIGNAL(clicked()), this, SLOT(SetEditCurrentArgument())); + connect(Group1->PushButton2, SIGNAL(clicked()), this, SLOT(SetEditCurrentArgument())); + + connect(Group1->SpinBox_DX, SIGNAL(valueChanged(double)), this, SLOT(ValueChangedInSpinBox(double))); + connect(Group1->SpinBox_DY, SIGNAL(valueChanged(double)), this, SLOT(ValueChangedInSpinBox(double))); + connect(myGeomGUI, SIGNAL(SignalDefaultStepValueChanged(double)), Group1->SpinBox_DX, SLOT(SetStep(double))); + connect(myGeomGUI, SIGNAL(SignalDefaultStepValueChanged(double)), Group1->SpinBox_DY, SLOT(SetStep(double))); + + connect(mySelection, SIGNAL(currentSelectionChanged()), this, SLOT(SelectionIntoArgument())); + + /* displays Dialog */ + Group1->show(); + this->show(); + + return; +} + + +//================================================================================= +// function : ClickOnOk() +// purpose : +//================================================================================= +void KinematicGUI_AnimationDlg::ClickOnOk() +{ + this->ClickOnApply(); + ClickOnCancel(); + return ; +} + + +//================================================================================= +// function : ClickOnApply() +// purpose : +//================================================================================= +void KinematicGUI_AnimationDlg::ClickOnApply() +{ + QAD_Application::getDesktop()->putInfo(tr("")); + + bool IsInLoop = Group1->CheckButton1->isChecked(); + if(myOkAssembly && myOkShape1) + myKinematicGUI->AddAnimation(myGeomAssembly, myGeomShape1, myDuration, myNbSeq, IsInLoop); + + return; +} + + +//================================================================================= +// function : SelectionIntoArgument() +// purpose : Called when selection has changed +//================================================================================= +void KinematicGUI_AnimationDlg::SelectionIntoArgument() +{ + myEditCurrentArgument->setText(""); + QString aString = ""; + + int nbSel = myGeomBase->GetNameOfSelectedIObjects(mySelection, aString); + if(nbSel != 1) { + if(myEditCurrentArgument == Group1->LineEdit1) + myOkAssembly = false; + else if( myEditCurrentArgument == Group1->LineEdit2) + myOkShape1 = false; + return; + } + + /* nbSel == 1 */ + Standard_Boolean testResult; + Handle(SALOME_InteractiveObject) IO = mySelection->firstIObject(); + + if(myEditCurrentArgument == Group1->LineEdit1) { + myGeomAssembly = myGeomBase->ConvertIOinAssembly(IO, testResult); + if(!testResult) + return; + Group1->LineEdit1->setText(aString); + myOkAssembly = true; + } + else { + TopoDS_Shape S; + if(!myGeomBase->GetTopoFromSelection(mySelection, S)) + return; + + if(myEditCurrentArgument == Group1->LineEdit2) { + myGeomShape1 = myGeomBase->ConvertIOinGEOMShape(IO, testResult); + if(!testResult) + return; + Group1->LineEdit2->setText(aString); + myOkShape1 = true; + } + } + return; +} + + +//================================================================================= +// function : SetEditCurrentArgument() +// purpose : +//================================================================================= +void KinematicGUI_AnimationDlg::SetEditCurrentArgument() +{ + QPushButton* send = (QPushButton*)sender(); + + if(send == Group1->PushButton1) { + Group1->LineEdit1->setFocus(); + myEditCurrentArgument = Group1->LineEdit1; + } + else if(send == Group1->PushButton2) { + Group1->LineEdit2->setFocus(); + myEditCurrentArgument = Group1->LineEdit2; + } + SelectionIntoArgument(); + + return; +} + + + +//================================================================================= +// function : LineEditReturnPressed() +// purpose : +//================================================================================= +void KinematicGUI_AnimationDlg::LineEditReturnPressed() +{ + QLineEdit* send = (QLineEdit*)sender(); + if(send == Group1->LineEdit1) + myEditCurrentArgument = Group1->LineEdit1; + else if(send == Group1->LineEdit2) + myEditCurrentArgument = Group1->LineEdit2; + else + return; + + GEOMBase_Skeleton::LineEditReturnPressed(); + return; +} + + +//================================================================================= +// function : ActivateThisDialog() +// purpose : +//================================================================================= +void KinematicGUI_AnimationDlg::ActivateThisDialog() +{ + GEOMBase_Skeleton::ActivateThisDialog(); + connect(mySelection, SIGNAL(currentSelectionChanged()), this, SLOT(SelectionIntoArgument())); + return; +} + + +//================================================================================= +// function : enterEvent() +// purpose : when mouse enter onto the QWidget +//================================================================================= +void KinematicGUI_AnimationDlg::enterEvent(QEvent * e) +{ + if (GroupConstructors->isEnabled()) + return; + this->ActivateThisDialog(); + return; +} + + +//================================================================================= +// function : ValueChangedInSpinBox() +// purpose : +//================================================================================= +void KinematicGUI_AnimationDlg::ValueChangedInSpinBox(double newValue) +{ + DlgRef_SpinBox* send = (DlgRef_SpinBox*)sender(); + + if(send == Group1->SpinBox_DX) + myDuration = newValue; + else if(send == Group1->SpinBox_DY) + myNbSeq = newValue; + + return; +} diff --git a/src/KinematicGUI/KinematicGUI_AnimationDlg.h b/src/KinematicGUI/KinematicGUI_AnimationDlg.h new file mode 100644 index 000000000..bd1b30d3d --- /dev/null +++ b/src/KinematicGUI/KinematicGUI_AnimationDlg.h @@ -0,0 +1,75 @@ +// GEOM GEOMGUI : GUI for Geometry component +// +// Copyright (C) 2003 OPEN CASCADE, EADS/CCR, LIP6, CEA/DEN, +// CEDRAT, EDF R&D, LEG, PRINCIPIA R&D, BUREAU VERITAS +// +// This library is free software; you can redistribute it and/or +// modify it under the terms of the GNU Lesser General Public +// License as published by the Free Software Foundation; either +// version 2.1 of the License. +// +// This library is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU +// Lesser General Public License for more details. +// +// You should have received a copy of the GNU Lesser General Public +// License along with this library; if not, write to the Free Software +// Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307 USA +// +// See http://www.opencascade.org/SALOME/ or email : webmaster.salome@opencascade.org +// +// +// +// File : KinematicGUI_AnimationDlg.h +// Author : Damien COQUERET +// Module : GEOM +// $Header: + +#ifndef DIALOGBOX_ANIMATION_H +#define DIALOGBOX_ANIMATION_H + +#include "GEOMBase_Skeleton.h" +#include "KinematicGUI_2Sel2Spin1Check.h" + +#include "KinematicGUI.h" + +//================================================================================= +// class : KinematicGUI_AnimationDlg +// purpose : +//================================================================================= +class KinematicGUI_AnimationDlg : public GEOMBase_Skeleton +{ + Q_OBJECT + +public: + KinematicGUI_AnimationDlg(QWidget* parent = 0, const char* name = 0, KinematicGUI* theKinematicGUI = 0, SALOME_Selection* Sel = 0, bool modal = FALSE, WFlags fl = 0); + ~KinematicGUI_AnimationDlg(); + +private: + void Init(); + void enterEvent(QEvent * e); + + KinematicGUI* myKinematicGUI; + + GEOM::GEOM_Assembly_var myGeomAssembly; + GEOM::GEOM_Shape_var myGeomShape1; /* is myShape1 */ + bool myOkAssembly; + bool myOkShape1; /* to check when arguments are defined */ + double myDuration; + int myNbSeq; + + KinematicGUI_2Sel2Spin1Check* Group1; + +private slots: + void ClickOnOk(); + void ClickOnApply(); + void SetEditCurrentArgument(); + void SelectionIntoArgument(); + void LineEditReturnPressed(); + void ActivateThisDialog(); + void ValueChangedInSpinBox(double newValue); + +}; + +#endif // DIALOGBOX_ANIMATION_H diff --git a/src/KinematicGUI/KinematicGUI_ContactDlg.cxx b/src/KinematicGUI/KinematicGUI_ContactDlg.cxx new file mode 100644 index 000000000..cd0ab2fb4 --- /dev/null +++ b/src/KinematicGUI/KinematicGUI_ContactDlg.cxx @@ -0,0 +1,294 @@ +// GEOM GEOMGUI : GUI for Geometry component +// +// Copyright (C) 2003 OPEN CASCADE, EADS/CCR, LIP6, CEA/DEN, +// CEDRAT, EDF R&D, LEG, PRINCIPIA R&D, BUREAU VERITAS +// +// This library is free software; you can redistribute it and/or +// modify it under the terms of the GNU Lesser General Public +// License as published by the Free Software Foundation; either +// version 2.1 of the License. +// +// This library is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU +// Lesser General Public License for more details. +// +// You should have received a copy of the GNU Lesser General Public +// License along with this library; if not, write to the Free Software +// Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307 USA +// +// See http://www.opencascade.org/SALOME/ or email : webmaster.salome@opencascade.org +// +// +// +// File : KinematicGUI_ContactDlg.cxx +// Author : Damien COQUERET +// Module : GEOM +// $Header: + +using namespace std; +#include "KinematicGUI_ContactDlg.h" + +//================================================================================= +// class : KinematicGUI_ContactDlg() +// purpose : Constructs a KinematicGUI_ContactDlg which is a child of 'parent', with the +// name 'name' and widget flags set to 'f'. +// The dialog will by default be modeless, unless you set 'modal' to +// TRUE to construct a modal dialog. +//================================================================================= +KinematicGUI_ContactDlg::KinematicGUI_ContactDlg(QWidget* parent, const char* name, KinematicGUI* theKinematicGUI, SALOME_Selection* Sel, int type, bool modal, WFlags fl) + :GEOMBase_Skeleton(parent, name, Sel, modal, WStyle_Customize | WStyle_NormalBorder | WStyle_Title | WStyle_SysMenu) +{ + QPixmap image0(QAD_Desktop::getResourceManager()->loadPixmap("GEOM",tr("ICON_CONTACT"))); + QPixmap image1(QAD_Desktop::getResourceManager()->loadPixmap("GEOM",tr("ICON_SELECT"))); + + setCaption(tr("GEOM_CONTACT_TITLE")); + + /***************************************************************/ + GroupConstructors->setTitle(tr("GEOM_CONTACT")); + RadioButton1->setPixmap(image0); + RadioButton2->close(TRUE); + RadioButton3->close(TRUE); + + Group1 = new KinematicGUI_3Sel1List_QTD(this, "Group1"); + Group1->GroupBox1->setTitle(tr("GEOM_ARGUMENTS")); + Group1->TextLabel1->setText(tr("GEOM_ASSEMBLY")); + Group1->TextLabel2->setText(tr("GEOM_TYPE")); + Group1->TextLabel3->setText(tr("GEOM_OBJECT_I").arg("1")); + Group1->TextLabel4->setText(tr("GEOM_OBJECT_I").arg("2")); + Group1->PushButton1->setPixmap(image1); + Group1->PushButton2->setPixmap(image1); + Group1->PushButton3->setPixmap(image1); + + Layout1->addWidget(Group1, 1, 0); + /***************************************************************/ + + /* Initialisation */ + myKinematicGUI = theKinematicGUI; + myType = type; + Init(); +} + + +//================================================================================= +// function : ~KinematicGUI_ContactDlg() +// purpose : Destroys the object and frees any allocated resources +//================================================================================= +KinematicGUI_ContactDlg::~KinematicGUI_ContactDlg() +{ + /* no need to delete child widgets, Qt does it all for us */ +} + + + +//================================================================================= +// function : Init() +// purpose : +//================================================================================= +void KinematicGUI_ContactDlg::Init() +{ + /* init variables */ + myEditCurrentArgument = Group1->LineEdit1; + myOkAssembly = myOkShape1 = myOkShape2 = false; + + /* type for sub shape selection */ + Group1->ComboBox1->insertItem("Embedding"); + Group1->ComboBox1->insertItem("Pivot"); + Group1->ComboBox1->insertItem("Slide"); + Group1->ComboBox1->insertItem("Sliding Pivot"); + Group1->ComboBox1->insertItem("Spherical"); + Group1->ComboBox1->insertItem("Plane"); + Group1->ComboBox1->insertItem("Annular"); + Group1->ComboBox1->insertItem("Rectilinear"); + Group1->ComboBox1->insertItem("Ponctual"); + + Group1->ComboBox1->setCurrentItem(myType); + + /* signals and slots connections */ + connect(buttonOk, SIGNAL(clicked()), this, SLOT(ClickOnOk())); + connect(buttonApply, SIGNAL(clicked()), this, SLOT(ClickOnApply())); + + connect(Group1->LineEdit1, SIGNAL(returnPressed()), this, SLOT(LineEditReturnPressed())); + connect(Group1->LineEdit2, SIGNAL(returnPressed()), this, SLOT(LineEditReturnPressed())); + connect(Group1->LineEdit3, SIGNAL(returnPressed()), this, SLOT(LineEditReturnPressed())); + + connect(Group1->PushButton1, SIGNAL(clicked()), this, SLOT(SetEditCurrentArgument())); + connect(Group1->PushButton2, SIGNAL(clicked()), this, SLOT(SetEditCurrentArgument())); + connect(Group1->PushButton3, SIGNAL(clicked()), this, SLOT(SetEditCurrentArgument())); + + connect(Group1->ComboBox1, SIGNAL(activated(int)), this, SLOT(ComboTextChanged())); + + connect(mySelection, SIGNAL(currentSelectionChanged()), this, SLOT(SelectionIntoArgument())); + + /* displays Dialog */ + Group1->show(); + this->show(); + + return; +} + + +//================================================================================= +// function : ClickOnOk() +// purpose : +//================================================================================= +void KinematicGUI_ContactDlg::ClickOnOk() +{ + this->ClickOnApply(); + ClickOnCancel(); + return ; +} + + +//================================================================================= +// function : ClickOnApply() +// purpose : +//================================================================================= +void KinematicGUI_ContactDlg::ClickOnApply() +{ + QAD_Application::getDesktop()->putInfo(tr("")); + + if(myOkAssembly && myOkShape1 && myOkShape2) + myKinematicGUI->AddContact(myGeomAssembly, myGeomShape1, myGeomShape2, myType); + + return; +} + + +//================================================================================= +// function : SelectionIntoArgument() +// purpose : Called when selection has changed +//================================================================================= +void KinematicGUI_ContactDlg::SelectionIntoArgument() +{ + myEditCurrentArgument->setText(""); + QString aString = ""; + + int nbSel = myGeomBase->GetNameOfSelectedIObjects(mySelection, aString); + if(nbSel != 1) { + if(myEditCurrentArgument == Group1->LineEdit1) + myOkAssembly = false; + else if( myEditCurrentArgument == Group1->LineEdit2) + myOkShape1 = false; + else if( myEditCurrentArgument == Group1->LineEdit3) + myOkShape2 = false; + return; + } + + /* nbSel == 1 */ + Standard_Boolean testResult; + Handle(SALOME_InteractiveObject) IO = mySelection->firstIObject(); + + if(myEditCurrentArgument == Group1->LineEdit1) { + myGeomAssembly = myGeomBase->ConvertIOinAssembly(IO, testResult); + if(!testResult) + return; + Group1->LineEdit1->setText(aString); + myOkAssembly = true; + } + else { + TopoDS_Shape S; + if(!myGeomBase->GetTopoFromSelection(mySelection, S)) + return; + + if(myEditCurrentArgument == Group1->LineEdit2) { + myGeomShape1 = myGeomBase->ConvertIOinGEOMShape(IO, testResult); + if(!testResult) + return; + Group1->LineEdit2->setText(aString); + myOkShape1 = true; + } + else if(myEditCurrentArgument == Group1->LineEdit3) { + myGeomShape2 = myGeomBase->ConvertIOinGEOMShape(IO, testResult); + if(!testResult) + return; + Group1->LineEdit3->setText(aString); + myOkShape2 = true; + } + } + return; +} + + +//================================================================================= +// function : SetEditCurrentArgument() +// purpose : +//================================================================================= +void KinematicGUI_ContactDlg::SetEditCurrentArgument() +{ + QPushButton* send = (QPushButton*)sender(); + + if(send == Group1->PushButton1) { + Group1->LineEdit1->setFocus(); + myEditCurrentArgument = Group1->LineEdit1; + } + else if(send == Group1->PushButton2) { + Group1->LineEdit2->setFocus(); + myEditCurrentArgument = Group1->LineEdit2; + } + else if(send == Group1->PushButton3) { + Group1->LineEdit3->setFocus(); + myEditCurrentArgument = Group1->LineEdit3; + } + SelectionIntoArgument(); + + return; +} + + + +//================================================================================= +// function : LineEditReturnPressed() +// purpose : +//================================================================================= +void KinematicGUI_ContactDlg::LineEditReturnPressed() +{ + QLineEdit* send = (QLineEdit*)sender(); + if(send == Group1->LineEdit1) + myEditCurrentArgument = Group1->LineEdit1; + else if(send == Group1->LineEdit2) + myEditCurrentArgument = Group1->LineEdit2; + else if(send == Group1->LineEdit3) + myEditCurrentArgument = Group1->LineEdit3; + else + return; + + GEOMBase_Skeleton::LineEditReturnPressed(); + return; +} + + +//================================================================================= +// function : ActivateThisDialog() +// purpose : +//================================================================================= +void KinematicGUI_ContactDlg::ActivateThisDialog() +{ + GEOMBase_Skeleton::ActivateThisDialog(); + connect(mySelection, SIGNAL(currentSelectionChanged()), this, SLOT(SelectionIntoArgument())); + return; +} + + +//================================================================================= +// function : enterEvent() +// purpose : when mouse enter onto the QWidget +//================================================================================= +void KinematicGUI_ContactDlg::enterEvent(QEvent * e) +{ + if (GroupConstructors->isEnabled()) + return; + this->ActivateThisDialog(); + return; +} + + +//================================================================================= +// function : ComboTextChanged() +// purpose : +//================================================================================= +void KinematicGUI_ContactDlg::ComboTextChanged() +{ + myType = Group1->ComboBox1->currentItem(); + return; +} diff --git a/src/KinematicGUI/KinematicGUI_ContactDlg.h b/src/KinematicGUI/KinematicGUI_ContactDlg.h new file mode 100644 index 000000000..c5967ef2f --- /dev/null +++ b/src/KinematicGUI/KinematicGUI_ContactDlg.h @@ -0,0 +1,76 @@ +// GEOM GEOMGUI : GUI for Geometry component +// +// Copyright (C) 2003 OPEN CASCADE, EADS/CCR, LIP6, CEA/DEN, +// CEDRAT, EDF R&D, LEG, PRINCIPIA R&D, BUREAU VERITAS +// +// This library is free software; you can redistribute it and/or +// modify it under the terms of the GNU Lesser General Public +// License as published by the Free Software Foundation; either +// version 2.1 of the License. +// +// This library is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU +// Lesser General Public License for more details. +// +// You should have received a copy of the GNU Lesser General Public +// License along with this library; if not, write to the Free Software +// Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307 USA +// +// See http://www.opencascade.org/SALOME/ or email : webmaster.salome@opencascade.org +// +// +// +// File : KinematicGUI_ContactDlg.h +// Author : Damien COQUERET +// Module : GEOM +// $Header: + +#ifndef DIALOGBOX_CONTACT_H +#define DIALOGBOX_CONTACT_H + +#include "GEOMBase_Skeleton.h" +#include "KinematicGUI_3Sel1List_QTD.h" + +#include "KinematicGUI.h" + +//================================================================================= +// class : KinematicGUI_ContactDlg +// purpose : +//================================================================================= +class KinematicGUI_ContactDlg : public GEOMBase_Skeleton +{ + Q_OBJECT + +public: + KinematicGUI_ContactDlg(QWidget* parent = 0, const char* name = 0, KinematicGUI* theKinematicGUI = 0, SALOME_Selection* Sel = 0, int type = 0, bool modal = FALSE, WFlags fl = 0); + ~KinematicGUI_ContactDlg(); + +private: + void Init(); + void enterEvent(QEvent * e); + + KinematicGUI* myKinematicGUI; + + GEOM::GEOM_Assembly_var myGeomAssembly; + GEOM::GEOM_Shape_var myGeomShape1; /* is myShape1 */ + GEOM::GEOM_Shape_var myGeomShape2; /* is myShape2 */ + bool myOkAssembly; + bool myOkShape1; + bool myOkShape2; /* to check when arguments are defined */ + int myType; + + KinematicGUI_3Sel1List_QTD* Group1; + +private slots: + void ClickOnOk(); + void ClickOnApply(); + void SetEditCurrentArgument(); + void SelectionIntoArgument(); + void LineEditReturnPressed(); + void ActivateThisDialog(); + void ComboTextChanged(); + +}; + +#endif // DIALOGBOX_CONTACT_H diff --git a/src/KinematicGUI/KinematicGUI_ContactHDlg.cxx b/src/KinematicGUI/KinematicGUI_ContactHDlg.cxx new file mode 100644 index 000000000..7f4433eb1 --- /dev/null +++ b/src/KinematicGUI/KinematicGUI_ContactHDlg.cxx @@ -0,0 +1,286 @@ +// GEOM GEOMGUI : GUI for Geometry component +// +// Copyright (C) 2003 OPEN CASCADE, EADS/CCR, LIP6, CEA/DEN, +// CEDRAT, EDF R&D, LEG, PRINCIPIA R&D, BUREAU VERITAS +// +// This library is free software; you can redistribute it and/or +// modify it under the terms of the GNU Lesser General Public +// License as published by the Free Software Foundation; either +// version 2.1 of the License. +// +// This library is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU +// Lesser General Public License for more details. +// +// You should have received a copy of the GNU Lesser General Public +// License along with this library; if not, write to the Free Software +// Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307 USA +// +// See http://www.opencascade.org/SALOME/ or email : webmaster.salome@opencascade.org +// +// +// +// File : KinematicGUI_ContactHDlg.cxx +// Author : Damien COQUERET +// Module : GEOM +// $Header: + +using namespace std; +#include "KinematicGUI_ContactHDlg.h" + +//================================================================================= +// class : KinematicGUI_ContactHDlg() +// purpose : Constructs a KinematicGUI_ContactHDlg which is a child of 'parent', with the +// name 'name' and widget flags set to 'f'. +// The dialog will by default be modeless, unless you set 'modal' to +// TRUE to construct a modal dialog. +//================================================================================= +KinematicGUI_ContactHDlg::KinematicGUI_ContactHDlg(QWidget* parent, const char* name, KinematicGUI* theKinematicGUI, SALOME_Selection* Sel, bool modal, WFlags fl) + :GEOMBase_Skeleton(parent, name, Sel, modal, WStyle_Customize | WStyle_NormalBorder | WStyle_Title | WStyle_SysMenu) +{ + QPixmap image0(QAD_Desktop::getResourceManager()->loadPixmap("GEOM",tr("ICON_CONTACT"))); + QPixmap image1(QAD_Desktop::getResourceManager()->loadPixmap("GEOM",tr("ICON_SELECT"))); + + setCaption(tr("GEOM_CONTACT_TITLE")); + + /***************************************************************/ + GroupConstructors->setTitle(tr("GEOM_CONTACT")); + RadioButton1->setPixmap(image0); + RadioButton2->close(TRUE); + RadioButton3->close(TRUE); + + Group1 = new KinematicGUI_3Sel1Spin(this, "Group1"); + Group1->GroupBox1->setTitle(tr("GEOM_ARGUMENTS")); + Group1->TextLabel1->setText(tr("GEOM_ASSEMBLY")); + Group1->TextLabel2->setText(tr("GEOM_OBJECT_I").arg("1")); + Group1->TextLabel3->setText(tr("GEOM_OBJECT_I").arg("2")); + Group1->TextLabel4->setText(tr("GEOM_STEP")); + Group1->PushButton1->setPixmap(image1); + Group1->PushButton2->setPixmap(image1); + Group1->PushButton3->setPixmap(image1); + + Layout1->addWidget(Group1, 1, 0); + /***************************************************************/ + + /* Initialisation */ + myKinematicGUI = theKinematicGUI; + Init(); +} + + +//================================================================================= +// function : ~KinematicGUI_ContactHDlg() +// purpose : Destroys the object and frees any allocated resources +//================================================================================= +KinematicGUI_ContactHDlg::~KinematicGUI_ContactHDlg() +{ + /* no need to delete child widgets, Qt does it all for us */ +} + + + +//================================================================================= +// function : Init() +// purpose : +//================================================================================= +void KinematicGUI_ContactHDlg::Init() +{ + /* init variables */ + myEditCurrentArgument = Group1->LineEdit1; + myOkAssembly = myOkShape1 = myOkShape2 = false; + + myStep = 1.0; + /* min, max, step and decimals for spin boxes & initial values */ + Group1->SpinBox_DX->RangeStepAndValidator(0.001, 999.999, 0.1, 3); + Group1->SpinBox_DX->SetValue(myStep); + + /* signals and slots connections */ + connect(buttonOk, SIGNAL(clicked()), this, SLOT(ClickOnOk())); + connect(buttonApply, SIGNAL(clicked()), this, SLOT(ClickOnApply())); + + connect(Group1->LineEdit1, SIGNAL(returnPressed()), this, SLOT(LineEditReturnPressed())); + connect(Group1->LineEdit2, SIGNAL(returnPressed()), this, SLOT(LineEditReturnPressed())); + connect(Group1->LineEdit3, SIGNAL(returnPressed()), this, SLOT(LineEditReturnPressed())); + + connect(Group1->PushButton1, SIGNAL(clicked()), this, SLOT(SetEditCurrentArgument())); + connect(Group1->PushButton2, SIGNAL(clicked()), this, SLOT(SetEditCurrentArgument())); + connect(Group1->PushButton3, SIGNAL(clicked()), this, SLOT(SetEditCurrentArgument())); + + connect(Group1->SpinBox_DX, SIGNAL(valueChanged(double)), this, SLOT(ValueChangedInSpinBox(double))); + connect(myGeomGUI, SIGNAL(SignalDefaultStepValueChanged(double)), Group1->SpinBox_DX, SLOT(SetStep(double))); + + connect(mySelection, SIGNAL(currentSelectionChanged()), this, SLOT(SelectionIntoArgument())); + + /* displays Dialog */ + Group1->show(); + this->show(); + + return; +} + + +//================================================================================= +// function : ClickOnOk() +// purpose : +//================================================================================= +void KinematicGUI_ContactHDlg::ClickOnOk() +{ + this->ClickOnApply(); + ClickOnCancel(); + return ; +} + + +//================================================================================= +// function : ClickOnApply() +// purpose : +//================================================================================= +void KinematicGUI_ContactHDlg::ClickOnApply() +{ + QAD_Application::getDesktop()->putInfo(tr("")); + + if(myOkAssembly && myOkShape1 && myOkShape2) + myKinematicGUI->AddContact(myGeomAssembly, myGeomShape1, myGeomShape2, 9, myStep); + + return; +} + + +//================================================================================= +// function : SelectionIntoArgument() +// purpose : Called when selection has changed +//================================================================================= +void KinematicGUI_ContactHDlg::SelectionIntoArgument() +{ + myEditCurrentArgument->setText(""); + QString aString = ""; + + int nbSel = myGeomBase->GetNameOfSelectedIObjects(mySelection, aString); + if(nbSel != 1) { + if(myEditCurrentArgument == Group1->LineEdit1) + myOkAssembly = false; + else if( myEditCurrentArgument == Group1->LineEdit2) + myOkShape1 = false; + else if( myEditCurrentArgument == Group1->LineEdit3) + myOkShape2 = false; + return; + } + + /* nbSel == 1 */ + Standard_Boolean testResult; + Handle(SALOME_InteractiveObject) IO = mySelection->firstIObject(); + + if(myEditCurrentArgument == Group1->LineEdit1) { + myGeomAssembly = myGeomBase->ConvertIOinAssembly(IO, testResult); + if(!testResult) + return; + Group1->LineEdit1->setText(aString); + myOkAssembly = true; + } + else { + TopoDS_Shape S; + if(!myGeomBase->GetTopoFromSelection(mySelection, S)) + return; + + if(myEditCurrentArgument == Group1->LineEdit2) { + myGeomShape1 = myGeomBase->ConvertIOinGEOMShape(IO, testResult); + if(!testResult) + return; + Group1->LineEdit2->setText(aString); + myOkShape1 = true; + } + else if(myEditCurrentArgument == Group1->LineEdit3) { + myGeomShape2 = myGeomBase->ConvertIOinGEOMShape(IO, testResult); + if(!testResult) + return; + Group1->LineEdit3->setText(aString); + myOkShape2 = true; + } + } + return; +} + + +//================================================================================= +// function : SetEditCurrentArgument() +// purpose : +//================================================================================= +void KinematicGUI_ContactHDlg::SetEditCurrentArgument() +{ + QPushButton* send = (QPushButton*)sender(); + + if(send == Group1->PushButton1) { + Group1->LineEdit1->setFocus(); + myEditCurrentArgument = Group1->LineEdit1; + } + else if(send == Group1->PushButton2) { + Group1->LineEdit2->setFocus(); + myEditCurrentArgument = Group1->LineEdit2; + } + else if(send == Group1->PushButton3) { + Group1->LineEdit3->setFocus(); + myEditCurrentArgument = Group1->LineEdit3; + } + SelectionIntoArgument(); + + return; +} + + + +//================================================================================= +// function : LineEditReturnPressed() +// purpose : +//================================================================================= +void KinematicGUI_ContactHDlg::LineEditReturnPressed() +{ + QLineEdit* send = (QLineEdit*)sender(); + if(send == Group1->LineEdit1) + myEditCurrentArgument = Group1->LineEdit1; + else if(send == Group1->LineEdit2) + myEditCurrentArgument = Group1->LineEdit2; + else if(send == Group1->LineEdit3) + myEditCurrentArgument = Group1->LineEdit3; + else + return; + + GEOMBase_Skeleton::LineEditReturnPressed(); + return; +} + + +//================================================================================= +// function : ActivateThisDialog() +// purpose : +//================================================================================= +void KinematicGUI_ContactHDlg::ActivateThisDialog() +{ + GEOMBase_Skeleton::ActivateThisDialog(); + connect(mySelection, SIGNAL(currentSelectionChanged()), this, SLOT(SelectionIntoArgument())); + return; +} + + +//================================================================================= +// function : enterEvent() +// purpose : when mouse enter onto the QWidget +//================================================================================= +void KinematicGUI_ContactHDlg::enterEvent(QEvent * e) +{ + if (GroupConstructors->isEnabled()) + return; + this->ActivateThisDialog(); + return; +} + + +//================================================================================= +// function : ValueChangedInSpinBox() +// purpose : +//================================================================================= +void KinematicGUI_ContactHDlg::ValueChangedInSpinBox(double newValue) +{ + myStep = newValue; + return; +} diff --git a/src/KinematicGUI/KinematicGUI_ContactHDlg.h b/src/KinematicGUI/KinematicGUI_ContactHDlg.h new file mode 100644 index 000000000..8a77fab0c --- /dev/null +++ b/src/KinematicGUI/KinematicGUI_ContactHDlg.h @@ -0,0 +1,76 @@ +// GEOM GEOMGUI : GUI for Geometry component +// +// Copyright (C) 2003 OPEN CASCADE, EADS/CCR, LIP6, CEA/DEN, +// CEDRAT, EDF R&D, LEG, PRINCIPIA R&D, BUREAU VERITAS +// +// This library is free software; you can redistribute it and/or +// modify it under the terms of the GNU Lesser General Public +// License as published by the Free Software Foundation; either +// version 2.1 of the License. +// +// This library is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU +// Lesser General Public License for more details. +// +// You should have received a copy of the GNU Lesser General Public +// License along with this library; if not, write to the Free Software +// Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307 USA +// +// See http://www.opencascade.org/SALOME/ or email : webmaster.salome@opencascade.org +// +// +// +// File : KinematicGUI_ContactHDlg.h +// Author : Damien COQUERET +// Module : GEOM +// $Header: + +#ifndef DIALOGBOX_CONTACTH_H +#define DIALOGBOX_CONTACTH_H + +#include "GEOMBase_Skeleton.h" +#include "KinematicGUI_3Sel1Spin.h" + +#include "KinematicGUI.h" + +//================================================================================= +// class : KinematicGUI_ContactHDlg +// purpose : +//================================================================================= +class KinematicGUI_ContactHDlg : public GEOMBase_Skeleton +{ + Q_OBJECT + +public: + KinematicGUI_ContactHDlg(QWidget* parent = 0, const char* name = 0, KinematicGUI* theKinematicGUI = 0, SALOME_Selection* Sel = 0, bool modal = FALSE, WFlags fl = 0); + ~KinematicGUI_ContactHDlg(); + +private: + void Init(); + void enterEvent(QEvent * e); + + KinematicGUI* myKinematicGUI; + + GEOM::GEOM_Assembly_var myGeomAssembly; + GEOM::GEOM_Shape_var myGeomShape1; /* is myShape1 */ + GEOM::GEOM_Shape_var myGeomShape2; /* is myShape2 */ + bool myOkAssembly; + bool myOkShape1; + bool myOkShape2; /* to check when arguments are defined */ + double myStep; + + KinematicGUI_3Sel1Spin* Group1; + +private slots: + void ClickOnOk(); + void ClickOnApply(); + void SetEditCurrentArgument(); + void SelectionIntoArgument(); + void LineEditReturnPressed(); + void ActivateThisDialog(); + void ValueChangedInSpinBox(double newValue); + +}; + +#endif // DIALOGBOX_CONTACT_H diff --git a/src/KinematicGUI/KinematicGUI_PositionDlg.cxx b/src/KinematicGUI/KinematicGUI_PositionDlg.cxx new file mode 100644 index 000000000..a10d0e102 --- /dev/null +++ b/src/KinematicGUI/KinematicGUI_PositionDlg.cxx @@ -0,0 +1,278 @@ +// GEOM GEOMGUI : GUI for Geometry component +// +// Copyright (C) 2003 OPEN CASCADE, EADS/CCR, LIP6, CEA/DEN, +// CEDRAT, EDF R&D, LEG, PRINCIPIA R&D, BUREAU VERITAS +// +// This library is free software; you can redistribute it and/or +// modify it under the terms of the GNU Lesser General Public +// License as published by the Free Software Foundation; either +// version 2.1 of the License. +// +// This library is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU +// Lesser General Public License for more details. +// +// You should have received a copy of the GNU Lesser General Public +// License along with this library; if not, write to the Free Software +// Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307 USA +// +// See http://www.opencascade.org/SALOME/ or email : webmaster.salome@opencascade.org +// +// +// +// File : KinematicGUI_PositionDlg.cxx +// Author : Damien COQUERET +// Module : GEOM +// $Header: + +using namespace std; +#include "KinematicGUI_PositionDlg.h" + +//================================================================================= +// class : KinematicGUI_PositionDlg() +// purpose : Constructs a KinematicGUI_PositionDlg which is a child of 'parent', with the +// name 'name' and widget flags set to 'f'. +// The dialog will by default be modeless, unless you set 'modal' to +// TRUE to construct a modal dialog. +//================================================================================= +KinematicGUI_PositionDlg::KinematicGUI_PositionDlg(QWidget* parent, const char* name, KinematicGUI* theKinematicGUI, SALOME_Selection* Sel, bool modal, WFlags fl) + :GEOMBase_Skeleton(parent, name, Sel, modal, WStyle_Customize | WStyle_NormalBorder | WStyle_Title | WStyle_SysMenu) +{ + //QPixmap image0(QAD_Desktop::getResourceManager()->loadPixmap("GEOM",tr("ICON_DLG_COMMON"))); + //QPixmap image1(QAD_Desktop::getResourceManager()->loadPixmap("GEOM",tr("ICON_SELECT"))); + + setCaption(tr("GEOM_KPOSITION_TITLE")); + + /***************************************************************/ + GroupConstructors->setTitle(tr("GEOM_KPOSITION")); + //RadioButton1->setPixmap(image0); + RadioButton2->close(TRUE); + RadioButton3->close(TRUE); + + Group1 = new KinematicGUI_12Spin(this, "Group1"); + Group1->GroupBox1->setTitle(tr("GEOM_ARGUMENTS")); + Group1->TextLabel1->setText(tr("GEOM_POS")); + Group1->TextLabel2->setText(tr("GEOM_X")); + Group1->TextLabel3->setText(tr("GEOM_Y")); + Group1->TextLabel4->setText(tr("GEOM_Z")); + Group1->TextLabel5->setText(tr("GEOM_VX")); + Group1->TextLabel6->setText(tr("GEOM_X")); + Group1->TextLabel7->setText(tr("GEOM_Y")); + Group1->TextLabel8->setText(tr("GEOM_Z")); + Group1->TextLabel9->setText(tr("GEOM_VY")); + Group1->TextLabel10->setText(tr("GEOM_X")); + Group1->TextLabel11->setText(tr("GEOM_Y")); + Group1->TextLabel12->setText(tr("GEOM_Z")); + Group1->TextLabel13->setText(tr("GEOM_VZ")); + Group1->TextLabel14->setText(tr("GEOM_X")); + Group1->TextLabel15->setText(tr("GEOM_Y")); + Group1->TextLabel16->setText(tr("GEOM_Z")); + + Layout1->addWidget(Group1, 1, 0); + /***************************************************************/ + + /* Initialisation */ + myKinematicGUI = theKinematicGUI; + Init(); +} + + +//================================================================================= +// function : ~KinematicGUI_PositionDlg() +// purpose : Destroys the object and frees any allocated resources +//================================================================================= +KinematicGUI_PositionDlg::~KinematicGUI_PositionDlg() +{ + /* no need to delete child widgets, Qt does it all for us */ +} + + + +//================================================================================= +// function : Init() +// purpose : +//================================================================================= +void