subblock.png \
group_new.png \
group_edit.png \
-glue.png
+glue.png \
+check_blocks_compound.png \
+free_faces.png \
+propagate.png
+
BIN_SCRIPT= \
VERSION
--- /dev/null
+# Doxyfile 1.3-rc1
+
+#---------------------------------------------------------------------------
+# General configuration options
+#---------------------------------------------------------------------------
+PROJECT_NAME = "SALOME - GEOM - v.2.1.0"
+PROJECT_NUMBER = id#1.1
+OUTPUT_DIRECTORY = ../
+OUTPUT_LANGUAGE = English
+EXTRACT_ALL = YES
+EXTRACT_PRIVATE = YES
+EXTRACT_STATIC = YES
+EXTRACT_LOCAL_CLASSES = YES
+HIDE_UNDOC_MEMBERS = NO
+HIDE_UNDOC_CLASSES = NO
+HIDE_FRIEND_COMPOUNDS = NO
+HIDE_IN_BODY_DOCS = NO
+BRIEF_MEMBER_DESC = YES
+REPEAT_BRIEF = NO
+ALWAYS_DETAILED_SEC = YES
+INLINE_INHERITED_MEMB = YES
+FULL_PATH_NAMES = NO
+STRIP_FROM_PATH =
+INTERNAL_DOCS = YES
+CASE_SENSE_NAMES = YES
+SHORT_NAMES = NO
+HIDE_SCOPE_NAMES = NO
+VERBATIM_HEADERS = YES
+SHOW_INCLUDE_FILES = YES
+JAVADOC_AUTOBRIEF = YES
+MULTILINE_CPP_IS_BRIEF = NO
+DETAILS_AT_TOP = NO
+INHERIT_DOCS = YES
+INLINE_INFO = YES
+SORT_MEMBER_DOCS = NO
+DISTRIBUTE_GROUP_DOC = NO
+TAB_SIZE = 5
+GENERATE_TODOLIST = YES
+GENERATE_TESTLIST = YES
+GENERATE_BUGLIST = YES
+GENERATE_DEPRECATEDLIST= YES
+ALIASES =
+ENABLED_SECTIONS =
+MAX_INITIALIZER_LINES = 25
+OPTIMIZE_OUTPUT_FOR_C = YES
+OPTIMIZE_OUTPUT_JAVA = YES
+SHOW_USED_FILES = NO
+#---------------------------------------------------------------------------
+# configuration options related to warning and progress messages
+#---------------------------------------------------------------------------
+QUIET = NO
+WARNINGS = YES
+WARN_IF_UNDOCUMENTED = YES
+WARN_FORMAT = "$file:$line: $text"
+WARN_LOGFILE = log.txt
+#---------------------------------------------------------------------------
+# configuration options related to the input files
+#---------------------------------------------------------------------------
+INPUT = list_py_files_to_process
+FILE_PATTERNS =
+RECURSIVE = NO
+EXCLUDE =
+EXCLUDE_SYMLINKS = NO
+EXCLUDE_PATTERNS =
+EXAMPLE_PATH =
+EXAMPLE_PATTERNS =
+EXAMPLE_RECURSIVE = NO
+IMAGE_PATH = ../sources/
+INPUT_FILTER =
+FILTER_SOURCE_FILES = YES
+#---------------------------------------------------------------------------
+# configuration options related to source browsing
+#---------------------------------------------------------------------------
+SOURCE_BROWSER = NO
+INLINE_SOURCES = NO
+STRIP_CODE_COMMENTS = YES
+REFERENCED_BY_RELATION = NO
+REFERENCES_RELATION = YES
+#---------------------------------------------------------------------------
+# configuration options related to the alphabetical class index
+#---------------------------------------------------------------------------
+ALPHABETICAL_INDEX = NO
+COLS_IN_ALPHA_INDEX = 5
+IGNORE_PREFIX =
+#---------------------------------------------------------------------------
+# configuration options related to the HTML output
+#---------------------------------------------------------------------------
+GENERATE_HTML = YES
+HTML_OUTPUT = ../GEOM/geompy_doc
+HTML_FILE_EXTENSION = .html
+HTML_HEADER = ../sources/myheader_py2.html
+HTML_FOOTER =
+HTML_STYLESHEET =
+HTML_ALIGN_MEMBERS = YES
+GENERATE_HTMLHELP = NO
+CHM_FILE =
+HHC_LOCATION =
+GENERATE_CHI = NO
+BINARY_TOC = YES
+TOC_EXPAND = YES
+DISABLE_INDEX = YES
+ENUM_VALUES_PER_LINE = 4
+GENERATE_TREEVIEW = YES
+TREEVIEW_WIDTH = 250
+#---------------------------------------------------------------------------
+# configuration options related to the LaTeX output
+#---------------------------------------------------------------------------
+GENERATE_LATEX = NO
+LATEX_OUTPUT = latex
+LATEX_CMD_NAME = latex
+MAKEINDEX_CMD_NAME = makeindex
+COMPACT_LATEX = NO
+PAPER_TYPE = a4wide
+EXTRA_PACKAGES =
+LATEX_HEADER =
+PDF_HYPERLINKS = NO
+USE_PDFLATEX = NO
+LATEX_BATCHMODE = NO
+#---------------------------------------------------------------------------
+# configuration options related to the RTF output
+#---------------------------------------------------------------------------
+GENERATE_RTF = NO
+RTF_OUTPUT = rtf
+COMPACT_RTF = NO
+RTF_HYPERLINKS = NO
+RTF_STYLESHEET_FILE =
+RTF_EXTENSIONS_FILE =
+#---------------------------------------------------------------------------
+# configuration options related to the man page output
+#---------------------------------------------------------------------------
+GENERATE_MAN = NO
+MAN_OUTPUT = man
+MAN_EXTENSION = .3
+MAN_LINKS = NO
+#---------------------------------------------------------------------------
+# configuration options related to the XML output
+#---------------------------------------------------------------------------
+GENERATE_XML = NO
+XML_SCHEMA =
+XML_DTD =
+#---------------------------------------------------------------------------
+# configuration options for the AutoGen Definitions output
+#---------------------------------------------------------------------------
+GENERATE_AUTOGEN_DEF = NO
+#---------------------------------------------------------------------------
+# configuration options related to the Perl module output
+#---------------------------------------------------------------------------
+GENERATE_PERLMOD = NO
+PERLMOD_LATEX = NO
+PERLMOD_PRETTY = YES
+PERLMOD_MAKEVAR_PREFIX =
+#---------------------------------------------------------------------------
+# Configuration options related to the preprocessor
+#---------------------------------------------------------------------------
+ENABLE_PREPROCESSING = YES
+MACRO_EXPANSION = YES
+EXPAND_ONLY_PREDEF = NO
+SEARCH_INCLUDES = YES
+INCLUDE_PATH =
+INCLUDE_FILE_PATTERNS =
+PREDEFINED =
+EXPAND_AS_DEFINED =
+SKIP_FUNCTION_MACROS = NO
+#---------------------------------------------------------------------------
+# Configuration::addtions related to external references
+#---------------------------------------------------------------------------
+TAGFILES =
+GENERATE_TAGFILE =
+ALLEXTERNALS = NO
+EXTERNAL_GROUPS = YES
+PERL_PATH = /usr/bin/perl
+#---------------------------------------------------------------------------
+# Configuration options related to the dot tool
+#---------------------------------------------------------------------------
+CLASS_DIAGRAMS = YES
+HIDE_UNDOC_RELATIONS = NO
+HAVE_DOT = YES
+CLASS_GRAPH = YES
+COLLABORATION_GRAPH = NO
+TEMPLATE_RELATIONS = YES
+INCLUDE_GRAPH = YES
+INCLUDED_BY_GRAPH = NO
+GRAPHICAL_HIERARCHY = YES
+DOT_IMAGE_FORMAT = jpg
+DOT_PATH =
+DOTFILE_DIRS =
+MAX_DOT_GRAPH_WIDTH = 1024
+MAX_DOT_GRAPH_HEIGHT = 1200
+GENERATE_LEGEND = NO
+DOT_CLEANUP = YES
+#---------------------------------------------------------------------------
+# Configuration::addtions related to the search engine
+#---------------------------------------------------------------------------
+SEARCHENGINE = NO
+CGI_NAME = search.cgi
+CGI_URL =
+DOC_URL =
+DOC_ABSPATH =
+BIN_ABSPATH = /usr/local/bin/
+EXT_DOC_PATHS =
--- /dev/null
+<!doctype html public "-//w3c//dtd html 4.0 transitional//en">
+<html>
+<head>
+ <meta http-equiv="Content-Type" content="text/html; charset=iso-8859-1">
+ <meta name="GENERATOR" content="Mozilla/4.73 [en] (WinNT; I) [Netscape]">
+ <title>Main Page</title>
+<link href="doxygen.css" rel="stylesheet" type="text/css">
+</head>
+<body>
+
+<center><table WIDTH="96%" >
+<tr>
+<td><a href="http://www.opencascade.com"><img src="../sources/logocorp.gif" BORDER=0 height=46 width=122></a></td>
+
+
+<td>
+<div align=right><a href="http://www.opencascade.org/SALOME/"><img src="../sources/application.gif" BORDER=0 height=46 width=108></a></div>
+</td>
+</tr>
+</table></center>
+
+
+</body>
+</html>
aux1 = insFld(foldersTree, gFld("IDL/Python mapping", ""))
insDoc(aux1, gLnk("Mapping of GEOMETRY IDL definitions to Python language", "", "page2.html"))
+/*!aux1 = insFld(foldersTree, gFld("Python Commands", "", "geompy_doc/main.html"))
+ insDoc(aux1, gLnk("Package geompy", "", "geompy_doc/namespacegeompy.html"))
+ insDoc(aux1, gLnk("Namespace Members", "", "geompy_doc/namespacemembers.html"))
+ insDoc(aux1, gLnk("File geompy.py", "", "geompy_doc/geompy_8py.html"))
+*/
+
+aux1 = insFld(foldersTree, gFld("Python Commands", "", "geompy_doc/main.html"))
+ insDoc(aux1, gLnk("Package List", "", "geompy_doc/namespaces.html"))
+ insDoc(aux1, gLnk("Namespace Members", "", "geompy_doc/namespacemembers.html"))
+ insDoc(aux1, gLnk("File List", "", "geompy_doc/files.html"))
+
/*! insDoc(foldersTree, gLnk("Graphical Class Hierarchy", "", "inherits.html"))
*/
@COMMENCE@
+PYTHON_SCRIPTS = \
+ geompy.py \
+ GEOM_TestMeasures.py
+
+#PYTHON_SCRIPTS_PY2 = py2/geompy.py py2/GEOM_TestMeasures.py
+
docs:
- cp -fr $(srcdir)/GEOM ./INPUT; \
+ cp -fr $(srcdir)/GEOM ./INPUT
cd INPUT; \
sed 's|../../../share/salome|$(root_srcdir)|' ./doxyfile > ./doxyfile1; \
mv -f doxyfile1 doxyfile; \
$(doxygen) ./doxyfile; \
- cd ..; \
+ mkdir py1; mkdir py2; \
+ cd ..
+ for file in $(PYTHON_SCRIPTS) dummy; do \
+ if [ $$file != "dummy" ]; then \
+ cp $(root_srcdir)/src/GEOM_SWIG/$$file INPUT/py1/; \
+ fi ; \
+ done
+ cd INPUT; \
+ python $(KERNEL_ROOT_DIR)/doc/salome/tui/KERNEL/pythfilter.py ./py1 ./py2; \
+ sed 's|list_py_files_to_process|$(PYTHON_SCRIPTS)|' ./doxyfile_py > py2/doxyfile_py; \
+ cd py2; \
+ $(doxygen) ./doxyfile_py; \
+ cd ../..; \
cp -fr $(srcdir)/GEOM/sources/static/*.* ./GEOM/
cp -fr $(srcdir)/GEOM/sources/ GEOM/
cp -fr $(srcdir)/GEOM/HTML/ GEOM/
in long theShapeType,
in boolean isSorted);
+ /*!
+ * Explode a shape on subshapes of a given type.
+ * Does the same, as the above method, but returns IDs of sub-shapes,
+ * not GEOM_Objects. It works faster.
+ * \param theShape Shape to be exploded.
+ * \param theShapeType Type of sub-shapes to be retrieved.
+ * \param isSorted If this parameter is TRUE, sub-shapes will be
+ * sorted by coordinates of their gravity centers.
+ * \return List of IDs of sub-shapes of type theShapeType, contained in theShape.
+ */
+ ListOfLong SubShapeAllIDs (in GEOM_Object theShape,
+ in long theShapeType,
+ in boolean isSorted);
+
/*!
* Get a sub shape defined by its unique ID inside \a theMainShape
* \note The sub shape GEOM_Objects can has ONLY ONE function.
* \return The reversed copy of theShape.
*/
GEOM_Object ChangeOrientation (in GEOM_Object theShape);
+
+ /*!
+ * Retrieve all free faces from the given shape.
+ * Free face is a face, which is not shared between two shells of the shape.
+ * \param theShape Shape to find free faces in.
+ * \return List of IDs of all free faces, contained in theShape.
+ */
+ ListOfLong GetFreeFacesIDs (in GEOM_Object theShape);
+
+ /*!
+ * Get all sub-shapes of theShape1 of the given type, shared with theShape2.
+ * \param theShape1 Shape to find sub-shapes in.
+ * \param theShape2 Shape to find shared sub-shapes with.
+ * \param theShapeType Type of sub-shapes to be retrieved.
+ * \return List of sub-shapes of theShape1, shared with theShape2.
+ */
+ ListOfGO GetSharedShapes (in GEOM_Object theShape1,
+ in GEOM_Object theShape2,
+ in long theShapeType);
+
+ /*!
+ * Get sub-shapes of theShape of the given type,
+ * laying on the specified plane.
+ * \param theShape Shape to find sub-shapes of.
+ * \param theShapeType Type of sub-shapes to be retrieved.
+ * \param thePlane Face, specifying the plane to find shapes on.
+ * \return Group of all found sub-shapes.
+ */
+ GEOM_Object GetShapesOnPlane (in GEOM_Object theShape,
+ in long theShapeType,
+ in GEOM_Object thePlane);
+
+ /*!
+ * Get sub-shape of theShape of the given type,
+ * laying on the specified cylinder.
+ * \param theShape Shape to find sub-shapes of.
+ * \param theShapeType Type of sub-shapes to be retrieved.
+ * \param theAxis Vector (or line, or linear edge), specifying
+ * axis of the cylinder to find shapes on.
+ * \param theRadius Radius of the cylinder to find shapes on.
+ * \return Group of all found sub-shapes.
+ */
+ GEOM_Object GetShapesOnCylinder (in GEOM_Object theShape,
+ in long theShapeType,
+ in GEOM_Object theAxis,
+ in double theRadius);
+
+ /*!
+ * Get sub-shape of theShape of the given type,
+ * laying on the specified sphere.
+ * \param theShape Shape to find sub-shapes of.
+ * \param theShapeType Type of sub-shapes to be retrieved.
+ * \param theCenter Point, specifying center of the sphere to find shapes on.
+ * \param theRadius Radius of the sphere to find shapes on.
+ * \return Group of all found sub-shapes.
+ */
+ GEOM_Object GetShapesOnSphere (in GEOM_Object theShape,
+ in long theShapeType,
+ in GEOM_Object theCenter,
+ in double theRadius);
+
+ /*!
+ * Get sub-shape(s) of theShapeWhere, which are
+ * coincident with \a theShapeWhat or could be a part of it.
+ * \param theShapeWhere Shape to find sub-shapes of.
+ * \param theShapeWhat Shape, specifying what to find.
+ * \return Group of all found sub-shapes or a single found sub-shape.
+ */
+ GEOM_Object GetInPlace (in GEOM_Object theShapeWhere,
+ in GEOM_Object theShapeWhat);
};
/*!
*/
enum BCErrorType
{
- NOT_BLOCK, /* Each element of the compound should be a Block */
- INVALID_CONNECTION, /* A connection between two Blocks should be an entire face or an entire edge */
- NOT_CONNECTED, /* The compound should be connexe */
- NOT_GLUED /* The glue between two quadrangle faces should be applied */
+ /* Each element of the compound should be a Block */
+ NOT_BLOCK,
+
+ /* An element is a potential block, but has degenerated and/or seam edge(s). */
+ EXTRA_EDGE,
+
+ /* A connection between two Blocks should be an entire face or an entire edge */
+ INVALID_CONNECTION,
+
+ /* The compound should be connexe */
+ NOT_CONNECTED,
+
+ /* The glue between two quadrangle faces should be applied */
+ NOT_GLUED
};
/*!
* - A connection between two Blocks should be an entire quadrangle face or an entire edge.
* - The compound should be connexe.
* - The glue between two quadrangle faces should be applied.
+ * \note Single block is also accepted as a valid compound of blocks.
* \param theCompound The compound to check.
* \return TRUE, if the given shape is a compound of blocks.
* \return theErrors Structure, containing discovered errors and incriminated sub-shapes.
string PrintBCErrors (in GEOM_Object theCompound,
in BCErrors theErrors);
+ /*!
+ * Remove all seam and degenerated edges from \a theShape.
+ * Unite faces and edges, sharing one surface.
+ * \param theShape The compound or single solid to remove irregular edges from.
+ * \return Improved shape.
+ */
+ GEOM_Object RemoveExtraEdges (in GEOM_Object theShape);
+
+ /*!
+ * Check, if the given shape is a blocks compound.
+ * Fix all detected errors.
+ * \note Single block can be also fixed by this method.
+ * \param theCompound The compound to check and improve.
+ * \return Improved compound.
+ */
+ GEOM_Object CheckAndImprove (in GEOM_Object theCompound);
+
/*!
* Get all the blocks, contained in the given compound.
* \param theCompound The compound to explode.
in long theDirFace1V,
in long theDirFace2V,
in long theNbTimesV);
+
+ /*!
+ * Special operation - propagation
+ */
+
+ /*!
+ * Build all possible propagation groups.
+ * Propagation group is a set of all edges, opposite to one (main)
+ * edge of this group directly or through other opposite edges.
+ * Notion of Opposite Edge make sence only on quadrangle face.
+ * \param theShape Shape to build propagation groups on.
+ * \return List of GEOM_Objects, each of them is a propagation group.
+ */
+ ListOfGO Propagate (in GEOM_Object theShape);
};
/*!
<endsubmenu />
<submenu label-id="Generation" item-id="403" pos-id="3">
<popup-item item-id="4031" pos-id="" label-id="Extrusion" icon-id="prism.png" tooltip-id="" accel-id="" toggle-id="" execute-action=""/>
- <popup-item item-id="4032" pos-id="" label-id="Revolution" icon-id="revol.png"tooltip-id="" accel-id="" toggle-id="" execute-action=""/>
+ <popup-item item-id="4032" pos-id="" label-id="Revolution" icon-id="revol.png" tooltip-id="" accel-id="" toggle-id="" execute-action=""/>
<popup-item item-id="4033" pos-id="" label-id="Filling" icon-id="filling.png" tooltip-id="" accel-id="" toggle-id="" execute-action=""/>
<popup-item item-id="4034" pos-id="" label-id="Pipe creation" icon-id="pipe.png" tooltip-id="" accel-id="" toggle-id="" execute-action=""/>
</submenu>
<popup-item item-id="5011" pos-id="" label-id="Fuse" icon-id="fuse.png" tooltip-id="" accel-id="" toggle-id="" execute-action=""/>
<popup-item item-id="5012" pos-id="" label-id="Common" icon-id="common.png" tooltip-id="" accel-id="" toggle-id="" execute-action=""/>
<popup-item item-id="5013" pos-id="" label-id="Cut" icon-id="cut.png" tooltip-id="" accel-id="" toggle-id="" execute-action=""/>
- <popup-item item-id="5014" pos-id="" label-id="Section" icon-id="section.png"tooltip-id="" accel-id="" toggle-id="" execute-action=""/>
+ <popup-item item-id="5014" pos-id="" label-id="Section" icon-id="section.png" tooltip-id="" accel-id="" toggle-id="" execute-action=""/>
</submenu>
<endsubmenu />
<submenu label-id="Transformation" item-id="502" pos-id="2">
<submenu label-id="Blocks" item-id="510" pos-id="">
<popup-item item-id="9998" pos-id="" label-id="Multi-transformation" icon-id="multirotation.png" tooltip-id="" accel-id="" toggle-id="" execute-action=""/>
<popup-item item-id="9995" pos-id="" label-id="Explode on Blocks" icon-id="subshape.png" tooltip-id="" accel-id="" toggle-id="" execute-action=""/>
+ <popup-item item-id="99991" pos-id="" label-id="Propagate" icon-id="propagate.png" tooltip-id="" accel-id="" toggle-id="" execute-action=""/>
</submenu>
<endsubmenu />
<popup-item item-id="602" pos-id="" label-id="Glue faces" icon-id="glue.png" tooltip-id="" accel-id="" toggle-id="" execute-action=""/>
<popup-item item-id="608" pos-id="" label-id="Add point on edge" icon-id="pointonedge.png" tooltip-id="" accel-id="" toggle-id="" execute-action=""/>
<popup-item item-id="609" pos-id="" label-id="Check free boundaries" icon-id="free_bound.png" tooltip-id="" accel-id="" toggle-id="" execute-action=""/>
+ <popup-item item-id="610" pos-id="" label-id="Check free faces" icon-id="free_faces.png" tooltip-id="" accel-id="" toggle-id="" execute-action=""/>
</menu-item>
<separator pos-id=""/>
<popup-item item-id="706" pos-id="" label-id="Whatis" icon-id="whatis.png" tooltip-id="" accel-id="" toggle-id="" execute-action=""/>
<popup-item item-id="707" pos-id="" label-id="Check" icon-id="check.png" tooltip-id="" accel-id="" toggle-id="" execute-action=""/>
+ <popup-item item-id="7072" pos-id="" label-id="Check Compound of Blocks" icon-id="check_blocks_compound.png" tooltip-id="" accel-id="" toggle-id="" execute-action=""/>
</menu-item>
<!-- ********************************* Tools (menubar) ************************************ -->
</toolbar>
<toolbar label-id="Transformation">
- <toolbutton-item item-id="5021" label-id="Translation" icon-id="translationVector.png" tooltip-id="Translate a shape"accel-id="" toggle-id="" execute-action=""/>
+ <toolbutton-item item-id="5021" label-id="Translation" icon-id="translationVector.png" tooltip-id="Translate a shape" accel-id="" toggle-id="" execute-action=""/>
<toolbutton-item item-id="5022" label-id="Rotation" icon-id="rotate.png" tooltip-id="Rotate a shape" accel-id="" toggle-id="" execute-action=""/>
<toolbutton-item item-id="5023" label-id="Location" icon-id="position2.png" tooltip-id="Modify The Location" accel-id="" toggle-id="" execute-action=""/>
<toolbutton-item item-id="5024" label-id="Mirror image" icon-id="mirrorPlane.png" tooltip-id="Mirror a shape" accel-id="" toggle-id="" execute-action=""/>
<endsubmenu />
<submenu label-id="Generation" item-id="403" pos-id="3">
<popup-item item-id="4031" pos-id="" label-id="Extrusion" icon-id="prism.png" tooltip-id="" accel-id="" toggle-id="" execute-action=""/>
- <popup-item item-id="4032" pos-id="" label-id="Revolution" icon-id="revol.png"tooltip-id="" accel-id="" toggle-id="" execute-action=""/>
+ <popup-item item-id="4032" pos-id="" label-id="Revolution" icon-id="revol.png" tooltip-id="" accel-id="" toggle-id="" execute-action=""/>
<popup-item item-id="4033" pos-id="" label-id="Filling" icon-id="filling.png" tooltip-id="" accel-id="" toggle-id="" execute-action=""/>
<popup-item item-id="4034" pos-id="" label-id="Pipe" icon-id="pipe.png" tooltip-id="" accel-id="" toggle-id="" execute-action=""/>
</submenu>
<popup-item item-id="5011" pos-id="" label-id="Union" icon-id="fuse.png" tooltip-id="" accel-id="" toggle-id="" execute-action=""/>
<popup-item item-id="5012" pos-id="" label-id="Commun" icon-id="common.png" tooltip-id="" accel-id="" toggle-id="" execute-action=""/>
<popup-item item-id="5013" pos-id="" label-id="Couper" icon-id="cut.png" tooltip-id="" accel-id="" toggle-id="" execute-action=""/>
- <popup-item item-id="5014" pos-id="" label-id="Section" icon-id="section.png"tooltip-id="" accel-id="" toggle-id="" execute-action=""/>
+ <popup-item item-id="5014" pos-id="" label-id="Section" icon-id="section.png" tooltip-id="" accel-id="" toggle-id="" execute-action=""/>
</submenu>
<endsubmenu />
<submenu label-id="Transformation" item-id="502" pos-id="2">
<separator pos-id=""/>
<popup-item item-id="505" pos-id="" label-id="Congé" icon-id="fillet.png" tooltip-id="" accel-id="" toggle-id="" execute-action=""/>
<popup-item item-id="506" pos-id="" label-id="Chanfrein" icon-id="chamfer.png" tooltip-id="" accel-id="" toggle-id="" execute-action=""/>
+ <separator pos-id=""/>
+ <submenu label-id="Blocks" item-id="510" pos-id="">
+ <popup-item item-id="9998" pos-id="" label-id="Multi-transformation" icon-id="multirotation.png" tooltip-id="" accel-id="" toggle-id="" execute-action=""/>
+ <popup-item item-id="9995" pos-id="" label-id="Explode on Blocks" icon-id="subshape.png" tooltip-id="" accel-id="" toggle-id="" execute-action=""/>
+ <popup-item item-id="99991" pos-id="" label-id="Propagate" icon-id="propagate.png" tooltip-id="" accel-id="" toggle-id="" execute-action=""/>
+ </submenu>
+ <endsubmenu />
</menu-item>
<popup-item item-id="602" pos-id="" label-id="Orientation" icon-id="orientation.png" tooltip-id="" accel-id="" toggle-id="" execute-action=""/>
<popup-item item-id="603" pos-id="" label-id="Suppression de faces" icon-id="supressface.png" tooltip-id="" accel-id="" toggle-id="" execute-action=""/>
<popup-item item-id="604" pos-id="" label-id="Suppression de trou" icon-id="supresshole.png" tooltip-id="" accel-id="" toggle-id="" execute-action=""/>
+ <popup-item item-id="610" pos-id="" label-id="Check free faces" icon-id="free_faces.png" tooltip-id="" accel-id="" toggle-id="" execute-action=""/>
</menu-item>
<separator pos-id=""/>
<popup-item item-id="706" pos-id="" label-id="Whatis" icon-id="whatis.png" tooltip-id="" accel-id="" toggle-id="" execute-action=""/>
<popup-item item-id="707" pos-id="" label-id="Check" icon-id="check.png" tooltip-id="" accel-id="" toggle-id="" execute-action=""/>
+ <popup-item item-id="7072" pos-id="" label-id="Check Compound of Blocks" icon-id="check_blocks_compound.png" tooltip-id="" accel-id="" toggle-id="" execute-action=""/>
</menu-item>
<!-- ********************************* Tools (menubar) ************************************ -->
</toolbar>
<toolbar label-id="Transformation">
- <toolbutton-item item-id="5021" label-id="Translation" icon-id="translationVector.png" tooltip-id="Translation d'une shape"accel-id="" toggle-id="" execute-action=""/>
+ <toolbutton-item item-id="5021" label-id="Translation" icon-id="translationVector.png" tooltip-id="Translation d'une shape" accel-id="" toggle-id="" execute-action=""/>
<toolbutton-item item-id="5022" label-id="Rotation" icon-id="rotate.png" tooltip-id="Rotation d'une shape" accel-id="" toggle-id="" execute-action=""/>
<toolbutton-item item-id="5023" label-id="Location" icon-id="position2.png" tooltip-id="Mise en position" accel-id="" toggle-id="" execute-action=""/>
<toolbutton-item item-id="5024" label-id="Symétrie" icon-id="mirrorPlane.png" tooltip-id="Symétrie" accel-id="" toggle-id="" execute-action=""/>
#include "BlocksGUI_TrsfDlg.h"
//#include "BlocksGUI_CheckMultiBlockDlg.h"
#include "BlocksGUI_ExplodeDlg.h"
+#include "BlocksGUI_PropagateDlg.h"
#include "SALOMEGUI_QtCatchCorbaException.hxx"
case 9995:
aDlg = new BlocksGUI_ExplodeDlg (parent, Sel);
break;
+ case 99991:
+ aDlg = new BlocksGUI_PropagateDlg (parent, "", Sel);
+ break;
default:
parent->putInfo(tr("GEOM_PRP_COMMAND").arg(theCommandID));
--- /dev/null
+// GEOM GEOMGUI : GUI for Geometry component
+//
+// Copyright (C) 2003 OPEN CASCADE, EADS/CCR, LIP6, CEA/DEN,
+// CEDRAT, EDF R&D, LEG, PRINCIPIA R&D, BUREAU VERITAS
+//
+// This library is free software; you can redistribute it and/or
+// modify it under the terms of the GNU Lesser General Public
+// License as published by the Free Software Foundation; either
+// version 2.1 of the License.
