]> SALOME platform Git repositories - modules/kernel.git/commitdiff
Salome HOME
Merge branch 'V7_5_BR'
authorvsr <vsr@opencascade.com>
Fri, 30 Jan 2015 06:46:29 +0000 (09:46 +0300)
committervsr <vsr@opencascade.com>
Fri, 30 Jan 2015 06:46:29 +0000 (09:46 +0300)
79 files changed:
CMakeLists.txt
SalomeKERNELConfig.cmake.in
doc/salome/main.dox
doc/salome/running_salome.dox
doc/salome/salome_application.dox
idl/CMakeLists.txt
idl/SALOME_SDS.idl [new file with mode: 0644]
salome_adm/cmake_files/deprecated/am2cmake.py
src/AppQuickStart/CMakeLists.txt [new file with mode: 0644]
src/AppQuickStart/app-quickstart.py [new file with mode: 0755]
src/AppQuickStart/app-template/CMakeLists.txt [new file with mode: 0644]
src/AppQuickStart/app-template/LICENCE [new file with mode: 0644]
src/AppQuickStart/app-template/README [new file with mode: 0644]
src/AppQuickStart/app-template/doc/CMakeLists.txt [new file with mode: 0755]
src/AppQuickStart/app-template/doc/README [new file with mode: 0644]
src/AppQuickStart/app-template/doc/conf.py.in [new file with mode: 0644]
src/AppQuickStart/app-template/doc/index.rst [new file with mode: 0644]
src/AppQuickStart/app-template/doc/intro.rst [new file with mode: 0644]
src/AppQuickStart/app-template/doc/link.rst [new file with mode: 0644]
src/AppQuickStart/app-template/resources/CMakeLists.txt [new file with mode: 0644]
src/AppQuickStart/app-template/resources/SalomeApp.xml.in [new file with mode: 0644]
src/AppQuickStart/app-template/resources/about.png [new file with mode: 0755]
src/AppQuickStart/app-template/resources/app_icon.png [new file with mode: 0755]
src/AppQuickStart/app-template/resources/app_logo.png [new file with mode: 0644]
src/AppQuickStart/app-template/resources/doc/CMakeLists.txt [new file with mode: 0644]
src/AppQuickStart/app-template/resources/doc/README [new file with mode: 0644]
src/AppQuickStart/app-template/resources/doc/sample.pdf [new file with mode: 0644]
src/AppQuickStart/app-template/resources/icon_about.png [new file with mode: 0755]
src/AppQuickStart/app-template/resources/splash.png [new file with mode: 0755]
src/AppQuickStart/app-template/src/CMakeLists.txt [new file with mode: 0644]
src/AppQuickStart/app-template/src/resources/CMakeLists.txt [new file with mode: 0644]
src/AppQuickStart/app-template/src/resources/LightApp_images.ts [new file with mode: 0755]
src/AppQuickStart/app-template/src/resources/LightApp_msg_en.ts [new file with mode: 0755]
src/AppQuickStart/app-template/src/resources/LightApp_msg_fr.ts [new file with mode: 0755]
src/AppQuickStart/app-template/src/tests/CMakeLists.txt [new file with mode: 0644]
src/AppQuickStart/app-template/src/tests/README [new file with mode: 0644]
src/AppQuickStart/app-template/src/tests/helloWorld.py [new file with mode: 0644]
src/AppQuickStart/ressources/Anita semi square.ttf [new file with mode: 0644]
src/AppQuickStart/ressources/CMakeLists.txt [new file with mode: 0644]
src/AppQuickStart/ressources/background.png [new file with mode: 0644]
src/CMakeLists.txt
src/Container/SALOME_ContainerManager.cxx
src/Container/SALOME_ContainerManager.hxx
src/Launcher/CMakeLists.txt
src/Launcher/SALOME_Launcher.cxx
src/Launcher/SALOME_LauncherServer.cxx
src/LifeCycleCORBA/CMakeLists.txt
src/LifeCycleCORBA/SALOME_LifeCycleCORBA.cxx
src/LifeCycleCORBA/Test/LifeCycleCORBATest.cxx
src/LifeCycleCORBA/TestContainerManager.cxx
src/NamingService/SALOME_NamingService.hxx
src/NamingService/Test/NamingServiceTest.cxx
src/Registry/SALOME_Registry_Server.cxx
src/SALOMEDS/SALOMEDS_StudyManager.cxx
src/SALOMESDS/CMakeLists.txt [new file with mode: 0644]
src/SALOMESDS/SALOMEGlobalVarHelper.py [new file with mode: 0644]
src/SALOMESDS/SALOMESDS_AutoRefCountPtr.hxx [new file with mode: 0644]
src/SALOMESDS/SALOMESDS_BasicDataServer.cxx [new file with mode: 0644]
src/SALOMESDS/SALOMESDS_BasicDataServer.hxx [new file with mode: 0644]
src/SALOMESDS/SALOMESDS_DataScopeServer.cxx [new file with mode: 0644]
src/SALOMESDS/SALOMESDS_DataScopeServer.hxx [new file with mode: 0644]
src/SALOMESDS/SALOMESDS_DataServerManager.cxx [new file with mode: 0644]
src/SALOMESDS/SALOMESDS_DataServerManager.hxx [new file with mode: 0644]
src/SALOMESDS/SALOMESDS_Exception.cxx [new file with mode: 0644]
src/SALOMESDS/SALOMESDS_Exception.hxx [new file with mode: 0644]
src/SALOMESDS/SALOMESDS_PickelizedPyObjRdExtServer.cxx [new file with mode: 0644]
src/SALOMESDS/SALOMESDS_PickelizedPyObjRdExtServer.hxx [new file with mode: 0644]
src/SALOMESDS/SALOMESDS_PickelizedPyObjRdOnlyServer.cxx [new file with mode: 0644]
src/SALOMESDS/SALOMESDS_PickelizedPyObjRdOnlyServer.hxx [new file with mode: 0644]
src/SALOMESDS/SALOMESDS_PickelizedPyObjRdWrServer.cxx [new file with mode: 0644]
src/SALOMESDS/SALOMESDS_PickelizedPyObjRdWrServer.hxx [new file with mode: 0644]
src/SALOMESDS/SALOMESDS_PickelizedPyObjServer.cxx [new file with mode: 0644]
src/SALOMESDS/SALOMESDS_PickelizedPyObjServer.hxx [new file with mode: 0644]
src/SALOMESDS/SALOMESDS_RefCountServ.cxx [new file with mode: 0644]
src/SALOMESDS/SALOMESDS_RefCountServ.hxx [new file with mode: 0644]
src/SALOMESDS/SALOME_DataScopeServer.cxx [new file with mode: 0644]
src/SALOMESDS/SalomeSDSClt.py [new file with mode: 0644]
src/SALOMESDS/TestSalomeSDS1.py [new file with mode: 0644]
src/SALOMESDS/TestSalomeSDS2.py [new file with mode: 0644]

index 9207e67501e0bfbf0c6ae4f9bb4ec139b99514fd..a0099ee44e4274d4bb121884710ab46bed469087 100755 (executable)
@@ -34,7 +34,7 @@ SET(${PROJECT_NAME_UC}_MINOR_VERSION 5)
 SET(${PROJECT_NAME_UC}_PATCH_VERSION 1)
 SET(${PROJECT_NAME_UC}_VERSION
   ${${PROJECT_NAME_UC}_MAJOR_VERSION}.${${PROJECT_NAME_UC}_MINOR_VERSION}.${${PROJECT_NAME_UC}_PATCH_VERSION})
-SET(${PROJECT_NAME_UC}_VERSION_DEV 0)
+SET(${PROJECT_NAME_UC}_VERSION_DEV 1)
 
 # Our own set of macros:
 LIST(APPEND CMAKE_MODULE_PATH "${PROJECT_SOURCE_DIR}/salome_adm/cmake_files")
@@ -218,7 +218,7 @@ ELSE()
     LIST(APPEND _${PROJECT_NAME}_exposed_targets 
       DF SalomeLoggerServer with_loggerTraceCollector SalomeNS SalomeGenericObj 
       Registry SalomeCatalog ResourcesManager SalomeResourcesManager
-      SalomeNotification SalomeContainer Launcher SalomeLauncher
+      SalomeNotification SalomeContainer SalomeSDS Launcher SalomeLauncher
       SalomeLifeCycleCORBA SalomeDSClient TOOLSDS SalomeKernelHelpers
       SalomeDSImpl SalomeDS SalomeCommunication SalomeDSCContainer)
     # Temporary solution for package src\DSC on windows
index f3fc6bd4812ff03da744d85fdb91759ab80e3a3b..02f080dfbfcf70a3eaee4deadd7adbd92f67626d 100644 (file)
@@ -168,6 +168,7 @@ SET(KERNEL_SALOMEBasics SALOMEBasics)
 SET(KERNEL_SalomeCatalog SalomeCatalog)
 SET(KERNEL_SalomeCommunication SalomeCommunication)
 SET(KERNEL_SalomeContainer SalomeContainer)
+SET(KERNEL_SalomeSDS SalomeSDS)
 SET(KERNEL_SalomeDatastream SalomeDatastream)
 SET(KERNEL_SalomeDSCContainer SalomeDSCContainer)
 SET(KERNEL_SalomeDSClient SalomeDSClient)
index a0b26f7f7c4bb991d07e86d7de4485d54de89904..8dcfc33dfd82ad8a0ca5f1a97c135e5621e831a3 100644 (file)
@@ -16,9 +16,9 @@ introductory documentation, listed below.
     See \subpage SALOME_Application to define your own configuration of %SALOME and run it
     on one or several computers. This is the recommended way of configuration.
 -# <b>How to launch %SALOME</b>:
-    - Using \b NEW \subpage salome_command, based on \ref SALOME_Application.
-    - In a %SALOME application, see \ref SALOME_Application.
-    - Using \c runSalome script, see \subpage running_salome_page
+    - Using a python launcher like the \subpage salome_command.
+    - <i>Deprecated:</i> Using the shell launchers (runAppli, runSession, runConsole...) alongside configuration files (*.cfg or *.sh), 
+    - <i>Deprecated:</i> Using \c runSalome script, see \subpage running_salome_page
 -# <b>How to use KERNEL services in Python scripts</b>\n
     The %SALOME KERNEL offers a list of services available in Python. See \subpage KERNEL_Services.
 -# <b>How to use KERNEL services from a C++ context</b>\n
index cf1a9ab70e9f360c04cf0a573a45317b5b2dc3c0..32cf2e8a76992829ca4ea8b772f0e0c5c6b9acd2 100644 (file)
@@ -4,11 +4,15 @@
 
 There are two ways to run %SALOME:
 
-1) Using <b>Salome Application Concept</b> approach.
+1) Using a python launcher.
+
+For more details see \ref salome_command.
+
+2) Deprecated : Using shell launchers.
 
 For more details see \ref SALOME_Application.
 
-2) Using <b>\c %runSalome</b> script supplied with %SALOME KERNEL module distribution.
+3) Deprecated : Using <b>\c %runSalome</b> script supplied with %SALOME KERNEL module distribution.
 
 To launch %SALOME using \c %runSalome script, you have first to
 set-up proper environment for %SALOME. If you installed %SALOME using
index e91b71e1193d9059593f4f2b24b8b3928cdc6005..bd79433d910aab44bbbf6adca0c3b9ff320f3474 100644 (file)
@@ -7,11 +7,11 @@ modules, how to define and run this application on one or more computers.
 
 \section S1_sal_appl General principles
 
-%A %SALOME application is defined by a set of modules (GEOM, SMESH, ASTER...). %A %SALOME application
-lives in an application  directory.
-%A %SALOME application is a virtual installation of %SALOME in the application directory 
-(bin, lib, doc, share...), with, for each file (executable, script, data,
-library, resources...), symbolic links to the actual files.
+%A %SALOME application is defined by :
+- a set of modules (GEOM, SMESH, ASTER...)
+- a profile: set of informatic resources (images, documentation, tests...) binding the modules together. 
+- a launcher: python script that creates a context (set of environment variables usable by the SALOME modules) and runs an instance of SALOME.
 
 %A %SALOME User can define several %SALOME Applications. These applications are
 runnable from the same user account. These applications may share the same 
@@ -40,7 +40,27 @@ account@computer is via rsh or ssh and must be configured for use without
 password (key exchange for ssh). Account may be different on each
 computer.
 
-\section S2_sal_appl Application Directory
+\section S2_sal_appl Generation of a profile
+
+The user can generate a default profile for its application using the following command:
+\code
+python ${KERNEL_ROOT_DIR}/bin/salome/app-quickstart.py --prefix=<generation directory> --name=<application's name> --modules=<list,of,modules>
+\endcode
+
+Likely, the user would like to personalize its application's profile. Then, the profile
+can be compiled using the standard cmake procedure:
+
+\code
+cmake
+make
+make install
+\endcode
+
+This profile can be used within a python launcher - like the \subpage salome_command - by setting
+context variable <b>SalomeAppConfig</b> to the path where the profile is installed.
+
+
+\section S3_sal_appl Deprecated Application Directory
 
 First, the user must create a %SALOME application configuration file by modifying a
 copy of ${KERNEL_ROOT_DIR}/bin/salome/config_appli.xml.
@@ -67,7 +87,7 @@ some modules needs a special environment not defined in the above script).
 For a distributed application (several computers), one must copy and adapt
 CatalogResources.xml from ${KERNEL_ROOT_DIR}/bin/salome/appliskel (see below).
 
-\section S3_sal_appl General rules
+\section S4_sal_appl Deprecated general rules
 
 The application directory must be created on each computer of the application.
 The easiest way is to use the same relative path (to ${HOME}) on each computer.
@@ -152,7 +172,7 @@ appliPath="my/specific/path/on/this/computer"
   </li>
 </ol>
 
-\section S4_sal_appl Examples of use
+\section S5_sal_appl Deprecated examples of use
 