KinematicGUI_PositionDlg::Init() +{ + /* Get setting of step value from file configuration */ + QString St = QAD_CONFIG->getSetting("Geometry:SettingsGeomStep"); + double step = St.toDouble(); + double specificstep = 1.0; + + Group1->SpinBox_11->RangeStepAndValidator(-99999.999, 99999.999, step, 3); + Group1->SpinBox_12->RangeStepAndValidator(-99999.999, 99999.999, step, 3); + Group1->SpinBox_13->RangeStepAndValidator(-99999.999, 99999.999, step, 3); + Group1->SpinBox_21->RangeStepAndValidator(-99999.999, 99999.999, specificstep, 3); + Group1->SpinBox_22->RangeStepAndValidator(-99999.999, 99999.999, specificstep, 3); + Group1->SpinBox_23->RangeStepAndValidator(-99999.999, 99999.999, specificstep, 3); + Group1->SpinBox_31->RangeStepAndValidator(-99999.999, 99999.999, specificstep, 3); + Group1->SpinBox_32->RangeStepAndValidator(-99999.999, 99999.999, specificstep, 3); + Group1->SpinBox_33->RangeStepAndValidator(-99999.999, 99999.999, specificstep, 3); + Group1->SpinBox_41->RangeStepAndValidator(-99999.999, 99999.999, specificstep, 3); + Group1->SpinBox_42->RangeStepAndValidator(-99999.999, 99999.999, specificstep, 3); + Group1->SpinBox_43->RangeStepAndValidator(-99999.999, 99999.999, specificstep, 3); + + Standard_Boolean testResult; + Handle(SALOME_InteractiveObject) IO = mySelection->firstIObject(); + myGeomContact = myGeomBase->ConvertIOinContact(IO, testResult); + if(!testResult) + ClickOnCancel(); + + myGeomPosition = GEOM::GEOM_Position::_narrow(myGeomContact->GetPosition()); + + P0 = myGeomPosition->GetOrigin(); + VX = myGeomPosition->GetVX(); + VY = myGeomPosition->GetVY(); + VZ = myGeomPosition->GetVZ(); + + Group1->SpinBox_11->SetValue(P0.x); + Group1->SpinBox_12->SetValue(P0.y); + Group1->SpinBox_13->SetValue(P0.z); + Group1->SpinBox_21->SetValue(VX.PS.x); + Group1->SpinBox_22->SetValue(VX.PS.y); + Group1->SpinBox_23->SetValue(VX.PS.z); + Group1->SpinBox_31->SetValue(VY.PS.x); + Group1->SpinBox_32->SetValue(VY.PS.y); + Group1->SpinBox_33->SetValue(VY.PS.z); + Group1->SpinBox_41->SetValue(VZ.PS.x); + Group1->SpinBox_42->SetValue(VZ.PS.y); + Group1->SpinBox_43->SetValue(VZ.PS.z); + + SetEnabledValues(); + + /* signals and slots connections */ + connect(buttonOk, SIGNAL(clicked()), this, SLOT(ClickOnOk())); + connect(buttonApply, SIGNAL(clicked()), this, SLOT(ClickOnApply())); + + connect(Group1->SpinBox_11, SIGNAL(valueChanged(double)), this, SLOT(ValueChangedInSpinBox(double))); + connect(Group1->SpinBox_12, SIGNAL(valueChanged(double)), this, SLOT(ValueChangedInSpinBox(double))); + connect(Group1->SpinBox_13, SIGNAL(valueChanged(double)), this, SLOT(ValueChangedInSpinBox(double))); + connect(Group1->SpinBox_21, SIGNAL(valueChanged(double)), this, SLOT(ValueChangedInSpinBox(double))); + connect(Group1->SpinBox_22, SIGNAL(valueChanged(double)), this, SLOT(ValueChangedInSpinBox(double))); + connect(Group1->SpinBox_23, SIGNAL(valueChanged(double)), this, SLOT(ValueChangedInSpinBox(double))); + connect(Group1->SpinBox_31, SIGNAL(valueChanged(double)), this, SLOT(ValueChangedInSpinBox(double))); + connect(Group1->SpinBox_32, SIGNAL(valueChanged(double)), this, SLOT(ValueChangedInSpinBox(double))); + connect(Group1->SpinBox_33, SIGNAL(valueChanged(double)), this, SLOT(ValueChangedInSpinBox(double))); + connect(Group1->SpinBox_41, SIGNAL(valueChanged(double)), this, SLOT(ValueChangedInSpinBox(double))); + connect(Group1->SpinBox_42, SIGNAL(valueChanged(double)), this, SLOT(ValueChangedInSpinBox(double))); + connect(Group1->SpinBox_43, SIGNAL(valueChanged(double)), this, SLOT(ValueChangedInSpinBox(double))); + connect(myGeomGUI, SIGNAL(SignalDefaultStepValueChanged(double)), Group1->SpinBox_11, SLOT(SetStep(double))); + connect(myGeomGUI, SIGNAL(SignalDefaultStepValueChanged(double)), Group1->SpinBox_12, SLOT(SetStep(double))); + connect(myGeomGUI, SIGNAL(SignalDefaultStepValueChanged(double)), Group1->SpinBox_13, SLOT(SetStep(double))); + connect(myGeomGUI, SIGNAL(SignalDefaultStepValueChanged(double)), Group1->SpinBox_21, SLOT(SetStep(double))); + connect(myGeomGUI, SIGNAL(SignalDefaultStepValueChanged(double)), Group1->SpinBox_22, SLOT(SetStep(double))); + connect(myGeomGUI, SIGNAL(SignalDefaultStepValueChanged(double)), Group1->SpinBox_23, SLOT(SetStep(double))); + connect(myGeomGUI, SIGNAL(SignalDefaultStepValueChanged(double)), Group1->SpinBox_31, SLOT(SetStep(double))); + connect(myGeomGUI, SIGNAL(SignalDefaultStepValueChanged(double)), Group1->SpinBox_32, SLOT(SetStep(double))); + connect(myGeomGUI, SIGNAL(SignalDefaultStepValueChanged(double)), Group1->SpinBox_33, SLOT(SetStep(double))); + connect(myGeomGUI, SIGNAL(SignalDefaultStepValueChanged(double)), Group1->SpinBox_41, SLOT(SetStep(double))); + connect(myGeomGUI, SIGNAL(SignalDefaultStepValueChanged(double)), Group1->SpinBox_42, SLOT(SetStep(double))); + connect(myGeomGUI, SIGNAL(SignalDefaultStepValueChanged(double)), Group1->SpinBox_43, SLOT(SetStep(double))); + + /* displays Dialog */ + Group1->show(); + this->show(); + return; +} + + +//================================================================================= +// function : InitValues() +// purpose : +//================================================================================= +void KinematicGUI_PositionDlg::SetEnabledValues() +{ + int type = myGeomContact->GetType(); + + if(type == 1 || type == 3 || type == 5 || type == 9) { //PIVOT || SLIDING PIVOT || PLANE || HELICOIDAL + Group1->SpinBox_31->setEnabled(false); + Group1->SpinBox_32->setEnabled(false); + Group1->SpinBox_33->setEnabled(false); + Group1->SpinBox_41->setEnabled(false); + Group1->SpinBox_42->setEnabled(false); + Group1->SpinBox_43->setEnabled(false); + Group1->TextLabel9->setEnabled(false); + Group1->TextLabel10->setEnabled(false); + Group1->TextLabel11->setEnabled(false); + Group1->TextLabel12->setEnabled(false); + Group1->TextLabel13->setEnabled(false); + Group1->TextLabel14->setEnabled(false); + Group1->TextLabel15->setEnabled(false); + Group1->TextLabel16->setEnabled(false); + } + else if(type == 7) { //RECTILINEAR + Group1->SpinBox_41->setEnabled(false); + Group1->SpinBox_42->setEnabled(false); + Group1->SpinBox_43->setEnabled(false); + Group1->TextLabel13->setEnabled(false); + Group1->TextLabel14->setEnabled(false); + Group1->TextLabel15->setEnabled(false); + Group1->TextLabel16->setEnabled(false); + } + + return; +} + + +//================================================================================= +// function : ClickOnOk() +// purpose : +//================================================================================= +void KinematicGUI_PositionDlg::ClickOnOk() +{ + this->ClickOnApply(); + ClickOnCancel(); + return ; +} + + +//================================================================================= +// function : ClickOnApply() +// purpose : +//================================================================================= +void KinematicGUI_PositionDlg::ClickOnApply() +{ + QAD_Application::getDesktop()->putInfo(tr("")); + + myKinematicGUI->SetPosition(myGeomContact, P0, VX, VY, VZ); + + return; +} + + +//================================================================================= +// function : ValueChangedInSpinBox() +// purpose : +//================================================================================= +void KinematicGUI_PositionDlg::ValueChangedInSpinBox(double newValue) +{ + DlgRef_SpinBox* send = (DlgRef_SpinBox*)sender(); + + if(send == Group1->SpinBox_11) + P0.x = newValue; + else if(send == Group1->SpinBox_12) + P0.y = newValue; + else if(send == Group1->SpinBox_13) + P0.z = newValue; + else if(send == Group1->SpinBox_21) + VX.PS.x = newValue; + else if(send == Group1->SpinBox_22) + VX.PS.y = newValue; + else if(send == Group1->SpinBox_23) + VX.PS.z = newValue; + else if(send == Group1->SpinBox_31) + VY.PS.x = newValue; + else if(send == Group1->SpinBox_32) + VY.PS.y = newValue; + else if(send == Group1->SpinBox_33) + VY.PS.z = newValue; + else if(send == Group1->SpinBox_41) + VZ.PS.x = newValue; + else if(send == Group1->SpinBox_42) + VZ.PS.y = newValue; + else if(send == Group1->SpinBox_43) + VZ.PS.z = newValue; + + return; +} diff --git a/src/KinematicGUI/KinematicGUI_PositionDlg.h b/src/KinematicGUI/KinematicGUI_PositionDlg.h new file mode 100644 index 000000000..2c7dd0dcc --- /dev/null +++ b/src/KinematicGUI/KinematicGUI_PositionDlg.h @@ -0,0 +1,72 @@ +// GEOM GEOMGUI : GUI for Geometry component +// +// Copyright (C) 2003 OPEN CASCADE, EADS/CCR, LIP6, CEA/DEN, +// CEDRAT, EDF R&D, LEG, PRINCIPIA R&D, BUREAU VERITAS +// +// This library is free software; you can redistribute it and/or +// modify it under the terms of the GNU Lesser General Public +// License as published by the Free Software Foundation; either +// version 2.1 of the License. +// +// This library is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU +// Lesser General Public License for more details. +// +// You should have received a copy of the GNU Lesser General Public +// License along with this library; if not, write to the Free Software +// Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307 USA +// +// See http://www.opencascade.org/SALOME/ or email : webmaster.salome@opencascade.org +// +// +// +// File : KinematicGUI_PositionDlg.h +// Author : Damien COQUERET +// Module : GEOM +// $Header: + +#ifndef DIALOGBOX_POSITION_H +#define DIALOGBOX_POSITION_H + +#include "GEOMBase_Skeleton.h" +#include "KinematicGUI_12Spin.h" + +#include "KinematicGUI.h" + +//================================================================================= +// class : KinematicGUI_PositionDlg +// purpose : +//================================================================================= +class KinematicGUI_PositionDlg : public GEOMBase_Skeleton +{ + Q_OBJECT + +public: + KinematicGUI_PositionDlg(QWidget* parent = 0, const char* name = 0, KinematicGUI* theKinematicGUI = 0, SALOME_Selection* Sel = 0, bool modal = FALSE, WFlags fl = 0); + ~KinematicGUI_PositionDlg(); + +private: + void Init(); + void SetEnabledValues(); + + KinematicGUI* myKinematicGUI; + + GEOM::GEOM_Contact_var myGeomContact; + GEOM::GEOM_Position_var myGeomPosition; + + GEOM::PointStruct P0; + GEOM::DirStruct VX; + GEOM::DirStruct VY; + GEOM::DirStruct VZ; + + KinematicGUI_12Spin* Group1; + +private slots: + void ClickOnOk(); + void ClickOnApply(); + void ValueChangedInSpinBox(double newValue); + +}; + +#endif // DIALOGBOX_TRANSLATION_H diff --git a/src/KinematicGUI/KinematicGUI_RotationDlg.cxx b/src/KinematicGUI/KinematicGUI_RotationDlg.cxx new file mode 100644 index 000000000..e522898dd --- /dev/null +++ b/src/KinematicGUI/KinematicGUI_RotationDlg.cxx @@ -0,0 +1,320 @@ +// GEOM GEOMGUI : GUI for Geometry component +// +// Copyright (C) 2003 OPEN CASCADE, EADS/CCR, LIP6, CEA/DEN, +// CEDRAT, EDF R&D, LEG, PRINCIPIA R&D, BUREAU VERITAS +// +// This library is free software; you can redistribute it and/or +// modify it under the terms of the GNU Lesser General Public +// License as published by the Free Software Foundation; either +// version 2.1 of the License. +// +// This library is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU +// Lesser General Public License for more details. +// +// You should have received a copy of the GNU Lesser General Public +// License along with this library; if not, write to the Free Software +// Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307 USA +// +// See http://www.opencascade.org/SALOME/ or email : webmaster.salome@opencascade.org +// +// +// +// File : KinematicGUI_RotationDlg.cxx +// Author : Damien COQUERET +// Module : GEOM +// $Header: + +using namespace std; +#include "KinematicGUI_RotationDlg.h" + +//================================================================================= +// class : KinematicGUI_RotationDlg() +// purpose : Constructs a KinematicGUI_RotationDlg which is a child of 'parent', with the +// name 'name' and widget flags set to 'f'. +// The dialog will by default be modeless, unless you set 'modal' to +// TRUE to construct a modal dialog. +//================================================================================= +KinematicGUI_RotationDlg::KinematicGUI_RotationDlg(QWidget* parent, const char* name, KinematicGUI* theKinematicGUI, SALOME_Selection* Sel, bool modal, WFlags fl) + :GEOMBase_Skeleton(parent, name, Sel, modal, WStyle_Customize | WStyle_NormalBorder | WStyle_Title | WStyle_SysMenu) +{ + //QPixmap