+//
+// This library is distributed in the hope that it will be useful,
+// but WITHOUT ANY WARRANTY; without even the implied warranty of
+// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU
+// Lesser General Public License for more details.
+//
+// You should have received a copy of the GNU Lesser General Public
+// License along with this library; if not, write to the Free Software
+// Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307 USA
+//
+// See http://www.opencascade.org/SALOME/ or email : webmaster.salome@opencascade.org
+//
+//
+//
+// File : BlocksGUI_PropagateDlg.cxx
+// Author : VKN
+// Module : GEOM
+// $Header$
+
+using namespace std;
+#include "BlocksGUI_PropagateDlg.h"
+
+#include "QAD_Desktop.h"
+#include "GEOMImpl_Types.hxx"
+
+
+//=================================================================================
+// class : BlocksGUI_PropagateDlg()
+// purpose : Constructs a BlocksGUI_PropagateDlg which is a child of 'parent', with the
+// name 'name' and widget flags set to 'f'.
+// The dialog will by default be modeless, unless you set 'modal' to
+// TRUE to construct a modal dialog.
+//=================================================================================
+BlocksGUI_PropagateDlg::BlocksGUI_PropagateDlg(QWidget* parent, const char* name, SALOME_Selection* Sel, bool modal, WFlags fl)
+ :GEOMBase_Skeleton(parent, name, Sel, modal, WStyle_Customize | WStyle_NormalBorder | WStyle_Title | WStyle_SysMenu)
+{
+ QPixmap image0(QAD_Desktop::getResourceManager()->loadPixmap("GEOM",tr("ICON_DLG_PROPAGATE")));
+ QPixmap image1(QAD_Desktop::getResourceManager()->loadPixmap("GEOM",tr("ICON_SELECT")));
+
+ setCaption(tr("GEOM_PROPAGATE_TITLE"));
+
+ /***************************************************************/
+ GroupConstructors->setTitle(tr("GEOM_PROPAGATE_TITLE"));
+ RadioButton1->setPixmap(image0);
+ RadioButton2->close(TRUE);
+ RadioButton3->close(TRUE);
+
+ QGroupBox* aMainGrp = new QGroupBox( 1, Qt::Horizontal, tr( "GEOM_SELECTED_SHAPE" ), this );
+ QGroupBox* aSelGrp = new QGroupBox(3, Qt::Horizontal, aMainGrp);
+ aSelGrp->setFrameStyle(QFrame::NoFrame);
+ aSelGrp->setInsideMargin(0);
+
+ new QLabel(tr("GEOM_OBJECT"), aSelGrp);
+ mySelBtn = new QPushButton(aSelGrp);
+ mySelBtn->setPixmap(image1);
+ mySelName = new QLineEdit(aSelGrp);
+ mySelName->setReadOnly(true);
+
+ Layout1->addWidget(aMainGrp, 1, 0);
+
+ /***************************************************************/
+
+ Init();
+}
+
+
+//=================================================================================
+// function : ~BlocksGUI_PropagateDlg()
+// purpose : Destroys the object and frees any allocated resources
+//=================================================================================
+BlocksGUI_PropagateDlg::~BlocksGUI_PropagateDlg()
+{
+}
+
+
+//=================================================================================
+// function : Init()
+// purpose :
+//=================================================================================
+void BlocksGUI_PropagateDlg::Init()
+{
+ /* init variables */
+
+ myObject = GEOM::GEOM_Object::_nil();
+ ResultName->setText( "" );
+
+ myGeomGUI->SetState( 0 );
+
+ /* signals and slots connections */
+ connect(buttonCancel, SIGNAL(clicked()), this, SLOT(ClickOnCancel()));
+ connect(myGeomGUI, SIGNAL(SignalDeactivateActiveDialog()), this, SLOT(DeactivateActiveDialog()));
+ connect(myGeomGUI, SIGNAL(SignalCloseAllDialogs()), this, SLOT(ClickOnCancel()));
+
+ connect(buttonOk, SIGNAL(clicked()), this, SLOT(ClickOnOk()));
+ connect(buttonApply, SIGNAL(clicked()), this, SLOT(ClickOnApply()));
+
+ connect(mySelBtn, SIGNAL(clicked()), this, SLOT(SetEditCurrentArgument()));
+ connect(mySelName, SIGNAL(returnPressed()), this, SLOT(LineEditReturnPressed()));
+
+ activateSelection();
+}
+
+
+//=================================================================================
+// function : ClickOnOk()
+// purpose : Same than click on apply but close this dialog.
+//=================================================================================
+void BlocksGUI_PropagateDlg::ClickOnOk()
+{
+ if ( ClickOnApply() )
+ ClickOnCancel();
+}
+
+
+
+//=================================================================================
+// function : ClickOnApply()
+// purpose :
+//=================================================================================
+bool BlocksGUI_PropagateDlg::ClickOnApply()
+{
+ if ( !onAccept() )
+ return false;
+
+ initName();
+
+ mySelName->setText("");
+ myObject = GEOM::GEOM_Object::_nil();
+
+ activateSelection();
+
+ return true;
+}
+
+
+//=================================================================================
+// function : ClickOnCancel()
+// purpose :
+//=================================================================================
+void BlocksGUI_PropagateDlg::ClickOnCancel()
+{
+ GEOMBase_Skeleton::ClickOnCancel();
+}
+
+
+//=================================================================================
+// function : SelectionIntoArgument()
+// purpose : Called when selection
+//=================================================================================
+void BlocksGUI_PropagateDlg::SelectionIntoArgument()
+{
+ mySelName->setText("");
+ myObject = GEOM::GEOM_Object::_nil();
+
+ if ( mySelection->IObjectCount() == 1 ) {
+ Handle(SALOME_InteractiveObject) anIO = mySelection->firstIObject();
+ Standard_Boolean aRes;
+ myObject = GEOMBase::ConvertIOinGEOMObject( anIO, aRes );
+ if ( aRes )
+ mySelName->setText( GEOMBase::GetName( myObject ) );
+ }
+}
+
+//=================================================================================
+// function : SetEditCurrentArgument()
+// purpose :
+//=================================================================================
+void BlocksGUI_PropagateDlg::SetEditCurrentArgument()
+{
+ const QObject* send = sender();
+ if ( send == mySelBtn ) {
+ mySelName->setFocus();
+ }
+ activateSelection();
+}
+
+
+//=================================================================================
+// function : LineEditReturnPressed()
+// purpose :
+//=================================================================================
+void BlocksGUI_PropagateDlg::LineEditReturnPressed()
+{
+ const QObject* send = sender();
+ if( send == mySelName ) {
+ GEOMBase_Skeleton::LineEditReturnPressed();
+ }
+}
+
+
+//=================================================================================
+// function : DeactivateActiveDialog()
+// purpose :
+//=================================================================================
+void BlocksGUI_PropagateDlg::DeactivateActiveDialog()
+{
+ myGeomGUI->SetState( -1 );
+ GEOMBase_Skeleton::DeactivateActiveDialog();
+}
+
+
+//=================================================================================
+// function : ActivateThisDialog()
+// purpose :
+//=================================================================================
+void BlocksGUI_PropagateDlg::ActivateThisDialog()
+{
+ GEOMBase_Skeleton::ActivateThisDialog();
+
+ mySelName->setText("");
+ myObject = GEOM::GEOM_Object::_nil();
+
+ myGeomGUI->SetState( 0 );
+ activateSelection();
+}
+
+
+//=================================================================================
+// function : enterEvent()
+// purpose : Mouse enter onto the dialog to activate it
+//=================================================================================
+void BlocksGUI_PropagateDlg::enterEvent(QEvent* e)
+{
+ if ( !GroupConstructors->isEnabled() )
+ ActivateThisDialog();
+}
+
+
+//=================================================================================
+// function : closeEvent()
+// purpose :
+//=================================================================================
+void BlocksGUI_PropagateDlg::closeEvent(QCloseEvent* e)
+{
+ myGeomGUI->SetState( -1 );
+ GEOMBase_Skeleton::closeEvent( e );
+}
+
+//=================================================================================
+// function : createOperation
+// purpose :
+//=================================================================================
+GEOM::GEOM_IOperations_ptr BlocksGUI_PropagateDlg::createOperation()
+{
+ return getGeomEngine()->GetIBlocksOperations( getStudyId() );
+}
+
+//=================================================================================
+// function : isValid
+// purpose :
+//=================================================================================
+bool BlocksGUI_PropagateDlg::isValid( QString& msg )
+{
+ return !myObject->_is_nil() ;
+}
+
+//=================================================================================
+// function : execute
+// purpose :
+//=================================================================================
+bool BlocksGUI_PropagateDlg::execute( ObjectList& objects )
+{
+
+ GEOM::ListOfGO_var aList = GEOM::GEOM_IBlocksOperations::_narrow( getOperation() )->Propagate( myObject );
+ ResultName->setText( "" );
+
+ if ( !aList->length() )
+ return false;
+
+ for ( int i = 0, n = aList->length(); i < n; i++ )
+ {
+ objects.push_back(aList[i]._retn());
+ }
+
+ return objects.size() ? true : false;
+}
+
+//=================================================================================
+// function : activateSelection
+// purpose : Activate selection
+//=================================================================================
+void BlocksGUI_PropagateDlg::activateSelection()
+{
+ TColStd_MapOfInteger aMap;
+ aMap.Add( GEOM_SOLID );
+ aMap.Add( GEOM_COMPOUND );
+ globalSelection( aMap );
+ if (myObject->_is_nil()) {
+ SelectionIntoArgument();
+ }
+ connect(mySelection, SIGNAL(currentSelectionChanged()), this, SLOT(SelectionIntoArgument()));
+}
+
+//================================================================
+// Function : getFather
+// Purpose : Get father object for object to be added in study
+// ( called with addInStudy method )
+//================================================================
+GEOM::GEOM_Object_ptr BlocksGUI_PropagateDlg::getFather (GEOM::GEOM_Object_ptr)
+{
+ return myObject;
+}
+
--- /dev/null
+// GEOM GEOMGUI : GUI for Geometry component
+//
+// Copyright (C) 2003 OPEN CASCADE, EADS/CCR, LIP6, CEA/DEN,
+// CEDRAT, EDF R&D, LEG, PRINCIPIA R&D, BUREAU VERITAS
+//
+// This library is free software; you can redistribute it and/or
+// modify it under the terms of the GNU Lesser General Public
+// License as published by the Free Software Foundation; either
+// version 2.1 of the License.
+//
+// This library is distributed in the hope that it will be useful,
+// but WITHOUT ANY WARRANTY; without even the implied warranty of
+// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU
+// Lesser General Public License for more details.
+//
+// You should have received a copy of the GNU Lesser General Public
+// License along with this library; if not, write to the Free Software
+// Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307 USA
+//
+// See http://www.opencascade.org/SALOME/ or email : webmaster.salome@opencascade.org
+//
+//
+//
+// File : BlocksGUI_PropagateDlg.h
+// Author : VKN
+// Module : GEOM
+// $Header$
+
+#ifndef DIALOGBOX_BlocksGUI_PropagateDlg_H
+#define DIALOGBOX_BlocksGUI_PropagateDlg_H
+
+#include "GEOMBase_Skeleton.h"
+
+
+//=================================================================================
+// class : BlocksGUI_PropagateDlg
+// purpose :
+//=================================================================================
+class BlocksGUI_PropagateDlg : public GEOMBase_Skeleton
+{
+ Q_OBJECT
+
+public:
+ BlocksGUI_PropagateDlg(QWidget* parent = 0, const char* name = 0, SALOME_Selection* Sel = 0, bool modal = FALSE, WFlags fl = 0);
+ ~BlocksGUI_PropagateDlg();
+
+protected:
+ // redefined from GEOMBase_Helper
+ virtual GEOM::GEOM_IOperations_ptr createOperation();
+ virtual bool isValid( QString& );
+ virtual bool execute( ObjectList& objects );
+ virtual GEOM::GEOM_Object_ptr getFather(GEOM::GEOM_Object_ptr theObj);
+
+private slots:
+ void ClickOnOk();
+ bool ClickOnApply();
+ void ClickOnCancel();
+
+ void ActivateThisDialog();
+ void DeactivateActiveDialog();
+
+ void LineEditReturnPressed();
+ void SelectionIntoArgument();
+ void SetEditCurrentArgument();
+
+private :
+ void Init();
+ void enterEvent(QEvent* e);
+ void closeEvent(QCloseEvent* e);
+ void activateSelection();
+
+private :
+
+ GEOM::GEOM_Object_var myObject;
+ QPushButton* mySelBtn;
+ QLineEdit* mySelName;
+
+};
+
+#endif // DIALOGBOX_BlocksGUI_PropagateDlg_H
BlocksGUI_QuadFaceDlg.cxx \
BlocksGUI_BlockDlg.cxx \
BlocksGUI_ExplodeDlg.cxx \
+ BlocksGUI_PropagateDlg.cxx \
BlocksGUI_TrsfDlg.cxx
LIB_MOC = \
BlocksGUI_QuadFaceDlg.h \
BlocksGUI_BlockDlg.h \
BlocksGUI_ExplodeDlg.h \
+ BlocksGUI_PropagateDlg.h \
BlocksGUI_TrsfDlg.h
LIB_CLIENT_IDL = SALOME_GenericObj.idl SALOME_Component.idl
--- /dev/null
+-- File: BlockFix.cdl
+-- Created: Tue Dec 7 11:59:05 2004
+-- Author: Pavel Durandin
+-- <det@doomox>
+---Copyright: Open CASCADE SA 2004
+
+
+
+
+package BlockFix
+
+uses
+
+ TColStd,
+ gp,
+ Geom,
+ Geom2d,
+ GeomAbs,
+ TopLoc,
+ TopoDS,
+ BRepTools,
+ TopTools,
+ ShapeBuild
+
+is
+
+ class SphereSpaceModifier;
+
+ class UnionFaces;
+
+ class UnionEdges;
+
+ class BlockFixAPI;
+ ---Purpose: API class to perform the fixing of the
+ -- block
+
+ class PeriodicSurfaceModifier;
+
+ class CheckTool;
+
+ RotateSphereSpace (S: Shape from TopoDS; Tol: Real)
+ returns Shape from TopoDS;
+
+ FixRanges (S: Shape from TopoDS; Tol: Real)
+ returns Shape from TopoDS;
+ ---Purpose: checking and fixing cases where parametric
+ -- boundaries of face based on periodic surface are not
+ -- contained in the range of this surface.
+
+end BlockFix;
--- /dev/null
+// File: BlockFix.cxx
+// Created: Tue Dec 7 11:59:05 2004
+// Author: Pavel DURANDIN
+// Copyright: Open CASCADE SA 2004
+
+
+#include <BlockFix.hxx>
+#include <TopoDS_Shape.hxx>
+#include <TopTools_DataMapOfShapeShape.hxx>
+#include <ShapeCustom.hxx>
+#include <BRepTools.hxx>
+#include <ShapeBuild_ReShape.hxx>
+#include <TopoDS_Face.hxx>
+#include <TopExp_Explorer.hxx>
+#include <TopoDS.hxx>
+#include <TopLoc_Location.hxx>
+#include <Geom_Surface.hxx>
+#include <Geom_CylindricalSurface.hxx>
+#include <Geom_ConicalSurface.hxx>
+#include <ShapeFix_Wire.hxx>
+#include <TopoDS_Wire.hxx>
+#include <BRepTools_Modifier.hxx>
+#include <Geom_SphericalSurface.hxx>
+#include <Geom_ToroidalSurface.hxx>
+#include <BRep_Tool.hxx>
+#include <TopoDS_Edge.hxx>
+#include <Geom2d_Curve.hxx>
+#include <BRep_Builder.hxx>
+#include <ShapeAnalysis_Edge.hxx>
+#include <ShapeFix_Edge.hxx>
+#include <ShapeFix.hxx>
+#include <ShapeFix_Face.hxx>
+#include <ShapeAnalysis.hxx>
+
+#include <TColgp_SequenceOfPnt2d.hxx>
+#include <ShapeAnalysis_Curve.hxx>
+#include <TopoDS_Vertex.hxx>
+#include <ShapeBuild_Edge.hxx>
+
+#include <BlockFix_SphereSpaceModifier.hxx>
+#include <TopTools_DataMapIteratorOfDataMapOfShapeShape.hxx>
+#include <TopTools_MapOfShape.hxx>
+#include <BlockFix_PeriodicSurfaceModifier.hxx>
+
+#include <TopoDS_Solid.hxx>
+
+
+//=======================================================================
+//function : FixResult
+//purpose : auxilary
+//=======================================================================
+static void FixResult(const TopoDS_Shape& result,
+ Handle(ShapeBuild_ReShape)& Context,
+ const Standard_Real Tol)
+{
+ for (TopExp_Explorer ex_f(result,TopAbs_FACE); ex_f.More(); ex_f.Next()) {
+ TopoDS_Shape aShape = Context->Apply(ex_f.Current().Oriented(TopAbs_FORWARD));
+ // face coud not be dropped or splitted on this step
+ TopoDS_Face aFace = TopoDS::Face(aShape);
+ TopLoc_Location L;
+ Handle(Geom_Surface) Surf = BRep_Tool::Surface(aFace,L);
+
+ if (Surf->IsKind(STANDARD_TYPE(Geom_SphericalSurface)) ||
+ Surf->IsKind(STANDARD_TYPE(Geom_CylindricalSurface))) {
+
+ Standard_Integer nbWires = 0;
+ for (TopExp_Explorer ex_w(aFace,TopAbs_WIRE); ex_w.More(); ex_w.Next()) {
+ nbWires++;
+ Handle(ShapeFix_Wire) sfw = new ShapeFix_Wire(TopoDS::Wire(ex_w.Current()),
+ aFace,
+ Precision::Confusion());
+ sfw->FixReorder();
+ if(sfw->StatusReorder ( ShapeExtend_FAIL ))
+ continue;
+
+ sfw->SetPrecision(2.*Tol);
+ sfw->FixShifted();
+
+ Standard_Boolean isDone = sfw->LastFixStatus ( ShapeExtend_DONE );
+ isDone |= sfw->FixDegenerated();
+
+ // remove degenerated edges from not degenerated points
+ ShapeAnalysis_Edge sae;
+ Handle(ShapeExtend_WireData) sewd = sfw->WireData();
+ Standard_Integer i;
+ for( i = 1; i<=sewd->NbEdges();i++) {
+ TopoDS_Edge E = sewd->Edge(i);
+ if(BRep_Tool::Degenerated(E)&&!sae.HasPCurve(E,aFace)) {
+ sewd->Remove(i);
+ isDone = Standard_True;
+ i--;
+ }
+ }
+
+ isDone |= sfw->FixLacking();
+
+ // remove neighbour seam edges
+ if(isDone) {
+ for( i = 1; i<sewd->NbEdges();i++) {
+ if(sewd->IsSeam(i) && sewd->IsSeam(i+1)) {
+ isDone = Standard_True;
+ sewd->Remove(i);
+ sewd->Remove(i);
+ i--;
+ }
+ }
+ if(sewd->IsSeam(1) && sewd->IsSeam(sewd->NbEdges())) {
+ sewd->Remove(1);
+ sewd->Remove(sewd->NbEdges());
+ }
+ }
+
+
+ if(isDone) {
+ TopoDS_Wire ResWire = sfw->Wire();
+ Context->Replace(ex_w.Current(), ResWire);
+ };
+ }
+ // Implement fix orientation in case of several wires
+ if(nbWires > 1) {
+ TopoDS_Face aFixedFace = TopoDS::Face(Context->Apply(aFace));
+ Handle(ShapeFix_Face) sff = new ShapeFix_Face(aFixedFace);
+ if(sff->FixOrientation())
+ Context->Replace(aFixedFace,sff->Face());
+ }
+
+ }
+ }
+}
+
+
+
+
+
+//=======================================================================
+//function : ConvertToAnalytical
+//purpose :
+//=======================================================================
+
+TopoDS_Shape BlockFix::RotateSphereSpace (const TopoDS_Shape& S,
+ const Standard_Real Tol)
+{
+
+ // Create a modification description
+ Handle(BlockFix_SphereSpaceModifier) SR = new BlockFix_SphereSpaceModifier;
+ SR->SetTolerance(Tol);
+
+ TopTools_DataMapOfShapeShape context;
+ BRepTools_Modifier MD;
+ TopoDS_Shape result = ShapeCustom::ApplyModifier ( S, SR, context,MD );
+
+ Handle(ShapeBuild_ReShape) RS = new ShapeBuild_ReShape;
+ FixResult(result,RS,Tol);
+ result = RS->Apply(result);
+
+ ShapeFix_Edge sfe;
+ for(TopExp_Explorer exp(result,TopAbs_EDGE); exp.More(); exp.Next()) {
+ TopoDS_Edge E = TopoDS::Edge(exp.Current());
+ sfe.FixVertexTolerance (E);
+ }
+
+ ShapeFix::SameParameter(result,Standard_False);
+ return result;
+}
+
+
+//=======================================================================
+//function : FixRanges
+//purpose :
+//=======================================================================
+
+TopoDS_Shape BlockFix::FixRanges (const TopoDS_Shape& S,
+ const Standard_Real Tol)
+{
+ // Create a modification description
+ Handle(BlockFix_PeriodicSurfaceModifier) SR = new BlockFix_PeriodicSurfaceModifier;
+ SR->SetTolerance(Tol);
+
+ TopTools_DataMapOfShapeShape context;
+ BRepTools_Modifier MD;
+ TopoDS_Shape result = ShapeCustom::ApplyModifier ( S, SR, context,MD );
+
+ Handle(ShapeBuild_ReShape) RS = new ShapeBuild_ReShape;
+ FixResult(result,RS,Tol);
+ result = RS->Apply(result);
+
+ ShapeFix_Edge sfe;
+ for(TopExp_Explorer exp(result,TopAbs_EDGE); exp.More(); exp.Next()) {
+ TopoDS_Edge E = TopoDS::Edge(exp.Current());
+ sfe.FixVertexTolerance (E);
+ }
+
+ ShapeFix::SameParameter(result,Standard_False);
+
+ return result;
+}
--- /dev/null
+// File generated by CPPExt (Value)
+//
+// Copyright (C) 1991 - 2000 by
+// Matra Datavision SA. All rights reserved.
+//
+// Copyright (C) 2001 - 2004 by
+// Open CASCADE SA. All rights reserved.
+//
+// This file is part of the Open CASCADE Technology software.
+//
+// This software may be distributed and/or modified under the terms and
+// conditions of the Open CASCADE Public License as defined by Open CASCADE SA
+// and appearing in the file LICENSE included in the packaging of this file.
+//
+// This software is distributed on an "AS IS" basis, without warranty of any
+// kind, and Open CASCADE SA hereby disclaims all such warranties,
+// including without limitation, any warranties of merchantability, fitness
+// for a particular purpose or non-infringement. Please see the License for
+// the specific terms and conditions governing rights and limitations under the
+// License.
+
+#ifndef _BlockFix_HeaderFile
+#define _BlockFix_HeaderFile
+
+#ifndef _Standard_Real_HeaderFile
+#include <Standard_Real.hxx>
+#endif
+class TopoDS_Shape;
+class BlockFix_SphereSpaceModifier;
+class BlockFix_UnionFaces;
+class BlockFix_UnionEdges;
+class BlockFix_BlockFixAPI;
+class BlockFix_PeriodicSurfaceModifier;
+class BlockFix_CheckTool;
+
+
+#ifndef _Standard_HeaderFile
+#include <Standard.hxx>
+#endif
+#ifndef _Standard_Macro_HeaderFile
+#include <Standard_Macro.hxx>
+#endif
+
+class BlockFix {
+
+public:
+
+ void* operator new(size_t,void* anAddress)
+ {
+ return anAddress;
+ }
+ void* operator new(size_t size)
+ {
+ return Standard::Allocate(size);
+ }
+ void operator delete(void *anAddress)
+ {
+ if (anAddress) Standard::Free((Standard_Address&)anAddress);
+ }
+ // Methods PUBLIC
+ //
+Standard_EXPORT static TopoDS_Shape RotateSphereSpace(const TopoDS_Shape& S,const Standard_Real Tol) ;
+Standard_EXPORT static TopoDS_Shape FixRanges(const TopoDS_Shape& S,const Standard_Real Tol) ;
+
+
+
+
+
+protected:
+
+ // Methods PROTECTED
+ //
+
+
+ // Fields PROTECTED
+ //
+
+
+private:
+
+ // Methods PRIVATE
+ //
+
+
+ // Fields PRIVATE
+ //
+
+friend class BlockFix_SphereSpaceModifier;
+friend class BlockFix_UnionFaces;
+friend class BlockFix_UnionEdges;
+friend class BlockFix_BlockFixAPI;
+friend class BlockFix_PeriodicSurfaceModifier;
+friend class BlockFix_CheckTool;
+
+};
+
+
+
+
+
+// other Inline functions and methods (like "C++: function call" methods)
+//
+
+
+#endif
--- /dev/null
+// File generated by CPPExt (Value)
+//
+// Copyright (C) 1991 - 2000 by
+// Matra Datavision SA. All rights reserved.
+//
+// Copyright (C) 2001 - 2004 by
+// Open CASCADE SA. All rights reserved.
+//
+// This file is part of the Open CASCADE Technology software.
+//
+// This software may be distributed and/or modified under the terms and
+// conditions of the Open CASCADE Public License as defined by Open CASCADE SA
+// and appearing in the file LICENSE included in the packaging of this file.