 <ol>
   <li>
index 894de4afa7fce3242dbc53b3524beb7d6e445a5a..b69a9bd1ee456f8f43ec92c049e160032c03c948 100755 (executable)
@@ -36,6 +36,7 @@ SET(SalomeIDLKernel_IDLSOURCES
   SALOMEDS_Attributes.idl
   SALOME_Component.idl
   SALOME_ContainerManager.idl
+  SALOME_SDS.idl
   SALOME_Registry.idl
   Logger.idl
   SALOME_GenericObj.idl
diff --git a/idl/SALOME_SDS.idl b/idl/SALOME_SDS.idl
new file mode 100644 (file)
index 0000000..762f46e
--- /dev/null
@@ -0,0 +1,86 @@
+// Copyright (C) 2007-2014  CEA/DEN, EDF R&D, OPEN CASCADE
+//
+// This library is free software; you can redistribute it and/or
+// modify it under the terms of the GNU Lesser General Public
+// License as published by the Free Software Foundation; either
+// version 2.1 of the License, or (at your option) any later version.
+//
+// This library is distributed in the hope that it will be useful,
+// but WITHOUT ANY WARRANTY; without even the implied warranty of
+// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the GNU
+// Lesser General Public License for more details.
+//
+// You should have received a copy of the GNU Lesser General Public
+// License along with this library; if not, write to the Free Software
+// Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA  02111-1307 USA
+//
+// See http://www.salome-platform.org/ or email : webmaster.salome@opencascade.com
+//
+// Author : Anthony GEAY (EDF R&D)
+
+#include "SALOME_GenericObj.idl"
+#include "SALOME_Exception.idl"
+
+module SALOME
+{
+  typedef sequence<string> StringVec;
+  typedef sequence<octet> ByteVec;
+  
+  interface DataScopeServer;
+
+  interface BasicDataServer : GenericObj
+  {
+    DataScopeServer getMyDataScopeServer();
+    string getVarName();
+    string getScopeName();
+  };
+
+  interface PickelizedPyObjServer : BasicDataServer
+  {
+    ByteVec fetchSerializedContent() raises (SALOME::SALOME_Exception);
+  };
+
+  interface PickelizedPyObjRdOnlyServer : PickelizedPyObjServer
+  {
+  };
+
+  interface PickelizedPyObjRdExtServer : PickelizedPyObjServer
+  {
+    PickelizedPyObjRdExtServer invokePythonMethodOn(in string method, in ByteVec args) raises (SALOME::SALOME_Exception);
+  };
+
+  interface PickelizedPyObjRdWrServer : PickelizedPyObjServer
+  {
+    void setSerializedContent(in ByteVec newValue) raises (SALOME::SALOME_Exception);
+    PickelizedPyObjRdWrServer invokePythonMethodOn(in string method, in ByteVec args) raises (SALOME::SALOME_Exception);
+  };
+
+  interface DataServerManager;
+
+  interface DataScopeServer
+  {
+    void ping();
+    string getScopeName();
+    StringVec listVars();
+    BasicDataServer retrieveVar(in string varName) raises (SALOME::SALOME_Exception);
+    void deleteVar(in string varName) raises (SALOME::SALOME_Exception);
+    PickelizedPyObjRdOnlyServer createRdOnlyVar(in string varName, in ByteVec constValue) raises (SALOME::SALOME_Exception);
+    PickelizedPyObjRdExtServer createRdExtVar(in string varName, in ByteVec constValue) raises (SALOME::SALOME_Exception);
+    //PickelizedPyObjRdWrServer createRdWrVar(in string typeName, in string varName) raises (SALOME::SALOME_Exception);
+    void shutdownIfNotHostedByDSM();
+  };
+
+  interface DataServerManager
+  {
+    StringVec listScopes();
+    StringVec listAliveAndKickingScopes() raises (SALOME::SALOME_Exception);
+    DataScopeServer getDefaultScope() raises (SALOME::SALOME_Exception);
+    boolean isAliveAndKicking(in string scopeName) raises (SALOME::SALOME_Exception);
+    DataScopeServer createDataScope(in string scopeName) raises (SALOME::SALOME_Exception);
+    DataScopeServer retriveDataScope(in string scopeName) raises (SALOME::SALOME_Exception);
+    DataScopeServer giveADataScopeCalled(in string scopeName, out boolean isCreated);
+    void removeDataScope(in string scopeName) raises (SALOME::SALOME_Exception);
+    void cleanScopesInNS();
+    void shutdownScopes() raises (SALOME::SALOME_Exception);
+  };
+};
index 47df11d6080489c56bfa3f94bb97d9036916819e..d1f74c0d6b89c21c29c72195fb494da10069b564 100644 (file)
@@ -819,7 +819,7 @@ class CMakeFile(object):
             set(VERSION 7.5.1)
             set(SHORT_VERSION 7.5)
             set(XVERSION 0x070501)
-            set(VERSION_DEV 0)
+            set(VERSION_DEV 1)
             """)
             pass
         # --
diff --git a/src/AppQuickStart/CMakeLists.txt b/src/AppQuickStart/CMakeLists.txt
new file mode 100644 (file)
index 0000000..07e7a06
--- /dev/null
@@ -0,0 +1,33 @@
+# Copyright (C) 2012-2014  CEA/DEN, EDF R&D, OPEN CASCADE
+#
+# This library is free software; you can redistribute it and/or
+# modify it under the terms of the GNU Lesser General Public
+# License as published by the Free Software Foundation; either
+# version 2.1 of the License, or (at your option) any later version.
+#
+# This library is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the GNU
+# Lesser General Public License for more details.
+#
+# You should have received a copy of the GNU Lesser General Public
+# License along with this library; if not, write to the Free Software
+# Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA  02111-1307 USA
+#
+# See http://www.salome-platform.org/ or email : webmaster.salome@opencascade.com
+#
+
+ADD_SUBDIRECTORY( ressources ) 
+
+# ===============================================================
+# Files to be installed
+# ===============================================================
+
+# These files are executable scripts
+SET(SCRIPTS
+  app-quickstart.py
+)
+
+SALOME_INSTALL_SCRIPTS("${SCRIPTS}" ${SALOME_INSTALL_SCRIPT_SCRIPTS})
+
+INSTALL( DIRECTORY app-template DESTINATION ${SALOME_KERNEL_INSTALL_RES_DATA})
diff --git a/src/AppQuickStart/app-quickstart.py b/src/AppQuickStart/app-quickstart.py
new file mode 100755 (executable)
index 0000000..8567a67
--- /dev/null
@@ -0,0 +1,268 @@
+#! /usr/bin/env python
+#  -*- coding: iso-8859-1 -*-
+# Copyright (C) 2007-2014  CEA/DEN, EDF R&D, OPEN CASCADE
+#
+# This library is free software; you can redistribute it and/or
+# modify it under the terms of the GNU Lesser General Public
+# License as published by the Free Software Foundation; either
+# version 2.1 of the License, or (at your option) any later version.
+#
+# This library is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the GNU
+# Lesser General Public License for more details.
+#
+# You should have received a copy of the GNU Lesser General Public
+# License along with this library; if not, write to the Free Software
+# Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA  02111-1307 USA
+#
+# See http://www.salome-platform.org/ or email : webmaster.salome@opencascade.com
+#
+
+import os
+import shutil
+import optparse
+
+# Options of this script
+def profileQuickStartParser() :
+
+    parser = optparse.OptionParser( usage = "usage: python app-quickstart.py [options]" )
+
+    parser.add_option('-p',
+                      "--prefix",
+                      metavar="</Path/to/the/sources/of/application>",
+                      type="string",
+                      action="store",
+                      dest="prefix",
+                      default='.',
+                      help="Where the application's sources will be generated. [Default : '.']")
+
+    parser.add_option('-m',
+                      "--modules",
+                      metavar="<module1,module2,...>",
+                      type="string",
+                      action="store",
+                      dest="modules",
+                      default='KERNEL,GUI',
+                      help="List of the application's modules. [Default : KERNEL,GUI]")
+
+    parser.add_option('-n',
+                      "--name",
+                      type="string",
+                      action="store",
+                      dest="name",
+                      help="Name of the application")
+
+    parser.add_option('-v',
+                      "--version",
+                      type="string",
+                      action="store",
+                      dest="version",
+                      default='1.0',
+                      help="Version of the application. [Default : 1.0]")
+
+    parser.add_option('-s',
+                      "--slogan",
+                      type="string",
+                      action="store",
+                      dest="slogan",
+                      default='',
+                      help="Slogan of the application.")
+
+    parser.add_option('-f',
+                      "--force",
+                      action="store_true",
+                      dest="force",
+                      help="Overwrites existing sources")
+
+    return parser
+
+
+
+#Create the splash screen
+def profileGenerateSplash( resources_dir, appname, version, subtext ):
+    import Image
+    import ImageDraw
+    import ImageFont
+
+    uname = unicode(appname, 'UTF-8')
+    uversion = unicode(version, 'UTF-8')
+
+    # fonts
+    fontbig = ImageFont.truetype( os.path.join( resources_dir, 'Anita semi square.ttf' ), 64)
+    fontsmall = ImageFont.truetype( os.path.join( resources_dir, 'Anita semi square.ttf' ), 20)
+    textColor = "rgb(255, 250, 250)"
+    shadowColor = "rgb(0, 0, 0)"
+
+    # dimensions
+    nbcar = len(uname)
+    width = 600
+    if nbcar > 12:
+        width = min( width*nbcar/12, 1024) #a little more
+    height = 300
+    borderX = 30 #50
+    borderY = 3 #30
+    shadowX = 2
+    shadowY = shadowX
+
+    # load background image 
+    f0 = os.path.join( resources_dir, "background.png" )
+    im = Image.open(f0)
+    im = im.resize( ( width, height ) )
+    draw = ImageDraw.Draw(im)
+
+    # add the name of the application
+    iw, ih = draw.textsize(uname, font=fontbig)
+    x = (width - iw) / 2.0 # horizontal center
+    y = (height - ih) / 2.0 # vertical center
+    draw.text((x+shadowX, y+shadowY), uname, font=fontbig, fill=shadowColor)
+    draw.text((x, y), uname, font=fontbig, fill=textColor)
+
+    # add subtext
+    if len(subtext) > 0:
+        iw, ih = draw.textsize(subtext, font=fontsmall)
+        draw.text((borderX+shadowX, height+shadowY-borderY-ih),
+                  subtext, font=fontsmall, fill=shadowColor)
+        draw.text((borderX, height-borderY-ih),
+                  subtext, font=fontsmall, fill=textColor)
+
+    # add the version if any
+    if len(version) > 0:
+        iw, ih = draw.textsize(uversion, font=fontsmall)
+        draw.text((width+shadowX-borderX-iw, height+shadowY-borderY-ih),
+                  uversion, font=fontsmall, fill=shadowColor)
+        draw.text((width-borderX-iw, height-borderY-ih),
+                  uversion, font=fontsmall, fill=textColor)
+
+    del draw
+    return im
+
+
+#Create the application logo
+def profileGenerateLogo( appname, font ):
+    import Image
+    import ImageDraw
+
+    uname = unicode(appname, 'UTF-8')
+
+    # evaluate size before deleting draw
+    im = Image.new( "RGBA", (1, 1), (0, 0, 0, 0) )
+    draw = ImageDraw.Draw( im )
+
+    im = Image.new( "RGBA", draw.textsize( uname, font=font ), (0, 0, 0, 0) )
+    draw = ImageDraw.Draw(im)
+    draw.text( (0+1, 0), uname, font=font, fill="rgb(0, 0, 0)" )
+    draw.text( (0, -1), uname, font=font, fill="rgb(191, 191, 191)" )
+
+    del draw
+    return im
+
+   
+#Replace strings in the template
+def profileReplaceStrings( src, dst, options ) :
+    with open( dst, "wt" ) as fout:
+        with open( src, "rt" ) as fin:
+            for line in fin:
+                l = line.replace( '[LIST_OF_MODULES]', options.modules )
+                l = l.replace( '[VERSION]', options.version )
+                l = l.replace( '[SLOGAN]', options.slogan )
+                l = l.replace( '[NAME_OF_APPLICATION]', options.name.upper() )
+                l = l.replace( '<Name_of_Application>', options.name )
+                l = l.replace( '(name_of_application)', options.name.lower() )
+                fout.write( l )
+
+
+#Generation of a template profile sources
+def profileGenerateSources( options, args ) :
+
+    #Set name of several directories
+    app_dir = options.prefix
+    app_resources_dir = os.path.join( app_dir, "resources" )
+    kernel_root_dir = os.environ["KERNEL_ROOT_DIR"]
+    bin_salome_dir = os.path.join( kernel_root_dir, "bin", "salome" )
+    kernel_resources_dir = os.path.join( kernel_root_dir, "share", "salome", "resources", "kernel" )
+    template_dir = os.path.join( kernel_resources_dir, "app-template" )
+
+    #Check if the directory of the sources already exists and delete it
+    if os.path.exists( app_dir ) :
+        if not options.force :
+            print "Directory %s already exists." %app_dir
+            print "Use option --force to overwrite it."
+            return
+        else :
+            shutil.rmtree( app_dir )
+
+    #Copy template directory
+    os.mkdir( app_dir )
+    for root, dirs, files in os.walk( template_dir ) :
+        dst_dir = root.replace( template_dir, app_dir ) 
+        for d in dirs :
+            os.mkdir( os.path.join( dst_dir, d ) )
+        for f in files :
+            profileReplaceStrings( os.path.join( root, f ), os.path.join( dst_dir, f ), options )
+
+    #Complete source directory
+    contextFiles = [ "salomeContext.py", "salomeContextUtils.py", "parseConfigFile.py" ]
+    for f in contextFiles :
+        shutil.copy( os.path.join( bin_salome_dir, f ), os.path.join( app_dir, "src" ) )
+
+    #Search for python modules Image, ImageDraw and ImageFont
+    try:
+        import imp
+        imp.find_module('Image')
+        imp.find_module('ImageDraw')
+        imp.find_module('ImageFont')
+        found = True
+    except ImportError:
+        found = False
+
+    #Generate logo and splash
+    logo_destination = os.path.join( app_resources_dir, 'app_logo.png')
+    splash_destination = os.path.join( app_resources_dir, 'splash.png')
+    about_destination = os.path.join( app_resources_dir, 'about.png')
+    if found :
+        import ImageFont
+        font = ImageFont.truetype( os.path.join( kernel_resources_dir, "Anita semi square.ttf" ) , 18 )
+
+        #Generate and save logo
+        app_logo = profileGenerateLogo( options.name, font )
+        app_logo.save( logo_destination, "PNG" )
+
+        #Generate and splash screen and about image
+        if options.slogan :
+            subtext = options.slogan
+        else :
+            subtext = "Powered by SALOME"
+        im = profileGenerateSplash( kernel_resources_dir, options.name, options.version, subtext )
+        im.save( splash_destination, "PNG" )
+        im.save( about_destination, "PNG" )
+    else :
+        gui_resources_dir = os.path.join( os.environ["GUI_ROOT_DIR"], "share", "salome", "resources", "gui" )
+        logo_name = os.path.join( gui_resources_dir, "icon_applogo.png" )
+        if os.path.exists( logo_name ) :
+            shutil.copy( logo_name, logo_destination )
+        about_name = os.path.join( gui_resources_dir, "icon_about.png" )
+        if os.path.exists( about_name ) :
+            shutil.copy( about_name, about_destination )
+            shutil.copy( about_name, splash_destination )
+
+    #End of script
+    print "Sources of %s were generated in %s." %( options.name, app_dir )
+
+
+# -----------------------------------------------------------------------------
+
+if __name__ == '__main__':
+    #Get options and args
+    (options, args) = profileQuickStartParser().parse_args()
+
+    #Check name of the application
+    if not options.name :
+        raise RuntimeError( "A name must be given to the application. Please use option --name." )
+
+    #Check if the prefix's parent is a directory
+    if not os.path.isdir( os.path.dirname( options.prefix ) ) :
+        raise RuntimeError( "%s is not a directory." % os.path.dirname( options.prefix ) )
+
+    #Generate sources of the profile
+    profileGenerateSources( options, args )
diff --git a/src/AppQuickStart/app-template/CMakeLists.txt b/src/AppQuickStart/app-template/CMakeLists.txt
new file mode 100644 (file)
index 0000000..ba99abf
--- /dev/null
@@ -0,0 +1,110 @@
+# Copyright (C) 2012-2014  CEA/DEN, EDF R&D, OPEN CASCADE
+#
+# This library is free software; you can redistribute it and/or
+# modify it under the terms of the GNU Lesser General Public
+# License as published by the Free Software Foundation; either
+# version 2.1 of the License, or (at your option) any later version.
+#
+# This library is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the GNU
+# Lesser General Public License for more details.
+#
+# You should have received a copy of the GNU Lesser General Public
+# License along with this library; if not, write to the Free Software
+# Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA  02111-1307 USA
+#
+# See http://www.salome-platform.org/ or email : webmaster.salome@opencascade.com
+#
+CMAKE_MINIMUM_REQUIRED(VERSION 2.8.8 FATAL_ERROR)
+PROJECT(Salome_<Name_of_Application>_Profile C CXX)
+
+# Ensure a proper linker behavior:
+CMAKE_POLICY(SET CMP0003 NEW)
+
+# Versioning
+# ===========
+# Project name, upper case
+STRING(TOUPPER ${PROJECT_NAME} PROJECT_NAME_UC)
+
+SET(${PROJECT_NAME_UC}_MAJOR_VERSION 0)
+SET(${PROJECT_NAME_UC}_MINOR_VERSION 0)
+SET(${PROJECT_NAME_UC}_PATCH_VERSION 0)
+SET(${PROJECT_NAME_UC}_VERSION
+  ${${PROJECT_NAME_UC}_MAJOR_VERSION}.${${PROJECT_NAME_UC}_MINOR_VERSION}.${${PROJECT_NAME_UC}_PATCH_VERSION})
+
+# Find KERNEL
+# ===========
+SET(KERNEL_ROOT_DIR $ENV{KERNEL_ROOT_DIR} CACHE PATH "Path to the Salome KERNEL")
+IF(EXISTS ${KERNEL_ROOT_DIR})
+  LIST(APPEND CMAKE_MODULE_PATH "${KERNEL_ROOT_DIR}/salome_adm/cmake_files")
+  INCLUDE(SalomeMacros)
+  FIND_PACKAGE(SalomeKERNEL REQUIRED)
+  KERNEL_WITH_CORBA() # check whether KERNEL builded with CORBA
+ELSE(EXISTS ${KERNEL_ROOT_DIR})
+  MESSAGE(FATAL_ERROR "We absolutely need a Salome KERNEL, please define KERNEL_ROOT_DIR")
+ENDIF(EXISTS ${KERNEL_ROOT_DIR})
+
+# User options
+# ============
+OPTION(SALOME_BUILD_TESTS "Build SALOME tests" ON)
+OPTION(SALOME_BUILD_DOC "Generate SALOME <Name_of_Application> documentation" ON)
+
+IF(SALOME_BUILD_TESTS)
+  ENABLE_TESTING()
+ENDIF()
+
+# KERNEL optionals:
+IF(SALOME_BUILD_DOC)
+  FIND_PACKAGE(SalomePython)
+  FIND_PACKAGE(SalomeSphinx)
+  SALOME_LOG_OPTIONAL_PACKAGE(Sphinx SALOME_BUILD_DOC)
+ENDIF()
+
+  
+# Find GUI
+# ===========
+
+SET(GUI_ROOT_DIR $ENV{GUI_ROOT_DIR} CACHE PATH "Path to the Salome GUI")
+IF(EXISTS ${GUI_ROOT_DIR})
+  LIST(APPEND CMAKE_MODULE_PATH "${GUI_ROOT_DIR}/adm_local/cmake_files")
+  FIND_PACKAGE(SalomeGUI REQUIRED)
+  FULL_GUI(TRUE) # check whether GUI builded in full mode and with CORBA
+  ADD_DEFINITIONS(${GUI_DEFINITIONS})
+  INCLUDE_DIRECTORIES(${GUI_INCLUDE_DIRS})
+ELSE(EXISTS ${GUI_ROOT_DIR})
+  MESSAGE(FATAL_ERROR "We absolutely need a Salome GUI, please define GUI_ROOT_DIR")
+ENDIF(EXISTS ${GUI_ROOT_DIR})
+
+# Qt4
+FIND_PACKAGE(SalomeQt4 REQUIRED COMPONENTS QtCore QtGui)
+INCLUDE(${QT_USE_FILE})
+
+# Directories
+# (default values taken from KERNEL)
+# ===========
+SET(SALOME_INSTALL_SCRIPT_PYTHON "${SALOME_INSTALL_SCRIPT_PYTHON}" CACHE PATH "Install path: SALOME Python scripts")
+
+# Specific to [NAME_OF_APPLICATION]:
+SET(SALOME_[NAME_OF_APPLICATION]_PROFILE_INSTALL_RES_DATA "${SALOME_INSTALL_RES}/(name_of_application)_profile" CACHE PATH "Install path: SALOME [NAME_OF_APPLICATION] specific data")
+SET(SALOME_[NAME_OF_APPLICATION]_PROFILE_INSTALL_DOC_GUI "${SALOME_INSTALL_DOC}/gui/${PROJECT_NAME_UC}" CACHE PATH "Install path: SALOME [NAME_OF_APPLICATION] gui documentation")
+SET(SALOME_[NAME_OF_APPLICATION]_PROFILE_HTML_STATIC_PATH "${SALOME_[NAME_OF_APPLICATION]_PROFILE_INSTALL_DOC_GUI}/_static" CACHE PATH "Install path: SALOME [NAME_OF_APPLICATION] html static data")
+
+MARK_AS_ADVANCED(SALOME_INSTALL_SCRIPT_PYTHON)
+
+INSTALL(CODE "FILE(MAKE_DIRECTORY ${CMAKE_INSTALL_PREFIX}/USERS)")
+
+# Sources 
+# ========
+ADD_SUBDIRECTORY( src )
+ADD_SUBDIRECTORY( resources )
+ADD_SUBDIRECTORY( doc )
+
+# Additional files
+# ================
+SET(_salome_context_API_SCRIPTS
+   ${KERNEL_ROOT_DIR}/bin/salome/salomeContext.py
+   ${KERNEL_ROOT_DIR}/bin/salome/salomeContextUtils.py
+   ${KERNEL_ROOT_DIR}/bin/salome/parseConfigFile.py
+)
+SALOME_INSTALL_SCRIPTS("${_salome_context_API_SCRIPTS}" ${SALOME_INSTALL_SCRIPT_PYTHON})
diff --git a/src/AppQuickStart/app-template/LICENCE b/src/AppQuickStart/app-template/LICENCE
new file mode 100644 (file)
index 0000000..b1e3f5a
--- /dev/null
@@ -0,0 +1,504 @@
+                 GNU LESSER GENERAL PUBLIC LICENSE
+                      Version 2.1, February 1999
+
+ Copyright (C) 1991, 1999 Free Software Foundation, Inc.
+     59 Temple Place, Suite 330, Boston, MA  02111-1307  USA
+ Everyone is permitted to copy and distribute verbatim copies
+ of this license document, but changing it is not allowed.
+
+[This is the first released version of the Lesser GPL.  It also counts
+ as the successor of the GNU Library Public License, version 2, hence
+ the version number 2.1.]
+
+                           Preamble
+
+  The licenses for most software are designed to take away your
+freedom to share and change it.  By contrast, the GNU General Public
+Licenses are intended to guarantee your freedom to share and change
+free software--to make sure the software is free for all its users.
+
+  This license, the Lesser General Public License, applies to some
+specially designated software packages--typically libraries--of the
+Free Software Foundation and other authors who decide to use it.  You
+can use it too, but we suggest you first think carefully about whether
+this license or the ordinary General Public License is the better
+strategy to use in any particular case, based on the explanations below.
+
+  When we speak of free software, we are referring to freedom of use,
+not price.  Our General Public Licenses are designed to make sure that
+you have the freedom to distribute copies of free software (and charge
+for this service if you wish); that you receive source code or can get
+it if you want it; that you can change the software and use pieces of
+it in new free programs; and that you are informed that you can do
+these things.
+
+  To protect your rights, we need to make restrictions that forbid
+distributors to deny you these rights or to ask you to surrender these
+rights.  These restrictions translate to certain responsibilities for
+you if you distribute copies of the library or if you modify it.
+
+  For example, if you distribute copies of the library, whether gratis
+or for a fee, you must give the recipients all the rights that we gave
+you.  You must make sure that they, too, receive or can get the source
+code.  If you link other code with the library, you must provide
+complete object files to the recipients, so that they can relink them
+with the library after making changes to the library and recompiling
+it.  And you must show them these terms so they know their rights.
+
+  We protect your rights with a two-step method: (1) we copyright the
+library, and (2) we offer you this license, which gives you legal
+permission to copy, distribute and/or modify the library.
+
+  To protect each distributor, we want to make it very clear that
+there is no warranty for the free library.  Also, if the library is
+modified by someone else and passed on, the recipients should know
+that what they have is not the original version, so that the original
+author's reputation will not be affected by problems that might be
+introduced by others.
+\f
+  Finally, software patents pose a constant threat to the existence of
+any free program.  We wish to make sure that a company cannot
+effectively restrict the users of a free program by obtaining a
+restrictive license from a patent holder.  Therefore, we insist that
+any patent license obtained for a version of the library must be
+consistent with the full freedom of use specified in this license.
+
+  Most GNU software, including some libraries, is covered by the
+ordinary GNU General Public License.  This license, the GNU Lesser
+General Public License, applies to certain designated libraries, and
+is quite different from the ordinary General Public License.  We use
+this license for certain libraries in order to permit linking those
+libraries into non-free programs.
+
+  When a program is linked with a library, whether statically or using
+a shared library, the combination of the two is legally speaking a
+combined work, a derivative of the original library.  The ordinary
+General Public License therefore permits such linking only if the
+entire combination fits its criteria of freedom.  The Lesser General
+Public License permits more lax criteria for linking other code with
+the library.
+
+  We call this license the "Lesser" General Public License because it
+does Less to protect the user's freedom than the ordinary General
+Public License.  It also provides other free software developers Less
+of an advantage over competing non-free programs.  These disadvantages
+are the reason we use the ordinary General Public License for many
+libraries.  However, the Lesser license provides advantages in certain
+special circumstances.
+
+  For example, on rare occasions, there may be a special need to
+encourage the widest possible use of a certain library, so that it becomes
+a de-facto standard.  To achieve this, non-free programs must be
+allowed to use the library.  A more frequent case is that a free
+library does the same job as widely used non-free libraries.  In this
+case, there is little to gain by limiting the free library to free
+software only, so we use the Lesser General Public License.
+
+  In other cases, permission to use a particular library in non-free
+programs enables a greater number of people to use a large body of
+free software.  For example, permission to use the GNU C Library in
+non-free programs enables many more people to use the whole GNU
+operating system, as well as its variant, the GNU/Linux operating
+system.
+
+  Although the Lesser General Public License is Less protective of the
+users' freedom, it does ensure that the user of a program that is
+linked with the Library has the freedom and the wherewithal to run
+that program using a modified version of the Library.
+
+  The precise terms and conditions for copying, distribution and
+modification follow.  Pay close attention to the difference between a
+"work based on the library" and a "work that uses the library".  The
+former contains code derived from the library, whereas the latter must
+be combined with the library in order to run.
+\f
+                 GNU LESSER GENERAL PUBLIC LICENSE
+   TERMS AND CONDITIONS FOR COPYING, DISTRIBUTION AND MODIFICATION
+
+  0. This License Agreement applies to any software library or other
+program which contains a notice placed by the copyright holder or
+other authorized party saying it may be distributed under the terms of
+this Lesser General Public License (also called "this License").
+Each licensee is addressed as "you".
+
+  A "library" means a collection of software functions and/or data
+prepared so as to be conveniently linked with application programs
+(which use some of those functions and data) to form executables.
+
+  The "Library", below, refers to any such software library or work
+which has been distributed under these terms.  A "work based on the
+Library" means either the Library or any derivative work under
+copyright law: that is to say, a work containing the Library or a
+portion of it, either verbatim or with modifications and/or translated
+straightforwardly into another language.  (Hereinafter, translation is
+included without limitation in the term "modification".)
+
+  "Source code" for a work means the preferred form of the work for
+making modifications to it.  For a library, complete source code means
+all the source code for all modules it contains, plus any associated
+interface definition files, plus the scripts used to control compilation
+and installation of the library.
+
+  Activities other than copying, distribution and modification are not
+covered by this License; they are outside its scope.  The act of
+running a program using the Library is not restricted, and output from
+such a program is covered only if its contents constitute a work based
+on the Library (independent of the use of the Library in a tool for
+writing it).  Whether that is true depends on what the Library does
+and what the program that uses the Library does.
+  
+  1. You may copy and distribute verbatim copies of the Library's
+complete source code as you receive it, in any medium, provided that
+you conspicuously and appropriately publish on each copy an
+appropriate copyright notice and disclaimer of warranty; keep intact
+all the notices that refer to this License and to the absence of any
+warranty; and distribute a copy of this License along with the
+Library.
+
+  You may charge a fee for the physical act of transferring a copy,
+and you may at your option offer warranty protection in exchange for a
+fee.
+\f
+  2. You may modify your copy or copies of the Library or any portion
+of it, thus forming a work based on the Library, and copy and
+distribute such modifications or work under the terms of Section 1
+above, provided that you also meet all of these conditions:
+
+    a) The modified work must itself be a software library.
+
+    b) You must cause the files modified to carry prominent notices
+    stating that you changed the files and the date of any change.
+
+    c) You must cause the whole of the work to be licensed at no
+    charge to all third parties under the terms of this License.
+
+    d) If a facility in the modified Library refers to a function or a
+    table of data to be supplied by an application program that uses
+    the facility, other than as an argument passed when the facility
+    is invoked, then you must make a good faith effort to ensure that,
+    in the event an application does not supply such function or
+    table, the facility still operates, and performs whatever part of
+    its purpose remains meaningful.
+
+    (For example, a function in a library to compute square roots has
+    a purpose that is entirely well-defined independent of the
+    application.  Therefore, Subsection 2d requires that any
+    application-supplied function or table used by this function must
+    be optional: if the application does not supply it, the square
+    root function must still compute square roots.)
+
+These requirements apply to the modified work as a whole.  If
+identifiable sections of that work are not derived from the Library,
+and can be reasonably considered independent and separate works in
+themselves, then this License, and its terms, do not apply to those
+sections when you distribute them as separate works.  But when you
+distribute the same sections as part of a whole which is a work based
+on the Library, the distribution of the whole must be on the terms of
+this License, whose permissions for other licensees extend to the
+entire whole, and thus to each and every part regardless of who wrote
+it.
+
+Thus, it is not the intent of this section to claim rights or contest
+your rights to work written entirely by you; rather, the intent is to
+exercise the right to control the distribution of derivative or
+collective works based on the Library.
+
+In addition, mere aggregation of another work not based on the Library
+with the Library (or with a work based on the Library) on a volume of
+a storage or distribution medium does not bring the other work under
+the scope of this License.
+
+  3. You may opt to apply the terms of the ordinary GNU General Public
+License instead of this License to a given copy of the Library.  To do
+this, you must alter all the notices that refer to this License, so
+that they refer to the ordinary GNU General Public License, version 2,
+instead of to this License.  (If a newer version than version 2 of the
+ordinary GNU General Public License has appeared, then you can specify
+that version instead if you wish.)  Do not make any other change in
+these notices.
+\f
+  Once this change is made in a given copy, it is irreversible for
+that copy, so the ordinary GNU General Public License applies to all
+subsequent copies and derivative works made from that copy.
+
+  This option is useful when you wish to copy part of the code of
+the Library into a program that is not a library.
+
+  4. You may copy and distribute the Library (or a portion or
+derivative of it, under Section 2) in object code or executable form
+under the terms of Sections 1 and 2 above provided that you accompany
+it with the complete corresponding machine-readable source code, which
+must be distributed under the terms of Sections 1 and 2 above on a
+medium customarily used for software interchange.
+
+  If distribution of object code is made by offering access to copy
+from a designated place, then offering equivalent access to copy the
+source code from the same place satisfies the requirement to
+distribute the source code, even though third parties are not
+compelled to copy the source along with the object code.
+
+  5. A program that contains no derivative of any portion of the
+Library, but is designed to work with the Library by being compiled or
+linked with it, is called a "work that uses the Library".  Such a
+work, in isolation, is not a derivative work of the Library, and
+therefore falls outside the scope of this License.
+
+  However, linking a "work that uses the Library" with the Library
+creates an executable that is a derivative of the Library (because it
+contains portions of the Library), rather than a "work that uses the
+library".  The executable is therefore covered by this License.
+Section 6 states terms for distribution of such executables.
+
+  When a "work that uses the Library" uses material from a header file
+that is part of the Library, the object code for the work may be a
+derivative work of the Library even though the source code is not.
+Whether this is true is especially significant if the work can be
+linked without the Library, or if the work is itself a library.  The
+threshold for this to be true is not precisely defined by law.
+
+  If such an object file uses only numerical parameters, data
+structure layouts and accessors, and small macros and small inline
+functions (ten lines or less in length), then the use of the object
+file is unrestricted, regardless of whether it is legally a derivative
+work.  (Executables containing this object code plus portions of the
+Library will still fall under Section 6.)
+
+  Otherwise, if the work is a derivative of the Library, you may
+distribute the object code for the work under the terms of Section 6.
+Any executables containing that work also fall under Section 6,
+whether or not they are linked directly with the Library itself.
+\f
+  6. As an exception to the Sections above, you may also combine or
+link a "work that uses the Library" with the Library to produce a
+work containing portions of the Library, and distribute that work
+under terms of your choice, provided that the terms permit
+modification of the work for the customer's own use and reverse
+engineering for debugging such modifications.
+
+  You must give prominent notice with each copy of the work that the
+Library is used in it and that the Library and its use are covered by
+this License.  You must supply a copy of this License.  If the work
+during execution displays copyright notices, you must include the
+copyright notice for the Library among them, as well as a reference
+directing the user to the copy of this License.  Also, you must do one
+of these things:
+
+    a) Accompany the work with the complete corresponding
+    machine-readable source code for the Library including whatever
+    changes were used in the work (which must be distributed under
+    Sections 1 and 2 above); and, if the work is an executable linked
+    with the Library, with the complete machine-readable "work that
+    uses the Library", as object code and/or source code, so that the
+    user can modify the Library and then relink to produce a modified
+    executable containing the modified Library.  (It is understood
+    that the user who changes the contents of definitions files in the