image0(QAD_Desktop::getResourceManager()->loadPixmap("GEOM",tr("ICON_DLG_COMMON"))); + //QPixmap image1(QAD_Desktop::getResourceManager()->loadPixmap("GEOM",tr("ICON_SELECT"))); + + setCaption(tr("GEOM_KROTATION_TITLE")); + + /***************************************************************/ + GroupConstructors->setTitle(tr("GEOM_KROTATION")); + //RadioButton1->setPixmap(image0); + RadioButton2->close(TRUE); + RadioButton3->close(TRUE); + + Group1 = new KinematicGUI_3List3Spin(this, "Group1"); + Group1->GroupBox1->setTitle(tr("GEOM_ARGUMENTS")); + Group1->TextLabel1->setText(tr("GEOM_1ROT")); + Group1->TextLabel2->setText(tr("GEOM_VALUE")); + Group1->TextLabel3->setText(tr("GEOM_2ROT")); + Group1->TextLabel4->setText(tr("GEOM_VALUE")); + Group1->TextLabel5->setText(tr("GEOM_3ROT")); + Group1->TextLabel6->setText(tr("GEOM_VALUE")); + + Layout1->addWidget(Group1, 1, 0); + /***************************************************************/ + + /* Initialisation */ + myKinematicGUI = theKinematicGUI; + Init(); +} + + +//================================================================================= +// function : ~KinematicGUI_RotationDlg() +// purpose : Destroys the object and frees any allocated resources +//================================================================================= +KinematicGUI_RotationDlg::~KinematicGUI_RotationDlg() +{ + /* no need to delete child widgets, Qt does it all for us */ +} + + + +//================================================================================= +// function : Init() +// purpose : +//================================================================================= +void KinematicGUI_RotationDlg::Init() +{ + double step = 5.0; + + Group1->SpinBox_DX->RangeStepAndValidator(-99999.999, 99999.999, step, 3); + Group1->SpinBox_DY->RangeStepAndValidator(-99999.999, 99999.999, step, 3); + Group1->SpinBox_DZ->RangeStepAndValidator(-99999.999, 99999.999, step, 3); + + Standard_Boolean testResult; + Handle(SALOME_InteractiveObject) IO = mySelection->firstIObject(); + myGeomContact = myGeomBase->ConvertIOinContact(IO, testResult); + if(!testResult) + ClickOnCancel(); + + myGeomRotation = GEOM::GEOM_Rotation::_narrow(myGeomContact->GetRotation()); + + myVal1 = myGeomRotation->GetVal1(); + myVal2 = myGeomRotation->GetVal2(); + myVal3 = myGeomRotation->GetVal3(); + + Group1->SpinBox_DX->SetValue(myVal1); + Group1->SpinBox_DY->SetValue(myVal2); + Group1->SpinBox_DZ->SetValue(myVal3); + + myRot1 = myGeomRotation->GetRot1(); + myRot2 = myGeomRotation->GetRot2(); + myRot3 = myGeomRotation->GetRot3(); + + Group1->ComboBox1->insertItem("X"); + Group1->ComboBox1->insertItem("Y"); + Group1->ComboBox1->insertItem("Z"); + Group1->ComboBox2->insertItem("Y"); + Group1->ComboBox2->insertItem("Z"); + Group1->ComboBox3->insertItem("Z"); + + Group1->ComboBox1->setCurrentItem(myRot1 - 1); + + InitValues(); + SetEnabledValues(); + + /* signals and slots connections */ + connect(buttonOk, SIGNAL(clicked()), this, SLOT(ClickOnOk())); + connect(buttonApply, SIGNAL(clicked()), this, SLOT(ClickOnApply())); + + connect(Group1->ComboBox1, SIGNAL(activated(int)), this, SLOT(ComboTextChanged())); + connect(Group1->ComboBox2, SIGNAL(activated(int)), this, SLOT(ComboTextChanged())); + connect(Group1->ComboBox3, SIGNAL(activated(int)), this, SLOT(ComboTextChanged())); + + connect(Group1->SpinBox_DX, SIGNAL(valueChanged(double)), this, SLOT(ValueChangedInSpinBox(double))); + connect(Group1->SpinBox_DY, SIGNAL(valueChanged(double)), this, SLOT(ValueChangedInSpinBox(double))); + connect(Group1->SpinBox_DZ, SIGNAL(valueChanged(double)), this, SLOT(ValueChangedInSpinBox(double))); + connect(myGeomGUI, SIGNAL(SignalDefaultStepValueChanged(double)), Group1->SpinBox_DX, SLOT(SetStep(double))); + connect(myGeomGUI, SIGNAL(SignalDefaultStepValueChanged(double)), Group1->SpinBox_DY, SLOT(SetStep(double))); + connect(myGeomGUI, SIGNAL(SignalDefaultStepValueChanged(double)), Group1->SpinBox_DZ, SLOT(SetStep(double))); + + /* displays Dialog */ + Group1->show(); + this->show(); + + return; +} + + +//================================================================================= +// function : InitValues() +// purpose : +//================================================================================= +void KinematicGUI_RotationDlg::InitValues() +{ + if(myRot1 == 1) { + Group1->ComboBox2->changeItem("Y", 0); + Group1->ComboBox2->changeItem("Z", 1); + if(myRot2 == 2) { + Group1->ComboBox3->changeItem("Z", 0); + Group1->ComboBox2->setCurrentItem(0); + } + else if(myRot2 == 3) { + Group1->ComboBox3->changeItem("Y", 0); + Group1->ComboBox2->setCurrentItem(1); + } + } + else if(myRot1 == 2) { + Group1->ComboBox2->changeItem("X", 0); + Group1->ComboBox2->changeItem("Z", 1); + if(myRot2 == 1) { + Group1->ComboBox3->changeItem("Z", 0); + Group1->ComboBox2->setCurrentItem(0); + } + else if(myRot2 == 3) { + Group1->ComboBox3->changeItem("X", 0); + Group1->ComboBox2->setCurrentItem(1); + } + } + else if(myRot1 == 3) { + Group1->ComboBox2->changeItem("X", 0); + Group1->ComboBox2->changeItem("Y", 1); + if(myRot2 == 1) { + Group1->ComboBox3->changeItem("Y", 0); + Group1->ComboBox2->setCurrentItem(0); + } + else if(myRot2 == 2) { + Group1->ComboBox3->changeItem("X", 0); + Group1->ComboBox2->setCurrentItem(1); + } + } + return; +} + + +//================================================================================= +// function : InitValues() +// purpose : +//================================================================================= +void KinematicGUI_RotationDlg::SetEnabledValues() +{ + int type = myGeomContact->GetType(); + + if(type == 1 || type == 3 || type == 5 || type == 9) { //PIVOT || SLIDING PIVOT || PLANE || HELICOIDAL + Group1->TextLabel3->setEnabled(false); + Group1->ComboBox2->setEnabled(false); + Group1->TextLabel4->setEnabled(false); + Group1->SpinBox_DY->setEnabled(false); + Group1->TextLabel5->setEnabled(false); + Group1->ComboBox3->setEnabled(false); + Group1->TextLabel6->setEnabled(false); + Group1->SpinBox_DZ->setEnabled(false); + } + else if(type == 7) { //RECTILINEAR + Group1->TextLabel5->setEnabled(false); + Group1->ComboBox3->setEnabled(false); + Group1->TextLabel6->setEnabled(false); + Group1->SpinBox_DZ->setEnabled(false); + } + + return; +} + + +//================================================================================= +// function : ClickOnOk() +// purpose : +//================================================================================= +void KinematicGUI_RotationDlg::ClickOnOk() +{ + this->ClickOnApply(); + ClickOnCancel(); + return; +} + + +//================================================================================= +// function : ClickOnApply() +// purpose : +//================================================================================= +void KinematicGUI_RotationDlg::ClickOnApply() +{ + QAD_Application::getDesktop()->putInfo(tr("")); + + myKinematicGUI->SetRotation(myGeomContact, myRot1, myRot2, myRot3, + myVal1, myVal2, myVal3); + + return; +} + + +//================================================================================= +// function : ComboTextChanged() +// purpose : +//================================================================================= +void KinematicGUI_RotationDlg::ComboTextChanged() +{ + QComboBox* send = (QComboBox*)sender(); + + if(send == Group1->ComboBox1) { + myRot1 = Group1->ComboBox1->currentItem() + 1; + if(myRot1 == 1) { //X + myRot2 = 2; //Y + myRot3 = 3; //Z + } else if(myRot1 == 2) { //Y + myRot2 = 1;//X + myRot3 = 3;//Z + } else if(myRot1 == 3) { //Z + myRot2 = 1;//X + myRot3 = 2;//Y + } + } else if(send == Group1->ComboBox2) { + if(myRot1 == 1) { + if(Group1->ComboBox2->currentItem() == 0) { + myRot2 = 2; + myRot3 = 3; + } else if(Group1->ComboBox2->currentItem() == 1) { + myRot2 = 3; + myRot3 = 2; + } + } else if(myRot1 == 2) { + if(Group1->ComboBox2->currentItem() == 0) { + myRot2 = 1; + myRot3 = 3; + } else if(Group1->ComboBox2->currentItem() == 1) { + myRot2 = 3; + myRot3 = 1; + } + } else if(myRot1 == 3) { + if(Group1->ComboBox2->currentItem() == 0) { + myRot2 = 1; + myRot3 = 2; + } else if(Group1->ComboBox2->currentItem() == 1) { + myRot2 = 2; + myRot3 = 1; + } + } + } + + InitValues(); + return; +} + + +//================================================================================= +// function : ValueChangedInSpinBox() +// purpose : +//================================================================================= +void KinematicGUI_RotationDlg::ValueChangedInSpinBox(double newValue) +{ + DlgRef_SpinBox* send = (DlgRef_SpinBox*)sender(); + + if(send == Group1->SpinBox_DX) + myVal1 = newValue; + else if(send == Group1->SpinBox_DY) + myVal2 = newValue; + else if(send == Group1->SpinBox_DZ) + myVal3 = newValue; + + return; +} diff --git a/src/KinematicGUI/KinematicGUI_RotationDlg.h b/src/KinematicGUI/KinematicGUI_RotationDlg.h new file mode 100644 index 000000000..b8e55f0b0 --- /dev/null +++ b/src/KinematicGUI/KinematicGUI_RotationDlg.h @@ -0,0 +1,77 @@ +// GEOM GEOMGUI : GUI for Geometry component +// +// Copyright (C) 2003 OPEN CASCADE, EADS/CCR, LIP6, CEA/DEN, +// CEDRAT, EDF R&D, LEG, PRINCIPIA R&D, BUREAU VERITAS +// +// This library is free software; you can redistribute it and/or +// modify it under the terms of the GNU Lesser General Public +// License as published by the Free Software Foundation; either +// version 2.1 of the License. +// +// This library is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU +// Lesser General Public License for more details. +// +// You should have received a copy of the GNU Lesser General Public +// License along with this library; if not, write to the Free Software +// Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307 USA +// +// See http://www.opencascade.org/SALOME/ or email : webmaster.salome@opencascade.org +// +// +// +// File : KinematicGUI_RotationDlg.h +// Author : Damien COQUERET +// Module : GEOM +// $Header: + +#ifndef DIALOGBOX_ROTATION_H +#define DIALOGBOX_ROTATION_H + +#include "GEOMBase_Skeleton.h" +#include "KinematicGUI_3List3Spin.h" + +#include "KinematicGUI.h" + +//================================================================================= +// class : KinematicGUI_RotationDlg +// purpose : +//================================================================================= +class KinematicGUI_RotationDlg : public GEOMBase_Skeleton +{ + Q_OBJECT + +public: + KinematicGUI_RotationDlg(QWidget* parent = 0, const char* name = 0, KinematicGUI* theKinematicGUI = 0, SALOME_Selection* Sel = 0, bool modal = FALSE, WFlags fl = 0); + ~KinematicGUI_RotationDlg(); + +private: + void Init(); + void InitValues(); + void SetEnabledValues(); + + KinematicGUI* myKinematicGUI; + + GEOM::GEOM_Contact_var myGeomContact; + GEOM::GEOM_Rotation_var myGeomRotation; + + int myRot1; + int myRot2; + int myRot3; + + double myVal1; + double myVal2; + double myVal3; + + KinematicGUI_3List3Spin* Group1; + +private slots: + void ClickOnOk(); + void ClickOnApply(); + void ComboTextChanged(); + void ValueChangedInSpinBox(double newValue); + +}; + +#endif // DIALOGBOX_ROTATION_H diff --git a/src/KinematicGUI/KinematicGUI_TranslationDlg.cxx b/src/KinematicGUI/KinematicGUI_TranslationDlg.cxx new file mode 100644 index 000000000..e36b5157a --- /dev/null +++ b/src/KinematicGUI/KinematicGUI_TranslationDlg.cxx @@ -0,0 +1,199 @@ +// GEOM GEOMGUI : GUI for Geometry component +// +// Copyright (C) 2003 OPEN CASCADE, EADS/CCR, LIP6, CEA/DEN, +// CEDRAT, EDF R&D, LEG, PRINCIPIA R&D, BUREAU VERITAS +// +// This library is free software; you can redistribute it and/or +// modify it under the terms of the GNU Lesser General Public +// License as published by the Free Software Foundation; either +// version 2.1 of the License. +// +// This library is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU +// Lesser General Public License for more details. +// +// You should have received a copy of the GNU Lesser General Public +// License along with this library; if not, write to the Free Software +// Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307 USA +// +// See http://www.opencascade.org/SALOME/ or email : webmaster.salome@opencascade.org +// +// +// +// File : KinematicGUI_TranslationDlg.cxx +// Author : Damien COQUERET +// Module : GEOM +// $Header: + +using namespace std; +#include "KinematicGUI_TranslationDlg.h" + +//================================================================================= +// class : KinematicGUI_TranslationDlg() +// purpose : Constructs a KinematicGUI_TranslationDlg which is a child of 'parent', with the +// name 'name' and widget flags set to 'f'. +// The dialog will by default be modeless, unless you set 'modal' to +// TRUE to construct a modal dialog. +//================================================================================= +KinematicGUI_TranslationDlg::KinematicGUI_TranslationDlg(QWidget* parent, const char* name, KinematicGUI* theKinematicGUI, SALOME_Selection* Sel, bool modal, WFlags fl) + :GEOMBase_Skeleton(parent, name, Sel, modal, WStyle_Customize | WStyle_NormalBorder | WStyle_Title | WStyle_SysMenu) +{ + //QPixmap image0(QAD_Desktop::getResourceManager()->loadPixmap("GEOM",tr("ICON_DLG_COMMON"))); + //QPixmap image1(QAD_Desktop::getResourceManager()->loadPixmap("GEOM",tr("ICON_SELECT"))); + + setCaption(tr("GEOM_KTRANSLATION_TITLE")); + + /***************************************************************/ + GroupConstructors->setTitle(tr("GEOM_KTRANSLATION")); + //RadioButton1->setPixmap(image0); + RadioButton2->close(TRUE); + RadioButton3->close(TRUE); + + Group1 = new DlgRef_3Spin(this, "Group1"); + Group1->GroupBox1->setTitle(tr("GEOM_ARGUMENTS")); + Group1->TextLabel1->setText(tr("GEOM_X")); + Group1->TextLabel2->setText(tr("GEOM_Y")); + Group1->TextLabel3->setText(tr("GEOM_Z")); + + Layout1->addWidget(Group1, 1, 0); + /***************************************************************/ + + /* Initialisation */ + myKinematicGUI = theKinematicGUI; + Init(); +} + + +//================================================================================= +// function : ~KinematicGUI_TranslationDlg() +// purpose : Destroys the object and frees any allocated resources +//================================================================================= +KinematicGUI_TranslationDlg::~KinematicGUI_TranslationDlg() +{ + /* no need to delete child widgets, Qt does it all for us */ +} + + + +//================================================================================= +// function : Init() +// purpose : +//================================================================================= +void KinematicGUI_TranslationDlg::Init() +{ + /* Get setting of step value from file configuration */ + QString St = QAD_CONFIG->getSetting("Geometry:SettingsGeomStep"); + double step = St.toDouble(); + + Group1->SpinBox_DX->RangeStepAndValidator(-99999.999, 99999.999, step, 3); + Group1->SpinBox_DY->RangeStepAndValidator(-99999.999, 99999.999, step, 3); + Group1->SpinBox_DZ->RangeStepAndValidator(-99999.999, 99999.999, step, 3); + + Standard_Boolean testResult; + Handle(SALOME_InteractiveObject) IO = mySelection->firstIObject(); + myGeomContact = myGeomBase->ConvertIOinContact(IO, testResult); + if(!testResult) + ClickOnCancel(); + + myGeomTranslation = GEOM::GEOM_Translation::_narrow(myGeomContact->GetTranslation()); + + myVal1 = myGeomTranslation->GetVal1(); + myVal2 = myGeomTranslation->GetVal2(); + myVal3 = myGeomTranslation->GetVal3(); + + Group1->SpinBox_DX->SetValue(myVal1); + Group1->SpinBox_DY->SetValue(myVal2); + Group1->SpinBox_DZ->SetValue(myVal3); + + SetEnabledValues(); + + /* signals and slots connections */ + connect(buttonOk, SIGNAL(clicked()), this, SLOT(ClickOnOk())); + connect(buttonApply, SIGNAL(clicked()), this, SLOT(ClickOnApply())); + + connect(Group1->SpinBox_DX, SIGNAL(valueChanged(double)), this, SLOT(ValueChangedInSpinBox(double))); + connect(Group1->SpinBox_DY, SIGNAL(valueChanged(double)), this, SLOT(ValueChangedInSpinBox(double))); + connect(Group1->SpinBox_DZ, SIGNAL(valueChanged(double)), this, SLOT(ValueChangedInSpinBox(double))); + connect(myGeomGUI, SIGNAL(SignalDefaultStepValueChanged(double)), Group1->SpinBox_DX, SLOT(SetStep(double))); + connect(myGeomGUI, SIGNAL(SignalDefaultStepValueChanged(double)), Group1->SpinBox_DY, SLOT(SetStep(double))); + connect(myGeomGUI, SIGNAL(SignalDefaultStepValueChanged(double)), Group1->SpinBox_DZ, SLOT(SetStep(double))); + + /* displays Dialog */ + Group1->show(); + this->show(); + + return; +} + + +//================================================================================= +// function : InitValues() +// purpose : +//================================================================================= +void KinematicGUI_TranslationDlg::SetEnabledValues() +{ + int type = myGeomContact->GetType(); + + if(type == 2 || type == 3 || type == 6 || type == 9) { //SLIDE || SLIDING PIVOT || ANNULAR || HELICOIDAL + Group1->TextLabel2->setEnabled(false); + Group1->SpinBox_DY->setEnabled(false); + Group1->TextLabel3->setEnabled(false); + Group1->SpinBox_DZ->setEnabled(false); + } + else if(type == 7) { //RECTILINEAR + Group1->TextLabel2->setEnabled(false); + Group1->SpinBox_DY->setEnabled(false); + } + else if(type == 5 || type == 8) { //PLANE || PONCTUAL + Group1->TextLabel1->setEnabled(false); + Group1->SpinBox_DX->setEnabled(false); + } + + return; +} + + +//================================================================================= +// function : ClickOnOk() +// purpose : +//================================================================================= +void KinematicGUI_TranslationDlg::ClickOnOk() +{ + this->ClickOnApply(); + ClickOnCancel(); + return ; +} + + +//================================================================================= +// function : ClickOnApply() +// purpose : +//================================================================================= +void KinematicGUI_TranslationDlg::ClickOnApply() +{ + QAD_Application::getDesktop()->putInfo(tr("")); + + myKinematicGUI->SetTranslation(myGeomContact, myVal1, myVal2, myVal3); + + return; +} + + +//================================================================================= +// function : ValueChangedInSpinBox() +// purpose : +//================================================================================= +void KinematicGUI_TranslationDlg::ValueChangedInSpinBox(double newValue) +{ + DlgRef_SpinBox* send = (DlgRef_SpinBox*)sender(); + + if(send == Group1->SpinBox_DX) + myVal1 = newValue; + else if(send == Group1->SpinBox_DY) + myVal2 = newValue; + else if(send == Group1->SpinBox_DZ) + myVal3 = newValue; + + return; +} diff --git a/src/KinematicGUI/KinematicGUI_TranslationDlg.h b/src/KinematicGUI/KinematicGUI_TranslationDlg.h new file mode 100644 index 000000000..847293258 --- /dev/null +++ b/src/KinematicGUI/KinematicGUI_TranslationDlg.h @@ -0,0 +1,71 @@ +// GEOM GEOMGUI : GUI for Geometry component +// +// Copyright (C) 2003 OPEN CASCADE, EADS/CCR, LIP6, CEA/DEN, +// CEDRAT, EDF R&D, LEG, PRINCIPIA R&D, BUREAU VERITAS +// +// This library is free software; you can redistribute it and/or +// modify it under the terms of the GNU Lesser General Public +// License as published by the Free Software Foundation; either +// version 2.1 of the License. +// +// This library is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU +// Lesser General Public License for more details. +// +// You should have received a copy of the GNU Lesser General Public +// License along with this library; if not, write to the Free Software +// Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307 USA +// +// See http://www.opencascade.org/SALOME/ or email : webmaster.salome@opencascade.org +// +// +// +// File : KinematicGUI_TranslationDlg.h +// Author : Damien COQUERET +// Module : GEOM +// $Header: + +#ifndef DIALOGBOX_TRANSLATION_H +#define DIALOGBOX_TRANSLATION_H + +#include "GEOMBase_Skeleton.h" +#include "DlgRef_3Spin.h" + +#include "KinematicGUI.h" + +//================================================================================= +// class : KinematicGUI_TranslationDlg +// purpose : +//================================================================================= +class KinematicGUI_TranslationDlg : public GEOMBase_Skeleton +{ + Q_OBJECT + +public: + KinematicGUI_TranslationDlg(QWidget* parent = 0, const char* name = 0, KinematicGUI* theKinematicGUI = 0, SALOME_Selection* Sel = 0, bool modal = FALSE, WFlags fl = 0); + ~KinematicGUI_TranslationDlg(); + +private: + void Init(); + void SetEnabledValues(); + + KinematicGUI* myKinematicGUI; + + GEOM::GEOM_Contact_var myGeomContact; + GEOM::GEOM_Translation_var myGeomTranslation; + + double myVal1; + double myVal2; + double myVal3; + + DlgRef_3Spin* Group1; + +private slots: + void ClickOnOk(); + void ClickOnApply(); + void ValueChangedInSpinBox(double newValue); + +}; + +#endif // DIALOGBOX_TRANSLATION_H diff --git a/src/KinematicGUI/Makefile.in b/src/KinematicGUI/Makefile.in new file mode 100644 index 000000000..9cf7dd044 --- /dev/null +++ b/src/KinematicGUI/Makefile.in @@ -0,0 +1,89 @@ +# GEOM KINETICGUI : +# +# Copyright (C) 2003 OPEN CASCADE, EADS/CCR, LIP6, CEA/DEN, +# CEDRAT, EDF R&D, LEG, PRINCIPIA R&D, BUREAU VERITAS +# +# This library is free software; you can redistribute it and/or +# modify it under the terms of the GNU Lesser General Public +# License as published by the Free Software Foundation; either +# version 2.1 of the License. +# +# This library is distributed in the hope that it will be useful, +# but WITHOUT ANY WARRANTY; without even the implied warranty of +# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU +# Lesser General Public License for more details. +# +# You should have received a copy of the GNU Lesser General Public +# License along with this library; if not, write to the Free Software +# Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307 USA +# +# See http://www.opencascade.org/SALOME/ or email : webmaster.salome@opencascade.org +# +# +# +# File : Makefile.in +# Author : Damien COQUERET (OCC) +# Module : GEOM +# $Header: + +top_srcdir=@top_srcdir@ +top_builddir=../.. +srcdir=@srcdir@ +VPATH=.:@srcdir@:@top_srcdir@/idl + + +@COMMENCE@ + +# header files +EXPORT_HEADERS= + +# Libraries targets +LIB = libKinematicGUI.la + +LIB_SRC = KinematicGUI.cxx \ + KinematicGUI_3Sel1List_QTD.cxx \ + KinematicGUI_3Sel1Spin_QTD.cxx \ + KinematicGUI_3List3Spin_QTD.cxx \ + KinematicGUI_12Spin_QTD.cxx \ + KinematicGUI_2Sel2Spin1Check_QTD.cxx \ + KinematicGUI_3Sel1Spin.cxx \ + KinematicGUI_3List3Spin.cxx \ + KinematicGUI_12Spin.cxx \ + KinematicGUI_2Sel2Spin1Check.cxx \ + KinematicGUI_ContactDlg.cxx \ + KinematicGUI_ContactHDlg.cxx \ + KinematicGUI_PositionDlg.cxx \ + KinematicGUI_RotationDlg.cxx \ + KinematicGUI_TranslationDlg.cxx \ + KinematicGUI_AnimationDlg.cxx + +LIB_MOC = \ + KinematicGUI.h \ + KinematicGUI_3Sel1List_QTD.h \ + KinematicGUI_3Sel1Spin_QTD.h \ + KinematicGUI_3List3Spin_QTD.h \ + KinematicGUI_12Spin_QTD.h \ + KinematicGUI_2Sel2Spin1Check_QTD.h \ + KinematicGUI_3Sel1Spin.h \ + KinematicGUI_3List3Spin.h \ + KinematicGUI_12Spin.h \ + KinematicGUI_2Sel2Spin1Check.h \ + KinematicGUI_ContactDlg.h \ + KinematicGUI_ContactHDlg.h \ + KinematicGUI_PositionDlg.h \ + KinematicGUI_RotationDlg.h \ + KinematicGUI_TranslationDlg.h \ + KinematicGUI_AnimationDlg.h + +LIB_CLIENT_IDL = GEOM_Kinematic.idl + +LIB_SERVER_IDL = + +# additionnal information to compil and link file + +CPPFLAGS += $(QT_INCLUDES) $(VTK_INCLUDES) $(OCC_INCLUDES) $(PYTHON_INCLUDES) -I${KERNEL_ROOT_DIR}/include/salome +CXXFLAGS += -I${KERNEL_ROOT_DIR}/include/salome + +LDFLAGS += -lGEOMBase -lGEOMKinematic + +@CONCLUDE@ diff --git a/src/KinematicGUI/UIFiles/KinematicGUI_12Spin_QTD.ui b/src/KinematicGUI/UIFiles/KinematicGUI_12Spin_QTD.ui new file mode 100644 index 000000000..b1496538d --- /dev/null +++ b/src/KinematicGUI/UIFiles/KinematicGUI_12Spin_QTD.ui @@ -0,0 +1,495 @@ + +KinematicGUI_12Spin_QTD + + + KinematicGUI_12Spin_QTD + + + + 0 + 0 + 396 + 139 + + + + KinematicGUI_12Spin_QTD + + + + unnamed + + + 0 + + + 6 + + + + GroupBox1 + + + + + + + unnamed + + + 11 + + + 6 + + + + Layout1 + + + + unnamed + + + 0 + + + 6 + + + + TextLabel15 + + + + 0 + 0 + 0 + 0 + + + + TL15 + + + + + Spacer7 + + + Vertical + + + Expanding + + + + 0 + 80 + + + + + + TextLabel14 + + + + 0 + 0 + 0 + 0 + + + + TL14 + + + + + SpinBox5 + + + + 7 + 0 + 0 + 0 + + + + + + TextLabel3 + + + + 0 + 0 + 0 + 0 + + + + TL3 + + + + + TextLabel11 + + + + 0 + 0 + 0 + 0 + + + + TL11 + + + + + TextLabel8 + + + + 0 + 0 + 0 + 0 + + + + TL8 + + + + + TextLabel4 + + + + 0 + 0 + 0 + 0 + + + + TL4 + + + + + TextLabel7 + + + + 0 + 0 + 0 + 0 + + + + TL7 + + + + + TextLabel12 + + + + 0 + 0 + 0 + 0 + + + + TL12 + + + + + TextLabel13 + + + + 0 + 0 + 0 + 0 + + + + TL13 + + + + + SpinBox12 + + + + 7 + 0 + 0 + 0 + + + + + + SpinBox11 + + + + 7 + 0 + 0 + 0 + + + + + + SpinBox9 + + + + 7 + 0 + 0 + 0 + + + + + + SpinBox8 + + + + 7 + 0 + 0 + 0 + + + + + + SpinBox7 + + + + 7 + 0 + 0 + 0 + + + + + + SpinBox6 + + + + 7 + 0 + 0 + 0 + + + + + + SpinBox3 + + + + 7 + 0 + 0 + 0 + + + + + + TextLabel16 + + + + 0 + 0 + 0 + 0 + + + + TL16 + + + + + TextLabel1 + + + + 0 + 0 + 0 + 0 + + + + TL1 + + + + + TextLabel10 + + + + 0 + 0 + 0 + 0 + + + + TL10 + + + + + SpinBox4 + + + + 7 + 0 + 0 + 0 + + + + + + TextLabel6 + + + + 0 + 0 + 0 + 0 + + + + TL6 + + + + + SpinBox10 + + + + 7 + 0 + 0 + 0 + + + + + + SpinBox2 + + + + 7 + 0 + 0 + 0 + + + + + + TextLabel2 + + + + 0 + 0 + 0 + 0 + + + + TL2 + + + + + TextLabel9 + + + + 0 + 0 + 0 + 0 + + + + TL9 + + + + + TextLabel5 + + + + 0 + 0 + 0 + 0 + + + + TL5 + + + + + SpinBox1 + + + + 7 + 0 + 0 + 0 + + + + + + + + + + + diff --git a/src/KinematicGUI/UIFiles/KinematicGUI_2Sel2Spin1Check_QTD.ui b/src/KinematicGUI/UIFiles/KinematicGUI_2Sel2Spin1Check_QTD.ui new file mode 100644 index 000000000..0130f2906 --- /dev/null +++ b/src/KinematicGUI/UIFiles/KinematicGUI_2Sel2Spin1Check_QTD.ui @@ -0,0 +1,239 @@ + +KinematicGUI_2Sel2Spin1Check_QTD + + + KinematicGUI_2Sel2Spin1Check_QTD + + + + 0 + 0 + 129 + 164 + + + + KinematicGUI_2Sel2Spin1Check_QTD + + + + unnamed + + + 0 + + + 6 + + + + GroupBox1 + + + + + + + unnamed + + + 11 + + + 6 + + + + Layout1 + + + + unnamed + + + 0 + + + 6 + + + + CheckButton1 + + + + + + + + LineEdit1 + + + + + TextLabel1 + + + + 0 + 0 + 0 + 0 + + + + TL1 + + + + + PushButton2 + + + + 0 + 0 + 0 + 0 + + + + + + + + + Layout2 + + + + unnamed + + + 0 + + + 6 + + + + SpinBox2 + + + + 7 + 0 + 0 + 0 + + + + + + SpinBox1 + + + + 7 + 0 + 0 + 0 + + + + + + TextLabel4 + + + + 0 + 0 + 0 + 0 + + + + TL4 + + + + + TextLabel3 + + + + 0 + 0 + 0 + 0 + + + + TL3 + + + + + + + PushButton1 + + + + 0 + 0 + 0 + 0 + + + + + + + + + Spacer5 + + + Vertical + + + Expanding + + + + 0 + 120 + + + + + + TextLabel2 + + + + 0 + 0 + 0 + 0 + + + + TL2 + + + + + LineEdit2 + + + + + + + + + + diff --git a/src/KinematicGUI/UIFiles/KinematicGUI_3List3Spin_QTD.ui b/src/KinematicGUI/UIFiles/KinematicGUI_3List3Spin_QTD.ui new file mode 100644 index 000000000..24e8d0e1c --- /dev/null +++ b/src/KinematicGUI/UIFiles/KinematicGUI_3List3Spin_QTD.ui @@ -0,0 +1,263 @@ + +KinematicGUI_3List3Spin_QTD + + + KinematicGUI_3List3Spin_QTD + + + + 0 + 0 + 279 + 111 + + + + + 100 + 0 + + + + KinematicGUI_3List3Spin_QTD + + + + unnamed + + + 0 + + + 6 + + + + GroupBox1 + + + + + + + unnamed + + + 11 + + + 6 + + + + Layout1 + + + + unnamed + + + 0 + + + 6 + + + + TextLabel2 + + + + 0 + 0 + 0 + 0 + + + + TL2 + + + + + Spacer7 + + + Vertical + + + Expanding + + + + 0 + 100 + + + + + + SpinBox1 + + + + 7 + 0 + 0 + 0 + + + + + + TextLabel4 + + + + 0 + 0 + 0 + 0 + + + + TL4 + + + + + TextLabel3 + + + + 0 + 0 + 0 + 0 + + + + TL3 + + + + + TextLabel1 + + + + 0 + 0 + 0 + 0 + + + + TL1 + + + + + ComboBox3 + + + + 7 + 0 + 0 + 0 + + + + + + SpinBox2 + + + + 7 + 0 + 0 + 0 + + + + + + SpinBox3 + + + + 7 + 0 + 0 + 0 + + + + + + TextLabel6 + + + + 0 + 0 + 0 + 0 + + + + TL6 + + + + + ComboBox1 + + + + 7 + 0 + 0 + 0 + + + + + + ComboBox2 + + + + 7 + 0 + 0 + 0 + + + + + + TextLabel5 + + + + 0 + 0 + 0 + 0 + + + + TL5 + + + + + + + + + + diff --git a/src/KinematicGUI/UIFiles/KinematicGUI_3Sel1List_QTD.ui b/src/KinematicGUI/UIFiles/KinematicGUI_3Sel1List_QTD.ui new file mode 100644 index 000000000..e38d3d6cc --- /dev/null +++ b/src/KinematicGUI/UIFiles/KinematicGUI_3Sel1List_QTD.ui @@ -0,0 +1,223 @@ + +KinematicGUI_3Sel1List_QTD + + + KinematicGUI_3Sel1List_QTD + + + + 0 + 0 + 129 + 145 + + + + KinematicGUI_3Sel1List_QTD + + + + unnamed + + + 0 + + + 6 + + + + GroupBox1 + + + + + + + unnamed + + + 11 + + + 6 + + + + Layout1 + + + + unnamed + + + 0 + + + 6 + + + + Spacer5 + + + Vertical + + + Expanding + + + + 0 + 90 + + + + + + PushButton2 + + + + 0 + 0 + 0 + 0 + + + + + + + + + TextLabel1 + + + + 0 + 0 + 0 + 0 + + + + TL1 + + + + + TextLabel4 + + + + 0 + 0 + 0 + 0 + + + + TL4 + + + + + LineEdit1 + + + + + PushButton1 + + + + 0 + 0 + 0 + 0 + + + + + + + + + TextLabel3 + + + + 0 + 0 + 0 + 0 + + + + TL3 + + + + + PushButton3 + + + + 0 + 0 + 0 + 0 + + + + + + + + + ComboBox1 + + + + 7 + 0 + 0 + 0 + + + + + + LineEdit2 + + + + + LineEdit3 + + + + + TextLabel2 + + + + 0 + 0 + 0 + 0 + + + + TL2 + + + + + + + + + + diff --git a/src/KinematicGUI/UIFiles/KinematicGUI_3Sel1Spin_QTD.ui b/src/KinematicGUI/UIFiles/KinematicGUI_3Sel1Spin_QTD.ui new file mode 100644 index 000000000..1af933d91 --- /dev/null +++ b/src/KinematicGUI/UIFiles/KinematicGUI_3Sel1Spin_QTD.ui @@ -0,0 +1,239 @@ + +KinematicGUI_3Sel1Spin_QTD + + + KinematicGUI_3Sel1Spin_QTD + + + + 0 + 0 + 129 + 147 + + + + KinematicGUI_3Sel1Spin_QTD + + + + unnamed + + + 0 + + + 6 + + + + GroupBox1 + + + + + + + unnamed + + + 11 + + + 6 + + + + Layout1 + + + + unnamed + + + 0 + + + 6 + + + + LineEdit1 + + + + + PushButton3 + + + + 0 + 0 + 0 + 0 + + + + + + + + + Layout2 + + + + unnamed + + + 0 + + + 6 + + + + TextLabel4 + + + + 0 + 0 + 0 + 0 + + + + TL4 + + + + + SpinBox1 + + + + 7 + 0 + 0 + 0 + + + + + + + + TextLabel3 + + + + 0 + 0 + 0 + 0 + + + + TL3 + + + + + LineEdit3 + + + + + LineEdit2 + + + + + PushButton2 + + + + 0 + 0 + 0 + 0 + + + + + + + + + TextLabel2 + + + + 0 + 0 + 0 + 0 + + + + TL2 + + + + + Spacer5 + + + Vertical + + + Expanding + + + + 0 + 100 + + + + + + TextLabel1 + + + + 0 + 0 + 0 + 0 + + + + TL1 + + + + + PushButton1 + + + + 0 + 0 + 0 + 0 + + + + + + + + + + + + + + diff --git a/src/KinematicGUI/UIFiles/ui_to_cxx b/src/KinematicGUI/UIFiles/ui_to_cxx new file mode 100755 index 000000000..ea0047ec5 --- /dev/null +++ b/src/KinematicGUI/UIFiles/ui_to_cxx @@ -0,0 +1,16 @@ +#!/bin/sh + +#uic -o KinematicGUI_3Sel1List_QTD.h KinematicGUI_3Sel1List_QTD.ui +#uic -o KinematicGUI_3Sel1List_QTD.cxx -impl KinematicGUI_3Sel1List_QTD.h KinematicGUI_3Sel1List_QTD.ui + +#uic -o KinematicGUI_3Sel1Spin_QTD.h KinematicGUI_3Sel1Spin_QTD.ui +#uic -o KinematicGUI_3Sel1Spin_QTD.cxx -impl KinematicGUI_3Sel1Spin_QTD.h KinematicGUI_3Sel1Spin_QTD.ui + +#uic -o KinematicGUI_3List3Spin_QTD.h KinematicGUI_3List3Spin_QTD.ui +#uic -o KinematicGUI_3List3Spin_QTD.cxx -impl KinematicGUI_3List3Spin_QTD.h KinematicGUI_3List3Spin_QTD.ui + +#uic -o KinematicGUI_12Spin_QTD.h KinematicGUI_12Spin_QTD.ui +#uic -o KinematicGUI_12Spin_QTD.cxx -impl KinematicGUI_12Spin_QTD.h KinematicGUI_12Spin_QTD.ui + +uic -o KinematicGUI_2Sel2Spin1Check_QTD.h KinematicGUI_2Sel2Spin1Check_QTD.ui +uic -o KinematicGUI_2Sel2Spin1Check_QTD.cxx -impl KinematicGUI_2Sel2Spin1Check_QTD.h KinematicGUI_2Sel2Spin1Check_QTD.ui diff --git a/src/Makefile.in b/src/Makefile.in index 766733aad..921628b05 100644 --- a/src/Makefile.in +++ b/src/Makefile.in @@ -32,6 +32,6 @@ VPATH=.:@srcdir@ @COMMENCE@ -SUBDIRS = OBJECT ARCHIMEDE PARTITION SKETCHER GEOMDS GEOM GEOMClient GEOMFiltersSelection DlgRef GEOMContext GEOMBase DisplayGUI GEOMToolsGUI BasicGUI PrimitiveGUI GenerationGUI EntityGUI BuildGUI BooleanGUI TransformationGUI OperationGUI RepairGUI MeasureGUI GEOMGUI GEOM_SWIG +SUBDIRS = OBJECT ARCHIMEDE PARTITION SKETCHER KINEMATIC GEOMDS GEOM GEOMClient GEOMFiltersSelection DlgRef GEOMContext GEOMBase DisplayGUI GEOMToolsGUI BasicGUI PrimitiveGUI GenerationGUI EntityGUI BuildGUI BooleanGUI TransformationGUI OperationGUI RepairGUI KinematicGUI MeasureGUI GEOMGUI GEOM_SWIG @MODULE@ diff --git a/src/MeasureGUI/Makefile.in b/src/MeasureGUI/Makefile.in index 2b983be0d..c4ab29a8a 100644 --- a/src/MeasureGUI/Makefile.in +++ b/src/MeasureGUI/Makefile.in @@ -75,7 +75,7 @@ LIB_MOC = \ MeasureGUI_WhatisDlg.h \ MeasureGUI_CheckShapeDlg.h -LIB_CLIENT_IDL = +LIB_CLIENT_IDL = GEOM_Kinematic.idl LIB_SERVER_IDL = diff --git a/src/OBJECT/GEOM_AISShape.cxx b/src/OBJECT/GEOM_AISShape.cxx index e87917f5e..81c83d1d3 100644 --- a/src/OBJECT/GEOM_AISShape.cxx +++ b/src/OBJECT/GEOM_AISShape.cxx @@ -103,11 +103,11 @@ void GEOM_AISShape::Compute(const Handle(PrsMgr_PresentationManager3d)& aPresent myDrawer->ShadingAspect()->Aspect()->SetDistinguishOn(); Graphic3d_MaterialAspect aMatAspect; - aMatAspect.SetAmbient( 1 ); - aMatAspect.SetDiffuse( 0 ); - aMatAspect.SetEmissive( 0 ); - aMatAspect.SetShininess(1 ); - aMatAspect.SetSpecular( 0 ); + aMatAspect.SetAmbient( 0.5 ); + aMatAspect.SetDiffuse( 0.5 ); + aMatAspect.SetEmissive( 0.5 ); + aMatAspect.SetShininess(0.5 ); + aMatAspect.SetSpecular( 0.5 ); myDrawer->ShadingAspect()->Aspect()->SetFrontMaterial(aMatAspect); myDrawer->ShadingAspect()->Aspect()->SetBackMaterial(Graphic3d_NOM_JADE); diff --git a/src/OBJECT/GEOM_Actor.cxx b/src/OBJECT/GEOM_Actor.cxx index 0602bc5ca..dde683ac8 100644 --- a/src/OBJECT/GEOM_Actor.cxx +++ b/src/OBJECT/GEOM_Actor.cxx @@ -76,6 +76,7 @@ GEOM_Actor::GEOM_Actor() this->ishighlighted = false; this->subshape = false; + this->myIsInfinite = false; } GEOM_Actor::~GEOM_Actor() @@ -171,6 +172,7 @@ void GEOM_Actor::SetShadingProperty(vtkProperty* Prop) { // Mapper creating function //------------------------------------------------------------- void GEOM_Actor::CreateMapper(int theMode) { + this->myIsInfinite = myShape.Infinite(); if(myShape.ShapeType() == TopAbs_VERTEX) { gp_Pnt aPnt = BRep_Tool::Pnt(TopoDS::Vertex(myShape)); this->SetPosition(aPnt.X(),aPnt.Y(),aPnt.Z()); @@ -220,7 +222,9 @@ void GEOM_Actor::Render(vtkRenderer *ren, vtkMapper *Mapper) } if(!ishighlighted) { - if(myDisplayMode >= 1) { + if ( ispreselected ) + this->Property = PreviewProperty; + else if(myDisplayMode >= 1) { // SHADING this->Property = ShadingProperty; } @@ -228,8 +232,6 @@ void GEOM_Actor::Render(vtkRenderer *ren, vtkMapper *Mapper) this->Property = WireframeProperty; } - if ( ispreselected ) - this->Property = PreviewProperty; } this->Property->Render(this, ren); diff --git a/src/OBJECT/GEOM_Actor.h b/src/OBJECT/GEOM_Actor.h index c40dd1001..cc6295159 100644 --- a/src/OBJECT/GEOM_Actor.h +++ b/src/OBJECT/GEOM_Actor.h @@ -93,7 +93,8 @@ class VTKOCC_EXPORT GEOM_Actor : public SALOME_Actor { // Color void SetColor(float r,float g,float b); void GetColor(float& r,float& g,float& b); - + + virtual bool IsInfinite() {return myIsInfinite;} protected: GEOM_Actor(); @@ -110,6 +111,7 @@ class VTKOCC_EXPORT GEOM_Actor : public SALOME_Actor { private: bool subshape; + bool myIsInfinite; TopoDS_Shape myShape; double deflection; diff --git a/src/OBJECT/GEOM_AssemblyBuilder.cxx b/src/OBJECT/GEOM_AssemblyBuilder.cxx index 39aca3d9c..6c0f4df92 100644 --- a/src/OBJECT/GEOM_AssemblyBuilder.cxx +++ b/src/OBJECT/GEOM_AssemblyBuilder.cxx @@ -69,7 +69,7 @@ void GEOM_AssemblyBuilder::InitProperties(vtkProperty* IsoProp, { // Shading like default OCC material FaceProp->SetRepresentationToSurface(); - FaceProp->SetInterpolation(1); + FaceProp->SetInterpolationToGouraud(); FaceProp->SetAmbient(1.0); FaceProp->SetDiffuse(1.0); FaceProp->SetSpecular(0.4); @@ -109,9 +109,9 @@ void GEOM_AssemblyBuilder::InitProperties(vtkProperty* IsoProp, // Wireframe for Preview edge EdgePVProp->SetRepresentationToWireframe(); - EdgePVProp->SetAmbientColor(0, 1, 1); - EdgePVProp->SetDiffuseColor(0, 1, 1); - EdgePVProp->SetSpecularColor(0, 1, 1); + EdgePVProp->SetAmbientColor(1, 1, 0); + EdgePVProp->SetDiffuseColor(1, 1, 0); + EdgePVProp->SetSpecularColor(1, 1, 0); // Wireframe for vertex VertexProp->SetRepresentationToWireframe(); diff --git a/src/OperationGUI/Makefile.in b/src/OperationGUI/Makefile.in index fe9386d87..802f1167c 100644 --- a/src/OperationGUI/Makefile.in +++ b/src/OperationGUI/Makefile.in @@ -53,7 +53,7 @@ LIB_MOC = \ OperationGUI_FilletDlg.h \ OperationGUI_ChamferDlg.h -LIB_CLIENT_IDL = +LIB_CLIENT_IDL = GEOM_Kinematic.idl LIB_SERVER_IDL = diff --git a/src/OperationGUI/OperationGUI_PartitionDlg.cxx b/src/OperationGUI/OperationGUI_PartitionDlg.cxx index add70022d..fb93269dd 100644 --- a/src/OperationGUI/OperationGUI_PartitionDlg.cxx +++ b/src/OperationGUI/OperationGUI_PartitionDlg.cxx @@ -205,14 +205,19 @@ void OperationGUI_PartitionDlg::SelectionIntoArgument() int nbSel = myGeomBase->GetNameOfSelectedIObjects(mySelection, aString); if(nbSel < 1) { - if(myEditCurrentArgument == GroupPoints->LineEdit1) + if(myEditCurrentArgument == GroupPoints->LineEdit1) { + myListShapes.length(0); myOkListShapes = false; - else if(myEditCurrentArgument == GroupPoints->LineEdit2) + } else if(myEditCurrentArgument == GroupPoints->LineEdit2) { + myListTools.length(0); myOkListTools = false; - else if(myEditCurrentArgument == GroupPoints->LineEdit3) + } else if(myEditCurrentArgument == GroupPoints->LineEdit3) { + myListRemoveInside.length(0); myOkKeepShape = false; - else if(myEditCurrentArgument == GroupPoints->LineEdit4) + } else if(myEditCurrentArgument == GroupPoints->LineEdit4) { + myListKeepInside.length(0); myOkRemoveShape = false; + } return; } diff --git a/src/PARTITION/Partition_Inter2d.cxx b/src/PARTITION/Partition_Inter2d.cxx index 54b25e6e9..f8fa4931e 100644 --- a/src/PARTITION/Partition_Inter2d.cxx +++ b/src/PARTITION/Partition_Inter2d.cxx @@ -241,11 +241,14 @@ TopoDS_Vertex Partition_Inter2d::AddVonE(const TopoDS_Vertex& theV, if (!OnE1 && !OnE2 && !theF.IsNull()) { - // analitically find vertices E1 and E2 must pass trough + // if 3 faces intersects each others, 3 new edges on them must pass + // through one vertex but real intersection points of each + // pair of edges are sometimes more far than a tolerance. + // Try to analitically find vertices that E1 and E2 must pass trough TopoDS_Shape F1 = getOtherShape( theF, AsDes->Ascendant( E1 )); TopoDS_Shape F2 = getOtherShape( theF, AsDes->Ascendant( E2 )); - if (!F1.IsNull() && !F2.IsNull()) + if (!F1.IsNull() && !F2.IsNull() && !F1.IsSame( F2 )) { OnE1 = findVOnE ( theV, E1, E2, F1, F2, AsDes, V1 ); OnE2 = findVOnE ( theV, E2, E1, F1, F2, AsDes, V2 ); diff --git a/src/PARTITION/Partition_Inter3d.cxx b/src/PARTITION/Partition_Inter3d.cxx index 7724b73f1..e9bf649ce 100644 --- a/src/PARTITION/Partition_Inter3d.cxx +++ b/src/PARTITION/Partition_Inter3d.cxx @@ -67,7 +67,6 @@ using namespace std; #include #include #include -#include #include #include #include @@ -136,10 +135,10 @@ void Partition_Inter3d::CompletPart3d(const TopTools_ListOfShape& SetOfFaces1, // avoid intersecting faces of one shape TopoDS_Shape S1; if (FaceShapeMap.IsBound(F1)) S1 = FaceShapeMap.Find(F1); - // avoid intersecting faces sharing vertices, suppose they belong to - // shapes sharing same faces - TopTools_IndexedMapOfShape VM; - TopExp::MapShapes( F1, TopAbs_VERTEX, VM); + + // to filter faces sharing an edge + TopTools_IndexedMapOfShape EM; + TopExp::MapShapes( F1, TopAbs_EDGE, EM); TColStd_ListIteratorOfListOfInteger itLI = BOS.Compare(F1); for (; itLI.More(); itLI.Next()) { @@ -152,13 +151,22 @@ void Partition_Inter3d::CompletPart3d(const TopTools_ListOfShape& SetOfFaces1, if (!S1.IsNull() && S1.IsSame(S2)) continue; // descendants of one shape - TopExp_Explorer expV (F2, TopAbs_VERTEX); - for ( ; expV.More(); expV.Next()) - if (VM.Contains( expV.Current() )) + TopExp_Explorer expE (F2, TopAbs_EDGE); + for ( ; expE.More(); expE.Next()) + if (EM.Contains( expE.Current() )) break; - if (expV.More()) - continue; // faces have a common edge - + if (expE.More()) + { + // faces have a common edge, check if they are a tool and a face + // generated by the tool in another shape; in that case they are + // to be intersected + TopLoc_Location L1, L2; + Handle(Geom_Surface) S1 = BRep_Tool::Surface( F1, L1 ); + Handle(Geom_Surface) S2 = BRep_Tool::Surface( F2, L2 ); + if ( S1 != S2 || L1 != L2 ) + continue; + } + F1.Orientation(TopAbs_FORWARD); F2.Orientation(TopAbs_FORWARD); FacesPartition(F1,F2); @@ -210,8 +218,7 @@ static void PutInBounds (const TopoDS_Face& F, // UPeriodic, sometimes it is in domain but nontheless it has // wrong position. // Check pcurve position by 3D point - if (S->IsKind(STANDARD_TYPE( Geom_SphericalSurface )) || - S->IsKind(STANDARD_TYPE( Geom_ToroidalSurface ))) + if (S->IsKind(STANDARD_TYPE( Geom_SphericalSurface ))) { // get point on the surface gp_Pnt Ps = S->Value( Pm.X(), Pm.Y() ); @@ -472,11 +479,17 @@ void Partition_Inter3d::Inter3D(const TopoDS_Face& F1, TopoDS_Edge se = TopoDS::Edge( itLSE.Value() ); + // move itLSE to the next se Standard_Integer ancRank = DS.AncestorRank(se); if (ME[ancRank-1].Contains( se )) + { LSE.Remove( itLSE ); // se is an edge of face it intersects + continue; + } else + { itLSE.Next(); + } const TopoDS_Face& F = (ancRank == 1) ? F2 : F1; diff --git a/src/PARTITION/Partition_Spliter.cdl b/src/PARTITION/Partition_Spliter.cdl index 0fc9b5be5..75537b498 100644 --- a/src/PARTITION/Partition_Spliter.cdl +++ b/src/PARTITION/Partition_Spliter.cdl @@ -163,6 +163,7 @@ fields myEqualEdges : MapOfShape from TopTools; -- equal splits myNewSection : MapOfShape from TopTools; -- new secton edges myClosedShapes : MapOfShape from TopTools; + mySharedFaces : MapOfShape from TopTools; -- faces shared by several shapes myWrappingSolid: MapOfShape from TopTools; -- solids having other shapes inside myFaceShapeMap : DataMapOfShapeShape from TopTools; -- to find a shape by face diff --git a/src/PARTITION/Partition_Spliter.cxx b/src/PARTITION/Partition_Spliter.cxx index 8dd5d136d..dc4900963 100644 --- a/src/PARTITION/Partition_Spliter.cxx +++ b/src/PARTITION/Partition_Spliter.cxx @@ -208,9 +208,10 @@ void Partition_Spliter::Clear() myListShapes.Clear(); myMapFaces.Clear(); myMapTools.Clear(); - myClosedShapes.Clear(); myEqualEdges.Clear(); myNewSection.Clear(); + myClosedShapes.Clear(); + mySharedFaces.Clear(); myWrappingSolid.Clear(); myFaceShapeMap.Clear(); @@ -520,7 +521,8 @@ void Partition_Spliter::Compute(const TopAbs_ShapeEnum Limit) MakeShells (S , NSL); if (makeSolids && S.ShapeType() == TopAbs_SOLID ) MakeSolids( S, NSL ); - + + // store new shells or solids TopTools_ListIteratorOfListOfShape itNSL (NSL); for ( ; itNSL.More(); itNSL.Next()) myBuilder.Add (myShape, itNSL.Value()); @@ -593,7 +595,7 @@ void Partition_Spliter::MakeSolids(const TopoDS_Shape & theSolid, } } - // find outer a shell most close to each hole shell + // find an outer shell most close to each hole shell TopTools_DataMapOfShapeShape aInOutMap; for (aShellIt.Initialize( aHoleShells ); aShellIt.More(); aShellIt.Next()) { @@ -913,42 +915,46 @@ TopoDS_Shape Partition_Spliter::FindFacesInside(const TopoDS_Shape& theShape, Standard_Boolean isSolid = (theShape.ShapeType() == TopAbs_SOLID); if (All || isSolid) // All is for sub-result removal { + // loop on not used faces; checked faces will be removed from MFP + // during the loop for ( itm.Initialize( MFP ); itm.More(); itm.Next() ) { - TopoDS_Shape aFace = itm.Key(); + const TopoDS_Shape & aFace = itm.Key(); - // find a shape aFace originates from + // a shape which aFace originates from TopoDS_Shape anOrigShape = GetOriginalShape( aFace ); - // find out if all faces of anOrigShape are not in MFP + // find out if all split faces of anOrigShape are not in MFP // and by the way remove them from MFP Standard_Boolean isAllOut = Standard_True; TopoDS_Shape aSplitFaces = anOrigShape; if (myImageShape.HasImage(anOrigShape)) aSplitFaces = myImageShape.Image(anOrigShape).First(); - TopTools_ListOfShape aSplitFaceL; + TopTools_ListOfShape aSplitFaceL; // faces candidate to be kept for (expl.Init( aSplitFaces, TopAbs_FACE ); expl.More(); expl.Next()) { const TopoDS_Shape & aSpFace = expl.Current(); - // a tool face which become object has image but the whole tool shape has not + // a tool face which became object has image but the whole tool shape has not if (myImageShape.HasImage( aSpFace )) { TopExp_Explorer exF (myImageShape.Image( aSpFace ).First(), TopAbs_FACE ); for ( ; exF.More(); exF.Next() ) { aSplitFaceL.Append( exF.Current() ); - if ( ! MFP.Remove( exF.Current() )) - isAllOut = Standard_False; + if ( ! MFP.Remove( exF.Current() ) && isAllOut ) + // a shared face might be removed from MFP during a prev loop + isAllOut = mySharedFaces.Contains( exF.Current() ); } } else { aSplitFaceL.Append( aSpFace ); - if ( ! MFP.Remove( aSpFace )) - isAllOut = Standard_False; + if ( ! MFP.Remove( aSpFace ) && isAllOut) + // a shared face might be removed from MFP during a prev loop + isAllOut = mySharedFaces.Contains( aSpFace ); } } - itm.Initialize( MFP ); + itm.Initialize( MFP ); // iterate remaining faces if ( !isAllOut ) continue; @@ -1301,15 +1307,17 @@ TopoDS_Shape Partition_Spliter::MakeFaces (const TopoDS_Shape& S) myImagesFaces.Bind(F,LNF); // replace the result faces that have already been built - // during same domain faces reconstruction - if (myInter3d.HasSameDomainF( F )) { - // build map edge to same domain faces + // during same domain faces reconstruction done earlier + if (myInter3d.HasSameDomainF( F )) + { + // build map edge to same domain faces: EFM TopTools_IndexedDataMapOfShapeListOfShape EFM; TopTools_MapOfShape SDFM; // avoid doubling itl.Initialize( myInter3d.SameDomain( F )); for (; itl.More(); itl.Next()) { if ( !myImagesFaces.HasImage( itl.Value() )) continue; + // loop on splits of a SD face TopTools_ListIteratorOfListOfShape itNF; itNF.Initialize (myImagesFaces.Image( itl.Value() )); for ( ; itNF.More(); itNF.Next()) { @@ -1320,7 +1328,7 @@ TopoDS_Shape Partition_Spliter::MakeFaces (const TopoDS_Shape& S) TopExp::MapShapesAndAncestors(SDF, TopAbs_EDGE, TopAbs_FACE, EFM); } } - // do replace + // do replace faces in the LNF TopTools_ListOfShape LOF; if ( !EFM.IsEmpty() ) itl.Initialize( LNF ); @@ -1335,13 +1343,15 @@ TopoDS_Shape Partition_Spliter::MakeFaces (const TopoDS_Shape& S) Standard_Real dot; Partition_Loop3d::IsInside (E, TopoDS::Face(NF), TopoDS::Face(SDF), 1, dot, GoodOri); - if (dot < 0) { + if (dot < 0) + { + // NF and SDF are on different side of E if (SDFL.Extent() == 1) { itl.Next(); continue; } else - SDF = SDFL.Last(); + SDF = SDFL.Last(); // next face must be on the same side } gp_Vec V1 = Partition_Loop3d::Normal( E, TopoDS::Face( NF )); gp_Vec V2 = Partition_Loop3d::Normal( E, TopoDS::Face( SDF )); @@ -1351,6 +1361,9 @@ TopoDS_Shape Partition_Spliter::MakeFaces (const TopoDS_Shape& S) if (!myImagesFaces.HasImage( NF )) myImagesFaces.Bind( NF, SDF ); + // mySharedFaces is used in FindFacesInside() + mySharedFaces.Add( SDF ); + LOF.Prepend ( SDF ); LNF.Remove (itl); } @@ -1367,9 +1380,11 @@ TopoDS_Shape Partition_Spliter::MakeFaces (const TopoDS_Shape& S) myImagesFaces.Bind(F,LNF); } } // if (myImagesFaces.HasImage( F )) - + + // fill the resulting compound for (itl.Initialize(LNF); itl.More(); itl.Next()) myBuilder.Add ( C, itl.Value()); + } // loop on faces of S return C; diff --git a/src/PARTITION/Partition_Spliter.hxx b/src/PARTITION/Partition_Spliter.hxx index 61700cecb..2f9e102bb 100644 --- a/src/PARTITION/Partition_Spliter.hxx +++ b/src/PARTITION/Partition_Spliter.hxx @@ -124,6 +124,7 @@ TopTools_MapOfShape myMapTools; TopTools_MapOfShape myEqualEdges; TopTools_MapOfShape myNewSection; TopTools_MapOfShape myClosedShapes; +TopTools_MapOfShape mySharedFaces; TopTools_MapOfShape myWrappingSolid; TopTools_DataMapOfShapeShape myFaceShapeMap; TopTools_DataMapOfShapeShape myInternalFaces; diff --git a/src/PrimitiveGUI/Makefile.in b/src/PrimitiveGUI/Makefile.in index d7407c810..6005cacbd 100644 --- a/src/PrimitiveGUI/Makefile.in +++ b/src/PrimitiveGUI/Makefile.in @@ -55,7 +55,7 @@ LIB_MOC = \ PrimitiveGUI_TorusDlg.h \ PrimitiveGUI_ConeDlg.h -LIB_CLIENT_IDL = +LIB_CLIENT_IDL = GEOM_Kinematic.idl LIB_SERVER_IDL = diff --git a/src/RepairGUI/Makefile.in b/src/RepairGUI/Makefile.in index 3b4d328f1..b920f6cd5 100644 --- a/src/RepairGUI/Makefile.in +++ b/src/RepairGUI/Makefile.in @@ -53,7 +53,7 @@ LIB_MOC = \ RepairGUI_SuppressFacesDlg.h \ RepairGUI_SuppressHoleDlg.h -LIB_CLIENT_IDL = +LIB_CLIENT_IDL = GEOM_Kinematic.idl LIB_SERVER_IDL = diff --git a/src/RepairGUI/RepairGUI_FillingHoleDlg.cxx b/src/RepairGUI/RepairGUI_FillingHoleDlg.cxx index 904e9d156..a591937a3 100644 --- a/src/RepairGUI/RepairGUI_FillingHoleDlg.cxx +++ b/src/RepairGUI/RepairGUI_FillingHoleDlg.cxx @@ -34,6 +34,8 @@ using namespace std; #include "QAD_Desktop.h" #include "utilities.h" + + #include #include #include diff --git a/src/SKETCHER/Makefile.in b/src/SKETCHER/Makefile.in index 3e988eb32..7b8a2758e 100644 --- a/src/SKETCHER/Makefile.in +++ b/src/SKETCHER/Makefile.in @@ -37,7 +37,7 @@ VPATH=.:@srcdir@:@top_srcdir@/idl # Libraries targets LIB = libGEOMSketcher.la LIB_SRC = GEOM_Sketcher.cxx -LIB_CLIENT_IDL = SALOME_Component.idl SALOMEDS.idl SALOME_Exception.idl GEOM_Shape.idl GEOM_Gen.idl +LIB_CLIENT_IDL = SALOME_Component.idl SALOMEDS.idl SALOME_Exception.idl GEOM_Shape.idl GEOM_Gen.idl GEOM_Kinematic.idl # header files EXPORT_HEADERS= GEOM_Sketcher.h \ diff --git a/src/TransformationGUI/Makefile.in b/src/TransformationGUI/Makefile.in index bf544b577..d19e3d26c 100644 --- a/src/TransformationGUI/Makefile.in +++ b/src/TransformationGUI/Makefile.in @@ -57,7 +57,7 @@ LIB_MOC = \ TransformationGUI_MirrorDlg.h \ TransformationGUI_ScaleDlg.h -LIB_CLIENT_IDL = +LIB_CLIENT_IDL = GEOM_Kinematic.idl LIB_SERVER_IDL = -- 2.39.2