+//
+// This software is distributed on an "AS IS" basis, without warranty of any
+// kind, and Open CASCADE SA hereby disclaims all such warranties,
+// including without limitation, any warranties of merchantability, fitness
+// for a particular purpose or non-infringement. Please see the License for
+// the specific terms and conditions governing rights and limitations under the
+// License.
+
+#include <BlockFix.jxx>
+
+
+
+
--- /dev/null
+#ifndef _TopoDS_Shape_HeaderFile
+#include <TopoDS_Shape.hxx>
+#endif
+#ifndef _BlockFix_HeaderFile
+#include <BlockFix.hxx>
+#endif
--- /dev/null
+-- File: BlockFix_BlockFixAPI.cdl
+-- Created: Tue Dec 7 17:56:09 2004
+-- Author: Pavel Durandin
+-- <det@doomox>
+---Copyright: Open CASCADE SA 2004
+
+class BlockFixAPI from BlockFix inherits TShared from MMgt
+
+ ---Purpose:
+
+uses
+
+ Shape from TopoDS,
+ ReShape from ShapeBuild
+
+is
+ Create returns BlockFixAPI from BlockFix;
+ ---Purpose: Empty constructor
+
+ SetShape(me: mutable; Shape: Shape from TopoDS);
+ ---Purpose: Sets the shape to be operated on
+ ---C++: inline
+
+ Perform(me: mutable);
+ ---Purpose:
+
+ Shape(me) returns Shape from TopoDS;
+ ---Purpose: Returns resulting shape.
+ ---C++: inline
+
+ Context(me:mutable) returns ReShape from ShapeBuild;
+ ---Purpose: Returns modifiable context for storing the
+ -- mofifications
+ ---C++: inline
+ ---C++: return &
+
+ Tolerance (me:mutable) returns Real;
+ ---Purpose: Returns modifiable tolerance of recognition
+ ---C++: inline
+ ---C++: return &
+
+fields
+
+ myContext : ReShape from ShapeBuild;
+ myShape : Shape from TopoDS;
+ myTolerance : Real from Standard;
+
+end BlockFixAPI from BlockFix;
--- /dev/null
+// File: BlockFix_BlockFixAPI.cxx
+// Created: Tue Dec 7 11:59:05 2004
+// Author: Pavel DURANDIN
+// Copyright: Open CASCADE SA 2004
+
+
+#include <BlockFix_BlockFixAPI.ixx>
+#include <BlockFix.hxx>
+#include <BlockFix_UnionFaces.hxx>
+#include <BlockFix_UnionEdges.hxx>
+#include <Precision.hxx>
+
+//=======================================================================
+//function : ShapeConvert_CanonicAPI
+//purpose :
+//=======================================================================
+
+BlockFix_BlockFixAPI::BlockFix_BlockFixAPI()
+{
+ myTolerance = Precision::Confusion();
+}
+
+//=======================================================================
+//function : Perform
+//purpose :
+//=======================================================================
+
+void BlockFix_BlockFixAPI::Perform()
+{
+
+ // processing spheres with degenerativities
+ TopoDS_Shape aShape = Shape();
+ myShape = BlockFix::RotateSphereSpace(aShape,myTolerance);
+
+ // faces unification
+ BlockFix_UnionFaces aFaceUnifier;
+ aFaceUnifier.GetTolerance() = myTolerance;
+ TopoDS_Shape aResult;
+ aResult = aFaceUnifier.Perform(myShape);
+
+
+ BlockFix_UnionEdges anEdgeUnifier;
+ myShape = anEdgeUnifier.Perform(aResult,myTolerance);
+
+ TopoDS_Shape aRes = BlockFix::FixRanges(myShape,myTolerance);
+ myShape = aRes;
+
+}
--- /dev/null
+// File generated by CPPExt (Transient)
+//
+//
+// Copyright (C) 1991 - 2000 by
+// Matra Datavision SA. All rights reserved.
+//
+// Copyright (C) 2001 - 2004 by
+// Open CASCADE SA. All rights reserved.
+//
+// This file is part of the Open CASCADE Technology software.
+//
+// This software may be distributed and/or modified under the terms and
+// conditions of the Open CASCADE Public License as defined by Open CASCADE SA
+// and appearing in the file LICENSE included in the packaging of this file.
+//
+// This software is distributed on an "AS IS" basis, without warranty of any
+// kind, and Open CASCADE SA hereby disclaims all such warranties,
+// including without limitation, any warranties of merchantability, fitness
+// for a particular purpose or non-infringement. Please see the License for
+// the specific terms and conditions governing rights and limitations under the
+// License.
+
+#ifndef _BlockFix_BlockFixAPI_HeaderFile
+#define _BlockFix_BlockFixAPI_HeaderFile
+
+#ifndef _Standard_HeaderFile
+#include <Standard.hxx>
+#endif
+#ifndef _Handle_BlockFix_BlockFixAPI_HeaderFile
+#include <Handle_BlockFix_BlockFixAPI.hxx>
+#endif
+
+#ifndef _Handle_ShapeBuild_ReShape_HeaderFile
+#include <Handle_ShapeBuild_ReShape.hxx>
+#endif
+#ifndef _TopoDS_Shape_HeaderFile
+#include <TopoDS_Shape.hxx>
+#endif
+#ifndef _Standard_Real_HeaderFile
+#include <Standard_Real.hxx>
+#endif
+#ifndef _MMgt_TShared_HeaderFile
+#include <MMgt_TShared.hxx>
+#endif
+class ShapeBuild_ReShape;
+class TopoDS_Shape;
+
+
+class BlockFix_BlockFixAPI : public MMgt_TShared {
+
+public:
+
+ void* operator new(size_t,void* anAddress)
+ {
+ return anAddress;
+ }
+ void* operator new(size_t size)
+ {
+ return Standard::Allocate(size);
+ }
+ void operator delete(void *anAddress)
+ {
+ if (anAddress) Standard::Free((Standard_Address&)anAddress);
+ }
+ // Methods PUBLIC
+ //
+Standard_EXPORT BlockFix_BlockFixAPI();
+ void SetShape(const TopoDS_Shape& Shape) ;
+Standard_EXPORT void Perform() ;
+ TopoDS_Shape Shape() const;
+ Handle_ShapeBuild_ReShape& Context() ;
+ Standard_Real& Tolerance() ;
+Standard_EXPORT ~BlockFix_BlockFixAPI();
+
+
+
+
+ // Type management
+ //
+ Standard_EXPORT friend Handle_Standard_Type& BlockFix_BlockFixAPI_Type_();
+ Standard_EXPORT const Handle(Standard_Type)& DynamicType() const;
+ Standard_EXPORT Standard_Boolean IsKind(const Handle(Standard_Type)&) const;
+
+protected:
+
+ // Methods PROTECTED
+ //
+
+
+ // Fields PROTECTED
+ //
+
+
+private:
+
+ // Methods PRIVATE
+ //
+
+
+ // Fields PRIVATE
+ //
+Handle_ShapeBuild_ReShape myContext;
+TopoDS_Shape myShape;
+Standard_Real myTolerance;
+
+
+};
+
+
+#include <BlockFix_BlockFixAPI.lxx>
+
+
+
+// other Inline functions and methods (like "C++: function call" methods)
+//
+
+
+#endif
--- /dev/null
+// File generated by CPPExt (Transient)
+//
+// Copyright (C) 1991 - 2000 by
+// Matra Datavision SA. All rights reserved.
+//
+// Copyright (C) 2001 - 2004 by
+// Open CASCADE SA. All rights reserved.
+//
+// This file is part of the Open CASCADE Technology software.
+//
+// This software may be distributed and/or modified under the terms and
+// conditions of the Open CASCADE Public License as defined by Open CASCADE SA
+// and appearing in the file LICENSE included in the packaging of this file.
+//
+// This software is distributed on an "AS IS" basis, without warranty of any
+// kind, and Open CASCADE SA hereby disclaims all such warranties,
+// including without limitation, any warranties of merchantability, fitness
+// for a particular purpose or non-infringement. Please see the License for
+// the specific terms and conditions governing rights and limitations under the
+// License.
+
+#include <BlockFix_BlockFixAPI.jxx>
+
+#ifndef _Standard_TypeMismatch_HeaderFile
+#include <Standard_TypeMismatch.hxx>
+#endif
+
+BlockFix_BlockFixAPI::~BlockFix_BlockFixAPI() {}
+
+
+
+Standard_EXPORT Handle_Standard_Type& BlockFix_BlockFixAPI_Type_()
+{
+
+ static Handle_Standard_Type aType1 = STANDARD_TYPE(MMgt_TShared);
+ if ( aType1.IsNull()) aType1 = STANDARD_TYPE(MMgt_TShared);
+ static Handle_Standard_Type aType2 = STANDARD_TYPE(Standard_Transient);
+ if ( aType2.IsNull()) aType2 = STANDARD_TYPE(Standard_Transient);
+
+
+ static Handle_Standard_Transient _Ancestors[]= {aType1,aType2,NULL};
+ static Handle_Standard_Type _aType = new Standard_Type("BlockFix_BlockFixAPI",
+ sizeof(BlockFix_BlockFixAPI),
+ 1,
+ (Standard_Address)_Ancestors,
+ (Standard_Address)NULL);
+
+ return _aType;
+}
+
+
+// DownCast method
+// allow safe downcasting
+//
+const Handle(BlockFix_BlockFixAPI) Handle(BlockFix_BlockFixAPI)::DownCast(const Handle(Standard_Transient)& AnObject)
+{
+ Handle(BlockFix_BlockFixAPI) _anOtherObject;
+
+ if (!AnObject.IsNull()) {
+ if (AnObject->IsKind(STANDARD_TYPE(BlockFix_BlockFixAPI))) {
+ _anOtherObject = Handle(BlockFix_BlockFixAPI)((Handle(BlockFix_BlockFixAPI)&)AnObject);
+ }
+ }
+
+ return _anOtherObject ;
+}
+const Handle(Standard_Type)& BlockFix_BlockFixAPI::DynamicType() const
+{
+ return STANDARD_TYPE(BlockFix_BlockFixAPI) ;
+}
+Standard_Boolean BlockFix_BlockFixAPI::IsKind(const Handle(Standard_Type)& AType) const
+{
+ return (STANDARD_TYPE(BlockFix_BlockFixAPI) == AType || MMgt_TShared::IsKind(AType));
+}
+Handle_BlockFix_BlockFixAPI::~Handle_BlockFix_BlockFixAPI() {}
+
--- /dev/null
+#ifndef _ShapeBuild_ReShape_HeaderFile
+#include <ShapeBuild_ReShape.hxx>
+#endif
+#ifndef _TopoDS_Shape_HeaderFile
+#include <TopoDS_Shape.hxx>
+#endif
+#ifndef _BlockFix_BlockFixAPI_HeaderFile
+#include <BlockFix_BlockFixAPI.hxx>
+#endif
--- /dev/null
+#include <BlockFix_BlockFixAPI.hxx>
+
+//=======================================================================
+//function : Shape
+//purpose :
+//=======================================================================
+
+inline void BlockFix_BlockFixAPI::SetShape(const TopoDS_Shape& Shape)
+{
+ myShape = Shape;
+}
+
+//=======================================================================
+//function : Shape
+//purpose :
+//=======================================================================
+
+inline TopoDS_Shape BlockFix_BlockFixAPI::Shape() const
+{
+ return myShape;
+}
+
+//=======================================================================
+//function : Context
+//purpose :
+//=======================================================================
+
+inline Handle(ShapeBuild_ReShape)& BlockFix_BlockFixAPI::Context()
+{
+ return myContext;
+}
+
+//=======================================================================
+//function : Tolerance
+//purpose :
+//=======================================================================
+
+inline Standard_Real& BlockFix_BlockFixAPI::Tolerance()
+{
+ return myTolerance;
+}
+
--- /dev/null
+-- File: BlockFix_CheckTool.cdl
+-- Created: Fri Dec 17 10:36:58 2004
+-- Author: Sergey KUUL
+-- <skl@strelox.nnov.matra-dtv.fr>
+---Copyright: Open CASCADE SA 2004
+
+class CheckTool from BlockFix
+
+ ---Purpose:
+
+uses
+
+ Shape from TopoDS,
+ SequenceOfShape from TopTools
+
+is
+
+ Create returns CheckTool from BlockFix;
+ ---Purpose: Empty constructor
+
+ SetShape(me: in out; aShape: Shape from TopoDS);
+
+ Perform(me: in out);
+ ---Purpose:
+
+ NbPossibleBlocks(me) returns Integer;
+
+ PossibleBlock(me; num: Integer) returns Shape from TopoDS;
+
+ DumpCheckResult(me; S : in out OStream);
+ ---Purpose: Dumps results of checking
+
+
+fields
+
+ myShape : Shape from TopoDS;
+ myHasCheck : Boolean;
+ myNbSolids : Integer;
+ myNbBlocks : Integer;
+ myPossibleBlocks : SequenceOfShape from TopTools;
+ myNbUF : Integer;
+ myNbUE : Integer;
+ myNbUFUE : Integer;
+ myBadRanges : Integer;
+
+end CheckTool;
--- /dev/null
+// File: BlockFix_CheckTool.cxx
+// Created: 17.12.04 11:15:25
+// Author: Sergey KUUL
+// Copyright: Open CASCADE SA 2004
+
+#include <BlockFix_CheckTool.ixx>
+
+#include <BRep_Tool.hxx>
+#include <BlockFix_UnionEdges.hxx>
+#include <BlockFix_UnionFaces.hxx>
+#include <TopExp.hxx>
+#include <TopExp_Explorer.hxx>
+#include <TopoDS.hxx>
+#include <TopoDS_Edge.hxx>
+#include <TopoDS_Face.hxx>
+#include <TopoDS_Solid.hxx>
+#include <TopTools_IndexedDataMapOfShapeListOfShape.hxx>
+#include <TopTools_MapOfShape.hxx>
+#include <TopTools_ListOfShape.hxx>
+#include <TopTools_ListIteratorOfListOfShape.hxx>
+
+
+//=======================================================================
+//function : BlockFix_CheckTool()
+//purpose : Constructor
+//=======================================================================
+
+BlockFix_CheckTool::BlockFix_CheckTool( )
+{
+ myHasCheck = Standard_False;
+ myPossibleBlocks.Clear();
+}
+
+
+//=======================================================================
+//function : SetShape
+//purpose :
+//=======================================================================
+
+void BlockFix_CheckTool::SetShape(const TopoDS_Shape& aShape)
+{
+ myHasCheck = Standard_False;
+ myShape = aShape;
+ myPossibleBlocks.Clear();
+}
+
+
+//=======================================================================
+//function : Perform
+//purpose :
+//=======================================================================
+
+void BlockFix_CheckTool::Perform()
+{
+ myNbSolids=0;
+ myNbBlocks=0;
+ myNbUF=0;
+ myNbUE=0;
+ myNbUFUE=0;
+ TopExp_Explorer exps;
+ for(exps.Init(myShape, TopAbs_SOLID); exps.More(); exps.Next()) {
+ TopoDS_Solid aSolid = TopoDS::Solid(exps.Current());
+ myNbSolids++;
+ Standard_Boolean IsBlock=Standard_True;
+ Standard_Boolean MayBeUF=Standard_False;
+ Standard_Boolean MayBeUE=Standard_False;
+ Standard_Integer nf=0;
+ TopExp_Explorer expf;
+ for(expf.Init(aSolid, TopAbs_FACE); expf.More(); expf.Next()) nf++;
+
+ if(nf<6) {
+ IsBlock=Standard_False;
+ }
+ else if(nf>6) {
+ IsBlock=Standard_False;
+ // check faces unification
+ TopTools_SequenceOfShape faces;
+ for( expf.Init(aSolid, TopAbs_FACE); expf.More(); expf.Next()) {
+ TopoDS_Face aFace = TopoDS::Face(expf.Current());
+ faces.Append(aFace);
+ }
+ Standard_Boolean HasFacesForUnification = Standard_False;
+ for(Standard_Integer i=1; i<faces.Length() && !HasFacesForUnification; i++) {
+ TopoDS_Face F1 = TopoDS::Face(faces.Value(i));
+ TopTools_MapOfShape Edges;
+ for(TopExp_Explorer expe(F1,TopAbs_EDGE); expe.More(); expe.Next())
+ Edges.Add(expe.Current().Oriented(TopAbs_FORWARD));
+ TopLoc_Location L1;
+ Handle(Geom_Surface) S1 = BRep_Tool::Surface(F1,L1);
+ for(Standard_Integer j=i+1; j<=faces.Length() && !HasFacesForUnification; j++) {
+ TopoDS_Face F2 = TopoDS::Face(faces.Value(j));
+ TopLoc_Location L2;
+ Handle(Geom_Surface) S2 = BRep_Tool::Surface(F2,L2);
+ if( S1==S2 && L1==L2 ) {
+ // faces have equal based surface
+ // now check common edge
+ for(TopExp_Explorer expe2(F2,TopAbs_EDGE); expe2.More(); expe2.Next()) {
+ if(Edges.Contains(expe2.Current().Oriented(TopAbs_FORWARD))) {
+ HasFacesForUnification = Standard_True;
+ break;
+ }
+ }
+ }
+ }
+ }
+ if(HasFacesForUnification) {
+ MayBeUF=Standard_True;
+ }
+ }
+
+ Standard_Integer ne=0;
+ TopExp_Explorer expe;
+ for(expe.Init(aSolid, TopAbs_EDGE); expe.More(); expe.Next()) ne++;
+ ne = ne/2;
+ if(ne<12)
+ IsBlock=Standard_False;
+ if(ne>12) {
+ IsBlock=Standard_False;
+ // check edges unification
+ // creating map of edge faces
+ TopTools_IndexedDataMapOfShapeListOfShape aMapEdgeFaces;
+ TopExp::MapShapesAndAncestors(aSolid, TopAbs_EDGE, TopAbs_FACE, aMapEdgeFaces);
+ for(expf.Init(aSolid, TopAbs_FACE); expf.More(); expf.Next()) {
+ TopoDS_Face aFace = TopoDS::Face(expf.Current());
+ TopTools_IndexedDataMapOfShapeListOfShape aMapFacesEdges;
+ for(expe.Init(aFace,TopAbs_EDGE); expe.More(); expe.Next()) {
+ TopoDS_Edge edge = TopoDS::Edge(expe.Current());
+ if(!aMapEdgeFaces.Contains(edge)) continue;
+ const TopTools_ListOfShape& aList = aMapEdgeFaces.FindFromKey(edge);
+ TopTools_ListIteratorOfListOfShape anIter(aList);
+ for( ; anIter.More(); anIter.Next()) {
+ TopoDS_Face face = TopoDS::Face(anIter.Value());
+ if(face.IsSame(aFace)) continue;
+ if(aMapFacesEdges.Contains(face)) {
+ aMapFacesEdges.ChangeFromKey(face).Append(edge);
+ }
+ else {
+ TopTools_ListOfShape ListEdges;
+ ListEdges.Append(edge);
+ aMapFacesEdges.Add(face,ListEdges);
+ }
+ }
+ }
+ Standard_Integer i = 1;
+ for (; i <= aMapFacesEdges.Extent(); i++) {
+ const TopTools_ListOfShape& ListEdges = aMapFacesEdges.FindFromIndex(i);
+ if (ListEdges.Extent() > 1) break;
+ }
+ if (i <= aMapFacesEdges.Extent()) {
+ MayBeUE = Standard_True;
+ break;
+ }
+ }
+ }
+
+ if(IsBlock)
+ myNbBlocks++;
+ else {
+ if(MayBeUF) {
+ myPossibleBlocks.Append(aSolid);
+ if(MayBeUE)
+ myNbUFUE++;
+ else
+ myNbUF++;
+ }
+ else if(MayBeUE) {
+ myNbUE++;
+ myPossibleBlocks.Append(aSolid);
+ }
+ }
+
+ }
+
+ myHasCheck = Standard_True;
+}
+
+
+//=======================================================================
+//function : NbPossibleBlocks
+//purpose :
+//=======================================================================
+
+Standard_Integer BlockFix_CheckTool::NbPossibleBlocks() const
+{
+ return myPossibleBlocks.Length();
+}
+
+
+//=======================================================================
+//function : PossibleBlock
+//purpose :
+//=======================================================================
+
+TopoDS_Shape BlockFix_CheckTool::PossibleBlock(const Standard_Integer num) const
+{
+ TopoDS_Shape res;
+ if( num>0 && num<=myPossibleBlocks.Length() )
+ res = myPossibleBlocks.Value(num);
+ return res;
+}
+
+
+//=======================================================================
+//function : DumpCheckResult
+//purpose :
+//=======================================================================
+
+void BlockFix_CheckTool::DumpCheckResult(Standard_OStream& S) const
+{
+ if(!myHasCheck)
+ S<<"Check not performed!"<<endl;
+ else {
+ S<<"dump results of check:"<<endl;
+ S<<" total number of solids = "<<myNbSolids<<endl;
+ S<<" including: number of good blocks = "<<myNbBlocks<<endl;
+ S<<" number of possible blocks = "<<NbPossibleBlocks()<<endl;
+ Standard_Integer nbtmp = myNbSolids - myNbBlocks - NbPossibleBlocks();
+ S<<" number of impossible blocks = "<<nbtmp<<endl;
+ S<<" including: need unionfaces = "<<myNbUF<<endl;
+ S<<" need unionedges = "<<myNbUE<<endl;
+ S<<" need both unionfaces and unionedges = "<<myNbUFUE<<endl;
+ }
+}
+
--- /dev/null
+// File generated by CPPExt (Value)
+//
+// Copyright (C) 1991 - 2000 by
+// Matra Datavision SA. All rights reserved.
+//
+// Copyright (C) 2001 - 2004 by
+// Open CASCADE SA. All rights reserved.
+//
+// This file is part of the Open CASCADE Technology software.
+//
+// This software may be distributed and/or modified under the terms and
+// conditions of the Open CASCADE Public License as defined by Open CASCADE SA
+// and appearing in the file LICENSE included in the packaging of this file.
+//
+// This software is distributed on an "AS IS" basis, without warranty of any
+// kind, and Open CASCADE SA hereby disclaims all such warranties,
+// including without limitation, any warranties of merchantability, fitness
+// for a particular purpose or non-infringement. Please see the License for
+// the specific terms and conditions governing rights and limitations under the
+// License.
+
+#ifndef _BlockFix_CheckTool_HeaderFile
+#define _BlockFix_CheckTool_HeaderFile
+
+#ifndef _TopoDS_Shape_HeaderFile
+#include <TopoDS_Shape.hxx>
+#endif
+#ifndef _Standard_Boolean_HeaderFile
+#include <Standard_Boolean.hxx>
+#endif
+#ifndef _Standard_Integer_HeaderFile
+#include <Standard_Integer.hxx>
+#endif
+#ifndef _TopTools_SequenceOfShape_HeaderFile
+#include <TopTools_SequenceOfShape.hxx>
+#endif
+#ifndef _Standard_OStream_HeaderFile
+#include <Standard_OStream.hxx>
+#endif
+class TopoDS_Shape;
+
+
+#ifndef _Standard_HeaderFile
+#include <Standard.hxx>
+#endif
+#ifndef _Standard_Macro_HeaderFile
+#include <Standard_Macro.hxx>
+#endif
+
+class BlockFix_CheckTool {
+
+public:
+
+ void* operator new(size_t,void* anAddress)
+ {
+ return anAddress;
+ }
+ void* operator new(size_t size)
+ {
+ return Standard::Allocate(size);
+ }
+ void operator delete(void *anAddress)
+ {
+ if (anAddress) Standard::Free((Standard_Address&)anAddress);
+ }
+ // Methods PUBLIC
+ //
+Standard_EXPORT BlockFix_CheckTool();
+Standard_EXPORT void SetShape(const TopoDS_Shape& aShape) ;
+Standard_EXPORT void Perform() ;
+Standard_EXPORT Standard_Integer NbPossibleBlocks() const;
+Standard_EXPORT TopoDS_Shape PossibleBlock(const Standard_Integer num) const;
+Standard_EXPORT void DumpCheckResult(Standard_OStream& S) const;
+
+
+
+
+
+protected:
+
+ // Methods PROTECTED
+ //
+
+
+ // Fields PROTECTED
+ //
+
+
+private:
+
+ // Methods PRIVATE
+ //
+
+
+ // Fields PRIVATE
+ //
+TopoDS_Shape myShape;
+Standard_Boolean myHasCheck;
+Standard_Integer myNbSolids;
+Standard_Integer myNbBlocks;
+TopTools_SequenceOfShape myPossibleBlocks;
+Standard_Integer myNbUF;
+Standard_Integer myNbUE;
+Standard_Integer myNbUFUE;
+Standard_Integer myBadRanges;
+
+
+};
+
+
+
+
+
+// other Inline functions and methods (like "C++: function call" methods)
+//
+
+
+#endif
--- /dev/null
+// File generated by CPPExt (Value)
+//
+// Copyright (C) 1991 - 2000 by
+// Matra Datavision SA. All rights reserved.
+//
+// Copyright (C) 2001 - 2004 by
+// Open CASCADE SA. All rights reserved.
+//
+// This file is part of the Open CASCADE Technology software.
+//
+// This software may be distributed and/or modified under the terms and
+// conditions of the Open CASCADE Public License as defined by Open CASCADE SA
+// and appearing in the file LICENSE included in the packaging of this file.
+//
+// This software is distributed on an "AS IS" basis, without warranty of any
+// kind, and Open CASCADE SA hereby disclaims all such warranties,
+// including without limitation, any warranties of merchantability, fitness
+// for a particular purpose or non-infringement. Please see the License for
+// the specific terms and conditions governing rights and limitations under the
+// License.
+
+#include <BlockFix_CheckTool.jxx>
+
+
+
+
--- /dev/null
+#ifndef _TopoDS_Shape_HeaderFile
+#include <TopoDS_Shape.hxx>
+#endif
+#ifndef _BlockFix_CheckTool_HeaderFile
+#include <BlockFix_CheckTool.hxx>
+#endif
--- /dev/null
+-- File: BlockFix_PeriodicSurfaceModifier.cdl
+-- Created: Wed Dec 15 10:03:50 2004
+-- Author: Sergey KUUL
+-- <skl@strelox.nnov.matra-dtv.fr>
+---Copyright: Open CASCADE SA 2004
+
+class PeriodicSurfaceModifier from BlockFix inherits Modification from BRepTools
+
+ ---Purpose:
+
+uses
+ Vertex from TopoDS,
+ Edge from TopoDS,
+ Face from TopoDS,
+ Location from TopLoc,
+ Shape from GeomAbs,
+ Pnt from gp,
+ Curve from Geom,
+ Curve from Geom2d,
+ Surface from Geom,
+ IndexedMapOfTransient from TColStd,
+ DataMapOfShapeInteger from TopTools
+
+is
+
+ Create returns mutable PeriodicSurfaceModifier from BlockFix;
+
+ SetTolerance(me: mutable; Toler: Real);
+ ---Purpose: Sets the tolerance for recognition of geometry
+
+ NewSurface(me: mutable; F : Face from TopoDS;
+ S : out Surface from Geom;
+ L : out Location from TopLoc;
+ Tol: out Real from Standard;
+ RevWires : out Boolean from Standard;
+ RevFace : out Boolean from Standard)
+ returns Boolean from Standard;
+ ---Purpose: Returns Standard_True if the face <F> has been
+ -- modified. In this case, <S> is the new geometric
+ -- support of the face, <L> the new location, <Tol>
+ -- the new tolerance. Otherwise, returns
+ -- Standard_False, and <S>, <L>, <Tol> are not
+ -- significant.