+    Library will not necessarily be able to recompile the application
+    to use the modified definitions.)
+
+    b) Use a suitable shared library mechanism for linking with the
+    Library.  A suitable mechanism is one that (1) uses at run time a
+    copy of the library already present on the user's computer system,
+    rather than copying library functions into the executable, and (2)
+    will operate properly with a modified version of the library, if
+    the user installs one, as long as the modified version is
+    interface-compatible with the version that the work was made with.
+
+    c) Accompany the work with a written offer, valid for at
+    least three years, to give the same user the materials
+    specified in Subsection 6a, above, for a charge no more
+    than the cost of performing this distribution.
+
+    d) If distribution of the work is made by offering access to copy
+    from a designated place, offer equivalent access to copy the above
+    specified materials from the same place.
+
+    e) Verify that the user has already received a copy of these
+    materials or that you have already sent this user a copy.
+
+  For an executable, the required form of the "work that uses the
+Library" must include any data and utility programs needed for
+reproducing the executable from it.  However, as a special exception,
+the materials to be distributed need not include anything that is
+normally distributed (in either source or binary form) with the major
+components (compiler, kernel, and so on) of the operating system on
+which the executable runs, unless that component itself accompanies
+the executable.
+
+  It may happen that this requirement contradicts the license
+restrictions of other proprietary libraries that do not normally
+accompany the operating system.  Such a contradiction means you cannot
+use both them and the Library together in an executable that you
+distribute.
+\f
+  7. You may place library facilities that are a work based on the
+Library side-by-side in a single library together with other library
+facilities not covered by this License, and distribute such a combined
+library, provided that the separate distribution of the work based on
+the Library and of the other library facilities is otherwise
+permitted, and provided that you do these two things:
+
+    a) Accompany the combined library with a copy of the same work
+    based on the Library, uncombined with any other library
+    facilities.  This must be distributed under the terms of the
+    Sections above.
+
+    b) Give prominent notice with the combined library of the fact
+    that part of it is a work based on the Library, and explaining
+    where to find the accompanying uncombined form of the same work.
+
+  8. You may not copy, modify, sublicense, link with, or distribute
+the Library except as expressly provided under this License.  Any
+attempt otherwise to copy, modify, sublicense, link with, or
+distribute the Library is void, and will automatically terminate your
+rights under this License.  However, parties who have received copies,
+or rights, from you under this License will not have their licenses
+terminated so long as such parties remain in full compliance.
+
+  9. You are not required to accept this License, since you have not
+signed it.  However, nothing else grants you permission to modify or
+distribute the Library or its derivative works.  These actions are
+prohibited by law if you do not accept this License.  Therefore, by
+modifying or distributing the Library (or any work based on the
+Library), you indicate your acceptance of this License to do so, and
+all its terms and conditions for copying, distributing or modifying
+the Library or works based on it.
+
+  10. Each time you redistribute the Library (or any work based on the
+Library), the recipient automatically receives a license from the
+original licensor to copy, distribute, link with or modify the Library
+subject to these terms and conditions.  You may not impose any further
+restrictions on the recipients' exercise of the rights granted herein.
+You are not responsible for enforcing compliance by third parties with
+this License.
+\f
+  11. If, as a consequence of a court judgment or allegation of patent
+infringement or for any other reason (not limited to patent issues),
+conditions are imposed on you (whether by court order, agreement or
+otherwise) that contradict the conditions of this License, they do not
+excuse you from the conditions of this License.  If you cannot
+distribute so as to satisfy simultaneously your obligations under this
+License and any other pertinent obligations, then as a consequence you
+may not distribute the Library at all.  For example, if a patent
+license would not permit royalty-free redistribution of the Library by
+all those who receive copies directly or indirectly through you, then
+the only way you could satisfy both it and this License would be to
+refrain entirely from distribution of the Library.
+
+If any portion of this section is held invalid or unenforceable under any
+particular circumstance, the balance of the section is intended to apply,
+and the section as a whole is intended to apply in other circumstances.
+
+It is not the purpose of this section to induce you to infringe any
+patents or other property right claims or to contest validity of any
+such claims; this section has the sole purpose of protecting the
+integrity of the free software distribution system which is
+implemented by public license practices.  Many people have made
+generous contributions to the wide range of software distributed
+through that system in reliance on consistent application of that
+system; it is up to the author/donor to decide if he or she is willing
+to distribute software through any other system and a licensee cannot
+impose that choice.
+
+This section is intended to make thoroughly clear what is believed to
+be a consequence of the rest of this License.
+
+  12. If the distribution and/or use of the Library is restricted in
+certain countries either by patents or by copyrighted interfaces, the
+original copyright holder who places the Library under this License may add
+an explicit geographical distribution limitation excluding those countries,
+so that distribution is permitted only in or among countries not thus
+excluded.  In such case, this License incorporates the limitation as if
+written in the body of this License.
+
+  13. The Free Software Foundation may publish revised and/or new
+versions of the Lesser General Public License from time to time.
+Such new versions will be similar in spirit to the present version,
+but may differ in detail to address new problems or concerns.
+
+Each version is given a distinguishing version number.  If the Library
+specifies a version number of this License which applies to it and
+"any later version", you have the option of following the terms and
+conditions either of that version or of any later version published by
+the Free Software Foundation.  If the Library does not specify a
+license version number, you may choose any version ever published by
+the Free Software Foundation.
+\f
+  14. If you wish to incorporate parts of the Library into other free
+programs whose distribution conditions are incompatible with these,
+write to the author to ask for permission.  For software which is
+copyrighted by the Free Software Foundation, write to the Free
+Software Foundation; we sometimes make exceptions for this.  Our
+decision will be guided by the two goals of preserving the free status
+of all derivatives of our free software and of promoting the sharing
+and reuse of software generally.
+
+                           NO WARRANTY
+
+  15. BECAUSE THE LIBRARY IS LICENSED FREE OF CHARGE, THERE IS NO
+WARRANTY FOR THE LIBRARY, TO THE EXTENT PERMITTED BY APPLICABLE LAW.
+EXCEPT WHEN OTHERWISE STATED IN WRITING THE COPYRIGHT HOLDERS AND/OR
+OTHER PARTIES PROVIDE THE LIBRARY "AS IS" WITHOUT WARRANTY OF ANY
+KIND, EITHER EXPRESSED OR IMPLIED, INCLUDING, BUT NOT LIMITED TO, THE
+IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR
+PURPOSE.  THE ENTIRE RISK AS TO THE QUALITY AND PERFORMANCE OF THE
+LIBRARY IS WITH YOU.  SHOULD THE LIBRARY PROVE DEFECTIVE, YOU ASSUME
+THE COST OF ALL NECESSARY SERVICING, REPAIR OR CORRECTION.
+
+  16. IN NO EVENT UNLESS REQUIRED BY APPLICABLE LAW OR AGREED TO IN
+WRITING WILL ANY COPYRIGHT HOLDER, OR ANY OTHER PARTY WHO MAY MODIFY
+AND/OR REDISTRIBUTE THE LIBRARY AS PERMITTED ABOVE, BE LIABLE TO YOU
+FOR DAMAGES, INCLUDING ANY GENERAL, SPECIAL, INCIDENTAL OR
+CONSEQUENTIAL DAMAGES ARISING OUT OF THE USE OR INABILITY TO USE THE
+LIBRARY (INCLUDING BUT NOT LIMITED TO LOSS OF DATA OR DATA BEING
+RENDERED INACCURATE OR LOSSES SUSTAINED BY YOU OR THIRD PARTIES OR A
+FAILURE OF THE LIBRARY TO OPERATE WITH ANY OTHER SOFTWARE), EVEN IF
+SUCH HOLDER OR OTHER PARTY HAS BEEN ADVISED OF THE POSSIBILITY OF SUCH
+DAMAGES.
+
+                    END OF TERMS AND CONDITIONS
+\f
+           How to Apply These Terms to Your New Libraries
+
+  If you develop a new library, and you want it to be of the greatest
+possible use to the public, we recommend making it free software that
+everyone can redistribute and change.  You can do so by permitting
+redistribution under these terms (or, alternatively, under the terms of the
+ordinary General Public License).
+
+  To apply these terms, attach the following notices to the library.  It is
+safest to attach them to the start of each source file to most effectively
+convey the exclusion of warranty; and each file should have at least the
+"copyright" line and a pointer to where the full notice is found.
+
+    <one line to give the library's name and a brief idea of what it does.>
+    Copyright (C) <year>  <name of author>
+
+    This library is free software; you can redistribute it and/or
+    modify it under the terms of the GNU Lesser General Public
+    License as published by the Free Software Foundation; either
+    version 2.1 of the License, or (at your option) any later version.
+
+    This library is distributed in the hope that it will be useful,
+    but WITHOUT ANY WARRANTY; without even the implied warranty of
+    MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the GNU
+    Lesser General Public License for more details.
+
+    You should have received a copy of the GNU Lesser General Public
+    License along with this library; if not, write to the Free Software
+    Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA  02111-1307  USA
+
+Also add information on how to contact you by electronic and paper mail.
+
+You should also get your employer (if you work as a programmer) or your
+school, if any, to sign a "copyright disclaimer" for the library, if
+necessary.  Here is a sample; alter the names:
+
+  Yoyodyne, Inc., hereby disclaims all copyright interest in the
+  library `Frob' (a library for tweaking knobs) written by James Random Hacker.
+
+  <signature of Ty Coon>, 1 April 1990
+  Ty Coon, President of Vice
+
+That's all there is to it!
+
+
diff --git a/src/AppQuickStart/app-template/README b/src/AppQuickStart/app-template/README
new file mode 100644 (file)
index 0000000..e69de29
diff --git a/src/AppQuickStart/app-template/doc/CMakeLists.txt b/src/AppQuickStart/app-template/doc/CMakeLists.txt
new file mode 100755 (executable)
index 0000000..b75081b
--- /dev/null
@@ -0,0 +1,31 @@
+# Copyright (C) 2012-2014  CEA/DEN, EDF R&D
+#
+# This library is free software; you can redistribute it and/or
+# modify it under the terms of the GNU Lesser General Public
+# License as published by the Free Software Foundation; either
+# version 2.1 of the License, or (at your option) any later version.
+#
+# This library is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the GNU
+# Lesser General Public License for more details.
+#
+# You should have received a copy of the GNU Lesser General Public
+# License along with this library; if not, write to the Free Software
+# Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA  02111-1307 USA
+#
+# See http://www.salome-platform.org/ or email : webmaster.salome@opencascade.com
+#
+
+SALOME_CONFIGURE_FILE(conf.py.in conf.py)
+
+SET(_cmd_options -c ${CMAKE_CURRENT_BINARY_DIR} -b html -d doctrees -D latex_paper_size=a4 ${CMAKE_CURRENT_SOURCE_DIR} html)
+SALOME_GENERATE_ENVIRONMENT_SCRIPT(_cmd env_script "${SPHINX_EXECUTABLE}" "${_cmd_options}")            
+
+ADD_CUSTOM_TARGET(html_docs COMMAND ${_cmd})
+
+INSTALL(CODE "EXECUTE_PROCESS(COMMAND \"${CMAKE_COMMAND}\" --build ${PROJECT_BINARY_DIR} --target html_docs)")
+INSTALL(DIRECTORY ${CMAKE_CURRENT_BINARY_DIR}/html/ DESTINATION ${SALOME_[NAME_OF_APPLICATION]_PROFILE_INSTALL_DOC_GUI})
+
+SET(make_clean_files html doctrees)
+SET_DIRECTORY_PROPERTIES(PROPERTIES ADDITIONAL_MAKE_CLEAN_FILES "${make_clean_files}")
diff --git a/src/AppQuickStart/app-template/doc/README b/src/AppQuickStart/app-template/doc/README
new file mode 100644 (file)
index 0000000..f5406eb
--- /dev/null
@@ -0,0 +1 @@
+This directory contains the sources of <Name_of_Application>'s documentation
diff --git a/src/AppQuickStart/app-template/doc/conf.py.in b/src/AppQuickStart/app-template/doc/conf.py.in
new file mode 100644 (file)
index 0000000..2d168f0
--- /dev/null
@@ -0,0 +1,187 @@
+# -*- coding: utf-8 -*-
+#
+# This file is execfile()d with the current directory set to its containing dir.
+#
+# The contents of this file are pickled, so don't put values in the namespace
+# that aren't pickleable (module imports are okay, they're removed automatically).
+#
+# All configuration values have a default; values that are commented out
+# serve to show the default.
+
+import sys, os
+
+# If your extensions are in another directory, add it here. If the directory
+# is relative to the documentation root, use os.path.abspath to make it
+# absolute, like shown here.
+#sys.path.append(os.path.abspath('.'))
+
+# General configuration
+# ---------------------
+
+# Add any Sphinx extension module names here, as strings. They can be extensions
+# coming with Sphinx (named 'sphinx.ext.*') or your custom ones.
+extensions = []
+
+# Add any paths that contain templates here, relative to this directory.
+templates_path = ['_templates']
+
+# The suffix of source filenames.
+source_suffix = '.rst'
+
+# The encoding of source files.
+#source_encoding = 'utf-8'
+
+# The master toctree document.
+master_doc = 'index'
+
+# General information about the project.
+project = '(name_of_application)'
+copyright = '2010-2014 CEA/DEN, EDF R&D, OPEN CASCADE, ASTEK INDUSTRIE'
+
+# The version info for the project you're documenting, acts as replacement for
+# |version| and |release|, also used in various other places throughout the
+# built documents.
+#
+# The short X.Y version.
+version = '@SALOME[NAME_OF_APPLICATION]_MAJOR_VERSION@.@SALOME[NAME_OF_APPLICATION]_MINOR_VERSION@'
+# The full version, including alpha/beta/rc tags.
+release = '@SALOME[NAME_OF_APPLICATION]_VERSION@'
+
+# The language for content autogenerated by Sphinx. Refer to documentation
+# for a list of supported languages.
+#language = None
+
+# There are two options for replacing |today|: either, you set today to some
+# non-false value, then it is used:
+#today = ''
+# Else, today_fmt is used as the format for a strftime call.
+#today_fmt = '%B %d, %Y'
+
+# List of documents that shouldn't be included in the build.
+#unused_docs = []
+
+# List of directories, relative to source directory, that shouldn't be searched
+# for source files.
+exclude_trees = ['.build','ref','images','CVS']
+
+# A list of glob-style patterns that should be excluded when looking for source
+# files. They are matched against the source file names relative to the
+# source directory, using slashes as directory separators on all platforms.
+exclude_patterns = ['**/CVS']
+
+# The reST default role (used for this markup: `text`) to use for all documents.
+#default_role = None
+
+# If true, '()' will be appended to :func: etc. cross-reference text.
+#add_function_parentheses = True
+
+# If true, the current module name will be prepended to all description
+# unit titles (such as .. function::).
+#add_module_names = True
+
+# If true, sectionauthor and moduleauthor directives will be shown in the
+# output. They are ignored by default.
+#show_authors = False
+
+# The name of the Pygments (syntax highlighting) style to use.
+pygments_style = 'sphinx'
+
+
+# Options for HTML output
+# -----------------------
+
+# The theme to use for HTML and HTML Help pages.  Major themes that come with
+# Sphinx are currently 'default' and 'sphinxdoc'.
+html_theme = 'default'
+
+# The name for this set of Sphinx documents.  If None, it defaults to
+# "<project> v<release> documentation".
+#html_title = None
+
+# A shorter title for the navigation bar.  Default is the same as html_title.
+#html_short_title = None
+
+# The name of an image file (relative to this directory) to place at the top
+# of the sidebar.
+#html_logo = None
+
+# The name of an image file (within the static path) to use as favicon of the
+# docs.  This file should be a Windows icon file (.ico) being 16x16 or 32x32
+# pixels large.
+#html_favicon = None
+
+# Add any paths that contain custom static files (such as style sheets) here,
+# relative to this directory. They are copied after the builtin static files,
+# so a file named "default.css" will overwrite the builtin "default.css".
+html_static_path = ['@SALOME_[NAME_OF_APPLICATION]_PROFILE_INSTALL_DOC_GUI@/_static']
+
+# If not '', a 'Last updated on:' timestamp is inserted at every page bottom,
+# using the given strftime format.
+#html_last_updated_fmt = '%b %d, %Y'
+
+# If true, SmartyPants will be used to convert quotes and dashes to
+# typographically correct entities.
+#html_use_smartypants = True
+
+# Custom sidebar templates, maps document names to template names.
+#html_sidebars = {}
+
+# Additional templates that should be rendered to pages, maps page names to
+# template names.
+#html_additional_pages = {}
+
+# If false, no module index is generated.
+html_use_modindex = False
+
+# If false, no index is generated.
+#html_use_index = True
+
+# If true, the index is split into individual pages for each letter.
+#html_split_index = False
+
+# If true, the reST sources are included in the HTML build as _sources/<name>.
+#html_copy_source = True
+
+# If true, an OpenSearch description file will be output, and all pages will
+# contain a <link> tag referring to it.  The value of this option must be the
+# base URL from which the finished HTML is served.
+#html_use_opensearch = ''
+
+# If nonempty, this is the file name suffix for HTML files (e.g. ".xhtml").
+#html_file_suffix = ''
+
+# Output file base name for HTML help builder.
+htmlhelp_basename = '(name_of_application)doc'
+
+
+# Options for LaTeX output
+# ------------------------
+
+# The paper size ('letter' or 'a4').
+latex_paper_size = 'a4'
+
+# The font size ('10pt', '11pt' or '12pt').
+latex_font_size = '10pt'
+
+# Grouping the document tree into LaTeX files. List of tuples
+# (source start file, target name, title, author, document class [howto/manual]).
+latex_documents = [
+  ('index', '(name_of_application).tex', '<Name_of_Application> User Documentation', 'A. Ribes', 'manual')
+]
+
+# The name of an image file (relative to this directory) to place at the top of
+# the title page.
+#latex_logo = None
+
+# For "manual" documents, if this is true, then toplevel headings are parts,
+# not chapters.
+#latex_use_parts = False
+
+# Additional stuff for the LaTeX preamble.
+#latex_preamble = ''
+
+# Documents to append as an appendix to all manuals.
+#latex_appendices = []
+
+# If false, no module index is generated.
+latex_use_modindex = False
diff --git a/src/AppQuickStart/app-template/doc/index.rst b/src/AppQuickStart/app-template/doc/index.rst
new file mode 100644 (file)
index 0000000..cb2b308
--- /dev/null
@@ -0,0 +1,14 @@
+
+%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%
+<Name_of_Application>'s documentation 
+%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%
+
+Outline
+===========================
+
+
+.. toctree::
+    :maxdepth: 1
+
+    intro.rst
+    link.rst
diff --git a/src/AppQuickStart/app-template/doc/intro.rst b/src/AppQuickStart/app-template/doc/intro.rst
new file mode 100644 (file)
index 0000000..e2baa23
--- /dev/null
@@ -0,0 +1,4 @@
+Introduction
+==========================================
+
+Welcome to <Name_of_Application>'s documentation!
diff --git a/src/AppQuickStart/app-template/doc/link.rst b/src/AppQuickStart/app-template/doc/link.rst
new file mode 100644 (file)
index 0000000..33a4a2c
--- /dev/null
@@ -0,0 +1,4 @@
+Link
+==========================================
+
+A sample pdf file can be found :download:`here <../resources/doc/sample.pdf>`
diff --git a/src/AppQuickStart/app-template/resources/CMakeLists.txt b/src/AppQuickStart/app-template/resources/CMakeLists.txt
new file mode 100644 (file)
index 0000000..c3a4cae
--- /dev/null
@@ -0,0 +1,36 @@
+# Copyright (C) 2012-2014  CEA/DEN, EDF R&D, OPEN CASCADE
+#
+# This library is free software; you can redistribute it and/or
+# modify it under the terms of the GNU Lesser General Public
+# License as published by the Free Software Foundation; either
+# version 2.1 of the License, or (at your option) any later version.
+#
+# This library is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the GNU
+# Lesser General Public License for more details.
+#
+# You should have received a copy of the GNU Lesser General Public
+# License along with this library; if not, write to the Free Software
+# Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA  02111-1307 USA
+#
+# See http://www.salome-platform.org/ or email : webmaster.salome@opencascade.com
+#
+
+# --- resources ---
+SET([NAME_OF_APPLICATION]_PROFILE_RESOURCES_FILES
+  app_icon.png
+  splash.png
+  about.png
+  icon_about.png
+  app_logo.png
+)
+
+# --- rules ---
+INSTALL(FILES ${[NAME_OF_APPLICATION]_PROFILE_RESOURCES_FILES} DESTINATION ${SALOME_[NAME_OF_APPLICATION]_PROFILE_INSTALL_RES_DATA})
+
+# --- config ---
+SALOME_CONFIGURE_FILE(${CMAKE_CURRENT_SOURCE_DIR}/SalomeApp.xml.in ${CMAKE_CURRENT_BINARY_DIR}/SalomeApp.xml INSTALL ${SALOME_[NAME_OF_APPLICATION]_PROFILE_INSTALL_RES_DATA})
+
+# --- sub-directories ---
+ADD_SUBDIRECTORY( doc )
diff --git a/src/AppQuickStart/app-template/resources/SalomeApp.xml.in b/src/AppQuickStart/app-template/resources/SalomeApp.xml.in
new file mode 100644 (file)
index 0000000..3a992ce
--- /dev/null
@@ -0,0 +1,30 @@
+<?xml version='1.0' encoding='utf-8'?>
+<document>  
+  <section name="launch">    
+    <parameter name="gui" value="yes"/>
+    <parameter name="splash" value="yes"/>
+    <parameter name="file" value="no"/>
+    <parameter name="key" value="no"/>
+    <parameter name="interp" value="no"/>
+    <parameter name="logger" value="no"/>
+    <parameter name="xterm" value="no"/>
+    <parameter name="portkill" value="no"/>
+    <parameter name="killall" value="no"/>
+    <parameter name="noexcepthandler" value="no"/>
+    <parameter name="modules" value="[LIST_OF_MODULES]"/>
+    <parameter name="pyModules" value=""/>
+    <parameter name="embedded" value="SalomeAppEngine,study,cppContainer,registry,moduleCatalog"/>
+    <parameter name="standalone" value=""/>
+  </section>
+  <section name="splash">
+    <parameter name="image" value="%<Name_of_Application>_PROFILE_ROOT_DIR%/share/salome/resources/(name_of_application)_profile/splash.png"/>
+    <parameter name="text_colors" value="#ffffff|#000000"/>
+    <parameter name="show_percents" value="yes"/>
+    <parameter name="show_progress" value="yes"/>
+    <parameter name="show_message" value="yes"/>
+    <parameter name="font" value="Xirod,12,normal"/>
+  </section>
+  <section name="resources">
+    <parameter name="LightApp" value="%<Name_of_Application>_PROFILE_ROOT_DIR%/share/salome/resources/(name_of_application)_profile"/>
+  </section>
+</document>
diff --git a/src/AppQuickStart/app-template/resources/about.png b/src/AppQuickStart/app-template/resources/about.png
new file mode 100755 (executable)
index 0000000..dfdc7e6
Binary files /dev/null and b/src/AppQuickStart/app-template/resources/about.png differ
diff --git a/src/AppQuickStart/app-template/resources/app_icon.png b/src/AppQuickStart/app-template/resources/app_icon.png
new file mode 100755 (executable)
index 0000000..03e172c
Binary files /dev/null and b/src/AppQuickStart/app-template/resources/app_icon.png differ
diff --git a/src/AppQuickStart/app-template/resources/app_logo.png b/src/AppQuickStart/app-template/resources/app_logo.png
new file mode 100644 (file)
index 0000000..362c018
Binary files /dev/null and b/src/AppQuickStart/app-template/resources/app_logo.png differ
diff --git a/src/AppQuickStart/app-template/resources/doc/CMakeLists.txt b/src/AppQuickStart/app-template/resources/doc/CMakeLists.txt
new file mode 100644 (file)
index 0000000..1e3735a
--- /dev/null
@@ -0,0 +1,27 @@
+# Copyright (C) 2012-2014  CEA/DEN, EDF R&D, OPEN CASCADE
+#
+# This library is free software; you can redistribute it and/or
+# modify it under the terms of the GNU Lesser General Public
+# License as published by the Free Software Foundation; either
+# version 2.1 of the License, or (at your option) any later version.
+#
+# This library is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the GNU
+# Lesser General Public License for more details.
+#
+# You should have received a copy of the GNU Lesser General Public
+# License along with this library; if not, write to the Free Software
+# Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA  02111-1307 USA
+#
+# See http://www.salome-platform.org/ or email : webmaster.salome@opencascade.com
+#
+
+# --- scripts ---
+
+# scripts / static
+SET(_bin_DOCUMENTS
+   sample.pdf
+)
+
+INSTALL(FILES ${_bin_DOCUMENTS} DESTINATION ${SALOME_[NAME_OF_APPLICATION]_PROFILE_INSTALL_DOC_GUI})
diff --git a/src/AppQuickStart/app-template/resources/doc/README b/src/AppQuickStart/app-template/resources/doc/README
new file mode 100644 (file)
index 0000000..8f54bbb
--- /dev/null
@@ -0,0 +1 @@
+This directory contains binaries of <Name_of_Application>'s documentation
diff --git a/src/AppQuickStart/app-template/resources/doc/sample.pdf b/src/AppQuickStart/app-template/resources/doc/sample.pdf
new file mode 100644 (file)
index 0000000..1f3b08f
Binary files /dev/null and b/src/AppQuickStart/app-template/resources/doc/sample.pdf differ
diff --git a/src/AppQuickStart/app-template/resources/icon_about.png b/src/AppQuickStart/app-template/resources/icon_about.png
new file mode 100755 (executable)
index 0000000..ec56cac
Binary files /dev/null and b/src/AppQuickStart/app-template/resources/icon_about.png differ
diff --git a/src/AppQuickStart/app-template/resources/splash.png b/src/AppQuickStart/app-template/resources/splash.png
new file mode 100755 (executable)
index 0000000..dfdc7e6
Binary files /dev/null and b/src/AppQuickStart/app-template/resources/splash.png differ
diff --git a/src/AppQuickStart/app-template/src/CMakeLists.txt b/src/AppQuickStart/app-template/src/CMakeLists.txt
new file mode 100644 (file)
index 0000000..5fcc1bd
--- /dev/null
@@ -0,0 +1,22 @@
+# Copyright (C) 2012-2014  CEA/DEN, EDF R&D, OPEN CASCADE
+#
+# This library is free software; you can redistribute it and/or
+# modify it under the terms of the GNU Lesser General Public
+# License as published by the Free Software Foundation; either
+# version 2.1 of the License, or (at your option) any later version.
+#
+# This library is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the GNU
+# Lesser General Public License for more details.
+#
+# You should have received a copy of the GNU Lesser General Public
+# License along with this library; if not, write to the Free Software
+# Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA  02111-1307 USA
+#
+# See http://www.salome-platform.org/ or email : webmaster.salome@opencascade.com
+#
+
+# --- sub-directories ---
+ADD_SUBDIRECTORY( tests )
+ADD_SUBDIRECTORY( resources )
diff --git a/src/AppQuickStart/app-template/src/resources/CMakeLists.txt b/src/AppQuickStart/app-template/src/resources/CMakeLists.txt
new file mode 100644 (file)
index 0000000..947046b
--- /dev/null
@@ -0,0 +1,33 @@
+# Copyright (C) 2012-2014  CEA/DEN, EDF R&D, OPEN CASCADE
+#
+# This library is free software; you can redistribute it and/or
+# modify it under the terms of the GNU Lesser General Public
+# License as published by the Free Software Foundation; either
+# version 2.1 of the License, or (at your option) any later version.
+#
+# This library is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the GNU
+# Lesser General Public License for more details.
+#
+# You should have received a copy of the GNU Lesser General Public
+# License along with this library; if not, write to the Free Software
+# Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA  02111-1307 USA
+#
+# See http://www.salome-platform.org/ or email : webmaster.salome@opencascade.com
+#
+
+INCLUDE(UseQt4Ext)
+
+# --- resources ---
+
+# resource files / to be processed by lrelease
+SET(_ts_RESOURCES
+  LightApp_images.ts
+  LightApp_msg_en.ts
+  LightApp_msg_fr.ts
+) 
+
+# --- rules ---
+
+QT4_INSTALL_TS_RESOURCES("${_ts_RESOURCES}" "${SALOME_[NAME_OF_APPLICATION]_PROFILE_INSTALL_RES_DATA}")
diff --git a/src/AppQuickStart/app-template/src/resources/LightApp_images.ts b/src/AppQuickStart/app-template/src/resources/LightApp_images.ts
new file mode 100755 (executable)
index 0000000..ee44bfc
--- /dev/null
@@ -0,0 +1,23 @@
+<?xml version="1.0" encoding="utf-8"?>
+<!DOCTYPE TS>
+<TS version="2.0" language="en_US">
+<context>
+    <name>@default</name>
+    <message>
+        <source>APP_DEFAULT_ICO</source>
+        <translation>app_icon.png</translation>
+    </message>
+    <message>
+        <source>ICO_ABOUT</source>
+        <translation>icon_about.png</translation>
+    </message>
+    <message>
+        <source>ABOUT</source>
+        <translation>about.png</translation>
+    </message>
+    <message>
+        <source>APP_BASE_LOGO</source>
+        <translation>app_logo.png</translation>
+    </message>
+</context>
+</TS>
diff --git a/src/AppQuickStart/app-template/src/resources/LightApp_msg_en.ts b/src/AppQuickStart/app-template/src/resources/LightApp_msg_en.ts
new file mode 100755 (executable)
index 0000000..4f7dfa1
--- /dev/null
@@ -0,0 +1,35 @@
+<?xml version="1.0" encoding="utf-8"?>
+<!DOCTYPE TS>
+<TS version="2.0" language="en_US">
+<context>
+    <name>@default</name>
+    <message>
+        <source>ABOUT_COPYRIGHT</source>
+        <translation>Copyright (C)</translation>
+    </message>
+    <message>
+        <source>ABOUT_CAPTION</source>
+        <translation>About <Name_of_Application></translation>
+    </message>
+    <message>
+        <source>APP_NAME</source>
+        <translation><Name_of_Application> [SLOGAN]</translation>
+    </message>
+    <message>
+        <source>APP_VERSION</source>
+        <translation>V[VERSION]</translation>
+    </message>
+    <message>
+        <source>ABOUT_LICENSE</source>
+        <translation>License description</translation>
+    </message>
+    <message>
+        <source>ABOUT_VERSION</source>
+        <translation>Version [VERSION]</translation>
+    </message>
+    <message>
+        <source>ABOUT_TITLE</source>
+        <translation><Name_of_Application></translation>
+    </message>
+</context>
+</TS>
diff --git a/src/AppQuickStart/app-template/src/resources/LightApp_msg_fr.ts b/src/AppQuickStart/app-template/src/resources/LightApp_msg_fr.ts
new file mode 100755 (executable)
index 0000000..ca80209
--- /dev/null
@@ -0,0 +1,35 @@
+<?xml version="1.0" encoding="utf-8"?>
+<!DOCTYPE TS>
+<TS version="2.0" language="fr_FR">
+<context>
+    <name>@default</name>
+    <message>
+        <source>ABOUT_COPYRIGHT</source>
+        <translation>Copyright (C)</translation>
+    </message>
+    <message>
+        <source>ABOUT_CAPTION</source>
+        <translation>A propos de <Name_of_Application></translation>
+    </message>
+    <message>
+        <source>APP_NAME</source>
+        <translation><Name_of_Application> [SLOGAN]</translation>
+    </message>
+    <message>
+        <source>APP_VERSION</source>
+        <translation>V[VERSION]</translation>
+    </message>
+    <message>
+        <source>ABOUT_LICENSE</source>
+        <translation>Description de la licence</translation>
+    </message>
+    <message>
+        <source>ABOUT_VERSION</source>
+        <translation>Version [VERSION]</translation>
+    </message>
+    <message>
+        <source>ABOUT_TITLE</source>
+        <translation><Name_of_Application></translation>
+    </message>
+</context>
+</TS>
diff --git a/src/AppQuickStart/app-template/src/tests/CMakeLists.txt b/src/AppQuickStart/app-template/src/tests/CMakeLists.txt
new file mode 100644 (file)
index 0000000..110c031
--- /dev/null
@@ -0,0 +1,29 @@
+# Copyright (C) 2012-2014  CEA/DEN, EDF R&D, OPEN CASCADE
+#
+# This library is free software; you can redistribute it and/or
+# modify it under the terms of the GNU Lesser General Public
+# License as published by the Free Software Foundation; either
+# version 2.1 of the License, or (at your option) any later version.
+#
+# This library is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the GNU
+# Lesser General Public License for more details.
+#
+# You should have received a copy of the GNU Lesser General Public
+# License along with this library; if not, write to the Free Software
+# Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA  02111-1307 USA
+#
+# See http://www.salome-platform.org/ or email : webmaster.salome@opencascade.com
+#
+
+# --- scripts ---
+
+# scripts / static
+SET(_bin_SCRIPTS
+   helloWorld.py
+)
+
+# --- rules ---
+SALOME_INSTALL_SCRIPTS("${_bin_SCRIPTS}" ${SALOME_INSTALL_SCRIPT_PYTHON})
+
diff --git a/src/AppQuickStart/app-template/src/tests/README b/src/AppQuickStart/app-template/src/tests/README
new file mode 100644 (file)
index 0000000..ef5ad8f
--- /dev/null
@@ -0,0 +1 @@
+This directory contains the tests of <Name_of_Application>
diff --git a/src/AppQuickStart/app-template/src/tests/helloWorld.py b/src/AppQuickStart/app-template/src/tests/helloWorld.py
new file mode 100644 (file)
index 0000000..62c813a
--- /dev/null
@@ -0,0 +1 @@
+print "Hello world"
diff --git a/src/AppQuickStart/ressources/Anita semi square.ttf b/src/AppQuickStart/ressources/Anita semi square.ttf
new file mode 100644 (file)
index 0000000..17776fd
Binary files /dev/null and b/src/AppQuickStart/ressources/Anita semi square.ttf differ
diff --git a/src/AppQuickStart/ressources/CMakeLists.txt b/src/AppQuickStart/ressources/CMakeLists.txt
new file mode 100644 (file)
index 0000000..e411b26
--- /dev/null
@@ -0,0 +1,30 @@
+# Copyright (C) 2012-2014  CEA/DEN, EDF R&D, OPEN CASCADE
+#
+# This library is free software; you can redistribute it and/or
+# modify it under the terms of the GNU Lesser General Public
+# License as published by the Free Software Foundation; either
+# version 2.1 of the License, or (at your option) any later version.
+#
+# This library is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the GNU
+# Lesser General Public License for more details.
+#
+# You should have received a copy of the GNU Lesser General Public
+# License along with this library; if not, write to the Free Software
+# Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA  02111-1307 USA
+#
+# See http://www.salome-platform.org/ or email : webmaster.salome@opencascade.com
+#
+
+# ===============================================================
+# Files to be installed
+# ===============================================================
+
+# These files are executable scripts
+SET(APPQUICKSTART_RESOURCES_FILES
+  "Anita semi square.ttf"
+  background.png
+)
+
+INSTALL( FILES ${APPQUICKSTART_RESOURCES_FILES} DESTINATION ${SALOME_KERNEL_INSTALL_RES_DATA} )
diff --git a/src/AppQuickStart/ressources/background.png b/src/AppQuickStart/ressources/background.png
new file mode 100644 (file)
index 0000000..66627c8
Binary files /dev/null and b/src/AppQuickStart/ressources/background.png differ
index 8ea2b8ca16509a3a4cea8894ce925a54b90ae162..9e8ee2889bf5f2287d92a31581e277948a36c22a 100755 (executable)
@@ -18,6 +18,7 @@
 #
 