+
+ NewCurve(me: mutable; E : Edge from TopoDS;
+ C : out Curve from Geom;
+ L : out Location from TopLoc;
+ Tol: out Real from Standard)
+ returns Boolean from Standard;
+ ---Purpose: Returns Standard_True if the edge <E> has been
+ -- modified. In this case, <C> is the new geometric
+ -- support of the edge, <L> the new location, <Tol>
+ -- the new tolerance. Otherwise, returns
+ -- Standard_False, and <C>, <L>, <Tol> are not
+ -- significant.
+
+ NewPoint(me: mutable; V : Vertex from TopoDS;
+ P : out Pnt from gp;
+ Tol: out Real from Standard)
+ returns Boolean from Standard;
+ ---Purpose: Returns Standard_True if the vertex <V> has been
+ -- modified. In this case, <P> is the new geometric
+ -- support of the vertex, <Tol> the new tolerance.
+ -- Otherwise, returns Standard_False, and <P>, <Tol>
+ -- are not significant.
+
+ NewCurve2d(me: mutable; E : Edge from TopoDS;
+ F : Face from TopoDS;
+ NewE : Edge from TopoDS;
+ NewF : Face from TopoDS;
+ C : out Curve from Geom2d;
+ Tol : out Real from Standard)
+ returns Boolean from Standard;
+ ---Purpose: Returns Standard_True if the edge <E> has a new
+ -- curve on surface on the face <F>.In this case, <C>
+ -- is the new geometric support of the edge, <L> the
+ -- new location, <Tol> the new tolerance.
+ --
+ -- Otherwise, returns Standard_False, and <C>, <L>,
+ -- <Tol> are not significant.
+ --
+ -- <NewE> is the new edge created from <E>. <NewF>
+ -- is the new face created from <F>. They may be usefull.
+
+ NewParameter(me: mutable; V : Vertex from TopoDS;
+ E : Edge from TopoDS;
+ P : out Real from Standard;
+ Tol: out Real from Standard)
+ returns Boolean from Standard;
+ ---Purpose: Returns Standard_True if the Vertex <V> has a new
+ -- parameter on the edge <E>. In this case, <P> is
+ -- the parameter, <Tol> the new tolerance.
+ -- Otherwise, returns Standard_False, and <P>, <Tol>
+ -- are not significant.
+
+ Continuity(me: mutable; E : Edge from TopoDS;
+ F1,F2 : Face from TopoDS;
+ NewE : Edge from TopoDS;
+ NewF1,NewF2: Face from TopoDS)
+ returns Shape from GeomAbs;
+ ---Purpose: Returns the continuity of <NewE> between <NewF1>
+ -- and <NewF2>.
+ --
+ -- <NewE> is the new edge created from <E>. <NewF1>
+ -- (resp. <NewF2>) is the new face created from <F1>
+ -- (resp. <F2>).
+
+
+fields
+
+ myTolerance : Real;
+ myMapOfFaces : DataMapOfShapeInteger from TopTools;
+ myMapOfSurfaces: IndexedMapOfTransient from TColStd;
+
+end PeriodicSurfaceModifier;
--- /dev/null
+// File: BlockFix_PeriodicSurfaceModifier.cxx
+// Created: 15.12.04 10:08:50
+// Author: Sergey KUUL
+// Copyright: Open CASCADE SA 2004
+
+#include <BlockFix_PeriodicSurfaceModifier.ixx>
+
+#include <BRep_Builder.hxx>
+#include <BRep_Tool.hxx>
+#include <BRepTools.hxx>
+#include <Geom_CylindricalSurface.hxx>
+#include <Geom_SphericalSurface.hxx>
+#include <ShapeFix_Edge.hxx>
+#include <TopExp.hxx>
+
+
+//=======================================================================
+//function : BlockFix_PeriodicSurfaceModifier()
+//purpose : Constructor
+//=======================================================================
+
+BlockFix_PeriodicSurfaceModifier::BlockFix_PeriodicSurfaceModifier ( )
+{
+ myMapOfFaces.Clear();
+ myMapOfSurfaces.Clear();
+}
+
+
+//=======================================================================
+//function : SetTolerance
+//purpose :
+//=======================================================================
+
+void BlockFix_PeriodicSurfaceModifier::SetTolerance(const Standard_Real Tol)
+{
+ myTolerance = Tol;
+}
+
+
+//=======================================================================
+//function : ModifySurface
+//purpose : auxilary
+//=======================================================================
+
+static Standard_Boolean ModifySurface(const TopoDS_Face& aFace,
+ const Handle(Geom_Surface)& aSurface,
+ Handle(Geom_Surface)& aNewSurface)
+{
+ Handle(Geom_Surface) S = aSurface;
+
+ if(S->IsKind(STANDARD_TYPE(Geom_CylindricalSurface))) {
+ Handle(Geom_CylindricalSurface) aCyl =
+ Handle(Geom_CylindricalSurface)::DownCast(S);
+ Standard_Real Umin, Umax, Vmin, Vmax;
+ BRepTools::UVBounds(aFace, Umin, Umax, Vmin, Vmax);
+ if( Umin<-Precision::PConfusion() || Umax>2*PI+Precision::PConfusion() ) {
+ gp_Ax3 ax3 = aCyl->Position();
+ gp_Ax1 NDir = ax3.Axis();
+ gp_Ax3 newax3 = ax3.Rotated(NDir,Umin-Precision::PConfusion());
+ Handle(Geom_CylindricalSurface) aNewCyl =
+ new Geom_CylindricalSurface(newax3,aCyl->Radius());
+ aNewSurface = aNewCyl;
+ return Standard_True;
+ }
+ }
+
+ if(S->IsKind(STANDARD_TYPE(Geom_SphericalSurface))) {
+ Handle(Geom_SphericalSurface) aSphere = Handle(Geom_SphericalSurface)::DownCast(S);
+ Standard_Real Umin, Umax, Vmin, Vmax;
+ BRepTools::UVBounds(aFace, Umin, Umax, Vmin, Vmax);
+ if( Umin<-Precision::PConfusion() || Umax>2*PI+Precision::PConfusion() ) {
+ gp_Ax3 ax3 = aSphere->Position();
+ gp_Ax1 NDir = ax3.Axis();
+ gp_Ax3 newax3 = ax3.Rotated(NDir,Umin-Precision::PConfusion());
+ Handle(Geom_SphericalSurface) aNewSphere = new Geom_SphericalSurface(newax3,aSphere->Radius());
+ aNewSurface = aNewSphere;
+ return Standard_True;
+ }
+ }
+
+ return Standard_False;
+}
+
+
+//=======================================================================
+//function : NewSurface
+//purpose :
+//=======================================================================
+
+Standard_Boolean BlockFix_PeriodicSurfaceModifier::NewSurface(const TopoDS_Face& F,
+ Handle(Geom_Surface)& S,
+ TopLoc_Location& L,Standard_Real& Tol,
+ Standard_Boolean& RevWires,
+ Standard_Boolean& RevFace)
+{
+ TopLoc_Location LS;
+ Handle(Geom_Surface) SIni = BRep_Tool::Surface(F, LS);
+
+ if(ModifySurface(F, SIni, S)) {
+
+ RevWires = Standard_False;
+ RevFace = Standard_False;
+
+ L = LS;
+ Tol = BRep_Tool::Tolerance(F);
+
+ Standard_Integer anIndex = myMapOfSurfaces.Add(S);
+ myMapOfFaces.Bind(F,anIndex);
+ return Standard_True;
+ }
+
+ return Standard_False;
+}
+
+
+//=======================================================================
+//function : NewCurve
+//purpose :
+//=======================================================================
+
+Standard_Boolean BlockFix_PeriodicSurfaceModifier::NewCurve(const TopoDS_Edge& /*E*/,
+ Handle(Geom_Curve)& /*C*/,
+ TopLoc_Location& /*L*/,
+ Standard_Real& /*Tol*/)
+{
+ return Standard_False;
+}
+
+
+//=======================================================================
+//function : NewPoint
+//purpose :
+//=======================================================================
+
+Standard_Boolean BlockFix_PeriodicSurfaceModifier::NewPoint(const TopoDS_Vertex& /*V*/,
+ gp_Pnt& /*P*/,
+ Standard_Real& /*Tol*/)
+{
+ return Standard_False;
+}
+
+
+//=======================================================================
+//function : NewCurve2d
+//purpose :
+//=======================================================================
+
+Standard_Boolean BlockFix_PeriodicSurfaceModifier::NewCurve2d(const TopoDS_Edge& E,
+ const TopoDS_Face& F,
+ const TopoDS_Edge& /*NewE*/,
+ const TopoDS_Face& /*NewF*/,
+ Handle(Geom2d_Curve)& C,
+ Standard_Real& Tol)
+{
+ //check if undelying surface of the face was modified
+ if(myMapOfFaces.IsBound(F)) {
+ Standard_Integer anIndex = myMapOfFaces.Find(F);
+
+ Handle(Geom_Surface) aNewSurf = Handle(Geom_Surface)::DownCast(myMapOfSurfaces.FindKey(anIndex));
+
+ Standard_Real f,l;
+ TopLoc_Location LC, LS;
+ Handle(Geom_Curve) C3d = BRep_Tool::Curve ( E, LC, f, l );
+ Handle(Geom_Surface) S = BRep_Tool::Surface(F, LS);
+
+ //taking into accound the orientation of the seam
+ C = BRep_Tool::CurveOnSurface(E,F,f,l);
+ Tol = BRep_Tool::Tolerance(E);
+
+ BRep_Builder B;
+ TopoDS_Edge TempE;
+ B.MakeEdge(TempE);
+ B.Add(TempE, TopExp::FirstVertex(E));
+ B.Add(TempE, TopExp::LastVertex(E));
+
+ if(!C3d.IsNull())
+ B.UpdateEdge(TempE, Handle(Geom_Curve)::DownCast(C3d->Transformed(LC.Transformation())), Precision::Confusion());
+ B.Range(TempE, f, l);
+
+ Handle(ShapeFix_Edge) sfe = new ShapeFix_Edge;
+ Handle(Geom_Surface) STemp = Handle(Geom_Surface)::DownCast(aNewSurf->Transformed(LS.Transformation()));
+ TopLoc_Location LTemp;
+ LTemp.Identity();
+
+ Standard_Boolean isClosed = BRep_Tool::IsClosed (E, F);
+ Standard_Real aWorkTol = 2*myTolerance+Tol;
+ sfe->FixAddPCurve(TempE, STemp, LTemp, isClosed, Max(Precision::Confusion(), aWorkTol));
+ sfe->FixSameParameter(TempE);
+
+ //keep the orientation of original edge
+ TempE.Orientation(E.Orientation());
+ C = BRep_Tool::CurveOnSurface(TempE, STemp, LTemp, f, l);
+
+ //surface was modified
+ return Standard_True;
+ }
+
+ return Standard_False;
+}
+
+
+//=======================================================================
+//function : NewParameter
+//purpose :
+//=======================================================================
+
+Standard_Boolean BlockFix_PeriodicSurfaceModifier::NewParameter(const TopoDS_Vertex& /*V*/,
+ const TopoDS_Edge& /*E*/,
+ Standard_Real& /*P*/,
+ Standard_Real& /*Tol*/)
+{
+ return Standard_False;
+}
+
+
+//=======================================================================
+//function : Continuity
+//purpose :
+//=======================================================================
+
+GeomAbs_Shape BlockFix_PeriodicSurfaceModifier::Continuity(const TopoDS_Edge& E,
+ const TopoDS_Face& F1,
+ const TopoDS_Face& F2,
+ const TopoDS_Edge& /*NewE*/,
+ const TopoDS_Face& /*NewF1*/,
+ const TopoDS_Face& /*NewF2*/)
+{
+ return BRep_Tool::Continuity(E,F1,F2);
+}
+
--- /dev/null
+// File generated by CPPExt (Transient)
+//
+//
+// Copyright (C) 1991 - 2000 by
+// Matra Datavision SA. All rights reserved.
+//
+// Copyright (C) 2001 - 2004 by
+// Open CASCADE SA. All rights reserved.
+//
+// This file is part of the Open CASCADE Technology software.
+//
+// This software may be distributed and/or modified under the terms and
+// conditions of the Open CASCADE Public License as defined by Open CASCADE SA
+// and appearing in the file LICENSE included in the packaging of this file.
+//
+// This software is distributed on an "AS IS" basis, without warranty of any
+// kind, and Open CASCADE SA hereby disclaims all such warranties,
+// including without limitation, any warranties of merchantability, fitness
+// for a particular purpose or non-infringement. Please see the License for
+// the specific terms and conditions governing rights and limitations under the
+// License.
+
+#ifndef _BlockFix_PeriodicSurfaceModifier_HeaderFile
+#define _BlockFix_PeriodicSurfaceModifier_HeaderFile
+
+#ifndef _Standard_HeaderFile
+#include <Standard.hxx>
+#endif
+#ifndef _Handle_BlockFix_PeriodicSurfaceModifier_HeaderFile
+#include <Handle_BlockFix_PeriodicSurfaceModifier.hxx>
+#endif
+
+#ifndef _Standard_Real_HeaderFile
+#include <Standard_Real.hxx>
+#endif
+#ifndef _TopTools_DataMapOfShapeInteger_HeaderFile
+#include <TopTools_DataMapOfShapeInteger.hxx>
+#endif
+#ifndef _TColStd_IndexedMapOfTransient_HeaderFile
+#include <TColStd_IndexedMapOfTransient.hxx>
+#endif
+#ifndef _BRepTools_Modification_HeaderFile
+#include <BRepTools_Modification.hxx>
+#endif
+#ifndef _Standard_Boolean_HeaderFile
+#include <Standard_Boolean.hxx>
+#endif
+#ifndef _Handle_Geom_Surface_HeaderFile
+#include <Handle_Geom_Surface.hxx>
+#endif
+#ifndef _Handle_Geom_Curve_HeaderFile
+#include <Handle_Geom_Curve.hxx>
+#endif
+#ifndef _Handle_Geom2d_Curve_HeaderFile
+#include <Handle_Geom2d_Curve.hxx>
+#endif
+#ifndef _GeomAbs_Shape_HeaderFile
+#include <GeomAbs_Shape.hxx>
+#endif
+class TopoDS_Face;
+class Geom_Surface;
+class TopLoc_Location;
+class TopoDS_Edge;
+class Geom_Curve;
+class TopoDS_Vertex;
+class gp_Pnt;
+class Geom2d_Curve;
+
+
+class BlockFix_PeriodicSurfaceModifier : public BRepTools_Modification {
+
+public:
+
+ void* operator new(size_t,void* anAddress)
+ {
+ return anAddress;
+ }
+ void* operator new(size_t size)
+ {
+ return Standard::Allocate(size);
+ }
+ void operator delete(void *anAddress)
+ {
+ if (anAddress) Standard::Free((Standard_Address&)anAddress);
+ }
+ // Methods PUBLIC
+ //
+Standard_EXPORT BlockFix_PeriodicSurfaceModifier();
+Standard_EXPORT void SetTolerance(const Standard_Real Toler) ;
+Standard_EXPORT Standard_Boolean NewSurface(const TopoDS_Face& F,Handle(Geom_Surface)& S,TopLoc_Location& L,Standard_Real& Tol,Standard_Boolean& RevWires,Standard_Boolean& RevFace) ;
+Standard_EXPORT Standard_Boolean NewCurve(const TopoDS_Edge& E,Handle(Geom_Curve)& C,TopLoc_Location& L,Standard_Real& Tol) ;
+Standard_EXPORT Standard_Boolean NewPoint(const TopoDS_Vertex& V,gp_Pnt& P,Standard_Real& Tol) ;
+Standard_EXPORT Standard_Boolean NewCurve2d(const TopoDS_Edge& E,const TopoDS_Face& F,const TopoDS_Edge& NewE,const TopoDS_Face& NewF,Handle(Geom2d_Curve)& C,Standard_Real& Tol) ;
+Standard_EXPORT Standard_Boolean NewParameter(const TopoDS_Vertex& V,const TopoDS_Edge& E,Standard_Real& P,Standard_Real& Tol) ;
+Standard_EXPORT GeomAbs_Shape Continuity(const TopoDS_Edge& E,const TopoDS_Face& F1,const TopoDS_Face& F2,const TopoDS_Edge& NewE,const TopoDS_Face& NewF1,const TopoDS_Face& NewF2) ;
+Standard_EXPORT ~BlockFix_PeriodicSurfaceModifier();
+
+
+
+
+ // Type management
+ //
+ Standard_EXPORT friend Handle_Standard_Type& BlockFix_PeriodicSurfaceModifier_Type_();
+ Standard_EXPORT const Handle(Standard_Type)& DynamicType() const;
+ Standard_EXPORT Standard_Boolean IsKind(const Handle(Standard_Type)&) const;
+
+protected:
+
+ // Methods PROTECTED
+ //
+
+
+ // Fields PROTECTED
+ //
+
+
+private:
+
+ // Methods PRIVATE
+ //
+
+
+ // Fields PRIVATE
+ //
+Standard_Real myTolerance;
+TopTools_DataMapOfShapeInteger myMapOfFaces;
+TColStd_IndexedMapOfTransient myMapOfSurfaces;
+
+
+};
+
+
+
+
+
+// other Inline functions and methods (like "C++: function call" methods)
+//
+
+
+#endif
--- /dev/null
+// File generated by CPPExt (Transient)
+//
+// Copyright (C) 1991 - 2000 by
+// Matra Datavision SA. All rights reserved.
+//
+// Copyright (C) 2001 - 2004 by
+// Open CASCADE SA. All rights reserved.
+//
+// This file is part of the Open CASCADE Technology software.
+//
+// This software may be distributed and/or modified under the terms and
+// conditions of the Open CASCADE Public License as defined by Open CASCADE SA
+// and appearing in the file LICENSE included in the packaging of this file.
+//
+// This software is distributed on an "AS IS" basis, without warranty of any
+// kind, and Open CASCADE SA hereby disclaims all such warranties,
+// including without limitation, any warranties of merchantability, fitness
+// for a particular purpose or non-infringement. Please see the License for
+// the specific terms and conditions governing rights and limitations under the
+// License.
+
+#include <BlockFix_PeriodicSurfaceModifier.jxx>
+
+#ifndef _Standard_TypeMismatch_HeaderFile
+#include <Standard_TypeMismatch.hxx>
+#endif
+
+BlockFix_PeriodicSurfaceModifier::~BlockFix_PeriodicSurfaceModifier() {}
+
+
+
+Standard_EXPORT Handle_Standard_Type& BlockFix_PeriodicSurfaceModifier_Type_()
+{
+
+ static Handle_Standard_Type aType1 = STANDARD_TYPE(BRepTools_Modification);
+ if ( aType1.IsNull()) aType1 = STANDARD_TYPE(BRepTools_Modification);
+ static Handle_Standard_Type aType2 = STANDARD_TYPE(MMgt_TShared);
+ if ( aType2.IsNull()) aType2 = STANDARD_TYPE(MMgt_TShared);
+ static Handle_Standard_Type aType3 = STANDARD_TYPE(Standard_Transient);
+ if ( aType3.IsNull()) aType3 = STANDARD_TYPE(Standard_Transient);
+
+
+ static Handle_Standard_Transient _Ancestors[]= {aType1,aType2,aType3,NULL};
+ static Handle_Standard_Type _aType = new Standard_Type("BlockFix_PeriodicSurfaceModifier",
+ sizeof(BlockFix_PeriodicSurfaceModifier),
+ 1,
+ (Standard_Address)_Ancestors,
+ (Standard_Address)NULL);
+
+ return _aType;
+}
+
+
+// DownCast method
+// allow safe downcasting
+//
+const Handle(BlockFix_PeriodicSurfaceModifier) Handle(BlockFix_PeriodicSurfaceModifier)::DownCast(const Handle(Standard_Transient)& AnObject)
+{
+ Handle(BlockFix_PeriodicSurfaceModifier) _anOtherObject;
+
+ if (!AnObject.IsNull()) {
+ if (AnObject->IsKind(STANDARD_TYPE(BlockFix_PeriodicSurfaceModifier))) {
+ _anOtherObject = Handle(BlockFix_PeriodicSurfaceModifier)((Handle(BlockFix_PeriodicSurfaceModifier)&)AnObject);
+ }
+ }
+
+ return _anOtherObject ;
+}
+const Handle(Standard_Type)& BlockFix_PeriodicSurfaceModifier::DynamicType() const
+{
+ return STANDARD_TYPE(BlockFix_PeriodicSurfaceModifier) ;
+}
+Standard_Boolean BlockFix_PeriodicSurfaceModifier::IsKind(const Handle(Standard_Type)& AType) const
+{
+ return (STANDARD_TYPE(BlockFix_PeriodicSurfaceModifier) == AType || BRepTools_Modification::IsKind(AType));
+}
+Handle_BlockFix_PeriodicSurfaceModifier::~Handle_BlockFix_PeriodicSurfaceModifier() {}
+
--- /dev/null
+#ifndef _TopoDS_Face_HeaderFile
+#include <TopoDS_Face.hxx>
+#endif
+#ifndef _Geom_Surface_HeaderFile
+#include <Geom_Surface.hxx>
+#endif
+#ifndef _TopLoc_Location_HeaderFile
+#include <TopLoc_Location.hxx>
+#endif
+#ifndef _TopoDS_Edge_HeaderFile
+#include <TopoDS_Edge.hxx>
+#endif
+#ifndef _Geom_Curve_HeaderFile
+#include <Geom_Curve.hxx>
+#endif
+#ifndef _TopoDS_Vertex_HeaderFile
+#include <TopoDS_Vertex.hxx>
+#endif
+#ifndef _gp_Pnt_HeaderFile
+#include <gp_Pnt.hxx>
+#endif
+#ifndef _Geom2d_Curve_HeaderFile
+#include <Geom2d_Curve.hxx>
+#endif
+#ifndef _BlockFix_PeriodicSurfaceModifier_HeaderFile
+#include <BlockFix_PeriodicSurfaceModifier.hxx>
+#endif
--- /dev/null
+-- File: BlockFix_SphereSpaceModifier.cdl
+-- Created: Tue Dec 7 12:01:49 2004
+-- Author: Pavel Durandin
+-- <det@doomox>
+---Copyright: Open CASCADE SA 2004
+
+
+class SphereSpaceModifier from BlockFix inherits Modification from BRepTools
+
+ ---Purpose: Rotation of the parametric space of the sphere in order
+ -- to avoid the seam and degenerared edge within it
+
+uses
+ Vertex from TopoDS,
+ Edge from TopoDS,
+ Face from TopoDS,
+ Location from TopLoc,
+ Shape from GeomAbs,
+ Pnt from gp,
+ Curve from Geom,
+ Curve from Geom2d,
+ Surface from Geom,
+ IndexedMapOfTransient from TColStd,
+ DataMapOfShapeInteger from TopTools
+
+is
+
+ Create returns mutable SphereSpaceModifier from BlockFix;
+
+ SetTolerance(me: mutable; Toler: Real);
+ ---Purpose: Sets the tolerance for recognition of geometry
+
+ NewSurface(me: mutable; F : Face from TopoDS;
+ S : out Surface from Geom;
+ L : out Location from TopLoc;
+ Tol: out Real from Standard;
+ RevWires : out Boolean from Standard;
+ RevFace : out Boolean from Standard)
+ returns Boolean from Standard;
+ ---Purpose: Returns Standard_True if the face <F> has been
+ -- modified. In this case, <S> is the new geometric
+ -- support of the face, <L> the new location, <Tol>
+ -- the new tolerance. Otherwise, returns
+ -- Standard_False, and <S>, <L>, <Tol> are not
+ -- significant.
+
+ NewCurve(me: mutable; E : Edge from TopoDS;
+ C : out Curve from Geom;
+ L : out Location from TopLoc;
+ Tol: out Real from Standard)
+ returns Boolean from Standard;
+ ---Purpose: Returns Standard_True if the edge <E> has been
+ -- modified. In this case, <C> is the new geometric
+ -- support of the edge, <L> the new location, <Tol>
+ -- the new tolerance. Otherwise, returns
+ -- Standard_False, and <C>, <L>, <Tol> are not
+ -- significant.
+
+ NewPoint(me: mutable; V : Vertex from TopoDS;
+ P : out Pnt from gp;
+ Tol: out Real from Standard)
+ returns Boolean from Standard;
+ ---Purpose: Returns Standard_True if the vertex <V> has been
+ -- modified. In this case, <P> is the new geometric
+ -- support of the vertex, <Tol> the new tolerance.
+ -- Otherwise, returns Standard_False, and <P>, <Tol>
+ -- are not significant.
+
+ NewCurve2d(me: mutable; E : Edge from TopoDS;
+ F : Face from TopoDS;
+ NewE : Edge from TopoDS;
+ NewF : Face from TopoDS;
+ C : out Curve from Geom2d;
+ Tol : out Real from Standard)
+ returns Boolean from Standard;
+ ---Purpose: Returns Standard_True if the edge <E> has a new
+ -- curve on surface on the face <F>.In this case, <C>
+ -- is the new geometric support of the edge, <L> the
+ -- new location, <Tol> the new tolerance.
+ --
+ -- Otherwise, returns Standard_False, and <C>, <L>,
+ -- <Tol> are not significant.
+ --
+ -- <NewE> is the new edge created from <E>. <NewF>
+ -- is the new face created from <F>. They may be usefull.
+
+ NewParameter(me: mutable; V : Vertex from TopoDS;
+ E : Edge from TopoDS;
+ P : out Real from Standard;
+ Tol: out Real from Standard)
+ returns Boolean from Standard;
+ ---Purpose: Returns Standard_True if the Vertex <V> has a new
+ -- parameter on the edge <E>. In this case, <P> is
+ -- the parameter, <Tol> the new tolerance.
+ -- Otherwise, returns Standard_False, and <P>, <Tol>
+ -- are not significant.
+
+ Continuity(me: mutable; E : Edge from TopoDS;
+ F1,F2 : Face from TopoDS;
+ NewE : Edge from TopoDS;
+ NewF1,NewF2: Face from TopoDS)
+ returns Shape from GeomAbs;
+ ---Purpose: Returns the continuity of <NewE> between <NewF1>
+ -- and <NewF2>.
+ --
+ -- <NewE> is the new edge created from <E>. <NewF1>
+ -- (resp. <NewF2>) is the new face created from <F1>
+ -- (resp. <F2>).
+
+ ForRotation(me: mutable; F: Face from TopoDS) returns Boolean;
+
+fields
+
+ myTolerance : Real;
+ myMapOfFaces : DataMapOfShapeInteger from TopTools;
+ myMapOfSpheres: IndexedMapOfTransient from TColStd;
+ --myMapOfGeom: MapOfShapeTransient from TColStd;
+
+end SphereSpaceModifier;
+
--- /dev/null
+// File: BlockFix.cxx
+// Created: Tue Dec 7 11:59:05 2004
+// Author: Pavel DURANDIN
+// Copyright: Open CASCADE SA 2004
+
+#include <BlockFix_SphereSpaceModifier.ixx>
+
+#include <TopLoc_Location.hxx>
+#include <BRep_Tool.hxx>
+#include <Geom_SphericalSurface.hxx>
+#include <Geom_RectangularTrimmedSurface.hxx>
+#include <ShapeAnalysis.hxx>
+#include <gp_Sphere.hxx>
+#include <BRep_Builder.hxx>
+#include <TopoDS.hxx>
+#include <TopoDS_Vertex.hxx>
+#include <TopoDS_Edge.hxx>
+#include <TopExp.hxx>
+#include <ShapeFix_Edge.hxx>
+#include <Geom_Curve.hxx>
+#include <Geom2d_Curve.hxx>
+
+
+//=======================================================================
+//function : BlockFix_SphereSpaceModifier
+//purpose :
+//=======================================================================
+
+BlockFix_SphereSpaceModifier::BlockFix_SphereSpaceModifier()
+{
+ myMapOfFaces.Clear();
+ myMapOfSpheres.Clear();
+}
+
+//=======================================================================
+//function : SetTolerance
+//purpose :
+//=======================================================================
+
+void BlockFix_SphereSpaceModifier::SetTolerance(const Standard_Real Tol)
+{
+ myTolerance = Tol;
+}
+
+
+//=======================================================================
+//function : NewSurface
+//purpose :
+//=======================================================================
+
+
+static Standard_Boolean ModifySurface(const TopoDS_Face& aFace,
+ const Handle(Geom_Surface)& aSurface,
+ Handle(Geom_Surface)& aNewSurface)
+{
+ Handle(Geom_Surface) S = aSurface;
+ if(S->IsKind(STANDARD_TYPE(Geom_RectangularTrimmedSurface))) {
+ Handle(Geom_RectangularTrimmedSurface) RTS =
+ Handle(Geom_RectangularTrimmedSurface)::DownCast(S);
+ S = RTS->BasisSurface();
+ }
+
+ if(S->IsKind(STANDARD_TYPE(Geom_SphericalSurface))) {
+ Standard_Real Umin, Umax, Vmin, Vmax;
+ ShapeAnalysis::GetFaceUVBounds(aFace,Umin, Umax, Vmin, Vmax);
+ Standard_Real PI2 = PI/2.;
+ if(Vmax > PI2 - Precision::PConfusion() || Vmin < -PI2+::Precision::PConfusion()) {
+ if(Abs(Vmax-Vmin) < PI2) {
+ Handle(Geom_SphericalSurface) aSphere = Handle(Geom_SphericalSurface)::DownCast(S);
+ gp_Sphere sp = aSphere->Sphere();
+ gp_Ax3 ax3 = sp.Position();
+ gp_Ax3 axnew3(ax3.Axis().Location(), ax3.Direction()^ax3.XDirection(),ax3.XDirection());
+ sp.SetPosition(axnew3);
+ Handle(Geom_SphericalSurface) aNewSphere = new Geom_SphericalSurface(sp);
+ aNewSurface = aNewSphere;
+ return Standard_True;
+ }
+ }
+ }
+ return Standard_False;
+}
+
+
+Standard_Boolean BlockFix_SphereSpaceModifier::NewSurface(const TopoDS_Face& F,
+ Handle(Geom_Surface)& S,
+ TopLoc_Location& L,Standard_Real& Tol,
+ Standard_Boolean& RevWires,
+ Standard_Boolean& RevFace)
+{
+ TopLoc_Location LS;
+ Handle(Geom_Surface) SIni = BRep_Tool::Surface(F, LS);
+
+ //check if pole of the sphere in the parametric space
+ if(ModifySurface(F, SIni, S)) {
+
+ RevWires = Standard_False;
+ RevFace = Standard_False;
+
+ L = LS;
+ Tol = BRep_Tool::Tolerance(F);
+
+ Standard_Integer anIndex = myMapOfSpheres.Add(S);
+ myMapOfFaces.Bind(F,anIndex);
+ return Standard_True;
+ }
+
+ return Standard_False;
+}
+
+//=======================================================================
+//function : NewCurve
+//purpose :
+//=======================================================================
+
+Standard_Boolean BlockFix_SphereSpaceModifier::NewCurve(const TopoDS_Edge& /*E*/,Handle(Geom_Curve)& /*C*/,
+ TopLoc_Location& /*L*/,Standard_Real& /*Tol*/)
+{
+ return Standard_False;
+}
+
+//=======================================================================
+//function : NewPoint
+//purpose :
+//=======================================================================
+
+Standard_Boolean BlockFix_SphereSpaceModifier::NewPoint(const TopoDS_Vertex& /*V*/,
+ gp_Pnt& /*P*/,
+ Standard_Real& /*Tol*/)
+{
+ return Standard_False;
+}
+
+//=======================================================================
+//function : NewCurve2d
+//purpose :
+//=======================================================================
+
+Standard_Boolean BlockFix_SphereSpaceModifier::NewCurve2d(const TopoDS_Edge& E,const TopoDS_Face& F,
+ const TopoDS_Edge& /*NewE*/,const TopoDS_Face& /*NewF*/,
+ Handle(Geom2d_Curve)& C,Standard_Real& Tol)
+{
+ //check if undelying surface of the face was modified
+ if(myMapOfFaces.IsBound(F)) {
+ Standard_Integer anIndex = myMapOfFaces.Find(F);
+
+ Handle(Geom_Surface) aNewSphere = Handle(Geom_Surface)::DownCast(myMapOfSpheres.FindKey(anIndex));
+
+ Standard_Real f,l;
+ TopLoc_Location LC, LS;
+ Handle(Geom_Curve) C3d = BRep_Tool::Curve ( E, LC, f, l );
+ Handle(Geom_Surface) S = BRep_Tool::Surface(F, LS);
+
+ //taking into accound the orientation of the seam
+ C = BRep_Tool::CurveOnSurface(E,F,f,l);
+ Tol = BRep_Tool::Tolerance(E);
+
+ BRep_Builder B;
+ TopoDS_Edge TempE;
+ B.MakeEdge(TempE);
+ B.Add(TempE, TopExp::FirstVertex(E));
+ B.Add(TempE, TopExp::LastVertex(E));
+
+ if(!C3d.IsNull())
+ B.UpdateEdge(TempE, Handle(Geom_Curve)::DownCast(C3d->Transformed(LC.Transformation())), Precision::Confusion());
+ B.Range(TempE, f, l);
+
+ Handle(ShapeFix_Edge) sfe = new ShapeFix_Edge;
+ Handle(Geom_Surface) STemp = Handle(Geom_Surface)::DownCast(aNewSphere->Transformed(LS.Transformation()));
+ TopLoc_Location LTemp;
+ LTemp.Identity();
+
+ Standard_Boolean isClosed = BRep_Tool::IsClosed (E, F);
+ Standard_Real aWorkTol = 2*myTolerance+Tol;
+ sfe->FixAddPCurve(TempE, STemp, LTemp, isClosed, Max(Precision::Confusion(), aWorkTol));
+ sfe->FixSameParameter(TempE);
+
+ //keep the orientation of original edge
+ TempE.Orientation(E.Orientation());
+ C = BRep_Tool::CurveOnSurface(TempE, STemp, LTemp, f, l);
+
+ // shifting seam of sphere
+ if(isClosed && !C.IsNull()) {
+ Standard_Real f2,l2;
+ Handle(Geom2d_Curve) c22 =
+ BRep_Tool::CurveOnSurface(TopoDS::Edge(TempE.Reversed()),STemp, LTemp,f2,l2);
+ Standard_Real dPreci = Precision::PConfusion()*Precision::PConfusion();
+ if((C->Value(f).SquareDistance(c22->Value(f2)) < dPreci)
+ ||(C->Value(l).SquareDistance(c22->Value(l2)) < dPreci)) {
+ gp_Vec2d shift(S->UPeriod(),0.);
+ C->Translate(shift);
+ }
+ }
+ //sphere was modified
+ return Standard_True;
+ }
+
+ return Standard_False;
+}
+
+
+//=======================================================================
+//function : NewParameter
+//purpose :
+//=======================================================================
+
+Standard_Boolean BlockFix_SphereSpaceModifier::NewParameter(const TopoDS_Vertex& /*V*/,const TopoDS_Edge& /*E*/,
+ Standard_Real& /*P*/,Standard_Real& /*Tol*/)
+{
+ return Standard_False;
+}
+
+
+//=======================================================================
+//function : Continuity
+//purpose :
+//=======================================================================
+
+GeomAbs_Shape BlockFix_SphereSpaceModifier::Continuity(const TopoDS_Edge& E,const TopoDS_Face& F1,
+ const TopoDS_Face& F2,const TopoDS_Edge& /*NewE*/,
+ const TopoDS_Face& /*NewF1*/,const TopoDS_Face& /*NewF2*/)
+{
+ return BRep_Tool::Continuity(E,F1,F2);
+}
+
--- /dev/null
+// File generated by CPPExt (Transient)
+//
+//
+// Copyright (C) 1991 - 2000 by
+// Matra Datavision SA. All rights reserved.
+//
+// Copyright (C) 2001 - 2004 by
+// Open CASCADE SA. All rights reserved.
+//
+// This file is part of the Open CASCADE Technology software.
+//
+// This software may be distributed and/or modified under the terms and
+// conditions of the Open CASCADE Public License as defined by Open CASCADE SA
+// and appearing in the file LICENSE included in the packaging of this file.
+//
+// This software is distributed on an "AS IS" basis, without warranty of any
+// kind, and Open CASCADE SA hereby disclaims all such warranties,
+// including without limitation, any warranties of merchantability, fitness
+// for a particular purpose or non-infringement. Please see the License for
+// the specific terms and conditions governing rights and limitations under the
+// License.
+
+#ifndef _BlockFix_SphereSpaceModifier_HeaderFile
+#define _BlockFix_SphereSpaceModifier_HeaderFile
+
+#ifndef _Standard_HeaderFile
+#include <Standard.hxx>
+#endif
+#ifndef _Handle_BlockFix_SphereSpaceModifier_HeaderFile
+#include <Handle_BlockFix_SphereSpaceModifier.hxx>
+#endif
+
+#ifndef _Standard_Real_HeaderFile
+#include <Standard_Real.hxx>
+#endif
+#ifndef _TopTools_DataMapOfShapeInteger_HeaderFile
+#include <TopTools_DataMapOfShapeInteger.hxx>
+#endif
+#ifndef _TColStd_IndexedMapOfTransient_HeaderFile
+#include <TColStd_IndexedMapOfTransient.hxx>
+#endif
+#ifndef _BRepTools_Modification_HeaderFile
+#include <BRepTools_Modification.hxx>
+#endif
+#ifndef _Standard_Boolean_HeaderFile
+#include <Standard_Boolean.hxx>
+#endif
+#ifndef _Handle_Geom_Surface_HeaderFile
+#include <Handle_Geom_Surface.hxx>
+#endif
+#ifndef _Handle_Geom_Curve_HeaderFile
+#include <Handle_Geom_Curve.hxx>
+#endif
+#ifndef _Handle_Geom2d_Curve_HeaderFile
+#include <Handle_Geom2d_Curve.hxx>
+#endif
+#ifndef _GeomAbs_Shape_HeaderFile
+#include <GeomAbs_Shape.hxx>
+#endif
+class TopoDS_Face;
+class Geom_Surface;
+class TopLoc_Location;
+class TopoDS_Edge;
+class Geom_Curve;
+class TopoDS_Vertex;
+class gp_Pnt;
+class Geom2d_Curve;
+
+
+class BlockFix_SphereSpaceModifier : public BRepTools_Modification {
+
+public:
+
+ void* operator new(size_t,void* anAddress)
+ {
+ return anAddress;
+ }
+ void* operator new(size_t size)
+ {
+ return Standard::Allocate(size);
+ }
+ void operator delete(void *anAddress)
+ {
+ if (anAddress) Standard::Free((Standard_Address&)anAddress);
+ }
+ // Methods PUBLIC
+ //
+Standard_EXPORT BlockFix_SphereSpaceModifier();
+Standard_EXPORT void SetTolerance(const Standard_Real Toler) ;
+Standard_EXPORT Standard_Boolean NewSurface(const TopoDS_Face& F,Handle(Geom_Surface)& S,TopLoc_Location& L,Standard_Real& Tol,Standard_Boolean& RevWires,Standard_Boolean& RevFace) ;
+Standard_EXPORT Standard_Boolean NewCurve(const TopoDS_Edge& E,Handle(Geom_Curve)& C,TopLoc_Location& L,Standard_Real& Tol) ;
+Standard_EXPORT Standard_Boolean NewPoint(const TopoDS_Vertex& V,gp_Pnt& P,Standard_Real& Tol) ;
+Standard_EXPORT Standard_Boolean NewCurve2d(const TopoDS_Edge& E,const TopoDS_Face& F,const TopoDS_Edge& NewE,const TopoDS_Face& NewF,Handle(Geom2d_Curve)& C,Standard_Real& Tol) ;
+Standard_EXPORT Standard_Boolean NewParameter(const TopoDS_Vertex& V,const TopoDS_Edge& E,Standard_Real& P,Standard_Real& Tol) ;
+Standard_EXPORT GeomAbs_Shape Continuity(const TopoDS_Edge& E,const TopoDS_Face& F1,const TopoDS_Face& F2,const TopoDS_Edge& NewE,const TopoDS_Face& NewF1,const TopoDS_Face& NewF2) ;
+Standard_EXPORT Standard_Boolean ForRotation(const TopoDS_Face& F) ;
+Standard_EXPORT ~BlockFix_SphereSpaceModifier();
+
+
+
+
+ // Type management
+ //
+ Standard_EXPORT friend Handle_Standard_Type& BlockFix_SphereSpaceModifier_Type_();
+ Standard_EXPORT const Handle(Standard_Type)& DynamicType() const;
+ Standard_EXPORT Standard_Boolean IsKind(const Handle(Standard_Type)&) const;
+
+protected:
+
+ // Methods PROTECTED
+ //
+
+
+ // Fields PROTECTED
+ //
+
+
+private:
+
+ // Methods PRIVATE
+ //
+
+
+ // Fields PRIVATE
+ //
+Standard_Real myTolerance;
+TopTools_DataMapOfShapeInteger myMapOfFaces;
+TColStd_IndexedMapOfTransient myMapOfSpheres;
+
+
+};
+
+
+
+
+
+// other Inline functions and methods (like "C++: function call" methods)
+//
+
+
+#endif
--- /dev/null
+// File generated by CPPExt (Transient)
+//
+// Copyright (C) 1991 - 2000 by
+// Matra Datavision SA. All rights reserved.
+//
+// Copyright (C) 2001 - 2004 by
+// Open CASCADE SA. All rights reserved.
+//
+// This file is part of the Open CASCADE Technology software.
+//
+// This software may be distributed and/or modified under the terms and
+// conditions of the Open CASCADE Public License as defined by Open CASCADE SA
+// and appearing in the file LICENSE included in the packaging of this file.
+//
+// This software is distributed on an "AS IS" basis, without warranty of any
+// kind, and Open CASCADE SA hereby disclaims all such warranties,
+// including without limitation, any warranties of merchantability, fitness
+// for a particular purpose or non-infringement. Please see the License for
+// the specific terms and conditions governing rights and limitations under the
+// License.
+
+#include <BlockFix_SphereSpaceModifier.jxx>
+
+#ifndef _Standard_TypeMismatch_HeaderFile
+#include <Standard_TypeMismatch.hxx>
+#endif
+
+BlockFix_SphereSpaceModifier::~BlockFix_SphereSpaceModifier() {}
+
+
+
+Standard_EXPORT Handle_Standard_Type& BlockFix_SphereSpaceModifier_Type_()
+{
+
+ static Handle_Standard_Type aType1 = STANDARD_TYPE(BRepTools_Modification);
+ if ( aType1.IsNull()) aType1 = STANDARD_TYPE(BRepTools_Modification);
+ static Handle_Standard_Type aType2 = STANDARD_TYPE(MMgt_TShared);
+ if ( aType2.IsNull()) aType2 = STANDARD_TYPE(MMgt_TShared);
+ static Handle_Standard_Type aType3 = STANDARD_TYPE(Standard_Transient);
+ if ( aType3.IsNull()) aType3 = STANDARD_TYPE(Standard_Transient);
+
+
+ static Handle_Standard_Transient _Ancestors[]= {aType1,aType2,aType3,NULL};
+ static Handle_Standard_Type _aType = new Standard_Type("BlockFix_SphereSpaceModifier",
+ sizeof(BlockFix_SphereSpaceModifier),
+ 1,
+ (Standard_Address)_Ancestors,
+ (Standard_Address)NULL);
+
+ return _aType;
+}
+
+
+// DownCast method
+// allow safe downcasting
+//
+const Handle(BlockFix_SphereSpaceModifier) Handle(BlockFix_SphereSpaceModifier)::DownCast(const Handle(Standard_Transient)& AnObject)
+{
+ Handle(BlockFix_SphereSpaceModifier) _anOtherObject;
+
+ if (!AnObject.IsNull()) {
+ if (AnObject->IsKind(STANDARD_TYPE(BlockFix_SphereSpaceModifier))) {
+ _anOtherObject = Handle(BlockFix_SphereSpaceModifier)((Handle(BlockFix_SphereSpaceModifier)&)AnObject);
+ }
+ }
+
+ return _anOtherObject ;
+}
+const Handle(Standard_Type)& BlockFix_SphereSpaceModifier::DynamicType() const
+{
+ return STANDARD_TYPE(BlockFix_SphereSpaceModifier) ;
+}
+Standard_Boolean BlockFix_SphereSpaceModifier::IsKind(const Handle(Standard_Type)& AType) const
+{
+ return (STANDARD_TYPE(BlockFix_SphereSpaceModifier) == AType || BRepTools_Modification::IsKind(AType));
+}
+Handle_BlockFix_SphereSpaceModifier::~Handle_BlockFix_SphereSpaceModifier() {}
+
--- /dev/null
+#ifndef _TopoDS_Face_HeaderFile
+#include <TopoDS_Face.hxx>
+#endif
+#ifndef _Geom_Surface_HeaderFile
+#include <Geom_Surface.hxx>
+#endif
+#ifndef _TopLoc_Location_HeaderFile
+#include <TopLoc_Location.hxx>
+#endif
+#ifndef _TopoDS_Edge_HeaderFile
+#include <TopoDS_Edge.hxx>
+#endif
+#ifndef _Geom_Curve_HeaderFile
+#include <Geom_Curve.hxx>
+#endif
+#ifndef _TopoDS_Vertex_HeaderFile
+#include <TopoDS_Vertex.hxx>
+#endif
+#ifndef _gp_Pnt_HeaderFile
+#include <gp_Pnt.hxx>
+#endif
+#ifndef _Geom2d_Curve_HeaderFile
+#include <Geom2d_Curve.hxx>
+#endif
+#ifndef _BlockFix_SphereSpaceModifier_HeaderFile
+#include <BlockFix_SphereSpaceModifier.hxx>
+#endif
--- /dev/null
+-- File: BlockFix_UnionEdges.cdl
+-- Created: Tue Dec 7 15:24:51 2004
+-- Author: Sergey KUUL
+-- <skl@novgorox.nnov.matra-dtv.fr>
+
+class UnionEdges from BlockFix
+
+ ---Purpose:
+
+uses
+
+ Shape from TopoDS,
+ ReShape from ShapeBuild
+
+is
+
+ Create returns UnionEdges from BlockFix;
+
+ Perform(me: in out; Shape: Shape from TopoDS;
+ Tol : Real)
+ returns Shape from TopoDS;
+
+fields
+
+ myTolerance : Real;
+ myContext : ReShape from ShapeBuild;
+
+end UnionEdges;
--- /dev/null
+// File: BlockFix_UnionEdges.cxx
+// Created: 07.12.04 15:27:30
+// Author: Sergey KUUL
+
+
+#include <BlockFix_UnionEdges.ixx>
+
+#include <Approx_Curve3d.hxx>
+#include <BRepAdaptor_HCompCurve.hxx>
+#include <BRep_Builder.hxx>
+#include <BRep_Tool.hxx>
+#include <GC_MakeCircle.hxx>
+#include <Geom_BSplineCurve.hxx>
+#include <Geom_Circle.hxx>
+#include <Geom_Curve.hxx>
+#include <Geom_Line.hxx>
+#include <Geom_TrimmedCurve.hxx>
+#include <ShapeAnalysis_Edge.hxx>
+#include <ShapeFix_Edge.hxx>
+#include <ShapeFix_Face.hxx>
+#include <TColgp_SequenceOfPnt.hxx>
+#include <TColStd_MapOfInteger.hxx>
+#include <TopExp.hxx>
+#include <TopExp_Explorer.hxx>
+#include <TopTools_IndexedDataMapOfShapeListOfShape.hxx>
+#include <TopTools_IndexedMapOfShape.hxx>
+#include <TopTools_ListOfShape.hxx>
+#include <TopTools_MapOfShape.hxx>
+#include <TopTools_ListIteratorOfListOfShape.hxx>
+#include <TopTools_SequenceOfShape.hxx>
+#include <TopoDS.hxx>
+#include <TopoDS_Edge.hxx>
+#include <TopoDS_Face.hxx>
+#include <TopoDS_Solid.hxx>
+#include <TopoDS_Vertex.hxx>
+#include <TopoDS_Iterator.hxx>
+
+
+//=======================================================================
+//function : BlockFix_UnionEdges()
+//purpose : Constructor
+//=======================================================================
+
+BlockFix_UnionEdges::BlockFix_UnionEdges ( )
+{
+}
+
+
+//=======================================================================
+//function : MergeEdges
+//purpose : auxilary
+//=======================================================================
+static Standard_Boolean MergeEdges(const TopTools_SequenceOfShape& SeqEdges,
+ const TopoDS_Face& aFace,
+ const Standard_Real Tol,
+ TopoDS_Edge& anEdge)
+{
+ // make chain for union
+ BRep_Builder B;
+ ShapeAnalysis_Edge sae;
+ TopoDS_Edge FirstE = TopoDS::Edge(SeqEdges.Value(1));
+ TopoDS_Edge LastE = FirstE;
+ TopoDS_Vertex VF = sae.FirstVertex(FirstE);
+ TopoDS_Vertex VL = sae.LastVertex(LastE);
+ TopTools_SequenceOfShape aChain;
+ aChain.Append(FirstE);
+ TColStd_MapOfInteger IndUsedEdges;
+ IndUsedEdges.Add(1);
+ Standard_Integer j;
+ for (j = 2; j <= SeqEdges.Length(); j++) {
+ for(Standard_Integer k=2; k<=SeqEdges.Length(); k++) {
+ if(IndUsedEdges.Contains(k)) continue;
+ TopoDS_Edge edge = TopoDS::Edge(SeqEdges.Value(k));
+ TopoDS_Vertex VF2 = sae.FirstVertex(edge);
+ TopoDS_Vertex VL2 = sae.LastVertex(edge);
+ if(sae.FirstVertex(edge).IsSame(VL)) {
+ aChain.Append(edge);
+ LastE = edge;
+ VL = sae.LastVertex(LastE);
+ IndUsedEdges.Add(k);
+ }
+ else if(sae.LastVertex(edge).IsSame(VF)) {
+ aChain.Prepend(edge);
+ FirstE = edge;
+ VF = sae.FirstVertex(FirstE);
+ IndUsedEdges.Add(k);
+ }
+ }
+ }
+ if(aChain.Length()<SeqEdges.Length()) {
+ cout<<"can not create correct chain..."<<endl;
+ return Standard_False;
+ }
+ // union edges in chain
+ // first step: union lines and circles
+ TopLoc_Location Loc;
+ Standard_Real fp1,lp1,fp2,lp2;
+ for (j = 1; j < aChain.Length(); j++) {
+ TopoDS_Edge edge1 = TopoDS::Edge(aChain.Value(j));
+ Handle(Geom_Curve) c3d1 = BRep_Tool::Curve(edge1,Loc,fp1,lp1);
+ if(c3d1.IsNull()) break;
+ while(c3d1->IsKind(STANDARD_TYPE(Geom_TrimmedCurve))) {
+ Handle(Geom_TrimmedCurve) tc =
+ Handle(Geom_TrimmedCurve)::DownCast(c3d1);
+ c3d1 = tc->BasisCurve();
+ }
+ TopoDS_Edge edge2 = TopoDS::Edge(aChain.Value(j+1));
+ Handle(Geom_Curve) c3d2 = BRep_Tool::Curve(edge2,Loc,fp2,lp2);
+ if(c3d2.IsNull()) break;
+ while(c3d2->IsKind(STANDARD_TYPE(Geom_TrimmedCurve))) {
+ Handle(Geom_TrimmedCurve) tc =
+ Handle(Geom_TrimmedCurve)::DownCast(c3d2);
+ c3d2 = tc->BasisCurve();
+ }
+ if( c3d1->IsKind(STANDARD_TYPE(Geom_Line)) && c3d2->IsKind(STANDARD_TYPE(Geom_Line)) ) {
+ Handle(Geom_Line) L1 = Handle(Geom_Line)::DownCast(c3d1);
+ Handle(Geom_Line) L2 = Handle(Geom_Line)::DownCast(c3d2);
+ gp_Dir Dir1 = L1->Position().Direction();
+ gp_Dir Dir2 = L2->Position().Direction();
+ if(!Dir1.IsEqual(Dir2,Precision::Angular())) continue;
+ // can union lines => create new edge
+ TopoDS_Vertex V1 = sae.FirstVertex(edge1);
+ gp_Pnt PV1 = BRep_Tool::Pnt(V1);
+ TopoDS_Vertex V2 = sae.LastVertex(edge2);
+ gp_Pnt PV2 = BRep_Tool::Pnt(V2);
+ gp_Vec Vec(PV1,PV2);
+ Handle(Geom_Line) L = new Geom_Line(gp_Ax1(PV1,Vec));
+ Standard_Real dist = PV1.Distance(PV2);
+ Handle(Geom_TrimmedCurve) tc = new Geom_TrimmedCurve(L,0.0,dist);
+ TopoDS_Edge E;
+ B.MakeEdge (E,tc,Precision::Confusion());
+ B.Add (E,V1); B.Add (E,V2);
+ B.UpdateVertex(V1, 0., E, 0.);
+ B.UpdateVertex(V2, dist, E, 0.);
+ ShapeFix_Edge sfe;
+ sfe.FixAddPCurve(E,aFace,Standard_False);
+ sfe.FixSameParameter(E);
+ aChain.Remove(j);
+ aChain.SetValue(j,E);
+ j--;
+ }
+ if( c3d1->IsKind(STANDARD_TYPE(Geom_Circle)) && c3d2->IsKind(STANDARD_TYPE(Geom_Circle)) ) {
+ Handle(Geom_Circle) C1 = Handle(Geom_Circle)::DownCast(c3d1);
+ Handle(Geom_Circle) C2 = Handle(Geom_Circle)::DownCast(c3d2);
+ gp_Pnt P01 = C1->Location();
+ gp_Pnt P02 = C2->Location();
+ if(P01.Distance(P02)>Precision::Confusion()) continue;
+ // can union circles => create new edge
+ TopoDS_Vertex V1 = sae.FirstVertex(edge1);
+ gp_Pnt PV1 = BRep_Tool::Pnt(V1);
+ TopoDS_Vertex V2 = sae.LastVertex(edge2);
+ gp_Pnt PV2 = BRep_Tool::Pnt(V2);
+ TopoDS_Vertex VM = sae.LastVertex(edge1);
+ gp_Pnt PVM = BRep_Tool::Pnt(VM);
+ GC_MakeCircle MC(PV1,PVM,PV2);
+ Handle(Geom_Circle) C = MC.Value();
+ gp_Pnt P0 = C->Location();
+ gp_Dir D1(gp_Vec(P0,PV1));
+ gp_Dir D2(gp_Vec(P0,PV2));
+ Standard_Real fpar = C->XAxis().Direction().Angle(D1);
+ Standard_Real lpar = C->XAxis().Direction().Angle(D2);
+ Handle(Geom_TrimmedCurve) tc = new Geom_TrimmedCurve(C,fpar,lpar);
+ TopoDS_Edge E;
+ B.MakeEdge (E,tc,Precision::Confusion());
+ B.Add (E,V1); B.Add (E,V2);
+ B.UpdateVertex(V1, fpar, E, 0.);
+ B.UpdateVertex(V2, lpar, E, 0.);
+ ShapeFix_Edge sfe;
+ sfe.FixAddPCurve(E,aFace,Standard_False);
+ sfe.FixSameParameter(E);
+ aChain.Remove(j);
+ aChain.SetValue(j,E);
+ j--;
+ }
+ }
+ if(j<aChain.Length()) {
+ cout<<"null curve3d in edge..."<<endl;
+ return Standard_False;
+ }
+ if(aChain.Length()>1) {
+ // second step: union edges with various curves
+ cout<<"can not make analitical union => make approximation"<<endl;
+ TopoDS_Wire W;
+ B.MakeWire(W);
+ for(j=1; j<=aChain.Length(); j++) {
+ TopoDS_Edge edge = TopoDS::Edge(aChain.Value(j));
+ B.Add(W,edge);
+ }
+ Handle(BRepAdaptor_HCompCurve) Adapt = new BRepAdaptor_HCompCurve(W);
+ Approx_Curve3d Conv(Adapt,Tol,GeomAbs_C1,9,1000);
+ Handle(Geom_BSplineCurve) bc = Conv.Curve();
+ TopoDS_Edge E;
+ B.MakeEdge (E,bc,Precision::Confusion());
+ B.Add (E,VF);
+ B.Add (E,VL);
+ //TopLoc_Location L;
+ //Handle(Geom_Surface) aSurf = BRep_Tool::Surface(aFace,L);
+ //ShapeFix_Edge sfe;
+ //if(!L.IsIdentity()) {
+ // TopoDS_Edge aPCEdge = TopoDS::Edge(E.Moved(L.Inverted()));
+ // sfe.FixAddPCurve(aPCEdge,aFace,Standard_False);
+ // Handle(Geom2d_Curve) c2d;
+ // Standard_Real fp,lp;
+ // sae.PCurve(aPCEdge,aFace,c2d,fp,lp);
+ // B.UpdateEdge(E,c2d,aFace,0.);
+ // B.Range(E,aFace,fp,lp);
+ // c2d.Nullify();
+ // B.UpdateEdge(aPCEdge,c2d,aFace,0.);
+ // E = aPCEdge;
+ //}
+ //else {
+ // sfe.FixAddPCurve(E,aFace,Standard_False);
+ //}
+ //sfe.FixSameParameter(E);
+ aChain.SetValue(1,E);
+ }
+
+ anEdge = TopoDS::Edge(aChain.Value(1));
+ return Standard_True;
+}
+
+