 SET(SUBDIR_BASE
+  AppQuickStart
   Basics
   SALOMELocalTrace
   HDFPersist
@@ -37,6 +38,7 @@ SET(SUBDIR_CORBA
   Notification
   NOTIFICATION_SWIG
   Container
+  SALOMESDS
   TestContainer
   Launcher
   LifeCycleCORBA
index 29a4fa0e2e3d40b27d58b77f95f7ea9c858464b2..e98ce072e506ce699fd2111df0a32d45085f05f2 100644 (file)
@@ -21,6 +21,8 @@
 //
 
 #include "SALOME_ContainerManager.hxx"
+#include "SALOME_ResourcesManager.hxx"
+#include "SALOME_LoadRateManager.hxx"
 #include "SALOME_NamingService.hxx"
 #include "SALOME_ResourcesManager_Client.hxx"
 #include "SALOME_ModuleCatalog.hh"
@@ -49,7 +51,7 @@
 #include "PaCOPP.hxx"
 #endif
 
-#define TIME_OUT_TO_LAUNCH_CONT 60
+const int SALOME_ContainerManager::TIME_OUT_TO_LAUNCH_CONT=60;
 
 const char *SALOME_ContainerManager::_ContainerManagerNameInNS = 
   "/ContainerManager";
@@ -587,11 +589,7 @@ SALOME_ContainerManager::LaunchContainer(const Engines::ContainerParameters& par
     logFilename += tmp.str();
     logFilename += ".log" ;
     command += " > " + logFilename + " 2>&1";
-#ifdef WIN32
-    command = "%PYTHONBIN% -c \"import win32pm ; win32pm.spawnpid(r'" + command + "', '')\"";
-#else
-    command += " &";
-#endif
+    MakeTheCommandToBeLaunchedASync(command);
 
     // launch container with a system call
     status=SystemThreadSafe(command.c_str());
@@ -612,30 +610,14 @@ SALOME_ContainerManager::LaunchContainer(const Engines::ContainerParameters& par
   else
     {
       // Step 4: Wait for the container
-      int count = TIME_OUT_TO_LAUNCH_CONT;
-      if (GetenvThreadSafe("TIMEOUT_TO_LAUNCH_CONTAINER") != 0)
-        {
-          std::string new_count_str = GetenvThreadSafe("TIMEOUT_TO_LAUNCH_CONTAINER");
-          int new_count;
-          std::istringstream ss(new_count_str);
-          if (!(ss >> new_count))
-            {
-              INFOS("[LaunchContainer] TIMEOUT_TO_LAUNCH_CONTAINER should be an int");
-            }
-          else
-            count = new_count;
-        }
+      int count(GetTimeOutToLoaunchServer());
       INFOS("[GiveContainer] waiting " << count << " second steps container " << containerNameInNS);
       while (CORBA::is_nil(ret) && count)
         {
-#ifndef WIN32
-          sleep( 1 ) ;
-#else
-          Sleep(1000);
-#endif
+          SleepInSecond(1);
           count--;
           MESSAGE("[GiveContainer] step " << count << " Waiting for container on " << resource_selected);
-          CORBA::Object_var obj = _NS->Resolve(containerNameInNS.c_str());
+          CORBA::Object_var obj(_NS->Resolve(containerNameInNS.c_str()));
           ret=Engines::Container::_narrow(obj);
         }
       if (CORBA::is_nil(ret))
@@ -980,9 +962,9 @@ void SALOME_ContainerManager::RmTmpFile(std::string& tmpFileName)
 
 void SALOME_ContainerManager::AddOmninamesParams(std::string& command) const
 {
-  CORBA::String_var iorstr = _NS->getIORaddr();
-  command += "ORBInitRef NameService=";
-  command += iorstr;
+  std::ostringstream oss;
+  AddOmninamesParams(oss);
+  command+=oss.str();
 }
 
 //=============================================================================
@@ -991,11 +973,9 @@ void SALOME_ContainerManager::AddOmninamesParams(std::string& command) const
  */ 
 //=============================================================================
 
-void SALOME_ContainerManager::AddOmninamesParams(std::ofstream& fileStream) const
+void SALOME_ContainerManager::AddOmninamesParams(std::ostream& fileStream) const
 {
-  CORBA::String_var iorstr = _NS->getIORaddr();
-  fileStream << "ORBInitRef NameService=";
-  fileStream << iorstr;
+  AddOmninamesParams(fileStream,_NS);
 }
 
 //=============================================================================
@@ -1004,11 +984,48 @@ void SALOME_ContainerManager::AddOmninamesParams(std::ofstream& fileStream) cons
  */ 
 //=============================================================================
 
-void SALOME_ContainerManager::AddOmninamesParams(std::ostringstream& oss) const
+void SALOME_ContainerManager::AddOmninamesParams(std::ostream& fileStream, SALOME_NamingService *ns)
+{
+  CORBA::String_var iorstr(ns->getIORaddr());
+  fileStream << "ORBInitRef NameService=";
+  fileStream << iorstr;
+}
+
+void SALOME_ContainerManager::MakeTheCommandToBeLaunchedASync(std::string& command)
 {
-  CORBA::String_var iorstr = _NS->getIORaddr();
-  oss << "ORBInitRef NameService=";
-  oss << iorstr;
+#ifdef WIN32
+    command = "%PYTHONBIN% -c \"import win32pm ; win32pm.spawnpid(r'" + command + "', '')\"";
+#else
+    command += " &";
+#endif
+}
+
+int SALOME_ContainerManager::GetTimeOutToLoaunchServer()
+{
+  int count(TIME_OUT_TO_LAUNCH_CONT);
+  if (GetenvThreadSafe("TIMEOUT_TO_LAUNCH_CONTAINER") != 0)
+    {
+      std::string new_count_str(GetenvThreadSafe("TIMEOUT_TO_LAUNCH_CONTAINER"));
+      int new_count;
+      std::istringstream ss(new_count_str);
+      if (!(ss >> new_count))
+        {
+          INFOS("[LaunchContainer] TIMEOUT_TO_LAUNCH_CONTAINER should be an int");
+        }
+      else
+        count = new_count;
+    }
+  return count;
+}
+
+void SALOME_ContainerManager::SleepInSecond(int ellapseTimeInSecond)
+{
+#ifndef WIN32
+  sleep( ellapseTimeInSecond ) ;
+#else
+  int timeInMS(1000*ellapseTimeInSecond);
+  Sleep(timeInMS);
+#endif
 }
 
 //=============================================================================
@@ -1852,7 +1869,7 @@ SALOME_ContainerManager::LaunchPaCOProxyContainer(const std::string& command,
     return container_proxy;
   }
 
-  int count = TIME_OUT_TO_LAUNCH_CONT;
+  int count(GetTimeOutToLoaunchServer());
   CORBA::Object_var obj = CORBA::Object::_nil();
   std::string containerNameInNS = _NS->BuildContainerNameForNS(params.container_name.in(), 
                                                                hostname.c_str());
@@ -1936,9 +1953,9 @@ SALOME_ContainerManager::LaunchPaCONodeContainer(const std::string& command,
     std::string container_node_name = name + proc_number;
     std::string containerNameInNS = _NS->BuildContainerNameForNS((char*) container_node_name.c_str(), theMachine.c_str());
     INFOS("[LaunchPaCONodeContainer]  Waiting for Parallel Container node " << containerNameInNS << " on " << theMachine);
-    int count = TIME_OUT_TO_LAUNCH_CONT;
+    int count(GetTimeOutToLoaunchServer());
     while (CORBA::is_nil(obj) && count) {
-      sleep(1) ;
+      SleepInSecond(1);
       count-- ;
       obj = _NS->Resolve(containerNameInNS.c_str());
     }
index fc55e7579f9e76140a31508b49a593de0da11a05..fea0be9103f197e0d4e80821873ad14f100b0f57 100644 (file)
@@ -81,9 +81,7 @@ protected:
 
   void AddOmninamesParams(std::string& command) const;
 
-  void AddOmninamesParams(std::ostringstream& oss) const;
-
-  void AddOmninamesParams(std::ofstream& fileStream) const;
+  void AddOmninamesParams(std::ostream& fileStream) const;
 
   static std::string BuildTemporaryFileName();
 
@@ -161,7 +159,12 @@ protected:
 public:
   static char *GetenvThreadSafe(const char *name);
   static int SystemThreadSafe(const char *command);
-private:
+  static void AddOmninamesParams(std::ostream& fileStream, SALOME_NamingService *ns);
+  static void MakeTheCommandToBeLaunchedASync(std::string& command);
+  static int GetTimeOutToLoaunchServer();
+  static void SleepInSecond(int ellapseTimeInSecond);
+ private:
+  static const int TIME_OUT_TO_LAUNCH_CONT;
   static Utils_Mutex _getenvMutex;
   static Utils_Mutex _systemMutex;
 };
index 4a14d049674c1517364dabcdea114709f13a49ee..9757df6b9fc27286140497cb1650554b416620d1 100755 (executable)
@@ -33,6 +33,7 @@ INCLUDE_DIRECTORIES(
   ${CMAKE_CURRENT_SOURCE_DIR}/../Notification
   ${CMAKE_CURRENT_SOURCE_DIR}/../Container
   ${CMAKE_CURRENT_SOURCE_DIR}/../ResourcesManager
+  ${CMAKE_CURRENT_SOURCE_DIR}/../SALOMESDS
   ${PROJECT_BINARY_DIR}/idl
 )
 
@@ -95,6 +96,7 @@ IF(NOT SALOME_LAUNCHER_ONLY)
   SET(SALOME_LauncherServer_LIBS
     Launcher
     SalomeLauncher
+    SalomeSDS
     SALOMEBasics
     SALOMELocalTrace
     ${LIBBATCH_LIBRARIES}
index 707b2947063a4f74915e74d2d5dfd508a44ea31c..4793267e98eea5642d3fb2ddf8bfcbd7e7cf4b75 100644 (file)
@@ -24,6 +24,7 @@
 #include "BatchTest.hxx"
 #include "OpUtil.hxx"
 #include "SALOME_ContainerManager.hxx"
+#include "SALOME_NamingService.hxx"
 #include "SALOME_ResourcesManager.hxx"
 #include "Utils_CorbaException.hxx"
 
@@ -32,6 +33,8 @@
 #include "Launcher_Job_YACSFile.hxx"
 #include "Launcher_Job_PythonSALOME.hxx"
 
+#include "utilities.h"
+
 #ifdef WIN32
 # include <process.h>
 #else
index 4bb4ecfd9d13c1e991c17c1bec5f92fb0893ac4e..d3b8ec602f06acbc115af9905669e8a254625cf0 100644 (file)
@@ -21,6 +21,7 @@
 //
 
 #include "SALOME_Launcher.hxx"
+#include "SALOMESDS_DataServerManager.hxx"
 #include "utilities.h"
 #include <sstream>
 #include <iostream>
@@ -85,18 +86,26 @@ int main(int argc, char* argv[])
     if(!CORBA::is_nil(obj))
       root_poa = PortableServer::POA::_narrow(obj);
     if(!CORBA::is_nil(root_poa))
-      pman = root_poa->the_POAManager();
+      {
+        pman = root_poa->the_POAManager();
+        pman->activate();
+      }
   }
   catch(CORBA::COMM_FAILURE&){
     MESSAGE( "Container: CORBA::COMM_FAILURE: Unable to contact the Naming Service" );
   }
-  try{
-    SALOME_Launcher *lServ=new SALOME_Launcher(orb,root_poa);
-    pman->activate();
-    lServ->_remove_ref();
-    orb->run();
-    orb->destroy();
-  }catch(CORBA::SystemException&){
+  try
+    {
+      SALOME_Launcher *lServ(new SALOME_Launcher(orb,root_poa));
+      lServ->_remove_ref();
+      //
+      SALOMESDS::DataServerManager *dsm(new SALOMESDS::DataServerManager(argc,argv,orb,root_poa));
+      dsm->_remove_ref();
+      //
+      orb->run();
+      orb->destroy();
+    }
+  catch(CORBA::SystemException&){
     MESSAGE("Caught CORBA::SystemException.");
   }catch(PortableServer::POA::WrongPolicy&){
     MESSAGE("Caught CORBA::WrongPolicyException.");
index abc89bbcd84d57445ea983252649a7a5d3cfa136..2ae2bf280a9cabbfae44a2346b7e86dca87507c0 100755 (executable)
@@ -33,6 +33,7 @@ INCLUDE_DIRECTORIES(
   ${CMAKE_CURRENT_SOURCE_DIR}/../Batch
   ${CMAKE_CURRENT_SOURCE_DIR}/../Notification
   ${CMAKE_CURRENT_SOURCE_DIR}/../Registry
+  ${CMAKE_CURRENT_SOURCE_DIR}/../SALOMESDS
   ${PROJECT_BINARY_DIR}/idl
 )
 
@@ -40,6 +41,7 @@ SET(COMMON_LIBS
   SalomeContainer
   SalomeResourcesManager
   SalomeNS
+  SalomeSDS
   OpUtil
   SALOMELocalTrace
   SALOMEBasics
index 5473178da525278f28f4993c0122704ada775414..19e66e5e10943143ef8e557c07b8ced5f94b6469 100644 (file)
 #include <ServiceUnreachable.hxx>
 
 #include "SALOME_LifeCycleCORBA.hxx"
+#include "SALOME_ResourcesManager.hxx"
+#include "SALOMESDS_DataServerManager.hxx"
+
 #include CORBA_CLIENT_HEADER(SALOME_ModuleCatalog)
 #include CORBA_CLIENT_HEADER(SALOME_Session)
 #include CORBA_CLIENT_HEADER(DSC_Engines)
 #include CORBA_CLIENT_HEADER(SALOME_Registry)
 #include CORBA_CLIENT_HEADER(SALOMEDS)
+#include CORBA_CLIENT_HEADER(SALOME_SDS)
 #include CORBA_CLIENT_HEADER(Logger)
 #include CORBA_CLIENT_HEADER(SALOME_Launcher)
 
@@ -503,8 +507,20 @@ void SALOME_LifeCycleCORBA::shutdownServers()
 #ifndef WIN32
   nanosleep(&ts_req,0);
 #endif
+  // 4 ) Remote ScopeServer (the DataServer is hosted by SalomeLauncher shutdown right after)
+  try
+    {
+      CORBA::Object_var objDSM(_NS->Resolve(SALOMESDS::DataServerManager::NAME_IN_NS));
+      SALOME::DataServerManager_var dsm(SALOME::DataServerManager::_narrow(objDSM));
+      if ( !CORBA::is_nil(dsm) )
+        dsm->shutdownScopes();
+    }
+  catch(const CORBA::Exception& e)
+    {
+       // ignore and continue
+    }
 
-  // 4) SalomeLauncher
+  // 5) SalomeLauncher
   try
     {
       CORBA::Object_var objSL = _NS->Resolve("/SalomeLauncher");
@@ -522,7 +538,7 @@ void SALOME_LifeCycleCORBA::shutdownServers()
   nanosleep(&ts_req,0);
 #endif
 
-  // 5) Registry
+  // 6) Registry
   try
     {
       CORBA::Object_var objR = _NS->Resolve("/Registry");
@@ -535,20 +551,6 @@ void SALOME_LifeCycleCORBA::shutdownServers()
        // ignore and continue
     }
 
-  /*
-  // 6) Session
-  if ( !CORBA::is_nil( session ) ) {
-    try
-    {
-      session->Shutdown();
-    }
-    catch(const CORBA::Exception& e)
-    {
-      // ignore and continue
-    }
-  }
-  */
-
   // 7) Logger
   int argc = 0;
   char *xargv = (char*)"";
index f95cccdb953c944ab67f2814ac9d842fead800ad..a9805ca081d0158766fce9843c0e41b14cc4e581 100644 (file)
@@ -26,6 +26,7 @@
 #include "Utils_ORB_INIT.hxx"
 #include "Utils_SINGLETON.hxx"
 #include "Basics_Utils.hxx"
+#include "utilities.h"
 
 #include <iostream>
 #include <fstream>
index 40e2afabe46fac6c288d00313febbd51a37a3da3..1dc981fe0de8cc26ce7efb16f58927f9a4de1c6b 100644 (file)
@@ -33,6 +33,7 @@
 #include "SALOME_ResourcesManager.hxx"
 #include "SALOME_ContainerManager.hxx"
 #include "SALOME_LifeCycleCORBA.hxx"
+#include "SALOME_ResourcesManager.hxx"
 #include "NamingService_WaitForServerReadiness.hxx"
 #include "OpUtil.hxx"
 #include "Utils_ORB_INIT.hxx"
index d6a53c28e2e6c138bd5421d827ec1292e03192df..07605c6f74e913737d9074589a85fecdcb384b3a 100644 (file)
@@ -35,7 +35,6 @@
 
 #include <vector>
 #include <string>
-#include "utilities.h"
 #include "Utils_Mutex.hxx"
 #include "ServiceUnreachable.hxx"
 
index 8f8cf52fc38eb0629458610c843c6af2687c8f04..456b9d617c286f1824abb9da419e4f5fa69fae21 100644 (file)
@@ -25,6 +25,7 @@
 #include "Utils_SINGLETON.hxx"
 #include "Basics_Utils.hxx"
 #include "SALOME_LifeCycleCORBA.hxx"
+#include "utilities.h"
 
 #include <iostream>
 #include <fstream>
index 4ee6ea453e8c30ba9745f05c36380e933811ee54..d8adcd7dc7275b318cbf2ba46eaf657b645451d6 100644 (file)
@@ -170,7 +170,17 @@ int main( int argc , char **argv )
       RegistryService *ptrRegistry = SINGLETON_<RegistryService>::Instance() ;
       ptrRegistry->SessionName( ptrSessionName ) ;
       ptrRegistry->SetOrb(orb);
-      varComponents = ptrRegistry->_this() ;
+      //
+      CORBA::PolicyList policies;
+      policies.length(1);
+      PortableServer::ThreadPolicy_var threadPol(poa->create_thread_policy(PortableServer::SINGLE_THREAD_MODEL));
+      policies[0]=PortableServer::ThreadPolicy::_duplicate(threadPol);
+      PortableServer::POA_var poa2(poa->create_POA("SingleThPOA4SDS",manager,policies));
+      threadPol->destroy();
+      //
+      PortableServer::ObjectId_var id(poa2->activate_object(ptrRegistry));
+      CORBA::Object_var pipo=poa2->id_to_reference(id);
+      varComponents = Registry::Components::_narrow(pipo) ;
       ptrRegistry->_remove_ref(); //let poa manage registryservice deletion
       // The RegistryService must not already exist.
             
index 3ffa83174d3350ddf8e389b3ce6eb8e657b330cd..ce80b264429d2560fa96eb8499563d1a0a79ad3f 100644 (file)
@@ -35,7 +35,8 @@
 #include "SALOMEDSImpl_Study.hxx"
 
 #include "Utils_ORB_INIT.hxx" 
-#include "Utils_SINGLETON.hxx" 
+#include "Utils_SINGLETON.hxx"
+#include "utilities.h" 
 
 #include "Basics_Utils.hxx"
 