+//=======================================================================
+//function : Perform
+//purpose :
+//=======================================================================
+
+TopoDS_Shape BlockFix_UnionEdges::Perform(const TopoDS_Shape& Shape,
+ const Standard_Real Tol)
+{
+ myContext = new ShapeBuild_ReShape;
+ myTolerance = Tol;
+ TopoDS_Shape aResult = myContext->Apply(Shape);
+
+ TopTools_IndexedMapOfShape ChangedFaces;
+
+ // processing each solid
+ TopExp_Explorer exps;
+ for(exps.Init(Shape, TopAbs_SOLID); exps.More(); exps.Next()) {
+ TopoDS_Solid aSolid = TopoDS::Solid(exps.Current());
+
+ // creating map of edge faces
+ TopTools_IndexedDataMapOfShapeListOfShape aMapEdgeFaces;
+ TopExp::MapShapesAndAncestors(aSolid, TopAbs_EDGE, TopAbs_FACE, aMapEdgeFaces);
+
+ // processing each face
+ TopExp_Explorer exp;
+ for(exp.Init(aSolid, TopAbs_FACE); exp.More(); exp.Next()) {
+ TopoDS_Face aFace = TopoDS::Face(myContext->Apply(exp.Current().Oriented(TopAbs_FORWARD)));
+ TopTools_IndexedDataMapOfShapeListOfShape aMapFacesEdges;
+
+ for(TopExp_Explorer expe(aFace,TopAbs_EDGE); expe.More(); expe.Next()) {
+ TopoDS_Edge edge = TopoDS::Edge(expe.Current());
+ if(!aMapEdgeFaces.Contains(edge)) continue;
+ const TopTools_ListOfShape& aList = aMapEdgeFaces.FindFromKey(edge);
+ TopTools_ListIteratorOfListOfShape anIter(aList);
+ for( ; anIter.More(); anIter.Next()) {
+ TopoDS_Face face = TopoDS::Face(anIter.Value());
+ TopoDS_Face face1 = TopoDS::Face(myContext->Apply(anIter.Value()));
+ if(face1.IsSame(aFace)) continue;
+ if(aMapFacesEdges.Contains(face)) {
+ aMapFacesEdges.ChangeFromKey(face).Append(edge);
+ }
+ else {
+ TopTools_ListOfShape ListEdges;
+ ListEdges.Append(edge);
+ aMapFacesEdges.Add(face,ListEdges);
+ }
+ }
+ }
+
+ for(Standard_Integer i=1; i<=aMapFacesEdges.Extent(); i++) {
+ const TopTools_ListOfShape& ListEdges = aMapFacesEdges.FindFromIndex(i);
+ TopTools_SequenceOfShape SeqEdges;
+ TopTools_ListIteratorOfListOfShape anIter(ListEdges);
+ for( ; anIter.More(); anIter.Next()) {
+ SeqEdges.Append(anIter.Value());
+ }
+ if(SeqEdges.Length()==1) continue;
+ TopoDS_Edge E;
+ if( MergeEdges(SeqEdges,aFace,Tol,E) ) {
+ // now we have only one edge - aChain.Value(1)
+ // we have to replace old ListEdges with this new edge
+ myContext->Replace(SeqEdges(1),E);
+ for(Standard_Integer j=2; j<=SeqEdges.Length(); j++) {
+ myContext->Remove(SeqEdges(j));
+ }
+ TopoDS_Face tmpF = TopoDS::Face(exp.Current());
+ if( !ChangedFaces.Contains(tmpF) )
+ ChangedFaces.Add(tmpF);
+ tmpF = TopoDS::Face(aMapFacesEdges.FindKey(i));
+ if( !ChangedFaces.Contains(tmpF) )
+ ChangedFaces.Add(tmpF);
+ }
+ }
+
+ } // end processing each face
+
+ } // end processing each solid
+
+ for(Standard_Integer i=1; i<=ChangedFaces.Extent(); i++) {
+ TopoDS_Face aFace = TopoDS::Face(myContext->Apply(ChangedFaces.FindKey(i)));
+ Handle(ShapeFix_Face) sff = new ShapeFix_Face(aFace);
+ sff->SetContext(myContext);
+ sff->SetPrecision(myTolerance);
+ sff->SetMinTolerance(myTolerance);
+ sff->SetMaxTolerance(Max(1.,myTolerance*1000.));
+ sff->Perform();
+ //Handle(ShapeFix_Wire) sfw = new ShapeFix_Wire;
+ //sfw->SetContext(myContext);
+ //sfw->SetPrecision(myTolerance);
+ //sfw->SetMinTolerance(myTolerance);
+ //sfw->SetMaxTolerance(Max(1.,myTolerance*1000.));
+ //sfw->SetFace(aFace);
+ //for ( TopoDS_Iterator iter(aFace,Standard_False); iter.More(); iter.Next()) {
+ // TopoDS_Wire wire = TopoDS::Wire ( iter.Value() );
+ // sfw->Load(wire);
+ // sfw->FixReorder();
+ // sfw->FixShifted();
+ //}
+ }
+
+ aResult = myContext->Apply(Shape);
+ return aResult;
+}
--- /dev/null
+// File generated by CPPExt (Value)
+//
+// Copyright (C) 1991 - 2000 by
+// Matra Datavision SA. All rights reserved.
+//
+// Copyright (C) 2001 - 2004 by
+// Open CASCADE SA. All rights reserved.
+//
+// This file is part of the Open CASCADE Technology software.
+//
+// This software may be distributed and/or modified under the terms and
+// conditions of the Open CASCADE Public License as defined by Open CASCADE SA
+// and appearing in the file LICENSE included in the packaging of this file.
+//
+// This software is distributed on an "AS IS" basis, without warranty of any
+// kind, and Open CASCADE SA hereby disclaims all such warranties,
+// including without limitation, any warranties of merchantability, fitness
+// for a particular purpose or non-infringement. Please see the License for
+// the specific terms and conditions governing rights and limitations under the
+// License.
+
+#ifndef _BlockFix_UnionEdges_HeaderFile
+#define _BlockFix_UnionEdges_HeaderFile
+
+#ifndef _Standard_Real_HeaderFile
+#include <Standard_Real.hxx>
+#endif
+#ifndef _Handle_ShapeBuild_ReShape_HeaderFile
+#include <Handle_ShapeBuild_ReShape.hxx>
+#endif
+class ShapeBuild_ReShape;
+class TopoDS_Shape;
+
+
+#ifndef _Standard_HeaderFile
+#include <Standard.hxx>
+#endif
+#ifndef _Standard_Macro_HeaderFile
+#include <Standard_Macro.hxx>
+#endif
+
+class BlockFix_UnionEdges {
+
+public:
+
+ void* operator new(size_t,void* anAddress)
+ {
+ return anAddress;
+ }
+ void* operator new(size_t size)
+ {
+ return Standard::Allocate(size);
+ }
+ void operator delete(void *anAddress)
+ {
+ if (anAddress) Standard::Free((Standard_Address&)anAddress);
+ }
+ // Methods PUBLIC
+ //
+Standard_EXPORT BlockFix_UnionEdges();
+Standard_EXPORT TopoDS_Shape Perform(const TopoDS_Shape& Shape,const Standard_Real Tol) ;
+
+
+
+
+
+protected:
+
+ // Methods PROTECTED
+ //
+
+
+ // Fields PROTECTED
+ //
+
+
+private:
+
+ // Methods PRIVATE
+ //
+
+
+ // Fields PRIVATE
+ //
+Standard_Real myTolerance;
+Handle_ShapeBuild_ReShape myContext;
+
+
+};
+
+
+
+
+
+// other Inline functions and methods (like "C++: function call" methods)
+//
+
+
+#endif
--- /dev/null
+// File generated by CPPExt (Value)
+//
+// Copyright (C) 1991 - 2000 by
+// Matra Datavision SA. All rights reserved.
+//
+// Copyright (C) 2001 - 2004 by
+// Open CASCADE SA. All rights reserved.
+//
+// This file is part of the Open CASCADE Technology software.
+//
+// This software may be distributed and/or modified under the terms and
+// conditions of the Open CASCADE Public License as defined by Open CASCADE SA
+// and appearing in the file LICENSE included in the packaging of this file.
+//
+// This software is distributed on an "AS IS" basis, without warranty of any
+// kind, and Open CASCADE SA hereby disclaims all such warranties,
+// including without limitation, any warranties of merchantability, fitness
+// for a particular purpose or non-infringement. Please see the License for
+// the specific terms and conditions governing rights and limitations under the
+// License.
+
+#include <BlockFix_UnionEdges.jxx>
+
+
+
+
--- /dev/null
+#ifndef _ShapeBuild_ReShape_HeaderFile
+#include <ShapeBuild_ReShape.hxx>
+#endif
+#ifndef _TopoDS_Shape_HeaderFile
+#include <TopoDS_Shape.hxx>
+#endif
+#ifndef _BlockFix_UnionEdges_HeaderFile
+#include <BlockFix_UnionEdges.hxx>
+#endif
--- /dev/null
+-- File: BlockFix_UnionFaces.cdl
+-- Created: Tue Dec 7 17:15:42 2004
+-- Author: Pavel Durandin
+-- <det@doomox>
+---Copyright: Open CASCADE SA 2004
+
+
+class UnionFaces from BlockFix
+
+uses
+
+ Face from TopoDS,
+ Shape from TopoDS
+
+is
+
+ Create returns UnionFaces from BlockFix;
+ ---Purpose: Empty constructor
+
+ GetTolerance(me: in out) returns Real;
+ ---Purpose: Returns modifiable tolerance
+ ---C++: return&
+
+ Perform (me: in out; Shape: Shape from TopoDS) returns Shape from TopoDS;
+ ---Purpose: Performs the unification of the fsces
+ -- whith the same geometry
+
+ IsSameDomain(me; aFace : Face from TopoDS;
+ aChekedFace: Face from TopoDS)
+ returns Boolean is virtual;
+ ---Purpose: Returns true is surfaces have same geometrically domain
+ -- with given tolerance
+
+ MovePCurves(me; aTarget: in out Face from TopoDS;
+ aSource: Face from TopoDS)
+ is virtual;
+ ---Purpose: Creates pcurves on aTarget face for each edge from
+ -- aSource one.
+
+fields
+
+ myTolerance: Real;
+
+end;
+
+
--- /dev/null
+// File: BlockFix_UnionFaces.cxx
+// Created: Tue Dec 7 17:15:42 2004
+// Author: Pavel DURANDIN
+// Open CASCADE SA 2004
+
+#include <BlockFix_UnionFaces.ixx>
+#include <TopTools_IndexedDataMapOfShapeListOfShape.hxx>
+#include <TopExp.hxx>
+#include <TopTools_MapOfShape.hxx>
+#include <ShapeBuild_ReShape.hxx>
+#include <TopoDS.hxx>
+#include <TopoDS_Edge.hxx>
+#include <TopoDS_Wire.hxx>
+#include <TopoDS_Face.hxx>
+#include <TopoDS_Solid.hxx>
+#include <TopExp_Explorer.hxx>
+#include <TopTools_SequenceOfShape.hxx>
+#include <Geom_Surface.hxx>
+#include <BRep_Tool.hxx>
+#include <TopTools_ListOfShape.hxx>
+#include <TopTools_ListIteratorOfListOfShape.hxx>
+#include <BRep_Builder.hxx>
+#include <TopTools_MapIteratorOfMapOfShape.hxx>
+#include <TopoDS_Vertex.hxx>
+#include <ShapeFix_Face.hxx>
+#include <BRep_Tool.hxx>
+#include <ShapeExtend_WireData.hxx>
+#include <ShapeAnalysis_WireOrder.hxx>
+#include <ShapeAnalysis_Edge.hxx>
+#include <Geom2d_Line.hxx>
+#include <gp_XY.hxx>
+#include <gp_Pnt2d.hxx>
+#include <ShapeBuild_Edge.hxx>
+#include <Geom_Curve.hxx>
+#include <TopoDS_Vertex.hxx>
+
+#include <ShapeFix_Wire.hxx>
+#include <ShapeFix_Edge.hxx>
+
+#include <Geom_RectangularTrimmedSurface.hxx>
+#include <BRepTools.hxx>
+
+#include <TColGeom_HArray2OfSurface.hxx>
+#include <ShapeExtend_CompositeSurface.hxx>
+#include <ShapeFix_ComposeShell.hxx>
+#include <TopTools_SequenceOfShape.hxx>
+#include <ShapeFix_SequenceOfWireSegment.hxx>
+#include <ShapeFix_WireSegment.hxx>
+#include <TopoDS_Shell.hxx>
+#include <TopoDS_Iterator.hxx>
+
+#include <Geom_CylindricalSurface.hxx>
+#include <Geom_SphericalSurface.hxx>
+
+
+//=======================================================================
+//function : BlockFix_UnionFaces
+//purpose :
+//=======================================================================
+
+BlockFix_UnionFaces::BlockFix_UnionFaces()
+ : myTolerance(Precision::Confusion())
+{
+}
+
+
+//=======================================================================
+//function : GetTolearnce
+//purpose :
+//=======================================================================
+
+Standard_Real& BlockFix_UnionFaces::GetTolerance()
+{
+ return myTolerance;
+}
+
+
+//=======================================================================
+//function : AddOrdinaryEdges
+//purpose : auxilary
+//=======================================================================
+// adds edges from the shape to the sequence
+// seams and equal edges are dropped
+// Returns true if one of original edges dropped
+static Standard_Boolean AddOrdinaryEdges(TopTools_SequenceOfShape& edges,
+ const TopoDS_Shape aShape,
+ Standard_Integer& anIndex)
+{
+ //map of edges
+ TopTools_MapOfShape aNewEdges;
+ //add edges without seams
+ for(TopExp_Explorer exp(aShape,TopAbs_EDGE); exp.More(); exp.Next()) {
+ TopoDS_Shape edge = exp.Current();
+ if(aNewEdges.Contains(edge))
+ aNewEdges.Remove(edge);
+ else
+ aNewEdges.Add(edge);
+ }
+
+ Standard_Boolean isDropped = Standard_False;
+ //merge edges and drop seams
+ for(Standard_Integer i = 1; i <= edges.Length(); i++) {
+ TopoDS_Shape current = edges(i);
+ if(aNewEdges.Contains(current)) {
+
+ aNewEdges.Remove(current);
+ edges.Remove(i);
+ i--;
+
+ if(!isDropped) {
+ isDropped = Standard_True;
+ anIndex = i;
+ }
+ }
+ }
+
+ //add edges to the sequemce
+ for(TopTools_MapIteratorOfMapOfShape anIter(aNewEdges); anIter.More(); anIter.Next())
+ edges.Append(anIter.Key());
+
+ return isDropped;
+}
+
+
+//=======================================================================
+//function : ClearRts
+//purpose : auxilary
+//=======================================================================
+static Handle(Geom_Surface) ClearRts(const Handle(Geom_Surface)& aSurface)
+{
+ if(aSurface->IsKind(STANDARD_TYPE(Geom_RectangularTrimmedSurface))) {
+ Handle(Geom_RectangularTrimmedSurface) rts =
+ Handle(Geom_RectangularTrimmedSurface)::DownCast(aSurface);
+ return rts->BasisSurface();
+ }
+ return aSurface;
+}
+
+
+//=======================================================================
+//function : Perform
+//purpose :
+//=======================================================================
+
+TopoDS_Shape BlockFix_UnionFaces::Perform(const TopoDS_Shape& Shape)
+{
+ Handle(ShapeBuild_ReShape) myContext = new ShapeBuild_ReShape;
+ TopoDS_Shape aResShape = myContext->Apply(Shape);
+
+ // processing each solid
+ TopExp_Explorer exps;
+ for(exps.Init(Shape, TopAbs_SOLID); exps.More(); exps.Next()) {
+ TopoDS_Solid aSolid = TopoDS::Solid(exps.Current());
+
+ // creating map of edge faces
+ TopTools_IndexedDataMapOfShapeListOfShape aMapEdgeFaces;
+ TopExp::MapShapesAndAncestors(aSolid, TopAbs_EDGE, TopAbs_FACE, aMapEdgeFaces);
+
+ // map of processed shapes
+ TopTools_MapOfShape aProcessed;
+
+ Handle(ShapeBuild_ReShape) aContext = new ShapeBuild_ReShape;
+
+ Standard_Integer NbModif=0;
+ Standard_Boolean hasFailed = Standard_False;
+ Standard_Real tol = Min(Max(Precision::Confusion(), myTolerance/10.),0.1);
+ // processing each face
+ TopExp_Explorer exp;
+ //for( exp.Init(Shape, TopAbs_FACE); exp.More(); exp.Next()) {
+ for( exp.Init(aSolid, TopAbs_FACE); exp.More(); exp.Next()) {
+ TopoDS_Face aFace = TopoDS::Face(exp.Current().Oriented(TopAbs_FORWARD));
+
+ if(aProcessed.Contains(aFace))
+ continue;
+
+ Standard_Integer dummy;
+ TopTools_SequenceOfShape edges;
+ AddOrdinaryEdges(edges,aFace,dummy);
+
+ TopTools_SequenceOfShape faces;
+ faces.Append(aFace);
+
+ //surface and location to construct result
+ TopLoc_Location aBaseLocation;
+ Handle(Geom_Surface) aBaseSurface = BRep_Tool::Surface(aFace,aBaseLocation);
+ aBaseSurface = ClearRts(aBaseSurface);
+
+ // find adjacent faces to union
+ Standard_Integer i;
+ for( i = 1; i <= edges.Length(); i++) {
+ TopoDS_Edge edge = TopoDS::Edge(edges(i));
+ if(BRep_Tool::Degenerated(edge))
+ continue;
+
+ const TopTools_ListOfShape& aList = aMapEdgeFaces.FindFromKey(edge);
+ TopTools_ListIteratorOfListOfShape anIter(aList);
+ for( ; anIter.More(); anIter.Next()) {
+ TopoDS_Face anCheckedFace = TopoDS::Face(anIter.Value().Oriented(TopAbs_FORWARD));
+ if(anCheckedFace.IsSame(aFace))
+ continue;
+
+ if(aProcessed.Contains(anCheckedFace))
+ continue;
+
+ if(IsSameDomain(aFace,anCheckedFace)) {
+
+ if(aList.Extent() != 2) {
+ // non mainfold case is not processed
+ continue;
+ }
+
+ // replacing pcurves
+ TopoDS_Face aMockUpFace;
+ BRep_Builder B;
+ B.MakeFace(aMockUpFace,aBaseSurface,aBaseLocation,0.);
+ MovePCurves(aMockUpFace,anCheckedFace);
+
+ if(AddOrdinaryEdges(edges,aMockUpFace,dummy)) {
+ // sequence edges is modified
+ i = dummy;
+ }
+
+ faces.Append(anCheckedFace);
+ aProcessed.Add(anCheckedFace);
+ break;
+ }
+ }
+ }
+
+ // all faces collected in the sequence. Perform union of faces
+ if(faces.Length() > 1) {
+ NbModif++;
+ TopoDS_Face aResult;
+ BRep_Builder B;
+ B.MakeFace(aResult,aBaseSurface,aBaseLocation,0);
+ Standard_Integer nbWires = 0;
+
+ // connecting wires
+ while(edges.Length()>0) {
+
+ Standard_Boolean isEdge3d = Standard_False;
+ nbWires++;
+ TopTools_MapOfShape aVertices;
+ TopoDS_Wire aWire;
+ B.MakeWire(aWire);
+
+ TopoDS_Edge anEdge = TopoDS::Edge(edges(1));
+ edges.Remove(1);
+
+ isEdge3d |= !BRep_Tool::Degenerated(anEdge);
+ B.Add(aWire,anEdge);
+ TopoDS_Vertex V1,V2;
+ TopExp::Vertices(anEdge,V1,V2);
+ aVertices.Add(V1);
+ aVertices.Add(V2);
+
+ Standard_Boolean isNewFound = Standard_False;
+ do {
+ isNewFound = Standard_False;
+ for(Standard_Integer j = 1; j <= edges.Length(); j++) {
+ anEdge = TopoDS::Edge(edges(j));
+ TopExp::Vertices(anEdge,V1,V2);
+ if(aVertices.Contains(V1) || aVertices.Contains(V2)) {
+ isEdge3d |= !BRep_Tool::Degenerated(anEdge);
+ aVertices.Add(V1);
+ aVertices.Add(V2);
+ B.Add(aWire,anEdge);
+ edges.Remove(j);
+ j--;
+ isNewFound = Standard_True;
+ }
+ }
+ } while (isNewFound);
+
+ // sorting eny type of edges
+ aWire = TopoDS::Wire(aContext->Apply(aWire));
+
+ TopoDS_Face tmpF = TopoDS::Face(aContext->Apply(faces(1).Oriented(TopAbs_FORWARD)));
+ Handle(ShapeFix_Wire) sfw = new ShapeFix_Wire(aWire,tmpF,Precision::Confusion());
+ sfw->FixReorder();
+ Standard_Boolean isDegRemoved = Standard_False;
+ if(!sfw->StatusReorder ( ShapeExtend_FAIL )) {
+ // clear degenerated edges if at least one with 3d curve exist
+ if(isEdge3d) {
+ Handle(ShapeExtend_WireData) sewd = sfw->WireData();
+ for(Standard_Integer j = 1; j<=sewd->NbEdges();j++) {
+ TopoDS_Edge E = sewd->Edge(j);
+ if(BRep_Tool::Degenerated(E)) {
+ sewd->Remove(j);
+ isDegRemoved = Standard_True;
+ j--;
+ }
+ }
+ }
+ sfw->FixShifted();
+ if(isDegRemoved)
+ sfw->FixDegenerated();
+ }
+ TopoDS_Wire aWireFixed = sfw->Wire();
+ aContext->Replace(aWire,aWireFixed);
+ // add resulting wire
+ if(isEdge3d) {
+ B.Add(aResult,aWireFixed);
+ }
+ else {
+ // sorting edges
+ Handle(ShapeExtend_WireData) sbwd = sfw->WireData();
+ Standard_Integer nbEdges = sbwd->NbEdges();
+ // sort degenerated edges and create one edge instead of several ones
+ ShapeAnalysis_WireOrder sawo(Standard_False, 0);
+ ShapeAnalysis_Edge sae;
+ Standard_Integer aLastEdge = nbEdges;
+ for(Standard_Integer j = 1; j <= nbEdges; j++) {
+ Standard_Real f,l;
+ //smh protection on NULL pcurve
+ Handle(Geom2d_Curve) c2d;
+ if(!sae.PCurve(sbwd->Edge(j),tmpF,c2d,f,l)) {
+ aLastEdge--;
+ continue;
+ }
+ sawo.Add(c2d->Value(f).XY(),c2d->Value(l).XY());
+ }
+ sawo.Perform();
+
+ // constructind one degenerative edge
+ gp_XY aStart, anEnd, tmp;
+ Standard_Integer nbFirst = sawo.Ordered(1);
+ TopoDS_Edge anOrigE = TopoDS::Edge(sbwd->Edge(nbFirst).Oriented(TopAbs_FORWARD));
+ ShapeBuild_Edge sbe;
+ TopoDS_Vertex aDummyV;
+ TopoDS_Edge E = sbe.CopyReplaceVertices(anOrigE,aDummyV,aDummyV);
+ sawo.XY(nbFirst,aStart,tmp);
+ sawo.XY(sawo.Ordered(aLastEdge),tmp,anEnd);
+
+ gp_XY aVec = anEnd-aStart;
+ Handle(Geom2d_Line) aLine = new Geom2d_Line(aStart,gp_Dir2d(anEnd-aStart));
+
+ B.UpdateEdge(E,aLine,tmpF,0.);
+ B.Range(E,tmpF,0.,aVec.Modulus());
+ Handle(Geom_Curve) C3d;
+ B.UpdateEdge(E,C3d,0.);
+ B.Degenerated(E,Standard_True);
+ TopoDS_Wire aW;
+ B.MakeWire(aW);
+ B.Add(aW,E);
+ B.Add(aResult,aW);
+ }
+
+ }
+
+ // perform substitution of face
+ aContext->Replace(aContext->Apply(aFace),aResult);
+
+
+ ShapeFix_Face sff (aResult);
+ //Intializing by tolerances
+ sff.SetPrecision(myTolerance);
+ sff.SetMinTolerance(tol);
+ sff.SetMaxTolerance(Max(1.,myTolerance*1000.));
+ //Setting modes
+ sff.FixOrientationMode() = 0;
+ //sff.FixWireMode() = 0;
+ sff.SetContext(aContext);
+ // Applying the fixes
+ sff.Perform();
+ if(sff.Status(ShapeExtend_FAIL))
+ hasFailed = Standard_True;
+
+ // breaking down to several faces
+ TopoDS_Shape theResult = aContext->Apply(aResult);
+ for(TopExp_Explorer aFaceExp(theResult,TopAbs_FACE);aFaceExp.More();aFaceExp.Next()) {
+ TopoDS_Face aCurrent = TopoDS::Face(aFaceExp.Current().Oriented(TopAbs_FORWARD));
+ Handle(TColGeom_HArray2OfSurface) grid = new TColGeom_HArray2OfSurface ( 1, 1, 1, 1 );
+ grid->SetValue ( 1, 1, aBaseSurface );
+ Handle(ShapeExtend_CompositeSurface) G = new ShapeExtend_CompositeSurface ( grid );
+ ShapeFix_ComposeShell CompShell;
+ CompShell.Init ( G, aBaseLocation, aCurrent, ::Precision::Confusion() );//myPrecision
+ CompShell.SetContext( aContext );
+
+ TopTools_SequenceOfShape parts;
+ ShapeFix_SequenceOfWireSegment wires;
+ for(TopExp_Explorer W_Exp(aCurrent,TopAbs_WIRE);W_Exp.More();W_Exp.Next()) {
+ Handle(ShapeExtend_WireData) sbwd =
+ new ShapeExtend_WireData ( TopoDS::Wire(W_Exp.Current() ));
+ ShapeFix_WireSegment seg ( sbwd, TopAbs_REVERSED );
+ wires.Append(seg);
+ }
+
+ CompShell.DispatchWires ( parts,wires );
+ for (Standard_Integer j=1; j <= parts.Length(); j++ ) {
+ ShapeFix_Face aFixOrient(TopoDS::Face(parts(j)));
+ aFixOrient.SetContext(aContext);
+ aFixOrient.FixOrientation();
+ }
+
+ TopoDS_Shape CompRes;
+ if ( faces.Length() !=1 ) {
+ TopoDS_Shell S;
+ B.MakeShell ( S );
+ for ( i=1; i <= parts.Length(); i++ )
+ B.Add ( S, parts(i) );
+ CompRes = S;
+ }
+ else CompRes = parts(1);
+
+ aContext->Replace(aCurrent,CompRes);
+ }
+
+ // remove the remaining faces
+ for(i = 2; i <= faces.Length(); i++)
+ aContext->Remove(faces(i));
+ }
+ }
+
+ //TopoDS_Shape aResult = Shape;
+ if(NbModif>0) {
+ TopoDS_Shape aResult = aSolid;
+ if(!hasFailed) {
+ aResult = aContext->Apply(aSolid);
+
+ ShapeFix_Edge sfe;
+ for(exp.Init(aResult,TopAbs_EDGE); exp.More(); exp.Next()) {
+ TopoDS_Edge E = TopoDS::Edge(exp.Current());
+ sfe.FixVertexTolerance (E);
+ // ptv add fix same parameter
+ sfe.FixSameParameter(E, myTolerance);
+ }
+
+ myContext->Replace(aSolid,aResult);
+ }
+ }
+ else {
+ for( exp.Init(aSolid, TopAbs_FACE); exp.More(); exp.Next()) {
+ TopoDS_Face aFace = TopoDS::Face(exp.Current().Oriented(TopAbs_FORWARD));
+ Handle(ShapeFix_Wire) sfw = new ShapeFix_Wire;
+ sfw->SetContext(myContext);
+ sfw->SetPrecision(myTolerance);
+ sfw->SetMinTolerance(myTolerance);
+ sfw->SetMaxTolerance(Max(1.,myTolerance*1000.));
+ sfw->SetFace(aFace);
+ for ( TopoDS_Iterator iter(aFace,Standard_False); iter.More(); iter.Next()) {
+ TopoDS_Wire wire = TopoDS::Wire ( iter.Value() );
+ sfw->Load(wire);
+ sfw->FixReorder();
+ sfw->FixShifted();
+ }
+ }
+ }
+
+ } // end processing each solid
+
+ aResShape = myContext->Apply(Shape);
+ return aResShape;
+}
+
+
+//=======================================================================
+//function : IsSameDomain
+//purpose :
+//=======================================================================
+
+Standard_Boolean BlockFix_UnionFaces::IsSameDomain(const TopoDS_Face& aFace,
+ const TopoDS_Face& aCheckedFace) const
+{
+ //checking the same handless
+ TopLoc_Location L1, L2;
+ Handle(Geom_Surface) S1, S2;
+
+ S1 = BRep_Tool::Surface(aFace,L1);
+ S2 = BRep_Tool::Surface(aCheckedFace,L2);
+
+ return (S1 == S2 && L1 == L2);
+}
+
+
+//=======================================================================
+//function : MovePCurves
+//purpose :
+//=======================================================================
+
+void BlockFix_UnionFaces::MovePCurves(TopoDS_Face& aTarget,
+ const TopoDS_Face& aSource) const
+{
+ BRep_Builder B;
+ for(TopExp_Explorer wexp(aSource,TopAbs_WIRE);wexp.More();wexp.Next()) {
+ Handle(ShapeFix_Wire) sfw = new ShapeFix_Wire(TopoDS::Wire(wexp.Current()),
+ aTarget, Precision::Confusion());
+ sfw->FixReorder();
+ Standard_Boolean isReoredFailed = sfw->StatusReorder ( ShapeExtend_FAIL );
+ sfw->FixEdgeCurves();
+ if(isReoredFailed)
+ continue;
+
+ sfw->FixShifted();
+ sfw->FixDegenerated();
+
+ // remove degenerated edges from not degenerated points
+ ShapeAnalysis_Edge sae;
+ Handle(ShapeExtend_WireData) sewd = sfw->WireData();
+ for(Standard_Integer i = 1; i<=sewd->NbEdges();i++) {
+ TopoDS_Edge E = sewd->Edge(i);
+ if(BRep_Tool::Degenerated(E)&&!sae.HasPCurve(E,aTarget)) {
+ sewd->Remove(i);
+ i--;
+ }
+ }
+
+ TopoDS_Wire ResWire = sfw->Wire();
+ B.Add(aTarget,ResWire);
+ }
+}
+
--- /dev/null
+// File generated by CPPExt (Value)
+//
+// Copyright (C) 1991 - 2000 by
+// Matra Datavision SA. All rights reserved.