diff --git a/src/SALOMESDS/CMakeLists.txt b/src/SALOMESDS/CMakeLists.txt
new file mode 100644 (file)
index 0000000..b86b576
--- /dev/null
@@ -0,0 +1,59 @@
+# Copyright (C) 2012-2014  CEA/DEN, EDF R&D, OPEN CASCADE
+#
+# This library is free software; you can redistribute it and/or
+# modify it under the terms of the GNU Lesser General Public
+# License as published by the Free Software Foundation; either
+# version 2.1 of the License, or (at your option) any later version.
+#
+# This library is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the GNU
+# Lesser General Public License for more details.
+#
+# You should have received a copy of the GNU Lesser General Public
+# License along with this library; if not, write to the Free Software
+# Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA  02111-1307 USA
+#
+# See http://www.salome-platform.org/ or email : webmaster.salome@opencascade.com
+#
+# Author : Anthony GEAY (EDF R&D)
+
+INCLUDE_DIRECTORIES(
+  ${OMNIORB_INCLUDE_DIR}
+  ${PTHREAD_INCLUDE_DIR}
+  ${PYTHON_INCLUDE_DIRS}
+  ${PROJECT_BINARY_DIR}/idl
+  ${PROJECT_BINARY_DIR}/salome_adm
+  ${CMAKE_CURRENT_SOURCE_DIR}/../Utils
+  ${CMAKE_CURRENT_SOURCE_DIR}/../NamingService
+  ${CMAKE_CURRENT_SOURCE_DIR}/../Container
+  ${CMAKE_CURRENT_SOURCE_DIR}/../ResourcesManager
+)
+
+ADD_DEFINITIONS(${OMNIORB_DEFINITIONS} ${PYTHON_DEFINITIONS})
+
+SET(COMMON_LIBS SalomeNS SalomeContainer SalomeIDLKernel ${OMNIORB_LIBRARIES} ${PYTHON_LIBRARIES})
+
+SET(SalomeSDS_SOURCES
+  SALOMESDS_Exception.cxx
+  SALOMESDS_RefCountServ.cxx
+  SALOMESDS_BasicDataServer.cxx
+  SALOMESDS_DataScopeServer.cxx
+  SALOMESDS_DataServerManager.cxx
+  SALOMESDS_PickelizedPyObjServer.cxx
+  SALOMESDS_PickelizedPyObjRdOnlyServer.cxx
+  SALOMESDS_PickelizedPyObjRdExtServer.cxx
+  SALOMESDS_PickelizedPyObjRdWrServer.cxx
+  )
+
+ADD_LIBRARY(SalomeSDS ${SalomeSDS_SOURCES})
+TARGET_LINK_LIBRARIES(SalomeSDS ${COMMON_LIBS} ${PTHREAD_LIBRARIES})
+INSTALL(TARGETS SalomeSDS EXPORT ${PROJECT_NAME}TargetGroup DESTINATION ${SALOME_INSTALL_LIBS})
+
+ADD_EXECUTABLE(SALOME_DataScopeServer SALOME_DataScopeServer.cxx)
+TARGET_LINK_LIBRARIES(SALOME_DataScopeServer SalomeSDS)
+INSTALL(TARGETS SALOME_DataScopeServer DESTINATION ${SALOME_INSTALL_BINS})
+INSTALL(FILES SalomeSDSClt.py DESTINATION ${SALOME_INSTALL_BINS})
+
+FILE(GLOB COMMON_HEADERS_HXX "${CMAKE_CURRENT_SOURCE_DIR}/*.hxx")
+INSTALL(FILES ${COMMON_HEADERS_HXX} DESTINATION ${SALOME_INSTALL_HEADERS})
diff --git a/src/SALOMESDS/SALOMEGlobalVarHelper.py b/src/SALOMESDS/SALOMEGlobalVarHelper.py
new file mode 100644 (file)
index 0000000..f4b6bbf
--- /dev/null
@@ -0,0 +1,212 @@
+#  -*- coding: iso-8859-1 -*-
+# Copyright (C) 2007-2014  CEA/DEN, EDF R&D
+#
+# This library is free software; you can redistribute it and/or
+# modify it under the terms of the GNU Lesser General Public
+# License as published by the Free Software Foundation; either
+# version 2.1 of the License, or (at your option) any later version.
+#
+# This library is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the GNU
+# Lesser General Public License for more details.
+#
+# You should have received a copy of the GNU Lesser General Public
+# License along with this library; if not, write to the Free Software
+# Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA  02111-1307 USA
+#
+# See http://www.salome-platform.org/ or email : webmaster.salome@opencascade.com
+#
+# Author : Anthony Geay
+
+# dict,list,tuple,int,float,str
+import SALOME
+import cPickle
+
+class List(object):
+    def __init__(self,varPtr,isTemporaryVar=False):
+        assert(isinstance(varPtr,SALOME._objref_StringDataServer))
+        self._var_ptr=varPtr
+        if not isTemporaryVar:
+            self._var_ptr.Register()
+        self._is_temp=isTemporaryVar
+        pass
+
+    def __del__(self):
+        self._var_ptr.UnRegister()
+        pass
+
+    def assign(self,elt):
+        st=cPickle.dumps(elt,cPickle.HIGHEST_PROTOCOL)
+        self._var_ptr.setSerializedContent(st)
+        pass
+
+    def __getitem__(self,*args):
+        ret=Caller(self._var_ptr,"__getitem__")
+        return ret(*args)
+
+    def __setitem__(self,*args):
+        ret=Caller(self._var_ptr,"__setitem__")
+        return ret(*args)
+
+    def append(self,*args):
+        ret=Caller(self._var_ptr,"append")
+        return ret(*args)
+
+    def __str__(self):
+        return self.local_copy().__str__()
+
+    def __repr__(self):
+        return self.local_copy().__repr__()
+
+    def local_copy(self):
+        return cPickle.loads(self._var_ptr.fetchSerializedContent())
+
+    def __reduce__(self):
+        return (list,(self.local_copy(),))
+
+    pass
+
+class Tuple(object):
+    def __init__(self,varPtr,isTemporaryVar=False):
+        assert(isinstance(varPtr,SALOME._objref_StringDataServer))
+        self._var_ptr=varPtr
+        if not isTemporaryVar:
+            self._var_ptr.Register()
+        self._is_temp=isTemporaryVar
+        pass
+
+    def __del__(self):
+        self._var_ptr.UnRegister()
+        pass
+
+    def assign(self,elt):
+        st=cPickle.dumps(elt,cPickle.HIGHEST_PROTOCOL)
+        self._var_ptr.setSerializedContent(st)
+        pass
+
+    def __getitem__(self,*args):
+        ret=Caller(self._var_ptr,"__getitem__")
+        return ret(*args)
+
+    def __setitem__(self,*args):
+        ret=Caller(self._var_ptr,"__setitem__")
+        return ret(*args)
+
+    def __str__(self):
+        return self.local_copy().__str__()
+
+    def __repr__(self):
+        return self.local_copy().__repr__()
+
+    def local_copy(self):
+        return cPickle.loads(self._var_ptr.fetchSerializedContent())
+
+    def __reduce__(self):
+        return (tuple,(self.local_copy(),))
+
+    pass
+        
+
+class Int(object):
+    def __init__(self,varPtr,isTemporaryVar=False):
+        assert(isinstance(varPtr,SALOME._objref_StringDataServer))
+        self._var_ptr=varPtr
+        if not isTemporaryVar:
+            self._var_ptr.Register()
+        self._is_temp=isTemporaryVar
+        pass
+
+    def __del__(self):
+        self._var_ptr.UnRegister()
+        pass
+
+    def __iadd__(self,*args):
+        ret=Caller(self._var_ptr,"__add__")
+        return ret(*args)
+
+    def __isub__(self,*args):
+        ret=Caller(self._var_ptr,"__sub__")
+        return ret(*args)
+
+    def assign(self,elt):
+        st=cPickle.dumps(elt,cPickle.HIGHEST_PROTOCOL)
+        self._var_ptr.setSerializedContent(st)
+        pass
+
+    def __str__(self):
+        return self.local_copy().__str__()
+
+    def __repr__(self):
+        return self.local_copy().__repr__()
+
+    def local_copy(self):
+        return cPickle.loads(self._var_ptr.fetchSerializedContent())
+
+    def __reduce__(self):
+        return (int,(self.local_copy(),))
+
+    pass
+
+class Dict(object):
+    def __init__(self,varPtr,isTemporaryVar=False):
+        assert(isinstance(varPtr,SALOME._objref_StringDataServer))
+        self._var_ptr=varPtr
+        if not isTemporaryVar:
+            self._var_ptr.Register()
+        self._is_temp=isTemporaryVar
+        pass
+
+    def __del__(self):
+        self._var_ptr.UnRegister()
+        pass
+
+    def assign(self,elt):
+        st=cPickle.dumps(elt,cPickle.HIGHEST_PROTOCOL)
+        self._var_ptr.setSerializedContent(st)
+        pass
+
+    def __getitem__(self,*args):
+        ret=Caller(self._var_ptr,"__getitem__")
+        return ret(*args)
+
+    def __setitem__(self,*args):
+        ret=Caller(self._var_ptr,"__setitem__")
+        return ret(*args)
+
+    def __len__(self):
+        return len(self.local_copy())
+
+    def __str__(self):
+        return self.local_copy().__str__()
+
+    def __repr__(self):
+        return self.local_copy().__repr__()
+
+    def local_copy(self):
+        return cPickle.loads(self._var_ptr.fetchSerializedContent())
+
+    def __reduce__(self):
+        return (dict,(self.local_copy(),))
+
+    pass
+
+class Caller:
+    def __init__(self,varPtr,meth):
+        assert(isinstance(varPtr,SALOME._objref_StringDataServer))
+        self._var_ptr=varPtr
+        self._meth=meth
+        pass
+
+    def __call__(self,*args):
+        ret=self._var_ptr.invokePythonMethodOn(self._meth,cPickle.dumps(args,cPickle.HIGHEST_PROTOCOL))
+        return GetHandlerFromRef(ret,True)
+    pass
+
+PyHandlerTypeMap={int:Int,list:List,tuple:Tuple,dict:Dict}
+
+def GetHandlerFromRef(objCorba,isTempVar=False):
+    v=cPickle.loads(objCorba.fetchSerializedContent())
+    if v is None:
+        return None
+    return PyHandlerTypeMap[v.__class__](objCorba,isTempVar)
diff --git a/src/SALOMESDS/SALOMESDS_AutoRefCountPtr.hxx b/src/SALOMESDS/SALOMESDS_AutoRefCountPtr.hxx
new file mode 100644 (file)
index 0000000..021b115
--- /dev/null
@@ -0,0 +1,78 @@
+// Copyright (C) 2007-2014  CEA/DEN, EDF R&D
+//
+// This library is free software; you can redistribute it and/or
+// modify it under the terms of the GNU Lesser General Public
+// License as published by the Free Software Foundation; either
+// version 2.1 of the License, or (at your option) any later version.
+//
+// This library is distributed in the hope that it will be useful,
+// but WITHOUT ANY WARRANTY; without even the implied warranty of
+// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the GNU
+// Lesser General Public License for more details.
+//
+// You should have received a copy of the GNU Lesser General Public
+// License along with this library; if not, write to the Free Software
+// Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA  02111-1307 USA
+//
+// See http://www.salome-platform.org/ or email : webmaster.salome@opencascade.com
+//
+// Author : Anthony Geay (EDF R&D)
+
+#ifndef __SALOMESDS_AUTOREFCOUNTPTR_HXX__
+#define __SALOMESDS_AUTOREFCOUNTPTR_HXX__
+
+#include "SALOMESDS_Exception.hxx"
+
+namespace SALOMESDS
+{
+  template<class T>
+  class AutoRefCountPtr
+  {
+  public:
+    AutoRefCountPtr(const AutoRefCountPtr& other):_ptr(0) { referPtr(other._ptr); }
+    AutoRefCountPtr(T *ptr=0):_ptr(ptr) { }
+    ~AutoRefCountPtr() { destroyPtr(); }
+    bool operator==(const AutoRefCountPtr& other) const { return _ptr==other._ptr; }
+    bool operator==(const T *other) const { return _ptr==other; }
+    AutoRefCountPtr &operator=(const AutoRefCountPtr& other) { if(_ptr!=other._ptr) { destroyPtr(); referPtr(other._ptr); } return *this; }
+    AutoRefCountPtr &operator=(T *ptr) { if(_ptr!=ptr) { destroyPtr(); _ptr=ptr; } return *this; }
+    T *operator->() { return _ptr ; }
+    const T *operator->() const { return _ptr; }
+    T& operator*() { return *_ptr; }
+    const T& operator*() const { return *_ptr; }
+    operator T *() { return _ptr; }
+    operator const T *() const { return _ptr; }
+    T *retn() { if(_ptr) _ptr->incrRef(); return _ptr; }
+  private:
+    void referPtr(T *ptr) { _ptr=ptr; if(_ptr) _ptr->incrRef(); }
+    void destroyPtr() { if(_ptr) _ptr->decrRef(); }
+  private:
+    T *_ptr;
+  };
+
+  template<class T, class U>
+  typename SALOMESDS::AutoRefCountPtr<U> DynamicCast(typename SALOMESDS::AutoRefCountPtr<T>& autoSubPtr) throw()
+  {
+    T *subPtr(autoSubPtr);
+    U *ptr(dynamic_cast<U *>(subPtr));
+    typename SALOMESDS::AutoRefCountPtr<U> ret(ptr);
+    if(ptr)
+      ptr->incrRef();
+    return ret;
+  }
+
+  template<class T, class U>
+  typename SALOMESDS::AutoRefCountPtr<U> DynamicCastSafe(typename SALOMESDS::AutoRefCountPtr<T>& autoSubPtr)
+  {
+    T *subPtr(autoSubPtr);
+    U *ptr(dynamic_cast<U *>(subPtr));
+    if(subPtr && !ptr)
+      throw Exception("DynamicCastSafe : U is not a subtype of T !");
+    typename SALOMESDS::AutoRefCountPtr<U> ret(ptr);
+    if(ptr)
+      ptr->incrRef();
+    return ret;
+  }
+}
+
+#endif
diff --git a/src/SALOMESDS/SALOMESDS_BasicDataServer.cxx b/src/SALOMESDS/SALOMESDS_BasicDataServer.cxx
new file mode 100644 (file)
index 0000000..00a639b
--- /dev/null
@@ -0,0 +1,70 @@
+// Copyright (C) 2007-2014  CEA/DEN, EDF R&D, OPEN CASCADE
+//
+// This library is free software; you can redistribute it and/or
+// modify it under the terms of the GNU Lesser General Public
+// License as published by the Free Software Foundation; either
+// version 2.1 of the License, or (at your option) any later version.
+//
+// This library is distributed in the hope that it will be useful,
+// but WITHOUT ANY WARRANTY; without even the implied warranty of
+// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the GNU
+// Lesser General Public License for more details.
+//
+// You should have received a copy of the GNU Lesser General Public
+// License along with this library; if not, write to the Free Software
+// Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA  02111-1307 USA
+//
+// See http://www.salome-platform.org/ or email : webmaster.salome@opencascade.com
+//
+// Author : Anthony GEAY (EDF R&D)
+
+#include "SALOMESDS_BasicDataServer.hxx"
+#include "SALOMESDS_DataScopeServer.hxx"
+#include "SALOMESDS_Exception.hxx"
+
+#include <sstream>
+
+using namespace SALOMESDS;
+
+BasicDataServer::BasicDataServer(DataScopeServer *father, const std::string& varName):_father(father),_var_name(varName)
+{
+}
+
+SALOME::DataScopeServer_ptr BasicDataServer::getMyDataScopeServer()
+{
+  CORBA::Object_var obj(getPOA()->servant_to_reference(_father));
+  return SALOME::DataScopeServer::_narrow(obj);
+}
+
+/*!
+ * Called remotely -> to protect against throw
+ */
+char *BasicDataServer::getVarName()
+{
+  return CORBA::string_dup(_var_name.c_str());
+}
+
+char *BasicDataServer::getScopeName()
+{
+  return _father->getScopeName();
+}
+
+void BasicDataServer::Register()
+{
+  incrRef();
+}
+
+void BasicDataServer::UnRegister()
+{
+  decrRef();
+}
+
+void BasicDataServer::Destroy()
+{
+  enforcedRelease();
+}
+
+PortableServer::POA_var BasicDataServer::getPOA()
+{
+  return _father->getPOA();
+}
diff --git a/src/SALOMESDS/SALOMESDS_BasicDataServer.hxx b/src/SALOMESDS/SALOMESDS_BasicDataServer.hxx
new file mode 100644 (file)
index 0000000..3115064
--- /dev/null
@@ -0,0 +1,57 @@
+// Copyright (C) 2007-2014  CEA/DEN, EDF R&D, OPEN CASCADE
+//
+// This library is free software; you can redistribute it and/or
+// modify it under the terms of the GNU Lesser General Public
+// License as published by the Free Software Foundation; either
+// version 2.1 of the License, or (at your option) any later version.
+//
+// This library is distributed in the hope that it will be useful,
+// but WITHOUT ANY WARRANTY; without even the implied warranty of
+// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the GNU
+// Lesser General Public License for more details.
+//
+// You should have received a copy of the GNU Lesser General Public
+// License along with this library; if not, write to the Free Software
+// Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA  02111-1307 USA
+//
+// See http://www.salome-platform.org/ or email : webmaster.salome@opencascade.com
+//
+// Author : Anthony GEAY (EDF R&D)
+
+#ifndef __SALOMESDS_BASICDATASERVER_HXX__
+#define __SALOMESDS_BASICDATASERVER_HXX__
+
+#include "SALOMEconfig.h"
+#include CORBA_SERVER_HEADER(SALOME_SDS)
+
+#include "SALOMESDS_RefCountServ.hxx"
+
+#include <string>
+
+namespace SALOMESDS
+{
+  class DataScopeServer;
+  
+  class BasicDataServer : public RefCountServ, public virtual POA_SALOME::BasicDataServer
+  {
+  public:
+    BasicDataServer(DataScopeServer *father, const std::string& varName);
+    SALOME::DataScopeServer_ptr getMyDataScopeServer();
+    char *getVarName();
+    char *getScopeName();
+  public:
+    void Register();
+    void UnRegister();
+    void Destroy();
+  public:
+    std::string getVarNameCpp() const { return _var_name; }
+  protected:
+    PortableServer::POA_var getPOA();
+  protected:
+    DataScopeServer *_father;
+  private:
+    std::string _var_name;
+  };
+}
+
+#endif
diff --git a/src/SALOMESDS/SALOMESDS_DataScopeServer.cxx b/src/SALOMESDS/SALOMESDS_DataScopeServer.cxx
new file mode 100644 (file)
index 0000000..3ff2e04
--- /dev/null
@@ -0,0 +1,270 @@
+// Copyright (C) 2007-2014  CEA/DEN, EDF R&D, OPEN CASCADE
+//
+// This library is free software; you can redistribute it and/or
+// modify it under the terms of the GNU Lesser General Public
+// License as published by the Free Software Foundation; either
+// version 2.1 of the License, or (at your option) any later version.
+//
+// This library is distributed in the hope that it will be useful,
+// but WITHOUT ANY WARRANTY; without even the implied warranty of
+// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the GNU
+// Lesser General Public License for more details.
+//
+// You should have received a copy of the GNU Lesser General Public
+// License along with this library; if not, write to the Free Software
+// Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA  02111-1307 USA
+//
+// See http://www.salome-platform.org/ or email : webmaster.salome@opencascade.com
+//
+// Author : Anthony GEAY (EDF R&D)
+
+#include "SALOMESDS_DataScopeServer.hxx"
+#include "SALOMESDS_DataServerManager.hxx"
+#include "SALOMESDS_PickelizedPyObjRdOnlyServer.hxx"
+#include "SALOMESDS_PickelizedPyObjRdExtServer.hxx"
+#include "SALOMESDS_PickelizedPyObjRdWrServer.hxx"
+#include "SALOME_NamingService.hxx"
+#include "SALOMESDS_Exception.hxx"
+
+#include <sstream>
+#include <iterator>
+#include <algorithm>
+
+// agy : awful, to be factorized with ContainerManager.
+#ifndef WIN32
+#include <unistd.h>
+#else
+#include <process.h>
+#define getpid _getpid
+#endif
+
+using namespace SALOMESDS;
+
+std::size_t DataScopeServer::COUNTER=0;
+
+DataScopeServer::DataScopeServer(CORBA::ORB_ptr orb, const std::string& scopeName):_globals(0),_locals(0),_pickler(0),_orb(CORBA::ORB::_duplicate(orb)),_name(scopeName)
+{
+}
+
+DataScopeServer::DataScopeServer(const DataScopeServer& other):_globals(0),_locals(0),_pickler(0),_name(other._name),_vars(other._vars)
+{
+}
+
+DataScopeServer::~DataScopeServer()
+{
+  // _globals is borrowed ref -> do nothing
+  Py_XDECREF(_locals);
+  Py_XDECREF(_pickler);
+}
+
+/*!
+ * Called remotely -> to protect against throw
+ */
+void DataScopeServer::ping()
+{
+}
+
+/*!
+ * Called remotely -> to protect against throw
+ */
+char *DataScopeServer::getScopeName()
+{
+  return CORBA::string_dup(_name.c_str());
+}
+
+/*!
+ * Called remotely -> to protect against throw
+ */
+SALOME::StringVec *DataScopeServer::listVars()
+{
+  SALOME::StringVec *ret(new SALOME::StringVec);
+  std::size_t sz(_vars.size());
+  ret->length(sz);
+  std::list< std::pair< SALOME::BasicDataServer_var, BasicDataServer * > >::iterator it(_vars.begin());
+  for(std::size_t i=0;i<sz;it++,i++)
+    {
+      BasicDataServer *obj((*it).second);
+      std::string name(obj->getVarNameCpp());
+      (*ret)[i]=CORBA::string_dup(name.c_str());
+    }
+  return ret;
+}
+
+SALOME::BasicDataServer_ptr DataScopeServer::retrieveVar(const char *varName)
+{
+  std::string varNameCpp(varName);
+  std::vector<std::string> allNames(getAllVarNames());
+  std::vector<std::string>::iterator it(std::find(allNames.begin(),allNames.end(),varNameCpp));
+  if(it==allNames.end())
+    {
+      std::ostringstream oss; oss << "DataScopeServer::retrieveVar : name \"" << varNameCpp << "\" does not exists ! Possibilities are :";
+      std::copy(allNames.begin(),allNames.end(),std::ostream_iterator<std::string>(oss,", "));
+      throw Exception(oss.str());
+    }
+  std::size_t pos(std::distance(allNames.begin(),it));
+  std::list< std::pair< SALOME::BasicDataServer_var, BasicDataServer * > >::iterator it0(_vars.begin());
+  for(std::size_t i=0;i<pos;i++,it0++);
+  return SALOME::BasicDataServer::_duplicate((*it0).first);
+}
+
+void DataScopeServer::deleteVar(const char *varName)
+{
+  std::string varNameCpp(varName);
+  std::vector<std::string> allNames(getAllVarNames());
+  std::vector<std::string>::iterator it(std::find(allNames.begin(),allNames.end(),varNameCpp));
+  if(it==allNames.end())
+    {
+      std::ostringstream oss; oss << "DataScopeServer::deleteVar : name \"" << varNameCpp << "\" does not exists ! Possibilities are :";
+      std::copy(allNames.begin(),allNames.end(),std::ostream_iterator<std::string>(oss,", "));
+      throw Exception(oss.str());
+    }
+  std::size_t pos(std::distance(allNames.begin(),it));
+  std::list< std::pair< SALOME::BasicDataServer_var, BasicDataServer * > >::iterator it0(_vars.begin());
+  (*it0).first->UnRegister();
+  _vars.erase(it0);
+}
+
+SALOME::PickelizedPyObjRdOnlyServer_ptr DataScopeServer::createRdOnlyVar(const char *varName, const SALOME::ByteVec& constValue)
+{
+  std::string varNameCpp(varName);
+  checkNotAlreadyExistingVar(varNameCpp);
+  PickelizedPyObjRdOnlyServer *tmp(new PickelizedPyObjRdOnlyServer(this,varNameCpp,constValue));
+  CORBA::Object_var ret(activateWithDedicatedPOA(tmp));
+  std::pair< SALOME::BasicDataServer_var, BasicDataServer * > p(SALOME::BasicDataServer::_narrow(ret),tmp);
+  _vars.push_back(p);
+  return SALOME::PickelizedPyObjRdOnlyServer::_narrow(ret);
+}
+
+SALOME::PickelizedPyObjRdExtServer_ptr DataScopeServer::createRdExtVar(const char *varName, const SALOME::ByteVec& constValue)
+{
+  std::string varNameCpp(varName);
+  checkNotAlreadyExistingVar(varNameCpp);
+  PickelizedPyObjRdExtServer *tmp(new PickelizedPyObjRdExtServer(this,varNameCpp,constValue));
+  CORBA::Object_var ret(activateWithDedicatedPOA(tmp));
+  std::pair< SALOME::BasicDataServer_var, BasicDataServer * > p(SALOME::BasicDataServer::_narrow(ret),tmp);
+  _vars.push_back(p);
+  return SALOME::PickelizedPyObjRdExtServer::_narrow(ret);
+}
+
+/*!
+ * Called remotely -> to protect against throw
+ */
+SALOME::PickelizedPyObjRdWrServer_ptr DataScopeServer::createRdWrVar(const char *typeName, const char *varName)
+{
+  std::string varNameCpp(varName),typeNameCpp(typeName);
+  checkNotAlreadyExistingVar(varNameCpp);
+  PickelizedPyObjRdWrServer *tmp(new PickelizedPyObjRdWrServer(this,typeNameCpp,varNameCpp));
+  CORBA::Object_var ret(activateWithDedicatedPOA(tmp));
+  std::pair< SALOME::BasicDataServer_var, BasicDataServer * > p(SALOME::BasicDataServer::_narrow(ret),tmp);
+  _vars.push_back(p);
+  return SALOME::PickelizedPyObjRdWrServer::_narrow(ret);
+}
+
+void DataScopeServer::shutdownIfNotHostedByDSM()
+{
+  SALOME_NamingService ns(_orb);
+  CORBA::Object_var obj(ns.Resolve(DataServerManager::NAME_IN_NS));
+  SALOME::DataServerManager_var dsm(SALOME::DataServerManager::_narrow(obj));
+  if(CORBA::is_nil(dsm))
+    return ;
+  // destroy ref in the naming service
+  std::string fullScopeName(SALOMESDS::DataServerManager::CreateAbsNameInNSFromScopeName(_name));
+  ns.Destroy_Name(fullScopeName.c_str());
+  // establish if dsm and this shared the same POA. If yes dsm and this are collocated !
+  PortableServer::ServantBase *ret(0);
+  try
+    {
+      ret=_poa->reference_to_servant(dsm);
+    }
+  catch(...) { ret=0; }
+  //
+  if(!ret)
+    _orb->shutdown(0);
+  else
+    {
+      PortableServer::ObjectId_var oid(_poa->servant_to_id(this));
+      _poa->deactivate_object(oid);
+      ret->_remove_ref();
+    }
+}
+
+void DataScopeServer::initializePython(int argc, char *argv[])
+{
+  Py_Initialize();
+  PySys_SetArgv(argc,argv);
+  PyObject *mainmod(PyImport_AddModule("__main__"));
+  _globals=PyModule_GetDict(mainmod);
+  if(PyDict_GetItemString(_globals, "__builtins__") == NULL)
+    {
+      PyObject *bimod(PyImport_ImportModule("__builtin__"));
+      if (bimod == NULL || PyDict_SetItemString(_globals, "__builtins__", bimod) != 0)
+        Py_FatalError("can't add __builtins__ to __main__");
+      Py_XDECREF(bimod);
+    }
+  _locals=PyDict_New();
+  PyObject *tmp(PyList_New(0));
+  _pickler=PyImport_ImportModuleLevel(const_cast<char *>("cPickle"),_globals,_locals,tmp,-1);
+}
+
+void DataScopeServer::registerToSalomePiDict() const
+{
+  PyObject *mod(PyImport_ImportModule("addToKillList"));
+  if(!mod)
+    return;
+  PyObject *meth(PyObject_GetAttrString(mod,"addToKillList"));
+  if(!meth)
+    { Py_XDECREF(mod); return ; }
+  PyObject *args(PyTuple_New(2));
+  PyTuple_SetItem(args,0,PyInt_FromLong(getpid()));
+  PyTuple_SetItem(args,1,PyString_FromString("SALOME_DataScopeServer"));
+  PyObject *res(PyObject_CallObject(meth,args));
+  Py_XDECREF(args);
+  Py_XDECREF(res);
+  Py_XDECREF(mod);
+}
+
+/*!
+ * \a ptr has been activated by the POA \a poa.
+ */
+void DataScopeServer::setPOAAndRegister(PortableServer::POA_var poa, SALOME::DataScopeServer_ptr ptr)
+{
+  _poa=poa;
+  std::string fullScopeName(SALOMESDS::DataServerManager::CreateAbsNameInNSFromScopeName(_name));