+//
+// Copyright (C) 2001 - 2004 by
+// Open CASCADE SA. All rights reserved.
+//
+// This file is part of the Open CASCADE Technology software.
+//
+// This software may be distributed and/or modified under the terms and
+// conditions of the Open CASCADE Public License as defined by Open CASCADE SA
+// and appearing in the file LICENSE included in the packaging of this file.
+//
+// This software is distributed on an "AS IS" basis, without warranty of any
+// kind, and Open CASCADE SA hereby disclaims all such warranties,
+// including without limitation, any warranties of merchantability, fitness
+// for a particular purpose or non-infringement. Please see the License for
+// the specific terms and conditions governing rights and limitations under the
+// License.
+
+#ifndef _BlockFix_UnionFaces_HeaderFile
+#define _BlockFix_UnionFaces_HeaderFile
+
+#ifndef _Standard_Real_HeaderFile
+#include <Standard_Real.hxx>
+#endif
+#ifndef _Standard_Boolean_HeaderFile
+#include <Standard_Boolean.hxx>
+#endif
+class TopoDS_Shape;
+class TopoDS_Face;
+
+
+#ifndef _Standard_HeaderFile
+#include <Standard.hxx>
+#endif
+#ifndef _Standard_Macro_HeaderFile
+#include <Standard_Macro.hxx>
+#endif
+
+class BlockFix_UnionFaces {
+
+public:
+
+ void* operator new(size_t,void* anAddress)
+ {
+ return anAddress;
+ }
+ void* operator new(size_t size)
+ {
+ return Standard::Allocate(size);
+ }
+ void operator delete(void *anAddress)
+ {
+ if (anAddress) Standard::Free((Standard_Address&)anAddress);
+ }
+ // Methods PUBLIC
+ //
+Standard_EXPORT BlockFix_UnionFaces();
+Standard_EXPORT Standard_Real& GetTolerance() ;
+Standard_EXPORT TopoDS_Shape Perform(const TopoDS_Shape& Shape) ;
+Standard_EXPORT virtual Standard_Boolean IsSameDomain(const TopoDS_Face& aFace,const TopoDS_Face& aChekedFace) const;
+Standard_EXPORT virtual void MovePCurves(TopoDS_Face& aTarget,const TopoDS_Face& aSource) const;
+
+
+
+
+
+protected:
+
+ // Methods PROTECTED
+ //
+
+
+ // Fields PROTECTED
+ //
+
+
+private:
+
+ // Methods PRIVATE
+ //
+
+
+ // Fields PRIVATE
+ //
+Standard_Real myTolerance;
+
+
+};
+
+
+
+
+
+// other Inline functions and methods (like "C++: function call" methods)
+//
+
+
+#endif
--- /dev/null
+// File generated by CPPExt (Value)
+//
+// Copyright (C) 1991 - 2000 by
+// Matra Datavision SA. All rights reserved.
+//
+// Copyright (C) 2001 - 2004 by
+// Open CASCADE SA. All rights reserved.
+//
+// This file is part of the Open CASCADE Technology software.
+//
+// This software may be distributed and/or modified under the terms and
+// conditions of the Open CASCADE Public License as defined by Open CASCADE SA
+// and appearing in the file LICENSE included in the packaging of this file.
+//
+// This software is distributed on an "AS IS" basis, without warranty of any
+// kind, and Open CASCADE SA hereby disclaims all such warranties,
+// including without limitation, any warranties of merchantability, fitness
+// for a particular purpose or non-infringement. Please see the License for
+// the specific terms and conditions governing rights and limitations under the
+// License.
+
+#include <BlockFix_UnionFaces.jxx>
+
+
+
+
--- /dev/null
+#ifndef _TopoDS_Shape_HeaderFile
+#include <TopoDS_Shape.hxx>
+#endif
+#ifndef _TopoDS_Face_HeaderFile
+#include <TopoDS_Face.hxx>
+#endif
+#ifndef _BlockFix_UnionFaces_HeaderFile
+#include <BlockFix_UnionFaces.hxx>
+#endif
uses
TCollection,
TColStd,
+ Geom,
Bnd,
gp,
TopAbs,
TopoDS,
TopTools,
- IntTools
+ IntTools,
+ BOPTools,
+ BOP
-is
+is
+ -- enumerations
+ --
+ enumeration State is
+ ST_UNKNOWN,
+ ST_IN,
+ ST_OUT,
+ ST_ON,
+ ST_ONIN,
+ ST_ONOUT,
+ ST_INOUT
+ end State;
+ --
+ -- classes
+ --
deferred class Algo;
- deferred class ShapeAlgo;
+ deferred class ShapeAlgo;
+ --
+ -- gluer
class Gluer;
+ class GlueAnalyser;
+ class CoupleOfShapes;
class PassKey;
class PassKeyMapHasher;
class Tools;
-
+ --
+ -- finder on
+ deferred class ShapeSolid;
+ class WireSolid;
+ class ShellSolid;
+ class VertexSolid;
+ class FinderShapeOn;
+ --
class IndexedDataMapOfPassKeyListOfShape
instantiates IndexedDataMap from TCollection (PassKey from GEOMAlgo,
ListOfShape from TopTools,
class IndexedDataMapOfIntegerShape
instantiates IndexedDataMap from TCollection (Integer from Standard,
Shape from TopoDS,
- MapIntegerHasher from TColStd);
+ MapIntegerHasher from TColStd);
+
+ class ListOfCoupleOfShapes
+ instantiates List from TCollection (CoupleOfShapes from GEOMAlgo);
+
end GEOMAlgo;
is deferred;
CheckData(me:out)
- is deferred protected;
+ is virtual protected;
CheckResult(me:out)
- is deferred protected;
+ is virtual protected;
ErrorStatus (me)
returns Integer from Standard;
{
}
//=======================================================================
+// function: CheckData
+// purpose:
+//=======================================================================
+ void GEOMAlgo_Algo::CheckData()
+{
+ myErrorStatus=0;
+}
+//=======================================================================
+// function: CheckResult
+// purpose:
+//=======================================================================
+ void GEOMAlgo_Algo::CheckResult()
+{
+ myErrorStatus=0;
+}
+//=======================================================================
// function: ErrorStatus
// purpose:
//=======================================================================
//
Standard_EXPORT GEOMAlgo_Algo();
Standard_EXPORT virtual ~GEOMAlgo_Algo();
-Standard_EXPORT virtual void CheckData() = 0;
-Standard_EXPORT virtual void CheckResult() = 0;
+Standard_EXPORT virtual void CheckData() ;
+Standard_EXPORT virtual void CheckResult() ;
// Fields PROTECTED
--- /dev/null
+-- File: GEOMAlgo_CoupleOfShapes.cdl
+-- Created: Wed Dec 15 13:00:10 2004
+-- Author: Peter KURNEV
+-- <pkv@irinox>
+---Copyright: Matra Datavision 2004
+
+
+class CoupleOfShapes from GEOMAlgo
+
+ ---Purpose:
+
+uses
+ Shape from TopoDS
+
+--raises
+
+is
+ Create
+ returns CoupleOfShapes from GEOMAlgo;
+
+ SetShapes(me:out;
+ aS1: Shape from TopoDS;
+ aS2: Shape from TopoDS);
+
+ SetShape1(me:out;
+ aS1: Shape from TopoDS);
+
+ SetShape2(me:out;
+ aS2: Shape from TopoDS);
+
+ Shapes(me;
+ aS1:out Shape from TopoDS;
+ aS2:out Shape from TopoDS);
+
+ Shape1(me)
+ returns Shape from TopoDS;
+ ---C++:return const &
+
+ Shape2(me)
+ returns Shape from TopoDS;
+ ---C++:return const &
+
+fields
+
+ myShape1: Shape from TopoDS is protected;
+ myShape2: Shape from TopoDS is protected;
+
+end CoupleOfShapes;
--- /dev/null
+// File: GEOMAlgo_CoupleOfShapes.cxx
+// Created: Wed Dec 15 13:03:52 2004
+// Author: Peter KURNEV
+// <pkv@irinox>
+
+
+#include <GEOMAlgo_CoupleOfShapes.ixx>
+//=======================================================================
+//function : GEOMAlgo_CoupleOfShapes
+//purpose :
+//=======================================================================
+GEOMAlgo_CoupleOfShapes::GEOMAlgo_CoupleOfShapes()
+{}
+//=======================================================================
+//function : SetShapes
+//purpose :
+//=======================================================================
+void GEOMAlgo_CoupleOfShapes::SetShapes(const TopoDS_Shape& aS1,
+ const TopoDS_Shape& aS2)
+{
+ myShape1=aS1;
+ myShape2=aS2;
+}
+//=======================================================================
+//function : Shapes
+//purpose :
+//=======================================================================
+void GEOMAlgo_CoupleOfShapes::Shapes(TopoDS_Shape& aS1,
+ TopoDS_Shape& aS2)const
+{
+ aS1=myShape1;
+ aS2=myShape2;
+}
+//=======================================================================
+//function : SetShape1
+//purpose :
+//=======================================================================
+void GEOMAlgo_CoupleOfShapes::SetShape1(const TopoDS_Shape& aS1)
+{
+ myShape1=aS1;
+}
+//=======================================================================
+//function : SetShape2
+//purpose :
+//=======================================================================
+void GEOMAlgo_CoupleOfShapes::SetShape2(const TopoDS_Shape& aS2)
+{
+ myShape2=aS2;
+}
+//=======================================================================
+//function : Shape1
+//purpose :
+//=======================================================================
+const TopoDS_Shape& GEOMAlgo_CoupleOfShapes::Shape1()const
+{
+ return myShape1;
+}
+//=======================================================================
+//function : Shape2
+//purpose :
+//=======================================================================
+const TopoDS_Shape& GEOMAlgo_CoupleOfShapes::Shape2()const
+{
+ return myShape2;
+}
--- /dev/null
+// File generated by CPPExt (Value)
+//
+// Copyright (C) 1991 - 2000 by
+// Matra Datavision SA. All rights reserved.
+//
+// Copyright (C) 2001 - 2004 by
+// Open CASCADE SA. All rights reserved.
+//
+// This file is part of the Open CASCADE Technology software.
+//
+// This software may be distributed and/or modified under the terms and
+// conditions of the Open CASCADE Public License as defined by Open CASCADE SA
+// and appearing in the file LICENSE included in the packaging of this file.
+//
+// This software is distributed on an "AS IS" basis, without warranty of any
+// kind, and Open CASCADE SA hereby disclaims all such warranties,
+// including without limitation, any warranties of merchantability, fitness
+// for a particular purpose or non-infringement. Please see the License for
+// the specific terms and conditions governing rights and limitations under the
+// License.
+
+#ifndef _GEOMAlgo_CoupleOfShapes_HeaderFile
+#define _GEOMAlgo_CoupleOfShapes_HeaderFile
+
+#ifndef _TopoDS_Shape_HeaderFile
+#include <TopoDS_Shape.hxx>
+#endif
+class TopoDS_Shape;
+
+
+#ifndef _Standard_HeaderFile
+#include <Standard.hxx>
+#endif
+#ifndef _Standard_Macro_HeaderFile
+#include <Standard_Macro.hxx>
+#endif
+
+class GEOMAlgo_CoupleOfShapes {
+
+public:
+
+ void* operator new(size_t,void* anAddress)
+ {
+ return anAddress;
+ }
+ void* operator new(size_t size)
+ {
+ return Standard::Allocate(size);
+ }
+ void operator delete(void *anAddress)
+ {
+ if (anAddress) Standard::Free((Standard_Address&)anAddress);
+ }
+ // Methods PUBLIC
+ //
+Standard_EXPORT GEOMAlgo_CoupleOfShapes();
+Standard_EXPORT void SetShapes(const TopoDS_Shape& aS1,const TopoDS_Shape& aS2) ;
+Standard_EXPORT void SetShape1(const TopoDS_Shape& aS1) ;
+Standard_EXPORT void SetShape2(const TopoDS_Shape& aS2) ;
+Standard_EXPORT void Shapes(TopoDS_Shape& aS1,TopoDS_Shape& aS2) const;
+Standard_EXPORT const TopoDS_Shape& Shape1() const;
+Standard_EXPORT const TopoDS_Shape& Shape2() const;
+
+
+
+
+
+protected:
+
+ // Methods PROTECTED
+ //
+
+
+ // Fields PROTECTED
+ //
+TopoDS_Shape myShape1;
+TopoDS_Shape myShape2;
+
+
+private:
+
+ // Methods PRIVATE
+ //
+
+
+ // Fields PRIVATE
+ //
+
+
+};
+
+
+
+
+
+// other Inline functions and methods (like "C++: function call" methods)
+//
+
+
+#endif
--- /dev/null
+// File generated by CPPExt (Value)
+//
+// Copyright (C) 1991 - 2000 by
+// Matra Datavision SA. All rights reserved.
+//
+// Copyright (C) 2001 - 2004 by
+// Open CASCADE SA. All rights reserved.
+//
+// This file is part of the Open CASCADE Technology software.
+//
+// This software may be distributed and/or modified under the terms and
+// conditions of the Open CASCADE Public License as defined by Open CASCADE SA
+// and appearing in the file LICENSE included in the packaging of this file.
+//
+// This software is distributed on an "AS IS" basis, without warranty of any
+// kind, and Open CASCADE SA hereby disclaims all such warranties,
+// including without limitation, any warranties of merchantability, fitness
+// for a particular purpose or non-infringement. Please see the License for
+// the specific terms and conditions governing rights and limitations under the
+// License.