+  SALOME_NamingService ns(_orb);
+  ns.Register(ptr,fullScopeName.c_str());
+}
+
+std::string DataScopeServer::BuildTmpVarNameFrom(const std::string& varName)
+{
+  std::ostringstream oss;
+  oss << varName << "@" << COUNTER++;
+  return oss.str();
+}
+
+std::vector< std::string > DataScopeServer::getAllVarNames() const
+{
+  std::size_t sz(_vars.size());
+  std::vector<std::string> ret(sz);
+  std::list< std::pair< SALOME::BasicDataServer_var, BasicDataServer * > >::const_iterator it(_vars.begin());
+  for(std::size_t i=0;i<sz;it++,i++)
+    ret[i]=(*it).second->getVarNameCpp();
+  return ret;
+}
+
+CORBA::Object_var DataScopeServer::activateWithDedicatedPOA(BasicDataServer *ds)
+{
+  PortableServer::ObjectId_var id(_poa->activate_object(ds));
+  CORBA::Object_var ret(_poa->id_to_reference(id));
+  return ret;
+}
+
+void DataScopeServer::checkNotAlreadyExistingVar(const std::string& varName)
+{
+  std::vector<std::string> allNames(getAllVarNames());
+  std::vector<std::string>::iterator it(std::find(allNames.begin(),allNames.end(),varName));
+  if(it!=allNames.end())
+    {
+      std::ostringstream oss; oss << "DataScopeServer::checkNotAlreadyExistingVar : name \"" << varName << "\" already exists !";
+      throw Exception(oss.str());
+    }
+}
diff --git a/src/SALOMESDS/SALOMESDS_DataScopeServer.hxx b/src/SALOMESDS/SALOMESDS_DataScopeServer.hxx
new file mode 100644 (file)
index 0000000..1147ba6
--- /dev/null
@@ -0,0 +1,79 @@
+// Copyright (C) 2007-2014  CEA/DEN, EDF R&D, OPEN CASCADE
+//
+// This library is free software; you can redistribute it and/or
+// modify it under the terms of the GNU Lesser General Public
+// License as published by the Free Software Foundation; either
+// version 2.1 of the License, or (at your option) any later version.
+//
+// This library is distributed in the hope that it will be useful,
+// but WITHOUT ANY WARRANTY; without even the implied warranty of
+// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the GNU
+// Lesser General Public License for more details.
+//
+// You should have received a copy of the GNU Lesser General Public
+// License along with this library; if not, write to the Free Software
+// Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA  02111-1307 USA
+//
+// See http://www.salome-platform.org/ or email : webmaster.salome@opencascade.com
+//
+// Author : Anthony GEAY (EDF R&D)
+
+#ifndef __SALOMESDS_DATASCOPEERVER_HXX__
+#define __SALOMESDS_DATASCOPEERVER_HXX__
+
+#include "SALOMEconfig.h"
+#include CORBA_SERVER_HEADER(SALOME_SDS)
+
+#include "SALOMESDS_RefCountServ.hxx"
+#include "SALOMESDS_AutoRefCountPtr.hxx"
+#include "SALOMESDS_BasicDataServer.hxx"
+
+#include <Python.h>
+
+#include <string>
+#include <vector>
+#include <list>
+
+namespace SALOMESDS
+{
+  class DataScopeServer : public virtual POA_SALOME::DataScopeServer
+  {
+  public:
+    DataScopeServer(CORBA::ORB_ptr orb, const std::string& scopeName);
+    DataScopeServer(const DataScopeServer& other);
+    void ping();
+    char *getScopeName();
+    SALOME::StringVec *listVars();
+    SALOME::BasicDataServer_ptr retrieveVar(const char *varName);
+    void deleteVar(const char *varName);
+    SALOME::PickelizedPyObjRdOnlyServer_ptr createRdOnlyVar(const char *varName, const SALOME::ByteVec& constValue);
+    SALOME::PickelizedPyObjRdExtServer_ptr createRdExtVar(const char *varName, const SALOME::ByteVec& constValue);
+    SALOME::PickelizedPyObjRdWrServer_ptr createRdWrVar(const char *typeName, const char *varName);
+    void shutdownIfNotHostedByDSM();
+    ~DataScopeServer();
+  public:
+    void initializePython(int argc, char *argv[]);
+    void registerToSalomePiDict() const;
+    void setPOAAndRegister(PortableServer::POA_var poa, SALOME::DataScopeServer_ptr ptr);
+    PyObject *getGlobals() const { return _globals; }
+    PyObject *getLocals() const { return _locals; }
+    PyObject *getPickler() const { return _pickler; }
+    PortableServer::POA_var getPOA() { return _poa; }
+    static std::string BuildTmpVarNameFrom(const std::string& varName);
+  private:
+    std::vector< std::string> getAllVarNames() const;
+    CORBA::Object_var activateWithDedicatedPOA(BasicDataServer *ds);
+    void checkNotAlreadyExistingVar(const std::string& varName);
+  private:
+    PyObject *_globals;
+    PyObject *_locals;
+    PyObject *_pickler;
+    PortableServer::POA_var _poa;
+    CORBA::ORB_var _orb;
+    std::string _name;
+    std::list< std::pair< SALOME::BasicDataServer_var, BasicDataServer * > > _vars;
+    static std::size_t COUNTER;
+  };
+}
+
+#endif
diff --git a/src/SALOMESDS/SALOMESDS_DataServerManager.cxx b/src/SALOMESDS/SALOMESDS_DataServerManager.cxx
new file mode 100644 (file)
index 0000000..0193b50
--- /dev/null
@@ -0,0 +1,227 @@
+// Copyright (C) 2007-2014  CEA/DEN, EDF R&D, OPEN CASCADE
+//
+// This library is free software; you can redistribute it and/or
+// modify it under the terms of the GNU Lesser General Public
+// License as published by the Free Software Foundation; either
+// version 2.1 of the License, or (at your option) any later version.
+//
+// This library is distributed in the hope that it will be useful,
+// but WITHOUT ANY WARRANTY; without even the implied warranty of
+// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the GNU
+// Lesser General Public License for more details.
+//
+// You should have received a copy of the GNU Lesser General Public
+// License along with this library; if not, write to the Free Software
+// Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA  02111-1307 USA
+//
+// See http://www.salome-platform.org/ or email : webmaster.salome@opencascade.com
+//
+// Author : Anthony GEAY (EDF R&D)
+
+#include "SALOMESDS_DataServerManager.hxx"
+#include "SALOMESDS_Exception.hxx"
+
+#include "SALOME_ContainerManager.hxx"
+#include "SALOME_NamingService.hxx"
+
+#include <sstream>
+#include <algorithm>
+
+using namespace SALOMESDS;
+
+const char DataServerManager::NAME_IN_NS[]="/DataServerManager";
+
+const char DataServerManager::DFT_SCOPE_NAME_IN_NS[]="Default";
+
+DataServerManager::DataServerManager(int argc, char *argv[], CORBA::ORB_ptr orb, PortableServer::POA_ptr poa):_orb(CORBA::ORB::_duplicate(orb))
+{
+  DataScopeServer *dftScope(new DataScopeServer(orb,DFT_SCOPE_NAME_IN_NS));//_remove_ref will be call by DataScopeServer::shutdownIfNotHostedByDSM
+  PortableServer::POAManager_var pman(poa->the_POAManager());
+  CORBA::PolicyList policies;
+  policies.length(1);
+  PortableServer::ThreadPolicy_var threadPol(poa->create_thread_policy(PortableServer::SINGLE_THREAD_MODEL));
+  policies[0]=PortableServer::ThreadPolicy::_duplicate(threadPol);
+  _poa=poa->create_POA("SingleThPOA4SDS",pman,policies);
+  threadPol->destroy();
+  //
+  dftScope->initializePython(argc,argv);// agy : Very important ! invoke this method BEFORE activation !
+  // activate this to be ready to be usable from NS.
+  PortableServer::ObjectId_var id(_poa->activate_object(this));
+  CORBA::Object_var obj(_poa->id_to_reference(id));
+  SALOME::DataServerManager_var obj2(SALOME::DataServerManager::_narrow(obj));
+  // publish Data server manager in NS
+  SALOME_NamingService ns(orb);
+  ns.Register(obj2,NAME_IN_NS);
+  // the default DataScopeServer object is the only one hosted by the current process
+  id=_poa->activate_object(dftScope);
+  obj=_poa->id_to_reference(id);
+  SALOME::DataScopeServer_var dftScopePtr(SALOME::DataScopeServer::_narrow(obj));
+  dftScope->setPOAAndRegister(_poa,dftScopePtr);// agy : Very important ! invoke this method BEFORE activation ! Because this method initializes Python !
+}
+
+SALOME::StringVec *DataServerManager::listScopes()
+{
+  std::vector<std::string> scopes(listOfScopesCpp());
+  SALOME::StringVec *ret(new SALOME::StringVec);
+  std::size_t sz(scopes.size());
+  ret->length(sz);
+  for(std::size_t i=0;i<sz;i++)
+    (*ret)[i]=CORBA::string_dup(scopes[i].c_str());
+  return ret;
+}
+
+SALOME::StringVec *DataServerManager::listAliveAndKickingScopes()
+{
+  std::vector<std::string> scopes(listOfScopesCpp());
+  std::size_t sz(scopes.size());
+  std::vector<std::string> retCpp; retCpp.reserve(sz);
+  for(std::size_t i=0;i<sz;i++)
+    {
+      if(isAliveAndKicking(scopes[i].c_str()))
+        retCpp.push_back(scopes[i]);
+    }
+  //
+  SALOME::StringVec *ret(new SALOME::StringVec);
+  sz=retCpp.size();
+  ret->length(sz);
+  for(std::size_t i=0;i<sz;i++)
+    (*ret)[i]=CORBA::string_dup(retCpp[i].c_str());
+  return ret;
+}
+
+SALOME::DataScopeServer_ptr DataServerManager::getDefaultScope()
+{
+  return retriveDataScope(DFT_SCOPE_NAME_IN_NS);
+}
+
+CORBA::Boolean DataServerManager::isAliveAndKicking(const char *scopeName)
+{
+  SALOME::DataScopeServer_var scopePtr(getScopePtrGivenName(scopeName));
+  CORBA::Boolean ret(true);
+  try
+    {
+      scopePtr->ping();
+    }
+  catch(...)
+    { ret=false; }
+  return ret;
+}
+
+SALOME::DataScopeServer_ptr DataServerManager::createDataScope(const char *scopeName)
+{
+  std::string scopeNameCpp(scopeName);
+  std::vector<std::string> scopes(listOfScopesCpp());
+  if(std::find(scopes.begin(),scopes.end(),scopeNameCpp)!=scopes.end())
+    {
+      std::ostringstream oss; oss << "DataServerManager::createDataScope : scope name \"" << scopeName << "\" already exists !";
+      throw Exception(oss.str());
+    }
+  //
+  SALOME_NamingService ns(_orb);
+  std::string fullScopeName(CreateAbsNameInNSFromScopeName(scopeName));
+  std::ostringstream oss; oss << "SALOME_DataScopeServer" << " " << scopeName << " ";
+  SALOME_ContainerManager::AddOmninamesParams(oss,&ns);
+  std::string command(oss.str());
+  SALOME_ContainerManager::MakeTheCommandToBeLaunchedASync(command);
+  int status(SALOME_ContainerManager::SystemThreadSafe(command.c_str()));
+  int count(SALOME_ContainerManager::GetTimeOutToLoaunchServer());
+  SALOME::DataScopeServer_var ret(SALOME::DataScopeServer::_nil());
+  while (CORBA::is_nil(ret) && count)
+    {
+      SALOME_ContainerManager::SleepInSecond(1);
+      count--;
+      CORBA::Object_var obj(ns.Resolve(fullScopeName.c_str()));
+      ret=SALOME::DataScopeServer::_narrow(obj);
+    }
+  return SALOME::DataScopeServer::_duplicate(ret);
+}
+
+SALOME::DataScopeServer_ptr DataServerManager::giveADataScopeCalled(const char *scopeName, CORBA::Boolean& isCreated)
+{
+  std::string scopeNameCpp(scopeName);
+  std::vector<std::string> scopes(listOfScopesCpp());
+  if(std::find(scopes.begin(),scopes.end(),scopeNameCpp)==scopes.end())
+    {
+      isCreated=true;
+      return createDataScope(scopeName);
+    }
+  else
+    {
+      if(isAliveAndKicking(scopeName))
+        {
+          isCreated=false;
+          return retriveDataScope(scopeName);
+        }
+      else
+        {
+          SALOME_NamingService ns(_orb);
+          std::string fullScopeName(SALOMESDS::DataServerManager::CreateAbsNameInNSFromScopeName(scopeNameCpp));
+          ns.Destroy_Name(fullScopeName.c_str());
+          isCreated=true;
+          return createDataScope(scopeName);
+        }
+    }
+}
+
+SALOME::DataScopeServer_ptr DataServerManager::retriveDataScope(const char *scopeName)
+{
+  SALOME::DataScopeServer_var ret(getScopePtrGivenName(scopeName));
+  return SALOME::DataScopeServer::_duplicate(ret);
+}
+
+void DataServerManager::removeDataScope(const char *scopeName)
+{
+  SALOME::DataScopeServer_var scs(getScopePtrGivenName(scopeName));
+  scs->shutdownIfNotHostedByDSM();
+}
+
+void DataServerManager::cleanScopesInNS()
+{
+  SALOME_NamingService ns(_orb);
+  std::vector<std::string> scopes(listOfScopesCpp());
+  for(std::vector<std::string>::const_iterator it=scopes.begin();it!=scopes.end();it++)
+    {
+      if(!isAliveAndKicking((*it).c_str()))
+        {
+          std::string fullScopeName(SALOMESDS::DataServerManager::CreateAbsNameInNSFromScopeName(*it));
+          ns.Destroy_Name(fullScopeName.c_str());
+        }
+    }
+}
+
+void DataServerManager::shutdownScopes()
+{
+  std::vector<std::string> scopeNames(listOfScopesCpp());
+  for(std::vector<std::string>::const_iterator it=scopeNames.begin();it!=scopeNames.end();it++)
+    getScopePtrGivenName(*it)->shutdownIfNotHostedByDSM();
+}
+
+std::string DataServerManager::CreateAbsNameInNSFromScopeName(const std::string& scopeName)
+{
+  std::ostringstream oss; oss << NAME_IN_NS << "/" << scopeName;
+  return oss.str();
+}
+
+std::vector<std::string> DataServerManager::listOfScopesCpp()
+{
+  SALOME_NamingService ns(_orb);
+  ns.Change_Directory(NAME_IN_NS);
+  std::vector<std::string> ret(ns.list_directory());
+  return ret;
+}
+
+SALOME::DataScopeServer_var DataServerManager::getScopePtrGivenName(const std::string& scopeName)
+{
+  std::vector<std::string> scopes(listOfScopesCpp());
+  std::size_t sz(scopes.size());
+  if(std::find(scopes.begin(),scopes.end(),scopeName)==scopes.end())
+    {
+      std::ostringstream oss; oss << "DataServerManager::getScopePtrGivenName : scope name \"" << scopeName << "\" does not exist !";
+      throw Exception(oss.str());
+    }
+  SALOME_NamingService ns(_orb);
+  std::string fullScopeName(CreateAbsNameInNSFromScopeName(scopeName));
+  CORBA::Object_var obj(ns.Resolve(fullScopeName.c_str()));
+  SALOME::DataScopeServer_var ret(SALOME::DataScopeServer::_narrow(obj));
+  return ret;
+}
diff --git a/src/SALOMESDS/SALOMESDS_DataServerManager.hxx b/src/SALOMESDS/SALOMESDS_DataServerManager.hxx
new file mode 100644 (file)
index 0000000..cf835c4
--- /dev/null
@@ -0,0 +1,64 @@
+// Copyright (C) 2007-2014  CEA/DEN, EDF R&D, OPEN CASCADE
+//
+// This library is free software; you can redistribute it and/or
+// modify it under the terms of the GNU Lesser General Public
+// License as published by the Free Software Foundation; either
+// version 2.1 of the License, or (at your option) any later version.
+//
+// This library is distributed in the hope that it will be useful,
+// but WITHOUT ANY WARRANTY; without even the implied warranty of
+// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the GNU
+// Lesser General Public License for more details.
+//
+// You should have received a copy of the GNU Lesser General Public
+// License along with this library; if not, write to the Free Software
+// Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA  02111-1307 USA
+//
+// See http://www.salome-platform.org/ or email : webmaster.salome@opencascade.com
+//
+// Author : Anthony GEAY (EDF R&D)
+
+#ifndef __SALOMESDS_DATASERVERMANAGER_HXX__
+#define __SALOMESDS_DATASERVERMANAGER_HXX__
+
+#include "SALOMEconfig.h"
+#include CORBA_SERVER_HEADER(SALOME_SDS)
+
+#include "SALOMESDS_AutoRefCountPtr.hxx"
+#include "SALOMESDS_DataScopeServer.hxx"
+
+#include <string>
+
+namespace SALOMESDS
+{
+  class DataScopeServer;
+  
+  class DataServerManager : public virtual POA_SALOME::DataServerManager
+  {
+  public:
+    DataServerManager(int argc, char *argv[], CORBA::ORB_ptr orb, PortableServer::POA_ptr poa);
+    SALOME::StringVec *listScopes();
+    SALOME::StringVec *listAliveAndKickingScopes();
+    SALOME::DataScopeServer_ptr getDefaultScope();
+    CORBA::Boolean isAliveAndKicking(const char *scopeName);
+    SALOME::DataScopeServer_ptr createDataScope(const char *scopeName);
+    SALOME::DataScopeServer_ptr retriveDataScope(const char *scopeName);
+    SALOME::DataScopeServer_ptr giveADataScopeCalled(const char *scopeName, CORBA::Boolean& isCreated);
+    void removeDataScope(const char *scopeName);
+    void cleanScopesInNS();
+    void shutdownScopes();
+    static std::string CreateAbsNameInNSFromScopeName(const std::string& scopeName);
+  public:
+    static const char NAME_IN_NS[];
+    static const char DFT_SCOPE_NAME_IN_NS[];
+  private:
+    std::vector<std::string> listOfScopesCpp();
+    SALOME::DataScopeServer_var getScopePtrGivenName(const std::string& scopeName);
+  private:
+    CORBA::ORB_var _orb;
+    //! single thread poa
+    PortableServer::POA_var _poa;
+  };
+}
+
+#endif
diff --git a/src/SALOMESDS/SALOMESDS_Exception.cxx b/src/SALOMESDS/SALOMESDS_Exception.cxx
new file mode 100644 (file)
index 0000000..5493bbf
--- /dev/null
@@ -0,0 +1,32 @@
+// Copyright (C) 2007-2014  CEA/DEN, EDF R&D, OPEN CASCADE
+//
+// This library is free software; you can redistribute it and/or
+// modify it under the terms of the GNU Lesser General Public
+// License as published by the Free Software Foundation; either
+// version 2.1 of the License, or (at your option) any later version.
+//
+// This library is distributed in the hope that it will be useful,
+// but WITHOUT ANY WARRANTY; without even the implied warranty of
+// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the GNU
+// Lesser General Public License for more details.
+//
+// You should have received a copy of the GNU Lesser General Public
+// License along with this library; if not, write to the Free Software
+// Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA  02111-1307 USA
+//
+// See http://www.salome-platform.org/ or email : webmaster.salome@opencascade.com
+//
+// Author : Anthony GEAY (EDF R&D)
+
+#include "SALOMESDS_Exception.hxx"
+
+SALOMESDS::Exception::Exception(const std::string& reason)
+{
+  SALOME::ExceptionStruct es;
+  es.type=SALOME::INTERNAL_ERROR;
+  es.text=CORBA::string_dup(reason.c_str());
+  es.lineNumber=0;
+  (*this).details=es;
+}
+
+
diff --git a/src/SALOMESDS/SALOMESDS_Exception.hxx b/src/SALOMESDS/SALOMESDS_Exception.hxx
new file mode 100644 (file)
index 0000000..c5943ae
--- /dev/null
@@ -0,0 +1,38 @@
+// Copyright (C) 2007-2014  CEA/DEN, EDF R&D, OPEN CASCADE
+//
+// This library is free software; you can redistribute it and/or
+// modify it under the terms of the GNU Lesser General Public
+// License as published by the Free Software Foundation; either
+// version 2.1 of the License, or (at your option) any later version.
+//
+// This library is distributed in the hope that it will be useful,
+// but WITHOUT ANY WARRANTY; without even the implied warranty of
+// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the GNU
+// Lesser General Public License for more details.
+//
+// You should have received a copy of the GNU Lesser General Public
+// License along with this library; if not, write to the Free Software
+// Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA  02111-1307 USA
+//
+// See http://www.salome-platform.org/ or email : webmaster.salome@opencascade.com
+//
+// Author : Anthony GEAY (EDF R&D)
+
+#ifndef __SALOMESDS_EXCEPTION_HXX__
+#define __SALOMESDS_EXCEPTION_HXX__
+
+#include "SALOMEconfig.h"
+#include CORBA_SERVER_HEADER(SALOME_Exception)
+
+#include <string>
+
+namespace SALOMESDS
+{
+  class Exception : public SALOME::SALOME_Exception
+  {
+  public:
+    Exception(const std::string& reason);
+  };
+}
+
+#endif
diff --git a/src/SALOMESDS/SALOMESDS_PickelizedPyObjRdExtServer.cxx b/src/SALOMESDS/SALOMESDS_PickelizedPyObjRdExtServer.cxx
new file mode 100644 (file)
index 0000000..5409851
--- /dev/null
@@ -0,0 +1,137 @@
+// Copyright (C) 2007-2014  CEA/DEN, EDF R&D, OPEN CASCADE
+//
+// This library is free software; you can redistribute it and/or
+// modify it under the terms of the GNU Lesser General Public
+// License as published by the Free Software Foundation; either
+// version 2.1 of the License, or (at your option) any later version.
+//
+// This library is distributed in the hope that it will be useful,
+// but WITHOUT ANY WARRANTY; without even the implied warranty of
+// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the GNU
+// Lesser General Public License for more details.
+//
+// You should have received a copy of the GNU Lesser General Public
+// License along with this library; if not, write to the Free Software
+// Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA  02111-1307 USA
+//
+// See http://www.salome-platform.org/ or email : webmaster.salome@opencascade.com
+//
+// Author : Anthony GEAY (EDF R&D)
+
+#include "SALOMESDS_PickelizedPyObjRdExtServer.hxx"
+#include "SALOMESDS_DataScopeServer.hxx"
+#include "SALOMESDS_Exception.hxx"
+
+#include <iostream>
+#include <sstream>
+
+using namespace SALOMESDS;
+
+PickelizedPyObjRdExtServer::PickelizedPyObjRdExtServer(DataScopeServer *father, const std::string& varName, const SALOME::ByteVec& value):PickelizedPyObjServer(father,varName,value)
+{
+}
+
+//! obj is consumed
+PickelizedPyObjRdExtServer::PickelizedPyObjRdExtServer(DataScopeServer *father, const std::string& varName, PyObject *obj):PickelizedPyObjServer(father,varName,obj)
+{
+}
+
+PickelizedPyObjRdExtServer::~PickelizedPyObjRdExtServer()
+{
+}
+
+/*!
+ * Called remotely -> to protect against throw
+ */
+SALOME::PickelizedPyObjRdExtServer_ptr PickelizedPyObjRdExtServer::invokePythonMethodOn(const char *method, const SALOME::ByteVec& args)
+{
+  if(!_self)
+    throw Exception("PickelizedPyObjRdExtServer::invokePythonMethodOn : self is NULL !");
+  std::string argsCpp;
+  FromByteSeqToCpp(args,argsCpp);
+  PyObject *argsPy(getPyObjFromPickled(argsCpp));
+  checkRdExtnessOf(method,argsPy);
+  //
+  PyObject *selfMeth(PyObject_GetAttrString(_self,method));
+  if(!selfMeth)
+    {
+      std::ostringstream oss; oss << "PickelizedPyObjRdExtServer::invokePythonMethodOn : Method \"" << method << "\" is not available !";
+      throw Exception(oss.str());
+    }
+  PyObject *res(PyObject_CallObject(selfMeth,argsPy));// self can have been modified by this call !
+  Py_XDECREF(selfMeth);
+  Py_XDECREF(argsPy);
+  if(!res)
+    {
+      std::ostringstream oss; oss << "PickelizedPyObjRdExtServer::invokePythonMethodOn : Problem during invokation serverside of Method \"" << method << "\" !";
+      throw Exception(oss.str());
+    }
+  PickelizedPyObjRdExtServer *ret(new PickelizedPyObjRdExtServer(_father,DataScopeServer::BuildTmpVarNameFrom(getVarNameCpp()),res));
+  PortableServer::POA_var poa(_father->getPOA());
+  PortableServer::ObjectId_var id(poa->activate_object(ret));
+  CORBA::Object_var obj(poa->id_to_reference(id));
+  return SALOME::PickelizedPyObjRdExtServer::_narrow(obj);
+}
+
+void PickelizedPyObjRdExtServer::checkRdExtnessOf(const std::string& methodName, PyObject *argsPy)
+{
+  if(!_self)
+    {
+      Py_XDECREF(argsPy);
+      throw Exception("PickelizedPyObjRdExtServer::checkRdExtnessOf : self is NULL !");
+    }
+  if(PyTuple_Check(_self)==1 || PyString_Check(_self)==1 || PyInt_Check(_self)==1 || PyBool_Check(_self)==1 || PyFloat_Check(_self)==1)
+    return ;//_self is tuple, str, int or float -> immutable in python. So no method can break the RdExtness of _self.
+  if(PyList_Check(_self)==1)
+    checkListRdExtnessOf(methodName,argsPy);
+  else if(PyDict_Check(_self)==1)
+    checkDictRdExtnessOf(methodName,argsPy);
+  else
+    throw Exception("PickelizedPyObjRdExtServer::checkRdExtnessOf : Supported python types are [list,tuple,dict,str,int,float] !");
+}
+
+void PickelizedPyObjRdExtServer::checkListRdExtnessOf(const std::string& methodName, PyObject *argsPy)
+{
+  static const char *THE_RDEXT_METH_OF_LIST[]={"__getitem__","append","extend","insert","reverse","sort"};
+  for(std::size_t i=0;i<sizeof(THE_RDEXT_METH_OF_LIST)/sizeof(const char *);i++)
+    if(methodName==THE_RDEXT_METH_OF_LIST[i])
+      return ;
+  Py_XDECREF(argsPy);
+  std::ostringstream oss; oss << "PickelizedPyObjRdExtServer::checkListRdExtnessOf : The method \"" << methodName << "\" is a method that can lead to a loss of data ! Supported method of \"list \"without loss of data are : __getitem__, append, extend, insert, reverse, sort !";
+  throw Exception(oss.str());
+}
+
+void PickelizedPyObjRdExtServer::checkDictRdExtnessOf(const std::string& methodName, PyObject *argsPy)
+{
+  static const char *THE_RDEXT_METH_OF_DICT[]={"__getitem__","get","items","keys","setdefault","update","values"};
+  for(std::size_t i=0;i<sizeof(THE_RDEXT_METH_OF_DICT)/sizeof(const char *);i++)
+    if(methodName==THE_RDEXT_METH_OF_DICT[i])
+      return ;
+  if(methodName=="__setitem__")
+    {
+      checkDictSetitemRdExtness(argsPy);
+      return ;
+    }
+  Py_XDECREF(argsPy);
+  std::ostringstream oss; oss << "PickelizedPyObjRdExtServer::checkDictRdExtnessOf : The method \"" << methodName << "\" is a method that can lead to a loss of data ! Supported method of \"list \"without loss of data are : __getitem__, __setitem__(with conditions), get, items, keys, setdefault, update, values !";
+  throw Exception(oss.str());
+}
+
+void PickelizedPyObjRdExtServer::checkDictSetitemRdExtness(PyObject *argsPy)
+{
+  if(PyTuple_Check(argsPy)==0)
+    {
+      Py_XDECREF(argsPy);
+      throw Exception("PickelizedPyObjRdExtServer::checkDictSetitemRdExtness : args of dic(self).__setitem__ is not a tuple !");
+    }
+  if(PyTuple_Size(argsPy)!=2)
+    {
+      Py_XDECREF(argsPy);
+      throw Exception("PickelizedPyObjRdExtServer::checkDictSetitemRdExtness : tuple of dic(self).__setitem__ has not a size equal to 2 !");
+    }
+  if(PyDict_GetItem(_self,PyTuple_GetItem(argsPy,0))!=0)
+    {// argsPy[0] is already a key of _self -> __setitem__ is NOT RdExt !
+      Py_XDECREF(argsPy);
+      throw Exception("PickelizedPyObjRdExtServer::checkDictSetitemRdExtness : specified key of __setitem__ already exists ! RdExt property is not applied !");
+    }
+}
diff --git a/src/SALOMESDS/SALOMESDS_PickelizedPyObjRdExtServer.hxx b/src/SALOMESDS/SALOMESDS_PickelizedPyObjRdExtServer.hxx
new file mode 100644 (file)
index 0000000..ea62b73
--- /dev/null
@@ -0,0 +1,48 @@
+// Copyright (C) 2007-2014  CEA/DEN, EDF R&D, OPEN CASCADE
+//
+// This library is free software; you can redistribute it and/or
+// modify it under the terms of the GNU Lesser General Public
+// License as published by the Free Software Foundation; either
+// version 2.1 of the License, or (at your option) any later version.
+//
+// This library is distributed in the hope that it will be useful,
+// but WITHOUT ANY WARRANTY; without even the implied warranty of
+// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the GNU
+// Lesser General Public License for more details.
+//
+// You should have received a copy of the GNU Lesser General Public
+// License along with this library; if not, write to the Free Software
+// Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA  02111-1307 USA
+//
+// See http://www.salome-platform.org/ or email : webmaster.salome@opencascade.com
+//
+// Author : Anthony GEAY (EDF R&D)
+
+#ifndef __SALOMESDS_PICKELIZEDPYOBJRDEXTSERVER_HXX__
+#define __SALOMESDS_PICKELIZEDPYOBJRDEXTSERVER_HXX__
+
+#include "SALOMEconfig.h"
+#include CORBA_SERVER_HEADER(SALOME_SDS)
+
+#include <Python.h>
+
+#include "SALOMESDS_PickelizedPyObjServer.hxx"
+
+namespace SALOMESDS
+{
+  class PickelizedPyObjRdExtServer : public PickelizedPyObjServer, public virtual POA_SALOME::PickelizedPyObjRdExtServer
+  {
+  public:
+    PickelizedPyObjRdExtServer(DataScopeServer *father, const std::string& varName, const SALOME::ByteVec& value);
+    PickelizedPyObjRdExtServer(DataScopeServer *father, const std::string& varName, PyObject *obj);
+    ~PickelizedPyObjRdExtServer();
+    SALOME::PickelizedPyObjRdExtServer_ptr invokePythonMethodOn(const char *method, const SALOME::ByteVec& args);
+  private:
+    void checkRdExtnessOf(const std::string& methodName, PyObject *argsPy);
+    void checkListRdExtnessOf(const std::string& methodName, PyObject *argsPy);
+    void checkDictRdExtnessOf(const std::string& methodName, PyObject *argsPy);
+    void checkDictSetitemRdExtness(PyObject *argsPy);
+  };
+}
+
+#endif
diff --git a/src/SALOMESDS/SALOMESDS_PickelizedPyObjRdOnlyServer.cxx b/src/SALOMESDS/SALOMESDS_PickelizedPyObjRdOnlyServer.cxx
new file mode 100644 (file)
index 0000000..4626d00
--- /dev/null
@@ -0,0 +1,35 @@
+// Copyright (C) 2007-2014  CEA/DEN, EDF R&D, OPEN CASCADE
+//
+// This library is free software; you can redistribute it and/or
+// modify it under the terms of the GNU Lesser General Public
+// License as published by the Free Software Foundation; either
+// version 2.1 of the License, or (at your option) any later version.
+//
+// This library is distributed in the hope that it will be useful,
+// but WITHOUT ANY WARRANTY; without even the implied warranty of
+// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the GNU
+// Lesser General Public License for more details.
+//
+// You should have received a copy of the GNU Lesser General Public
+// License along with this library; if not, write to the Free Software
+// Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA  02111-1307 USA
+//
+// See http://www.salome-platform.org/ or email : webmaster.salome@opencascade.com
+//
+// Author : Anthony GEAY (EDF R&D)
+
+#include "SALOMESDS_PickelizedPyObjRdOnlyServer.hxx"
+
+using namespace SALOMESDS;
+
+PickelizedPyObjRdOnlyServer::PickelizedPyObjRdOnlyServer(DataScopeServer *father, const std::string& varName, const SALOME::ByteVec& value):PickelizedPyObjServer(father,varName,value)
+{
+}
+
+PickelizedPyObjRdOnlyServer::PickelizedPyObjRdOnlyServer(DataScopeServer *father, const std::string& varName, PyObject *obj):PickelizedPyObjServer(father,varName,obj)
+{
+}
+
+PickelizedPyObjRdOnlyServer::~PickelizedPyObjRdOnlyServer()
+{
+}
diff --git a/src/SALOMESDS/SALOMESDS_PickelizedPyObjRdOnlyServer.hxx b/src/SALOMESDS/SALOMESDS_PickelizedPyObjRdOnlyServer.hxx
new file mode 100644 (file)
index 0000000..68924a7
--- /dev/null
@@ -0,0 +1,42 @@
+// Copyright (C) 2007-2014  CEA/DEN, EDF R&D, OPEN CASCADE
+//
+// This library is free software; you can redistribute it and/or
+// modify it under the terms of the GNU Lesser General Public
+// License as published by the Free Software Foundation; either
+// version 2.1 of the License, or (at your option) any later version.
+//
+// This library is distributed in the hope that it will be useful,
+// but WITHOUT ANY WARRANTY; without even the implied warranty of
+// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the GNU
+// Lesser General Public License for more details.
+//
+// You should have received a copy of the GNU Lesser General Public
+// License along with this library; if not, write to the Free Software
+// Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA  02111-1307 USA
+//
+// See http://www.salome-platform.org/ or email : webmaster.salome@opencascade.com
+//
+// Author : Anthony GEAY (EDF R&D)
+
+#ifndef __SALOMESDS_PICKELIZEDPYOBJRDONLYSERVER_HXX__
+#define __SALOMESDS_PICKELIZEDPYOBJRDONLYSERVER_HXX__
+
+#include "SALOMEconfig.h"
+#include CORBA_SERVER_HEADER(SALOME_SDS)
+
+#include <Python.h>
+
+#include "SALOMESDS_PickelizedPyObjServer.hxx"
+
+namespace SALOMESDS
+{
+  class PickelizedPyObjRdOnlyServer : public PickelizedPyObjServer, public virtual POA_SALOME::PickelizedPyObjRdOnlyServer
+  {
+  public:
+    PickelizedPyObjRdOnlyServer(DataScopeServer *father, const std::string& varName, const SALOME::ByteVec& value);
+    PickelizedPyObjRdOnlyServer(DataScopeServer *father, const std::string& varName, PyObject *obj);
+    ~PickelizedPyObjRdOnlyServer();
+  };
+}
+
+#endif
diff --git a/src/SALOMESDS/SALOMESDS_PickelizedPyObjRdWrServer.cxx b/src/SALOMESDS/SALOMESDS_PickelizedPyObjRdWrServer.cxx
new file mode 100644 (file)
index 0000000..848cefc
--- /dev/null
@@ -0,0 +1,110 @@
+// Copyright (C) 2007-2014  CEA/DEN, EDF R&D, OPEN CASCADE
+//
+// This library is free software; you can redistribute it and/or
+// modify it under the terms of the GNU Lesser General Public
+// License as published by the Free Software Foundation; either
+// version 2.1 of the License, or (at your option) any later version.
+//
+// This library is distributed in the hope that it will be useful,
+// but WITHOUT ANY WARRANTY; without even the implied warranty of
+// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the GNU
+// Lesser General Public License for more details.
+//
+// You should have received a copy of the GNU Lesser General Public
+// License along with this library; if not, write to the Free Software
+// Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA  02111-1307 USA
+//
+// See http://www.salome-platform.org/ or email : webmaster.salome@opencascade.com
+//
+// Author : Anthony GEAY (EDF R&D)
+
+#include "SALOMESDS_PickelizedPyObjRdWrServer.hxx"
+#include "SALOMESDS_DataScopeServer.hxx"
+#include "SALOMESDS_Exception.hxx"
+
+#include <iostream>
+#include <sstream>
+
+using namespace SALOMESDS;
+
+PickelizedPyObjRdWrServer::PickelizedPyObjRdWrServer(DataScopeServer *father, const std::string& typeName, const std::string& varName):PickelizedPyObjServer(father,varName,CreateDftObjFromType(father->getGlobals(),typeName))
+{
+}
+
+PickelizedPyObjRdWrServer::PickelizedPyObjRdWrServer(DataScopeServer *father, const std::string& varName, const SALOME::ByteVec& value):PickelizedPyObjServer(father,varName,value)
+{
+}
+
+//! obj is consumed
+PickelizedPyObjRdWrServer::PickelizedPyObjRdWrServer(DataScopeServer *father, const std::string& varName, PyObject *obj):PickelizedPyObjServer(father,varName,obj)
+{
+}
+
+PickelizedPyObjRdWrServer::~PickelizedPyObjRdWrServer()
+{
+}
+
+/*!
+ * Called remotely -> to protect against throw
+ */
+void PickelizedPyObjRdWrServer::setSerializedContent(const SALOME::ByteVec& newValue)
+{
+  setSerializedContentInternal(newValue);
+}
+
+/*!
+ * Called remotely -> to protect against throw
+ */
+SALOME::PickelizedPyObjRdWrServer_ptr PickelizedPyObjRdWrServer::invokePythonMethodOn(const char *method, const SALOME::ByteVec& args)
+{
+  if(!_self)
+    throw Exception("PickelizedPyObjRdWrServer::invokePythonMethodOn : self is NULL !");
+  std::string argsCpp;
+  FromByteSeqToCpp(args,argsCpp);
+  PyObject *argsPy(getPyObjFromPickled(argsCpp));
+  //
+  PyObject *selfMeth(PyObject_GetAttrString(_self,method));
+  if(!selfMeth)
+    {
+      std::ostringstream oss; oss << "PickelizedPyObjRdWrServer::invokePythonMethodOn : Method \"" << method << "\" is not available !";
+      throw Exception(oss.str());
+    }
+  PyObject *res(PyObject_CallObject(selfMeth,argsPy));// self can have been modified by this call !
+  Py_XDECREF(selfMeth);
+  Py_XDECREF(argsPy);
+  if(!res)
+    {
+      std::ostringstream oss,oss2,oss3;
+      PyObject *errTyp(0),*errValue(0),*errTB(0);
+      PyErr_Fetch(&errTyp,&errValue,&errTB);
+      oss2 << "(";
+      if(errTyp)
+        {
+          PyObject *ob(PyObject_Str(errTyp));
+          oss2 << " type : \"" << (const char *)PyString_AsString(ob) << "\"";
+          Py_XDECREF(ob); Py_XDECREF(errTyp);
+        }
+      if(errValue)
+        {
+          PyObject *ob(PyObject_Str(errValue));
+          oss2 << " value : \"" << (const char *)PyString_AsString(ob) << "\"";
+          Py_XDECREF(ob); Py_XDECREF(errValue);
+        }
+      oss2 << " )";
+      if(errTB)
+        {
+          PyObject *ob(PyObject_Str(errTB));
+          oss2 << "( traceback : \"" << (const char *)PyString_AsString(ob) << "\"";
+          Py_XDECREF(ob); Py_XDECREF(errTB);
+        }
+      oss2 << " )";
+      PyErr_Clear();
+      oss << "PickelizedPyObjRdWrServer::invokePythonMethodOn : Problem during invokation serverside of Method \"" << method << "\" ! Details are : " << oss2.str() << "\n\n" << "TraceBack is : " << oss3.str(); 
+      throw Exception(oss.str());
+    }
+  PickelizedPyObjRdWrServer *ret(new PickelizedPyObjRdWrServer(_father,DataScopeServer::BuildTmpVarNameFrom(getVarNameCpp()),res));
+  PortableServer::POA_var poa(_father->getPOA());
+  PortableServer::ObjectId_var id(poa->activate_object(ret));
+  CORBA::Object_var obj(poa->id_to_reference(id));
+  return SALOME::PickelizedPyObjRdWrServer::_narrow(obj);
+}
diff --git a/src/SALOMESDS/SALOMESDS_PickelizedPyObjRdWrServer.hxx b/src/SALOMESDS/SALOMESDS_PickelizedPyObjRdWrServer.hxx
new file mode 100644 (file)
index 0000000..fe33ca2
--- /dev/null
@@ -0,0 +1,45 @@
+// Copyright (C) 2007-2014  CEA/DEN, EDF R&D, OPEN CASCADE
+//
+// This library is free software; you can redistribute it and/or
+// modify it under the terms of the GNU Lesser General Public
+// License as published by the Free Software Foundation; either
+// version 2.1 of the License, or (at your option) any later version.
+//
+// This library is distributed in the hope that it will be useful,
+// but WITHOUT ANY WARRANTY; without even the implied warranty of
+// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the GNU
+// Lesser General Public License for more details.
+//
+// You should have received a copy of the GNU Lesser General Public
+// License along with this library; if not, write to the Free Software
+// Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA  02111-1307 USA
+//
+// See http://www.salome-platform.org/ or email : webmaster.salome@opencascade.com
+//
+// Author : Anthony GEAY (EDF R&D)
+
+#ifndef __SALOMESDS_PICKELIZEDPYOBJRDWRSERVER_HXX__
+#define __SALOMESDS_PICKELIZEDPYOBJRDWRSERVER_HXX__
+
+#include "SALOMEconfig.h"
+#include CORBA_SERVER_HEADER(SALOME_SDS)
+
+#include <Python.h>
+
+#include "SALOMESDS_PickelizedPyObjServer.hxx"
+
+namespace SALOMESDS
+{
+  class PickelizedPyObjRdWrServer : public PickelizedPyObjServer, public virtual POA_SALOME::PickelizedPyObjRdWrServer
+  {
+  public:
+    PickelizedPyObjRdWrServer(DataScopeServer *father, const std::string& typeName, const std::string& varName);
+    PickelizedPyObjRdWrServer(DataScopeServer *father, const std::string& varName, const SALOME::ByteVec& value);
+    PickelizedPyObjRdWrServer(DataScopeServer *father, const std::string& varName, PyObject *obj);
+    ~PickelizedPyObjRdWrServer();
+    void setSerializedContent(const SALOME::ByteVec& newValue);
+    SALOME::PickelizedPyObjRdWrServer_ptr invokePythonMethodOn(const char *method, const SALOME::ByteVec& args);
+  };
+}
+
+#endif
diff --git a/src/SALOMESDS/SALOMESDS_PickelizedPyObjServer.cxx b/src/SALOMESDS/SALOMESDS_PickelizedPyObjServer.cxx
new file mode 100644 (file)
index 0000000..baba4b5
--- /dev/null
@@ -0,0 +1,161 @@
+// Copyright (C) 2007-2014  CEA/DEN, EDF R&D, OPEN CASCADE
+//
+// This library is free software; you can redistribute it and/or
+// modify it under the terms of the GNU Lesser General Public
+// License as published by the Free Software Foundation; either
+// version 2.1 of the License, or (at your option) any later version.
+//
+// This library is distributed in the hope that it will be useful,
+// but WITHOUT ANY WARRANTY; without even the implied warranty of
+// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the GNU
+// Lesser General Public License for more details.
+//
+// You should have received a copy of the GNU Lesser General Public
+// License along with this library; if not, write to the Free Software
+// Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA  02111-1307 USA
+//
+// See http://www.salome-platform.org/ or email : webmaster.salome@opencascade.com
+//
+// Author : Anthony GEAY (EDF R&D)
+
+#include "SALOMESDS_PickelizedPyObjServer.hxx"
+#include "SALOMESDS_DataScopeServer.hxx"
+#include "SALOMESDS_Exception.hxx"
+
+#include <iostream>
+#include <sstream>
+
+using namespace SALOMESDS;
+
+PickelizedPyObjServer::PickelizedPyObjServer(DataScopeServer *father, const std::string& varName, const SALOME::ByteVec& value):BasicDataServer(father,varName),_self(0)
+{
+  setSerializedContentInternal(value);
+}
+
+//! obj is consumed
+PickelizedPyObjServer::PickelizedPyObjServer(DataScopeServer *father, const std::string& varName, PyObject *obj):BasicDataServer(father,varName),_self(0)
+{
+  setNewPyObj(obj);
+}
+
+PickelizedPyObjServer::~PickelizedPyObjServer()
+{
+  Py_XDECREF(_self);
+}
+
+/*!
+ * Called remotely -> to protect against throw
+ */
+SALOME::ByteVec *PickelizedPyObjServer::fetchSerializedContent()
+{
+  Py_XINCREF(_self);//because pickelize consume _self
+  return FromCppToByteSeq(pickelize(_self));
+}
+
+void PickelizedPyObjServer::FromByteSeqToCpp(const SALOME::ByteVec& bsToBeConv, std::string& ret)
+{
+  std::size_t sz(bsToBeConv.length());
+  ret.resize(sz,' ');
+  char *buf(const_cast<char *>(ret.c_str()));
+  for(std::size_t i=0;i<sz;i++)
+    buf[i]=bsToBeConv[i];
+}
+
+SALOME::ByteVec *PickelizedPyObjServer::FromCppToByteSeq(const std::string& strToBeConv)
+{
+  SALOME::ByteVec *ret(new SALOME::ByteVec);
+  const char *buf(strToBeConv.c_str());
+  std::size_t sz(strToBeConv.size());
+  ret->length(sz);
+  for(std::size_t i=0;i<sz;i++)
+    (*ret)[i]=buf[i];
+  return ret;
+}
+
+//! New reference returned
+PyObject *PickelizedPyObjServer::getPyObjFromPickled(const std::string& pickledData)
+{
+  std::size_t sz(pickledData.size());
+  PyObject *pickledDataPy(PyString_FromStringAndSize(NULL,sz));// agy : do not use PyString_FromString because std::string hides a vector of byte.
+  char *buf(PyString_AsString(pickledDataPy));// this buf can be used thanks to python documentation.
+  const char *inBuf(pickledData.c_str());
+  std::copy(inBuf,inBuf+sz,buf);
+  PyObject *selfMeth(PyObject_GetAttrString(_father->getPickler(),"loads"));
+  PyObject *args(PyTuple_New(1)); PyTuple_SetItem(args,0,pickledDataPy);
+  PyObject *ret(PyObject_CallObject(selfMeth,args));
+  Py_XDECREF(args);
+  Py_XDECREF(selfMeth);
+  return ret;
+}
+
+//! obj is consumed by this method.
+std::string PickelizedPyObjServer::pickelize(PyObject *obj)
+{
+  PyObject *args(PyTuple_New(2));
+  PyTuple_SetItem(args,0,obj);
+  PyTuple_SetItem(args,1,PyInt_FromLong(2));// because "assert(cPickle.HIGHEST_PROTOCOL is 2)"
+  PyObject *selfMeth(PyObject_GetAttrString(_father->getPickler(),"dumps"));
+  PyObject *retPy(PyObject_CallObject(selfMeth,args));
+  Py_XDECREF(selfMeth);
+  Py_XDECREF(args);
+  std::size_t sz(PyString_Size(retPy));
+  std::string ret(sz,'\0');
+  const char *buf(PyString_AsString(retPy));
+  char *inBuf(const_cast<char *>(ret.c_str()));
+  for(std::size_t i=0;i<sz;i++)
+    inBuf[i]=buf[i];
+  Py_XDECREF(retPy);
+  return ret;
+}
+
+//! obj is consumed by this method.
+void PickelizedPyObjServer::setNewPyObj(PyObject *obj)
+{
+  if(!obj)
+    throw Exception("PickelizedPyObjServer::setNewPyObj : trying to assign a NULL pyobject in this !");
+  if(obj==_self)
+    return ;
+  if(PyList_Check(obj)==0 && PyDict_Check(obj)==0 && PyTuple_Check(obj)==0 && PyString_Check(obj)==0 && PyInt_Check(obj)==0 && PyBool_Check(obj)==0 && PyFloat_Check(obj)==0 && obj!=Py_None)
+    throw Exception("PickelizedPyObjServer::setNewPyObj : Supported python types are [list,tuple,dict,str,int,bool,float,None] !");
+  if(_self)
+    {
+      PyObject *selfType(PyObject_Type(_self));
+      if(PyObject_IsInstance(obj,selfType)!=1)
+        {
+          Py_XDECREF(obj);
+          Py_XDECREF(selfType);
+          throw Exception("PickelizedPyObjServer::setNewPyObj : type of new object is not the same than those previously set !");
+        }
+      else
+        Py_XDECREF(selfType);
+    }
+  Py_XDECREF(_self);
+  _self=obj;
+}
+
+void PickelizedPyObjServer::setSerializedContentInternal(const SALOME::ByteVec& newValue)
+{
+  std::string data;
+  FromByteSeqToCpp(newValue,data);
+  setNewPyObj(getPyObjFromPickled(data));
+}
+
+PyObject *PickelizedPyObjServer::CreateDftObjFromType(PyObject *globals, const std::string& typeName)
+{
+  PyObject *builtins(PyDict_GetItemString(globals,"__builtins__"));
+  if(!builtins)
+    throw Exception("PickelizedPyObjServer constructor : no __builtins__ in globals !");
+  PyObject *builtins2(PyModule_GetDict(builtins));
+  if(!builtins2)
+    throw Exception("PickelizedPyObjServer constructor : internal error fail to invoke __dict__ on __builtins__ !");
+  PyObject *tmp(PyDict_GetItemString(builtins2,typeName.c_str()));
+  if(!tmp)
+    {
+      std::ostringstream oss; oss << "PickelizedPyObjServer::CreateDftObjFromType : Invalid type name \"" << typeName << "\" !";
+      throw Exception(oss.str());
+    }
+  PyObject *args(PyTuple_New(0));
+  PyObject *ret(PyObject_CallObject(tmp,args));
+  Py_XDECREF(args);
+  return ret;
+}
diff --git a/src/SALOMESDS/SALOMESDS_PickelizedPyObjServer.hxx b/src/SALOMESDS/SALOMESDS_PickelizedPyObjServer.hxx
new file mode 100644 (file)
index 0000000..ba8af50
--- /dev/null
@@ -0,0 +1,56 @@
+// Copyright (C) 2007-2014  CEA/DEN, EDF R&D, OPEN CASCADE
+//
+// This library is free software; you can redistribute it and/or
+// modify it under the terms of the GNU Lesser General Public
+// License as published by the Free Software Foundation; either
+// version 2.1 of the License, or (at your option) any later version.
+//
+// This library is distributed in the hope that it will be useful,
+// but WITHOUT ANY WARRANTY; without even the implied warranty of
+// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the GNU
+// Lesser General Public License for more details.
+//
+// You should have received a copy of the GNU Lesser General Public
+// License along with this library; if not, write to the Free Software
+// Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA  02111-1307 USA
+//
+// See http://www.salome-platform.org/ or email : webmaster.salome@opencascade.com
+//
+// Author : Anthony GEAY (EDF R&D)
+
+#ifndef __SALOMESDS_PICKELIZEDPYOBJSERVER_HXX__
+#define __SALOMESDS_PICKELIZEDPYOBJSERVER_HXX__
+
+#include "SALOMEconfig.h"
+#include CORBA_SERVER_HEADER(SALOME_SDS)
+
+#include <Python.h>
+
+#include "SALOMESDS_BasicDataServer.hxx"
+
+namespace SALOMESDS
+{
+  class PickelizedPyObjServer : public BasicDataServer, public virtual POA_SALOME::PickelizedPyObjServer
+  {
+  public:
+    PickelizedPyObjServer(DataScopeServer *father, const std::string& varName, const SALOME::ByteVec& value);
+    PickelizedPyObjServer(DataScopeServer *father, const std::string& varName, PyObject *obj);
+    ~PickelizedPyObjServer();
+    void setSerializedContent(const SALOME::ByteVec& newValue);
+    SALOME::ByteVec *fetchSerializedContent();
+  protected:
+    static void FromByteSeqToCpp(const SALOME::ByteVec& bsToBeConv, std::string& ret);
+    static SALOME::ByteVec *FromCppToByteSeq(const std::string& strToBeConv);
+    PyObject *getPyObjFromPickled(const std::string& pickledData);
+    std::string pickelize(PyObject *obj);
+    void setNewPyObj(PyObject *obj);
+    void setSerializedContentInternal(const SALOME::ByteVec& newValue);
+    static PyObject *CreateDftObjFromType(PyObject *globals, const std::string& typeName);
+  protected:
+    static const char FAKE_VAR_NAME_FOR_WORK[];
+    PyObject *_self;
+    PortableServer::POA_var _poa;
+  };
+}
+
+#endif
diff --git a/src/SALOMESDS/SALOMESDS_RefCountServ.cxx b/src/SALOMESDS/SALOMESDS_RefCountServ.cxx
new file mode 100644 (file)
index 0000000..b21d5a9
--- /dev/null
@@ -0,0 +1,59 @@
+// Copyright (C) 2007-2014  CEA/DEN, EDF R&D, OPEN CASCADE
+//
+// This library is free software; you can redistribute it and/or
+// modify it under the terms of the GNU Lesser General Public
+// License as published by the Free Software Foundation; either
+// version 2.1 of the License, or (at your option) any later version.
+//
+// This library is distributed in the hope that it will be useful,
+// but WITHOUT ANY WARRANTY; without even the implied warranty of
+// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the GNU
+// Lesser General Public License for more details.
+//
+// You should have received a copy of the GNU Lesser General Public
+// License along with this library; if not, write to the Free Software
+// Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA  02111-1307 USA
+//
+// See http://www.salome-platform.org/ or email : webmaster.salome@opencascade.com
+//
+// Author : Anthony GEAY (EDF R&D)
+
+#include "SALOMESDS_RefCountServ.hxx"
+
+using namespace SALOMESDS;
+
+void RefCountServ::incrRef() const
+{
+  _cnt++;
+}
+
+bool RefCountServ::decrRef() const
+{
+  bool ret((--_cnt)==0);
+  if(ret)
+    {
+      RefCountServ *thisNC(const_cast<RefCountServ *>(this));
+      thisNC->enforcedRelease();
+    }
+  return ret;
+}
+
+void RefCountServ::enforcedRelease()
+{
+  PortableServer::POA_var poa(getPOA());
+  PortableServer::ObjectId_var oid(poa->servant_to_id(this));
+  poa->deactivate_object(oid);
+  _remove_ref();
+}
+
+RefCountServ::RefCountServ():_cnt(1)
+{
+}
+
+RefCountServ::RefCountServ(const RefCountServ& other):_cnt(1)
+{
+}
+
+RefCountServ::~RefCountServ()
+{
+}
diff --git a/src/SALOMESDS/SALOMESDS_RefCountServ.hxx b/src/SALOMESDS/SALOMESDS_RefCountServ.hxx
new file mode 100644 (file)
index 0000000..0ec2d95
--- /dev/null
@@ -0,0 +1,44 @@
+// Copyright (C) 2007-2014  CEA/DEN, EDF R&D, OPEN CASCADE
+//
+// This library is free software; you can redistribute it and/or
+// modify it under the terms of the GNU Lesser General Public
+// License as published by the Free Software Foundation; either
+// version 2.1 of the License, or (at your option) any later version.
+//
+// This library is distributed in the hope that it will be useful,
+// but WITHOUT ANY WARRANTY; without even the implied warranty of
+// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the GNU
+// Lesser General Public License for more details.
+//
+// You should have received a copy of the GNU Lesser General Public
+// License along with this library; if not, write to the Free Software
+// Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA  02111-1307 USA
+//
+// See http://www.salome-platform.org/ or email : webmaster.salome@opencascade.com
+//
+// Author : Anthony GEAY (EDF R&D)
+
+#ifndef __SALOMESDS_REFCOUNTSERV_HXX__
+#define __SALOMESDS_REFCOUNTSERV_HXX__
+
+#include <omniORB4/CORBA.h>
+
+namespace SALOMESDS
+{
+  class RefCountServ : public virtual PortableServer::ServantBase
+  {
+  public:
+    void incrRef() const;
+    bool decrRef() const;
+    virtual PortableServer::POA_var getPOA() = 0;
+  protected:
+    void enforcedRelease();
+    RefCountServ();
+    RefCountServ(const RefCountServ& other);
+    virtual ~RefCountServ();
+  private:
+    mutable unsigned int _cnt;
+  };
+}
+
+#endif
diff --git a/src/SALOMESDS/SALOME_DataScopeServer.cxx b/src/SALOMESDS/SALOME_DataScopeServer.cxx
new file mode 100644 (file)
index 0000000..a5061c3
--- /dev/null
@@ -0,0 +1,60 @@
+// Copyright (C) 2007-2014  CEA/DEN, EDF R&D, OPEN CASCADE
+//
+// This library is free software; you can redistribute it and/or
+// modify it under the terms of the GNU Lesser General Public
+// License as published by the Free Software Foundation; either
+// version 2.1 of the License, or (at your option) any later version.
+//
+// This library is distributed in the hope that it will be useful,
+// but WITHOUT ANY WARRANTY; without even the implied warranty of
+// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the GNU
+// Lesser General Public License for more details.
+//
+// You should have received a copy of the GNU Lesser General Public
+// License along with this library; if not, write to the Free Software
+// Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA  02111-1307 USA
+//
+// See http://www.salome-platform.org/ or email : webmaster.salome@opencascade.com
+//
+// Author : Anthony GEAY (EDF R&D)
+
+#include "SALOMESDS_DataScopeServer.hxx"
+#include "SALOMESDS_DataServerManager.hxx"
+#include "SALOMESDS_Exception.hxx"
+
+#include "SALOME_NamingService.hxx"
+
+#include <string>
+#include <sstream>
+
+int main(int argc, char *argv[])
+{
+  std::string scopeName;
+  if(argc<=1)
+    throw SALOMESDS::Exception("In the main of SALOME_DataScopeServer.cxx !");
+  scopeName=argv[1];
+  CORBA::ORB_var orb(CORBA::ORB_init(argc,argv));
+  CORBA::Object_var obj(orb->resolve_initial_references("RootPOA"));
+  PortableServer::POA_var poa(PortableServer::POA::_narrow(obj));
+  PortableServer::POAManager_var mgr(poa->the_POAManager());
+  mgr->activate();
+  SALOMESDS::DataScopeServer *server(new SALOMESDS::DataScopeServer(orb,scopeName));
+  //
+  CORBA::PolicyList policies;
+  policies.length(1);
+  PortableServer::ThreadPolicy_var threadPol(poa->create_thread_policy(PortableServer::SINGLE_THREAD_MODEL));
+  policies[0]=PortableServer::ThreadPolicy::_duplicate(threadPol);
+  PortableServer::POA_var poa2(poa->create_POA("SingleThPOA4SDS",mgr,policies));
+  threadPol->destroy();
+  server->initializePython(argc,argv);// agy : Very important ! invoke this method BEFORE activation !
+  server->registerToSalomePiDict();
+  PortableServer::ObjectId_var id(poa2->activate_object(server));
+  obj=poa2->id_to_reference(id);
+  SALOME::DataScopeServer_var serverPtr(SALOME::DataScopeServer::_narrow(obj));
+  server->setPOAAndRegister(poa2,serverPtr);
+  //
+  orb->run();
+  server->_remove_ref();
+  return 0;
+}
+
diff --git a/src/SALOMESDS/SalomeSDSClt.py b/src/SALOMESDS/SalomeSDSClt.py
new file mode 100644 (file)
index 0000000..9b9218c
--- /dev/null
@@ -0,0 +1,492 @@
+# -*- coding: utf-8 -*-
+# Copyright (C) 2007-2014  CEA/DEN, EDF R&D
+#
+# This library is free software; you can redistribute it and/or
+# modify it under the terms of the GNU Lesser General Public
+# License as published by the Free Software Foundation; either
+# version 2.1 of the License, or (at your option) any later version.
+#
+# This library is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the GNU
+# Lesser General Public License for more details.
+#
+# You should have received a copy of the GNU Lesser General Public
+# License along with this library; if not, write to the Free Software
+# Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA  02111-1307 USA
+#
+# See http://www.salome-platform.org/ or email : webmaster.salome@opencascade.com
+#
+# Author : Anthony Geay
+
+import SALOME
+import cPickle
+
+class WrappedType(object):
+    def __init__(self,varPtr,isTemporaryVar=False):
+        assert(isinstance(varPtr,SALOME._objref_PickelizedPyObjServer))
+        self._var_ptr=varPtr
+        if not isTemporaryVar:
+            self._var_ptr.Register()
+        self._is_temp=isTemporaryVar
+        pass
+
+    def local_copy(self):
+        return cPickle.loads(self._var_ptr.fetchSerializedContent())
+
+    def __str__(self):
+        return self.local_copy().__str__()
+
+    def __repr__(self):
+        return self.local_copy().__repr__()
+
+    def __reduce__(self):
+        return (self._wrapped_type,(self.local_copy(),))
+
+    def assign(self,elt):
+        assert(isinstance(self._var_ptr,SALOME._objref_PickelizedPyObjRdWrServer))
+        st=cPickle.dumps(elt,cPickle.HIGHEST_PROTOCOL)
+        self._var_ptr.setSerializedContent(st)
+        pass
+
+    def __del__(self):
+        self._var_ptr.UnRegister()
+        pass
+    pass
+
+class List(WrappedType):
+    def __init__(self,varPtr,isTemporaryVar=False):
+        WrappedType.__init__(self,varPtr,isTemporaryVar)
+        self._wrapped_type=list
+        pass
+
+    def __getitem__(self,*args):
+        ret=Caller(self._var_ptr,"__getitem__")
+        return ret(*args)
+
+    def __setitem__(self,*args):
+        ret=Caller(self._var_ptr,"__setitem__")
+        return ret(*args)
+    
+    def __delitem__(self,*args):
+        ret=Caller(self._var_ptr,"__delitem__")
+        return ret(*args)
+
+    def append(self,*args):
+        ret=Caller(self._var_ptr,"append")
+        return ret(*args)
+
+    def extend(self,*args):
+        ret=Caller(self._var_ptr,"extend")
+        return ret(*args)
+
+    def insert(self,*args):
+        ret=Caller(self._var_ptr,"insert")
+        return ret(*args)
+
+    def pop(self,*args):
+        ret=Caller(self._var_ptr,"pop")
+        return ret(*args)
+
+    def remove(self,*args):
+        ret=Caller(self._var_ptr,"remove")
+        return ret(*args)
+
+    def reverse(self,*args):
+        ret=Caller(self._var_ptr,"reverse")
+        return ret(*args)
+
+    def sort(self,*args):
+        ret=Caller(self._var_ptr,"sort")
+        return ret(*args)
+    
+    def count(self,*args):
+        return self.local_copy().count(*args)
+
+    def index(self,*args):
+        return self.local_copy().index(*args)
+
+    def __len__(self):
+        return len(self.local_copy())
+    pass
+
+class Dict(WrappedType):
+    def __init__(self,varPtr,isTemporaryVar=False):
+        WrappedType.__init__(self,varPtr,isTemporaryVar)
+        self._wrapped_type=dict
+        pass
+
+    def __getitem__(self,*args):
+        ret=Caller(self._var_ptr,"__getitem__")
+        return ret(*args)
+
+    def __setitem__(self,*args):
+        ret=Caller(self._var_ptr,"__setitem__")
+        return ret(*args)
+
+    def __delitem__(self,*args):
+        ret=Caller(self._var_ptr,"__delitem__")
+        return ret(*args)
+    
+    def clear(self,*args):
+        ret=Caller(self._var_ptr,"clear")
+        return ret(*args)
+
+    def get(self,*args):
+        ret=Caller(self._var_ptr,"get")
+        return ret(*args)
+
+    def items(self,*args):
+        ret=Caller(self._var_ptr,"items")
+        return ret(*args)
+
+    def pop(self,*args):
+        ret=Caller(self._var_ptr,"pop")
+        return ret(*args)
+
+    def popitem(self,*args):
+        ret=Caller(self._var_ptr,"popitem")
+        return ret(*args)
+
+    def setdefault(self,*args):
+        ret=Caller(self._var_ptr,"setdefault")
+        return ret(*args)
+
+    def update(self,*args):
+        ret=Caller(self._var_ptr,"update")
+        return ret(*args)
+
+    def values(self,*args):
+        ret=Caller(self._var_ptr,"values")
+        return ret(*args)
+    # work on local copy
+
+    def __contains__(self,*args):
+        return self.local_copy().__contains__(*args)
+
+    def has_key(self,*args):
+        return self.local_copy().has_key(*args)
+
+    def keys(self,*args):
+        return self.local_copy().keys(*args)
+
+    def copy(self,*args):
+        return self.local_copy().copy(*args)
+
+    def __len__(self):
+        return len(self.local_copy())
+
+    pass
+
+class Tuple(WrappedType):
+    def __init__(self,varPtr,isTemporaryVar=False):
+        WrappedType.__init__(self,varPtr,isTemporaryVar)
+        self._wrapped_type=tuple
+        pass
+
+    def __getitem__(self,*args):
+        ret=Caller(self._var_ptr,"__getitem__")
+        return ret(*args)
+    
+    # work on local copy
+
+    def count(self,*args):
+        return self.local_copy().count(*args)
+
+    def index(self,*args):
+        return self.local_copy().index(*args)
+    
+    def __len__(self):
+        return len(self.local_copy())
+
+    pass
+
+class Float(WrappedType):
+    def __init__(self,varPtr,isTemporaryVar=False):
+        WrappedType.__init__(self,varPtr,isTemporaryVar)
+        self._wrapped_type=float
+        pass
+
+    def __iadd__(self,*args):
+        return self.local_copy().__add__(*args)
+
+    def __isub__(self,*args):
+        return self.local_copy().__sub__(*args)
+
+    def __imul__(self,*args):
+        return self.local_copy().__mul__(*args)
+
+    def __idiv__(self,*args):
+        return self.local_copy().__div__(*args)
+
+    def __add__(self,*args):
+        return self.local_copy().__add__(*args)
+
+    def __sub__(self,*args):
+        return self.local_copy().__sub__(*args)
+
+    def __mul__(self,*args):
+        return self.local_copy().__mul__(*args)
+
+    def __div__(self,*args):
+        return self.local_copy().__div__(*args)
+    
+    def __pow__(self,*args):
+        return self.local_copy().__pow__(*args)
+
+    def as_integer_ratio(self,*args):
+        return self.local_copy().as_integer_ratio(*args)
+
+    def conjugate(self,*args):
+        return self.local_copy().conjugate(*args)
+
+    def fromhex(self,*args):
+        return self.local_copy().fromhex(*args)
+
+    def hex(self,*args):
+        return self.local_copy().hex(*args)
+
+    def imag(self,*args):
+        return self.local_copy().imag(*args)
+
+    def is_integer(self,*args):
+        return self.local_copy().is_integer(*args)
+
+    def real(self,*args):
+        return self.local_copy().real(*args)
+    pass
+
+class Int(WrappedType):
+    def __init__(self,varPtr,isTemporaryVar=False):
+        WrappedType.__init__(self,varPtr,isTemporaryVar)
+        self._wrapped_type=int
+        pass
+
+    def __iadd__(self,*args):
+        return self.local_copy().__add__(*args)
+
+    def __isub__(self,*args):
+        return self.local_copy().__sub__(*args)
+
+    def __imul__(self,*args):
+        return self.local_copy().__mul__(*args)
+
+    def __imod__(self,*args):
+        return self.local_copy().__mod__(*args)
+    
+    def __idiv__(self,*args):
+        return self.local_copy().__div__(*args)
+
+    def __add__(self,*args):
+        return self.local_copy().__add__(*args)
+
+    def __sub__(self,*args):
+        return self.local_copy().__sub__(*args)
+
+    def __mul__(self,*args):
+        return self.local_copy().__mul__(*args)
+
+    def __mod__(self,*args):
+        return self.local_copy().__mod__(*args)
+
+    def __div__(self,*args):
+        return self.local_copy().__div__(*args)
+    
+    def __pow__(self,*args):
+        return self.local_copy().__pow__(*args)
+
+    def bit_length(self,*args):
+        return self.local_copy().bit_length(*args)
+
+    def conjugate(self,*args):
+        return self.local_copy().conjugate(*args)
+
+    def denominator(self,*args):
+        return self.local_copy().denominator(*args)
+
+    def imag(self,*args):
+        return self.local_copy().imag(*args)
+    
+    def numerator(self,*args):
+        return self.local_copy().numerator(*args)
+
+    def real(self,*args):
+        return self.local_copy().real(*args)
+    pass
+
+class String(WrappedType):
+    def __init__(self,varPtr,isTemporaryVar=False):
+        WrappedType.__init__(self,varPtr,isTemporaryVar)
+        self._wrapped_type=int
+        pass
+
+    def __add__(self,*args):
+        return self.local_copy().__add__(*args)
+
+    def __iadd__(self,*args):
+        return self.local_copy().__add__(*args)
+
+    def __getitem__(self,*args):
+        return self.local_copy().__getitem__(*args)
+
+    def capitalize(self,*args):
+        return self.local_copy().capitalize(*args)
+
+    def center(self,*args):
+        return self.local_copy().center(*args)
+
+    def count(self,*args):
+        return self.local_copy().count(*args)
+
+    def decode(self,*args):
+        return self.local_copy().decode(*args)
+
+    def encode(self,*args):
+        return self.local_copy().encode(*args)
+
+    def endswith(self,*args):
+        return self.local_copy().endswith(*args)
+
+    def expandtabs(self,*args):
+        return self.local_copy().expandtabs(*args)
+
+    def find(self,*args):
+        return self.local_copy().find(*args)
+
+    def format(self,*args):
+        return self.local_copy().format(*args)
+
+    def index(self,*args):
+        return self.local_copy().index(*args)
+
+    def isalnum(self,*args):
+        return self.local_copy().isalnum(*args)
+
+    def isalpha(self,*args):
+        return self.local_copy().isalpha(*args)
+
+    def isdigit(self,*args):
+        return self.local_copy().isdigit(*args)
+
+    def islower(self,*args):
+        return self.local_copy().islower(*args)
+
+    def isspace(self,*args):
+        return self.local_copy().isspace(*args)
+
+    def istitle(self,*args):
+        return self.local_copy().istitle(*args)
+
+    def isupper(self,*args):
+        return self.local_copy().isupper(*args)
+
+    def join(self,*args):
+        return self.local_copy().join(*args)
+
+    def ljust(self,*args):
+        return self.local_copy().ljust(*args)
+
+    def lower(self,*args):
+        return self.local_copy().lower(*args)
+
+    def lstrip(self,*args):
+        return self.local_copy().lstrip(*args)
+
+    def partition(self,*args):
+        return self.local_copy().partition(*args)
+
+    def replace(self,*args):
+        return self.local_copy().replace(*args)
+
+    def rfind(self,*args):
+        return self.local_copy().rfind(*args)
+
+    def rindex(self,*args):
+        return self.local_copy().rindex(*args)
+
+    def rjust(self,*args):
+        return self.local_copy().rjust(*args)
+
+    def rpartition(self,*args):
+        return self.local_copy().rpartition(*args)
+
+    def rsplit(self,*args):
+        return self.local_copy().rsplit(*args)
+
+    def rstrip(self,*args):
+        return self.local_copy().rstrip(*args)
+
+    def split(self,*args):
+        return self.local_copy().split(*args)
+
+    def splitlines(self,*args):
+        return self.local_copy().splitlines(*args)
+
+    def startswith(self,*args):
+        return self.local_copy().startswith(*args)
+
+    def strip(self,*args):
+        return self.local_copy().strip(*args)
+
+    def swapcase(self,*args):
+        return self.local_copy().swapcase(*args)
+
+    def title(self,*args):
+        return self.local_copy().title(*args)
+
+    def translate(self,*args):
+        return self.local_copy().translate(*args)
+
+    def upper(self,*args):
+        return self.local_copy().upper(*args)
+
+    def zfill(self,*args):
+        return self.local_copy().zfill(*args)
+
+    def __len__(self):
+        return len(self.local_copy())
+    pass
+
+class Caller:
+    def __init__(self,varPtr,meth):
+        assert(isinstance(varPtr,SALOME._objref_PickelizedPyObjServer))
+        self._var_ptr=varPtr
+        self._meth=meth
+        pass
+
+    def __call__(self,*args):
+        ret=self._var_ptr.invokePythonMethodOn(self._meth,cPickle.dumps(args,cPickle.HIGHEST_PROTOCOL))
+        return GetHandlerFromRef(ret,True)
+    pass
+
+PyHandlerTypeMap={int:Int,float:Float,str:String,list:List,tuple:Tuple,dict:Dict}
+
+def GetHandlerFromRef(objCorba,isTempVar=False):
+    """ Returns a client that allows to handle a remote corba ref of a global var easily.
+    """
+    assert(isinstance(objCorba,SALOME._objref_PickelizedPyObjServer))
+    v=cPickle.loads(objCorba.fetchSerializedContent())
+    if v is None:
+        objCorba.UnRegister()
+        return None
+    return PyHandlerTypeMap[v.__class__](objCorba,isTempVar)
+    
+    
+def CreateRdOnlyGlobalVar(value,varName,scopeName):
+    import salome
+    dsm=salome.naming_service.Resolve("/DataServerManager")
+    d2s,isCreated=dsm.giveADataScopeCalled(scopeName)
+    return GetHandlerFromRef(d2s.createRdOnlyVar(varName,cPickle.dumps(value,cPickle.HIGHEST_PROTOCOL)),False)
+    
+def CreateRdExtGlobalVar(value,varName,scopeName):
+    import salome
+    dsm=salome.naming_service.Resolve("/DataServerManager")
+    d2s,isCreated=dsm.giveADataScopeCalled(scopeName)
+    return GetHandlerFromRef(d2s.createRdExtVar(varName,cPickle.dumps(value,cPickle.HIGHEST_PROTOCOL)),False)
+
+def GetHandlerFromName(scopeName,varName):
+    import salome
+    dsm=salome.naming_service.Resolve("/DataServerManager")
+    d2s=dsm.retriveDataScope(scopeName)
+    return GetHandlerFromRef(d2s.retrieveVar(varName),False)
diff --git a/src/SALOMESDS/TestSalomeSDS1.py b/src/SALOMESDS/TestSalomeSDS1.py
new file mode 100644 (file)
index 0000000..26e11ac
--- /dev/null
@@ -0,0 +1,102 @@
+# -*- coding: utf-8 -*-
+# Copyright (C) 2007-2014  CEA/DEN, EDF R&D
+#
+# This library is free software; you can redistribute it and/or
+# modify it under the terms of the GNU Lesser General Public
+# License as published by the Free Software Foundation; either
+# version 2.1 of the License, or (at your option) any later version.
+#
+# This library is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the GNU
+# Lesser General Public License for more details.
+#
+# You should have received a copy of the GNU Lesser General Public
+# License along with this library; if not, write to the Free Software
+# Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA  02111-1307 USA
+#
+# See http://www.salome-platform.org/ or email : webmaster.salome@opencascade.com
+#
+# Author : Anthony Geay
+
+import salome
+import SALOME
+import cPickle
+import gc
+import SalomeSDSClt
+
+st="jjj"
+dsm=salome.naming_service.Resolve("/DataServerManager")
+assert(dsm.isAliveAndKicking("Default"))
+assert(isinstance(dsm,SALOME._objref_DataServerManager))
+assert(isinstance(dsm.getDefaultScope(),SALOME._objref_DataScopeServer))
+d2s=dsm.createDataScope("tonyy")
+assert(isinstance(d2s,SALOME._objref_DataScopeServer))
+a=d2s.createRdWrVar("str","c")
+assert(a.getVarName()=="c")
+#
+a.setSerializedContent(cPickle.dumps(st,cPickle.HIGHEST_PROTOCOL))
+assert(cPickle.loads(a.fetchSerializedContent())==st)
+assert(cPickle.loads(a.fetchSerializedContent())==st)
+assert(cPickle.loads(d2s.retrieveVar("c").fetchSerializedContent())==st)
+assert(isinstance(d2s.retrieveVar("c"),SALOME._objref_PickelizedPyObjRdWrServer))
+assert(dsm.listScopes()==['Default','tonyy'])
+dsm.createDataScope("S2")
+assert(dsm.retriveDataScope("S2").getScopeName()=="S2")
+assert(dsm.listScopes()==['Default','tonyy','S2'])
+dsm.removeDataScope("Default")
+assert(dsm.listScopes()==['tonyy','S2'])
+dsm.removeDataScope("tonyy")
+assert(dsm.listScopes()==['S2'])
+a=dsm.retriveDataScope("S2").createRdWrVar("int","a")
+#
+sname="S7"
+dsm=salome.naming_service.Resolve("/DataServerManager")
+st=cPickle.dumps([],cPickle.HIGHEST_PROTOCOL)
+a=dsm.giveADataScopeCalled(sname)[0].createRdWrVar("list","a")
+dsm.giveADataScopeCalled(sname)
+a.setSerializedContent(cPickle.dumps([0,],cPickle.HIGHEST_PROTOCOL))
+assert(cPickle.loads(a.fetchSerializedContent())==[0,])
+a.setSerializedContent(st)
+assert(cPickle.loads(a.fetchSerializedContent())==[])
+tmp=a.invokePythonMethodOn("append",cPickle.dumps((0,),cPickle.HIGHEST_PROTOCOL))
+assert(cPickle.loads(a.fetchSerializedContent())==[0])
+for i in xrange(0,1000):
+    tmp=a.invokePythonMethodOn("append",cPickle.dumps((i,),cPickle.HIGHEST_PROTOCOL))
+    pass
+dsm.removeDataScope(sname)
+#
+sname="S4"
+d2s,_=dsm.giveADataScopeCalled(sname)
+d2s.createRdWrVar("list","a")
+a=SalomeSDSClt.GetHandlerFromRef(dsm.retriveDataScope(sname).retrieveVar("a"))
+a.append(1)
+for i in xrange(1000):
+    a.append(i)
+    pass
+assert(sum(a.local_copy())==499501)
+assert(dsm.isAliveAndKicking(sname))
+#
+dsm=salome.naming_service.Resolve("/DataServerManager")
+sname="S11"
+d2s,_=dsm.giveADataScopeCalled(sname)
+d2s.createRdWrVar("dict","a")
+a=SalomeSDSClt.GetHandlerFromName(sname,"a")
+assert(isinstance(a,SalomeSDSClt.Dict))
+a.assign({})
+a["ab"]=45 ; gc.collect(0)
+a["cd"]=[4,5] ; gc.collect(0)
+a["cd"].append(77) ; gc.collect(0)
+a["cd"].append([4,7,8]) ; gc.collect(0)
+a["cd"][3].append(3) ; gc.collect(0)
+a["ab"]+=2
+assert(a.local_copy()=={'ab':47,'cd':[4,5,77,[4,7,8,3]]})
+a["ab"]-=1
+assert(a.local_copy()=={'ab':46,'cd':[4,5,77,[4,7,8,3]]})
+assert(len(a)==2)
+c=a["cd"] ; gc.collect(0)
+assert(isinstance(c,SalomeSDSClt.List))
+a["cd"]=26 ; gc.collect(0)
+assert(a.local_copy()=={'ab':46,'cd':26})
+a["cd"]=c
+assert(a.local_copy()=={'ab':46,'cd':[4,5,77,[4,7,8,3]]})
diff --git a/src/SALOMESDS/TestSalomeSDS2.py b/src/SALOMESDS/TestSalomeSDS2.py
new file mode 100644 (file)
index 0000000..d4222a9
--- /dev/null
@@ -0,0 +1,83 @@
+# -*- coding: utf-8 -*-
+# Copyright (C) 2007-2014  CEA/DEN, EDF R&D
+#
+# This library is free software; you can redistribute it and/or
+# modify it under the terms of the GNU Lesser General Public
+# License as published by the Free Software Foundation; either
+# version 2.1 of the License, or (at your option) any later version.
+#
+# This library is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the GNU
+# Lesser General Public License for more details.
+#
+# You should have received a copy of the GNU Lesser General Public
+# License along with this library; if not, write to the Free Software
+# Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA  02111-1307 USA
+#
+# See http://www.salome-platform.org/ or email : webmaster.salome@opencascade.com
+#
+# Author : Anthony Geay
+
+import SalomeSDSClt
+import SALOME
+import salome
+import unittest
+import gc
+
+class SalomeSDS2Test(unittest.TestCase):
+  
+  def testList1(self):
+    a=SalomeSDSClt.CreateRdExtGlobalVar([],"a","Scope0")
+    self.assertEqual(a.local_copy(),[])
+    a.append(5)
+    self.assertEqual(a.local_copy(),[5])
+    self.assertRaises(SALOME.SALOME_Exception,a.__delitem__,0)
+    a.append(["rt"])
+    self.assertEqual(a.local_copy(),[5,["rt"]])
+    a[1].append(8)
+    self.assertEqual(a.local_copy(),[5,["rt",8]])
+    a.extend(a)
+    self.assertEqual(a.local_copy(),[5,["rt",8],5,["rt",8]])
+    a.extend(a[3:])
+    self.assertEqual(a.local_copy(),[5,["rt",8],5,["rt",8],["rt",8]])
+    a[4].append(7)
+    self.assertEqual(a.local_copy(),[5,["rt",8],5,["rt",8],["rt",8,7]])
+    a._var_ptr.getMyDataScopeServer().deleteVar("a")
+    pass
+  
+  def testDict1(self):
+    a=SalomeSDSClt.CreateRdExtGlobalVar({},"a","Scope0")
+    a["ab"]=4
+    self.assertEqual(a.local_copy(),{"ab":4})
+    a["cd"]=[5]
+    self.assertEqual(a.local_copy(),{"ab":4,"cd":[5]})
+    a["cd"].append(77)
+    self.assertEqual(a.local_copy(),{"ab":4,"cd":[5,77]})
+    a.__setitem__("ef",["a","bb"])
+    self.assertEqual(a.local_copy(),{"ab":4,"cd":[5,77],"ef":["a","bb"]})
+    self.assertRaises(SALOME.SALOME_Exception,a.__setitem__,"ef",["a","bb"])
+    self.assertRaises(SALOME.SALOME_Exception,a.__setitem__,"ef",["a","bb","ccc"])
+    a["ef"].append("ccc")
+    self.assertEqual(a.local_copy(),{"ab":4,"cd":[5,77],"ef":["a","bb","ccc"]})
+    a["gh"]=a
+    self.assertEqual(a.local_copy(),{"ab":4,"cd":[5,77],"ef":["a","bb","ccc"],"gh":{"ab":4,"cd":[5,77],"ef":["a","bb","ccc"]}})
+    a["gh"]["cd"].append(99) ; a["cd"].append(88)
+    self.assertEqual(a.local_copy(),{"ab":4,"cd":[5,77,88],"ef":["a","bb","ccc"],"gh":{"ab":4,"cd":[5,77,99],"ef":["a","bb","ccc"]}})
+    a._var_ptr.getMyDataScopeServer().deleteVar("a")
+    pass
+
+  def testReadOnly1(self):
+    a=SalomeSDSClt.CreateRdOnlyGlobalVar({"ab":4,"cd":[5,77]},"a","Scope0")
+    self.assertEqual(a.local_copy(),{"ab":4,"cd":[5,77]})
+    self.assertRaises(AttributeError,a.__getitem__,"ab")
+    a._var_ptr.getMyDataScopeServer().deleteVar("a")
+
+  def setUp(self):
+    salome.salome_init()
+    pass
+  
+  pass
+
+unittest.main()
+