+
+#include <GEOMAlgo_CoupleOfShapes.jxx>
+
+
+
+
--- /dev/null
+#ifndef _TopoDS_Shape_HeaderFile
+#include <TopoDS_Shape.hxx>
+#endif
+#ifndef _GEOMAlgo_CoupleOfShapes_HeaderFile
+#include <GEOMAlgo_CoupleOfShapes.hxx>
+#endif
--- /dev/null
+-- File: GEOMAlgo_FinderShapeOn.cdl
+-- Created: Tue Jan 11 14:35:52 2005
+-- Author: Peter KURNEV
+-- <pkv@irinox>
+---Copyright: Matra Datavision 2005
+
+
+class FinderShapeOn from GEOMAlgo
+ inherits ShapeAlgo from GEOMAlgo
+
+ ---Purpose:
+
+uses
+ Surface from Geom,
+ ShapeEnum from TopAbs,
+ ListOfShape from TopTools,
+ DataMapOfShapeShape from TopTools,
+ Shape from TopoDS,
+ State from GEOMAlgo
+
+--raises
+
+is
+ Create
+ returns FinderShapeOn from GEOMAlgo;
+ ---C++: alias "Standard_EXPORT virtual ~GEOMAlgo_FinderShapeOn();"
+
+ Perform(me:out)
+ is redefined;
+
+ SetSurface(me:out;
+ aS:Surface from Geom);
+
+ SetShapeType(me:out;
+ aST:ShapeEnum from TopAbs);
+
+ SetState(me:out;
+ aSF:State from GEOMAlgo);
+
+ Surface(me)
+ returns Surface from Geom;
+ ---C++: return const &
+
+ ShapeType(me)
+ returns ShapeEnum from TopAbs;
+
+ State(me)
+ returns State from GEOMAlgo;
+
+ Shapes(me)
+ returns ListOfShape from TopTools;
+ ---C++: return const &
+
+ --
+ -- protected methods
+ --
+ CheckData(me:out)
+ is redefined protected;
+
+ MakeArguments(me:out)
+ is protected;
+
+ Find(me:out)
+ is protected;
+
+ CopySource(myclass;
+ aS :Shape from TopoDS;
+ aImages : out DataMapOfShapeShape from TopTools;
+ aOriginals: out DataMapOfShapeShape from TopTools;
+ aSC : out Shape from TopoDS);
+
+
+
+fields
+ mySurface : Surface from Geom is protected;
+ myShapeType : ShapeEnum from TopAbs is protected;
+ myState : State from GEOMAlgo is protected;
+ myArg1 : Shape from TopoDS is protected;
+ myArg2 : Shape from TopoDS is protected;
+ myLS : ListOfShape from TopTools is protected;
+ myImages : DataMapOfShapeShape from TopTools is protected;
+
+end FinderShapeOn;
--- /dev/null
+// File: GEOMAlgo_FinderShapeOn.cxx
+// Created: Tue Jan 11 14:44:31 2005
+// Author: Peter KURNEV
+// <pkv@irinox>
+
+
+#include <GEOMAlgo_FinderShapeOn.ixx>
+
+#include <TopAbs_ShapeEnum.hxx>
+
+#include <TopoDS.hxx>
+#include <TopoDS_Face.hxx>
+#include <TopoDS_Shape.hxx>
+#include <TopoDS_Compound.hxx>
+#include <TopoDS_Shell.hxx>
+#include <TopoDS_Solid.hxx>
+#include <TopoDS_Vertex.hxx>
+#include <TopoDS_Edge.hxx>
+
+#include <TopoDS_Iterator.hxx>
+
+#include <TopTools_ListIteratorOfListOfShape.hxx>
+#include <TopTools_IndexedMapOfShape.hxx>
+#include <TopTools_DataMapOfShapeShape.hxx>
+
+#include <BRep_Builder.hxx>
+
+#include <TopExp.hxx>
+#include <TopExp_Explorer.hxx>
+
+#include <BRepLib_MakeFace.hxx>
+#include <BRepLib_FaceError.hxx>
+
+#include <BOPTools_DSFiller.hxx>
+
+#include <GEOMAlgo_WireSolid.hxx>
+#include <GEOMAlgo_ShellSolid.hxx>
+#include <GEOMAlgo_VertexSolid.hxx>
+#include <GEOMAlgo_ShapeSolid.hxx>
+
+
+//=======================================================================
+//function : GEOMAlgo_FinderShapeOn
+//purpose :
+//=======================================================================
+GEOMAlgo_FinderShapeOn::GEOMAlgo_FinderShapeOn()
+:
+ GEOMAlgo_ShapeAlgo()
+{
+ myTolerance=0.0001;
+ myShapeType=TopAbs_VERTEX;
+ myState=GEOMAlgo_ST_UNKNOWN;
+}
+//=======================================================================
+//function : ~
+//purpose :
+//=======================================================================
+GEOMAlgo_FinderShapeOn::~GEOMAlgo_FinderShapeOn()
+{
+}
+//=======================================================================
+//function : SetSurface
+//purpose :
+//=======================================================================
+void GEOMAlgo_FinderShapeOn::SetSurface(const Handle(Geom_Surface)& aS)
+{
+ mySurface=aS;
+}
+//=======================================================================
+//function : Surface
+//purpose :
+//=======================================================================
+const Handle(Geom_Surface)& GEOMAlgo_FinderShapeOn::Surface() const
+{
+ return mySurface;
+}
+//=======================================================================
+//function : SetShapeType
+//purpose :
+//=======================================================================
+void GEOMAlgo_FinderShapeOn::SetShapeType(const TopAbs_ShapeEnum aType)
+{
+ myShapeType=aType;
+}
+//=======================================================================
+//function : ShapeType
+//purpose :
+//=======================================================================
+TopAbs_ShapeEnum GEOMAlgo_FinderShapeOn::ShapeType()const
+{
+ return myShapeType;
+}
+//=======================================================================
+//function : SetState
+//purpose :
+//=======================================================================
+void GEOMAlgo_FinderShapeOn::SetState(const GEOMAlgo_State aState)
+{
+ myState=aState;
+}
+//=======================================================================
+//function : State
+//purpose :
+//=======================================================================
+GEOMAlgo_State GEOMAlgo_FinderShapeOn::State() const
+{
+ return myState;
+}
+//=======================================================================
+// function: Shapes
+// purpose:
+//=======================================================================
+const TopTools_ListOfShape& GEOMAlgo_FinderShapeOn::Shapes() const
+{
+ return myLS;
+}
+//=======================================================================
+//function : Perform
+//purpose :
+//=======================================================================
+void GEOMAlgo_FinderShapeOn::Perform()
+{
+ myErrorStatus=0;
+ myWarningStatus=0;
+ myLS.Clear();
+ //
+ if (!myResult.IsNull()){
+ myResult.Nullify();
+ }
+ //
+ CheckData();
+ if(myErrorStatus) {
+ return;
+ }
+ //
+ MakeArguments();
+ if(myErrorStatus || myWarningStatus) {
+ return;
+ }
+ //
+ Find();
+ if(myErrorStatus) {
+ return;
+ }
+ //
+}
+//=======================================================================
+//function : Find
+//purpose :
+//=======================================================================
+void GEOMAlgo_FinderShapeOn::Find()
+{
+ myErrorStatus=0;
+ //
+ Standard_Boolean bIsDone;
+ Standard_Integer iErr;
+ TopTools_ListIteratorOfListOfShape aIt;
+ BRep_Builder aBB;
+ BOPTools_DSFiller aDF;
+ GEOMAlgo_ShapeSolid* pSS;
+ //
+ // 1. Prepare DSFiller
+ aDF.SetShapes (myArg1, myArg2);
+ bIsDone=aDF.IsDone();
+ if (!bIsDone) {
+ myErrorStatus=30; // wrong args are used for DSFiller
+ return;
+ }
+ aDF.Perform();
+ bIsDone=aDF.IsDone();
+ if (!bIsDone) {
+ myErrorStatus=31; // DSFiller failed
+ return;
+ }
+ //
+ // 2. Find shapes
+ myLS.Clear();
+ //
+ if (myShapeType==TopAbs_VERTEX) {
+ pSS=new GEOMAlgo_VertexSolid;
+ }
+ else if (myShapeType==TopAbs_EDGE) {
+ pSS=new GEOMAlgo_WireSolid;
+ }
+ else if (myShapeType==TopAbs_FACE) {
+ pSS=new GEOMAlgo_ShellSolid;
+ }
+ //
+ pSS->SetFiller(aDF);
+ pSS->Perform();
+ iErr=pSS->ErrorStatus();
+ if (iErr) {
+ myErrorStatus=32; // builder ShapeSolid failed
+ delete pSS;
+ return;
+ }
+ //
+ const TopTools_ListOfShape& aLS=pSS->Shapes(myState);
+ //
+ aIt.Initialize(aLS);
+ for (; aIt.More(); aIt.Next()) {
+ const TopoDS_Shape& aSImage=aIt.Value();
+ if (myImages.IsBound(aSImage)) {
+ const TopoDS_Shape& aS=myImages.Find(aSImage);
+ myLS.Append(aS);
+ }
+ else {
+ myErrorStatus=33;// can not find original shape
+ return;
+ }
+ }
+ //
+ delete pSS;
+}
+//=======================================================================
+//function : MakeArguments
+//purpose :
+//=======================================================================
+void GEOMAlgo_FinderShapeOn::MakeArguments()
+{
+ myErrorStatus=0;
+ //
+ Standard_Integer i, aNb;
+ BRepLib_FaceError aFErr;
+ BRepLib_MakeFace aMF;
+ TopTools_IndexedMapOfShape aM;
+ BRep_Builder aBB;
+ TopoDS_Compound aCmp;
+ TopoDS_Shell aSh;
+ TopoDS_Solid aSd;
+ TopoDS_Shape aSC;
+ TopTools_DataMapOfShapeShape aOriginals;
+ TopExp_Explorer aExp;
+ //
+ // Argument 1
+ aMF.Init(mySurface, Standard_True);
+ aFErr=aMF.Error();
+ if (aFErr!=BRepLib_FaceDone) {
+ myErrorStatus=20; // can not build the face
+ return;
+ }
+ //
+ const TopoDS_Shape& aF=aMF.Shape();
+ //
+ // update tolerance
+ aExp.Init(aF, TopAbs_VERTEX);
+ for (; aExp.More(); aExp.Next()) {
+ const TopoDS_Vertex& aV=TopoDS::Vertex(aExp.Current());
+ aBB.UpdateVertex(aV, myTolerance);
+ }
+ aExp.Init(aF, TopAbs_EDGE);
+ for (; aExp.More(); aExp.Next()) {
+ const TopoDS_Edge& aE=TopoDS::Edge(aExp.Current());
+ aBB.UpdateEdge(aE, myTolerance);
+ }
+ const TopoDS_Face& aFace=TopoDS::Face(aF);
+ aBB.UpdateFace(aFace, myTolerance);
+ //
+ // make solid
+ aBB.MakeShell(aSh);
+ aBB.Add(aSh, aFace);
+ aBB.MakeSolid(aSd);
+ aBB.Add(aSd, aSh);
+ myArg1=aSd;
+ //
+ // Argument 2
+ //
+ myImages.Clear();
+ //
+ GEOMAlgo_FinderShapeOn::CopySource(myShape, myImages, aOriginals, aSC);
+ //
+ TopExp::MapShapes(aSC, myShapeType, aM);
+ aNb=aM.Extent();
+ if (!aNb) {
+ myWarningStatus=10; // No found subshapes of type myShapeType
+ return;
+ }
+ //
+ aBB.MakeCompound(aCmp);
+ for (i=1; i<=aNb; ++i) {
+ const TopoDS_Shape& aS=aM(i);
+ aBB.Add(aCmp, aS);
+ }
+ myArg2=aCmp;
+}
+//=======================================================================
+//function : CheckData
+//purpose :
+//=======================================================================
+void GEOMAlgo_FinderShapeOn::CheckData()
+{
+ myErrorStatus=0;
+ //
+ if(mySurface.IsNull()) {
+ myErrorStatus=10; // mySurface=NULL
+ return;
+ }
+ //
+ if (myShape.IsNull()) {
+ myErrorStatus=11; // myShape=NULL
+ return;
+ }
+ //
+ if (!(myShapeType==TopAbs_VERTEX ||
+ myShapeType==TopAbs_EDGE ||
+ myShapeType==TopAbs_FACE)) {
+ myErrorStatus=12; // unallowed subshape type
+ return;
+ }
+ //
+ if (myState==GEOMAlgo_ST_UNKNOWN ||
+ myState==GEOMAlgo_ST_INOUT) {
+ myErrorStatus=13; // unallowed state type
+ return;
+ }
+}
+//
+//=======================================================================
+//function : CopySource
+//purpose :
+//=======================================================================
+void GEOMAlgo_FinderShapeOn::CopySource(const TopoDS_Shape& aE,
+ TopTools_DataMapOfShapeShape& aImages,
+ TopTools_DataMapOfShapeShape& aOriginals,
+ TopoDS_Shape& aEx)
+{
+ Standard_Boolean bFree;
+ TopAbs_ShapeEnum aType;
+ Standard_Integer aR;
+ BRep_Builder BB;
+ TopoDS_Iterator aIt;
+ //
+ aType=aE.ShapeType();
+ //
+ if (aOriginals.IsBound(aE)) {
+ aEx=aOriginals.ChangeFind(aE);
+ if (aType==TopAbs_EDGE) {
+ return;
+ }
+ }
+ else {
+ aEx=aE.EmptyCopied();
+ aOriginals.Bind(aE, aEx);
+ aImages.Bind(aEx, aE);
+ }
+ //
+ aR=(Standard_Integer)aType+1;
+ if (aR>TopAbs_VERTEX) {
+ return;
+ }
+ //
+ bFree=aEx.Free();
+ aEx.Free(Standard_True);
+ //
+ aType=(TopAbs_ShapeEnum) aR;
+ //
+ aIt.Initialize(aE);//, Standard_False);
+ for (; aIt.More(); aIt.Next()) {
+ const TopoDS_Shape& aV=aIt.Value();
+ TopoDS_Shape aVx;
+ //
+ CopySource (aV, aImages, aOriginals, aVx);
+ //
+ aVx.Orientation(aV.Orientation());
+ BB.Add(aEx, aVx);
+ }
+ //
+ aEx.Free(bFree);
+}
+
+//
+// myErrorStatus :
+//
+// 10 -mySurface=NULL
+// 11 -myShape=NULL
+// 12 -unallowed type of subshapes
+// 13 -unallowed state
+// 20 -can not build the face
+// 30 -wrong args are used for DSFiller
+// 31 -DSFiller failed
+// 32 -builder ShapeSolid failed
+// 33 -can not find original shape
+//
+// myWarningStatus
+//
+// 10 -subshapes of type myShapeType can not be fond in myShape
+
--- /dev/null
+// File generated by CPPExt (Value)
+//
+// Copyright (C) 1991 - 2000 by
+// Matra Datavision SA. All rights reserved.
+//
+// Copyright (C) 2001 - 2004 by
+// Open CASCADE SA. All rights reserved.
+//
+// This file is part of the Open CASCADE Technology software.
+//
+// This software may be distributed and/or modified under the terms and
+// conditions of the Open CASCADE Public License as defined by Open CASCADE SA
+// and appearing in the file LICENSE included in the packaging of this file.
+//
+// This software is distributed on an "AS IS" basis, without warranty of any
+// kind, and Open CASCADE SA hereby disclaims all such warranties,
+// including without limitation, any warranties of merchantability, fitness
+// for a particular purpose or non-infringement. Please see the License for
+// the specific terms and conditions governing rights and limitations under the
+// License.
+
+#ifndef _GEOMAlgo_FinderShapeOn_HeaderFile
+#define _GEOMAlgo_FinderShapeOn_HeaderFile
+
+#ifndef _Handle_Geom_Surface_HeaderFile
+#include <Handle_Geom_Surface.hxx>
+#endif
+#ifndef _TopAbs_ShapeEnum_HeaderFile
+#include <TopAbs_ShapeEnum.hxx>
+#endif
+#ifndef _GEOMAlgo_State_HeaderFile
+#include <GEOMAlgo_State.hxx>
+#endif
+#ifndef _TopoDS_Shape_HeaderFile
+#include <TopoDS_Shape.hxx>
+#endif
+#ifndef _TopTools_ListOfShape_HeaderFile
+#include <TopTools_ListOfShape.hxx>
+#endif
+#ifndef _TopTools_DataMapOfShapeShape_HeaderFile
+#include <TopTools_DataMapOfShapeShape.hxx>
+#endif
+#ifndef _GEOMAlgo_ShapeAlgo_HeaderFile
+#include <GEOMAlgo_ShapeAlgo.hxx>
+#endif
+class Geom_Surface;
+class TopTools_ListOfShape;
+class TopoDS_Shape;
+class TopTools_DataMapOfShapeShape;
+
+
+#ifndef _Standard_HeaderFile
+#include <Standard.hxx>
+#endif
+#ifndef _Standard_Macro_HeaderFile
+#include <Standard_Macro.hxx>
+#endif
+
+class GEOMAlgo_FinderShapeOn : public GEOMAlgo_ShapeAlgo {
+
+public:
+
+ void* operator new(size_t,void* anAddress)
+ {
+ return anAddress;
+ }
+ void* operator new(size_t size)
+ {
+ return Standard::Allocate(size);
+ }
+ void operator delete(void *anAddress)
+ {
+ if (anAddress) Standard::Free((Standard_Address&)anAddress);
+ }
+ // Methods PUBLIC
+ //
+Standard_EXPORT GEOMAlgo_FinderShapeOn();
+Standard_EXPORT virtual ~GEOMAlgo_FinderShapeOn();
+Standard_EXPORT virtual void Perform() ;
+Standard_EXPORT void SetSurface(const Handle(Geom_Surface)& aS) ;
+Standard_EXPORT void SetShapeType(const TopAbs_ShapeEnum aST) ;
+Standard_EXPORT void SetState(const GEOMAlgo_State aSF) ;
+Standard_EXPORT const Handle_Geom_Surface& Surface() const;
+Standard_EXPORT TopAbs_ShapeEnum ShapeType() const;
+Standard_EXPORT GEOMAlgo_State State() const;
+Standard_EXPORT const TopTools_ListOfShape& Shapes() const;
+Standard_EXPORT static void CopySource(const TopoDS_Shape& aS,TopTools_DataMapOfShapeShape& aImages,TopTools_DataMapOfShapeShape& aOriginals,TopoDS_Shape& aSC) ;
+
+
+
+
+
+protected:
+
+ // Methods PROTECTED
+ //
+Standard_EXPORT virtual void CheckData() ;
+Standard_EXPORT void MakeArguments() ;
+Standard_EXPORT void Find() ;
+
+
+ // Fields PROTECTED
+ //
+Handle_Geom_Surface mySurface;
+TopAbs_ShapeEnum myShapeType;
+GEOMAlgo_State myState;
+TopoDS_Shape myArg1;
+TopoDS_Shape myArg2;
+TopTools_ListOfShape myLS;
+TopTools_DataMapOfShapeShape myImages;
+
+
+private:
+
+ // Methods PRIVATE
+ //
+
+
+ // Fields PRIVATE
+ //
+
+
+};
+
+
+
+
+
+// other Inline functions and methods (like "C++: function call" methods)
+//
+
+
+#endif
--- /dev/null
+// File generated by CPPExt (Value)
+//
+// Copyright (C) 1991 - 2000 by
+// Matra Datavision SA. All rights reserved.
+//
+// Copyright (C) 2001 - 2004 by
+// Open CASCADE SA. All rights reserved.
+//
+// This file is part of the Open CASCADE Technology software.
+//
+// This software may be distributed and/or modified under the terms and
+// conditions of the Open CASCADE Public License as defined by Open CASCADE SA
+// and appearing in the file LICENSE included in the packaging of this file.
+//
+// This software is distributed on an "AS IS" basis, without warranty of any
+// kind, and Open CASCADE SA hereby disclaims all such warranties,
+// including without limitation, any warranties of merchantability, fitness
+// for a particular purpose or non-infringement. Please see the License for
+// the specific terms and conditions governing rights and limitations under the
+// License.
+
+#include <GEOMAlgo_FinderShapeOn.jxx>
+
+
+
+
--- /dev/null
+#ifndef _Geom_Surface_HeaderFile
+#include <Geom_Surface.hxx>
+#endif
+#ifndef _TopTools_ListOfShape_HeaderFile
+#include <TopTools_ListOfShape.hxx>
+#endif
+#ifndef _TopoDS_Shape_HeaderFile
+#include <TopoDS_Shape.hxx>
+#endif
+#ifndef _TopTools_DataMapOfShapeShape_HeaderFile
+#include <TopTools_DataMapOfShapeShape.hxx>
+#endif
+#ifndef _GEOMAlgo_FinderShapeOn_HeaderFile
+#include <GEOMAlgo_FinderShapeOn.hxx>
+#endif
--- /dev/null
+-- File: GEOMAlgo_GlueAnalyser.cdl
+-- Created: Wed Dec 15 11:03:03 2004
+-- Author: Peter KURNEV
+-- <pkv@irinox>
+---Copyright: Matra Datavision 2004
+
+
+class GlueAnalyser from GEOMAlgo
+ inherits Gluer from GEOMAlgo
+ ---Purpose:
+
+uses
+ ShapeEnum from TopAbs,
+ ListOfShape from TopTools,
+ ListOfCoupleOfShapes from GEOMAlgo
+
+--raises
+
+is
+ Create
+ returns GlueAnalyser from GEOMAlgo;
+ ---C++: alias "Standard_EXPORT virtual ~GEOMAlgo_GlueAnalyser();"
+
+ Perform(me:out)
+ is redefined;
+
+ HasSolidsToGlue(me)
+ returns Boolean from Standard;
+
+ SolidsToGlue(me)
+ returns ListOfCoupleOfShapes from GEOMAlgo;
+ ---C++:return const &
+
+ HasSolidsAlone(me)
+ returns Boolean from Standard;
+
+ SolidsAlone(me)
+ returns ListOfShape from TopTools;
+ ---C++:return const &
+
+ DetectVertices(me:out)
+ is protected;
+
+ DetectEdges(me:out)
+ is protected;
+
+ DetectFaces(me:out)
+ is protected;
+
+ DetectShapes(me:out;
+ aType:ShapeEnum from TopAbs)
+ is protected;
+
+ DetectSolids (me:out)
+ is protected;
+
+
+
+fields
+ mySolidsToGlue : ListOfCoupleOfShapes from GEOMAlgo is protected;
+ mySolidsAlone : ListOfShape from TopTools is protected;
+
+end GlueAnalyser;
--- /dev/null
+// File: GEOMAlgo_GlueDetector.cxx
+// Created: Wed Dec 15 11:08:09 2004
+// Author: Peter KURNEV
+// <pkv@irinox>
+
+
+#include <GEOMAlgo_GlueAnalyser.ixx>
+
+#include <TopoDS.hxx>
+#include <TopoDS_Shape.hxx>
+#include <TopoDS_Face.hxx>
+#include <TopoDS_Edge.hxx>
+#include <TopoDS_Compound.hxx>
+
+#include <BRep_Builder.hxx>
+
+#include <TopExp.hxx>
+
+#include <TopTools_IndexedMapOfShape.hxx>
+#include <TopTools_ListOfShape.hxx>
+#include <TopTools_ListIteratorOfListOfShape.hxx>
+#include <TopTools_IndexedDataMapOfShapeListOfShape.hxx>
+#include <TopTools_DataMapIteratorOfDataMapOfShapeListOfShape.hxx>
+
+#include <GEOMAlgo_PassKey.hxx>
+#include <GEOMAlgo_IndexedDataMapOfPassKeyListOfShape.hxx>
+#include <GEOMAlgo_Tools.hxx>
+#include <GEOMAlgo_CoupleOfShapes.hxx>
+
+#include <GEOMAlgo_Gluer.hxx>
+#include <Bnd_HArray1OfBox.hxx>
+#include <Bnd_BoundSortBox.hxx>
+#include <TopoDS_Vertex.hxx>
+#include <GEOMAlgo_IndexedDataMapOfIntegerShape.hxx>
+#include <GEOMAlgo_IndexedDataMapOfShapeBox.hxx>
+#include <Bnd_Box.hxx>
+#include <TColStd_ListOfInteger.hxx>
+#include <TopTools_MapOfShape.hxx>
+#include <TColStd_ListIteratorOfListOfInteger.hxx>
+#include <BRepBndLib.hxx>
+
+//=======================================================================
+//function :
+//purpose :
+//=======================================================================
+ GEOMAlgo_GlueAnalyser::GEOMAlgo_GlueAnalyser()
+:
+ GEOMAlgo_Gluer()
+{}
+//=======================================================================
+//function : ~
+//purpose :
+//=======================================================================
+ GEOMAlgo_GlueAnalyser::~GEOMAlgo_GlueAnalyser()
+{}
+//=======================================================================
+//function : HasSolidsToGlue
+//purpose :
+//=======================================================================
+ Standard_Boolean GEOMAlgo_GlueAnalyser::HasSolidsToGlue()const
+{
+ return !mySolidsToGlue.IsEmpty();
+}
+//=======================================================================
+//function : HasSolidsAlone
+//purpose :
+//=======================================================================
+ Standard_Boolean GEOMAlgo_GlueAnalyser::HasSolidsAlone()const
+{
+ return !mySolidsAlone.IsEmpty();
+}
+//=======================================================================
+//function : SolidsToGlue
+//purpose :
+//=======================================================================
+ const GEOMAlgo_ListOfCoupleOfShapes& GEOMAlgo_GlueAnalyser::SolidsToGlue()const
+{
+ return mySolidsToGlue;
+}
+//=======================================================================
+//function : SolidsAlone
+//purpose :
+//=======================================================================
+ const TopTools_ListOfShape& GEOMAlgo_GlueAnalyser::SolidsAlone()const
+{
+ return mySolidsAlone;
+}
+//=======================================================================
+//function : Perform
+//purpose :
+//=======================================================================
+ void GEOMAlgo_GlueAnalyser::Perform()
+{
+ myErrorStatus=0;
+ myWarningStatus=0;
+ //
+ mySolidsToGlue.Clear();
+ mySolidsAlone.Clear();
+ //
+ CheckData();
+ if (myErrorStatus) {
+ return;
+ }
+ //
+ InnerTolerance();
+ if (myErrorStatus) {
+ return;
+ }
+ //
+ DetectVertices();
+ if (myErrorStatus) {
+ return;
+ }
+ //
+ DetectEdges();
+ if (myErrorStatus) {
+ return;
+ }
+ //
+ DetectFaces();
+ if (myErrorStatus) {
+ return;
+ }
+ //
+ DetectSolids();
+ if (myErrorStatus) {
+ return;
+ }
+}
+//=======================================================================
+//function : DetectVertices
+//purpose :
+//=======================================================================
+ void GEOMAlgo_GlueAnalyser::DetectVertices()
+{
+ myErrorStatus=0;
+ //
+ Standard_Integer j, i, aNbV, aIndex, aNbVSD;
+ TColStd_ListIteratorOfListOfInteger aIt;
+ Handle(Bnd_HArray1OfBox) aHAB;
+ Bnd_BoundSortBox aBSB;
+ TopoDS_Shape aSTmp, aVF;
+ TopoDS_Vertex aVnew;
+ TopTools_IndexedMapOfShape aMV, aMVProcessed;
+ TopTools_ListIteratorOfListOfShape aItS;
+ TopTools_DataMapIteratorOfDataMapOfShapeListOfShape aItIm;
+ GEOMAlgo_IndexedDataMapOfIntegerShape aMIS;
+ GEOMAlgo_IndexedDataMapOfShapeBox aMSB;
+ //
+ TopExp::MapShapes(myShape, TopAbs_VERTEX, aMV);
+ aNbV=aMV.Extent();
+ if (!aNbV) {
+ myErrorStatus=2; // no vertices in source shape
+ return;
+ }
+ //
+ aHAB=new Bnd_HArray1OfBox(1, aNbV);
+ //
+ for (i=1; i<=aNbV; ++i) {
+ const TopoDS_Shape& aV=aMV(i);
+ Bnd_Box aBox;
+ //
+ aBox.SetGap(myTol);
+ BRepBndLib::Add(aV, aBox);
+ aHAB->SetValue(i, aBox);
+ aMIS.Add(i, aV);
+ aMSB.Add(aV, aBox);
+ }
+ //
+ aBSB.Initialize(aHAB);
+ //
+ for (i=1; i<=aNbV; ++i) {
+ const TopoDS_Shape& aV=aMV(i);
+ //
+ if (aMVProcessed.Contains(aV)) {
+ continue;
+ }
+ //
+ const Bnd_Box& aBoxV=aMSB.FindFromKey(aV);
+ const TColStd_ListOfInteger& aLI=aBSB.Compare(aBoxV);
+ aNbVSD=aLI.Extent();
+ if (!aNbVSD) {
+ myErrorStatus=3; // it must not be
+ return;
+ }
+ //
+ // Images
+ TopTools_ListOfShape aLVSD;
+ //
+ aIt.Initialize(aLI);
+ for (j=0; aIt.More(); aIt.Next(), ++j) {
+ aIndex=aIt.Value();
+ const TopoDS_Shape& aVx=aMIS.FindFromKey(aIndex);
+ if(!j) {
+ aVF=aVx;
+ }
+ aLVSD.Append(aVx);
+ aMVProcessed.Add(aVx);
+ }
+ myImages.Bind(aVF, aLVSD);
+ }
+ // Origins
+ aItIm.Initialize(myImages);
+ for (; aItIm.More(); aItIm.Next()) {
+ const TopoDS_Shape& aV=aItIm.Key();
+ const TopTools_ListOfShape& aLVSD=aItIm.Value();
+ //
+ aItS.Initialize(aLVSD);
+ for (; aItS.More(); aItS.Next()) {
+ const TopoDS_Shape& aVSD=aItS.Value();
+ if (!myOrigins.IsBound(aVSD)) {
+ myOrigins.Bind(aVSD, aV);
+ }
+ }
+ }
+}
+//=======================================================================
+//function : DetectFaces
+//purpose :
+//=======================================================================
+ void GEOMAlgo_GlueAnalyser::DetectFaces()
+{
+ DetectShapes(TopAbs_FACE);
+}
+//=======================================================================
+//function : DetectEdges
+//purpose :
+//=======================================================================
+ void GEOMAlgo_GlueAnalyser::DetectEdges()
+{
+ DetectShapes(TopAbs_EDGE);
+}
+//=======================================================================
+//function : DetectShapes
+//purpose :
+//=======================================================================
+ void GEOMAlgo_GlueAnalyser::DetectShapes(const TopAbs_ShapeEnum aType)
+{
+ myErrorStatus=0;
+ //
+ Standard_Integer i, aNbF, aNbSDF, iErr;
+ TopoDS_Shape aNewShape;
+ TopTools_IndexedMapOfShape aMF;
+ TopTools_ListIteratorOfListOfShape aItS;
+ GEOMAlgo_PassKey aPKF;
+ GEOMAlgo_IndexedDataMapOfPassKeyListOfShape aMPKLF;
+ //
+ TopExp::MapShapes(myShape, aType, aMF);
+ //
+ aNbF=aMF.Extent();
+ for (i=1; i<=aNbF; ++i) {
+ const TopoDS_Shape& aS=aMF(i);
+ //
+ aPKF.Clear();
+ if (aType==TopAbs_FACE) {
+ const TopoDS_Face& aF=TopoDS::Face(aS);
+ FacePassKey(aF, aPKF);
+ }
+ else if (aType==TopAbs_EDGE) {
+ const TopoDS_Edge& aE=TopoDS::Edge(aS);
+ EdgePassKey(aE, aPKF);
+ }
+ //
+ if (myErrorStatus) {
+ return;
+ }
+ //
+ if (aMPKLF.Contains(aPKF)) {
+ TopTools_ListOfShape& aLSDF=aMPKLF.ChangeFromKey(aPKF);
+ aLSDF.Append(aS);
+ }
+ else {
+ TopTools_ListOfShape aLSDF;
+ //
+ aLSDF.Append(aS);
+ aMPKLF.Add(aPKF, aLSDF);
+ }
+ }
+ // check geometric coincidence
+ if (myCheckGeometry) {
+ iErr=GEOMAlgo_Tools::RefineSDShapes(aMPKLF, myTol, myContext); //XX
+ if (iErr) {
+ myErrorStatus=200;
+ return;
+ }
+ }
+ //
+ // Images/Origins
+ aNbF=aMPKLF.Extent();
+ for (i=1; i<=aNbF; ++i) {
+ const TopTools_ListOfShape& aLSDF=aMPKLF(i);
+ aNbSDF=aLSDF.Extent();
+ if (!aNbSDF) {
+ myErrorStatus=4; // it must not be
+ }
+ //
+ const TopoDS_Shape& aS1=aLSDF.First();
+ aNewShape=aS1;
+ //
+ myImages.Bind(aNewShape, aLSDF);
+ // origins
+ aItS.Initialize(aLSDF);
+ for (; aItS.More(); aItS.Next()) {
+ const TopoDS_Shape& aFSD=aItS.Value();
+ if (!myOrigins.IsBound(aFSD)) {
+ myOrigins.Bind(aFSD, aNewShape);
+ }
+ }
+ }
+}
+//=======================================================================
+//function : DetectSolids
+//purpose :
+//=======================================================================
+ void GEOMAlgo_GlueAnalyser::DetectSolids()
+{
+ myErrorStatus=0;
+ //
+ Standard_Integer i, aNbF, aNbS, aNbC, aNbX;
+ TopoDS_Compound aCmp;
+ BRep_Builder aBB;
+ TopTools_IndexedDataMapOfShapeListOfShape aMFS;
+ TopTools_IndexedMapOfShape aMx, aMS;
+ TopTools_DataMapIteratorOfDataMapOfShapeListOfShape aItIm;
+ GEOMAlgo_IndexedDataMapOfPassKeyListOfShape aMPKLS;
+ GEOMAlgo_PassKey aPKSx;
+ GEOMAlgo_CoupleOfShapes aCS;
+ //
+ aBB.MakeCompound(aCmp);
+ //
+ TopExp::MapShapesAndAncestors(myShape, TopAbs_FACE, TopAbs_SOLID, aMFS);
+ //
+ aItIm.Initialize(myImages);
+ for (; aItIm.More(); aItIm.Next()) {
+ const TopoDS_Shape& aIm=aItIm.Key();
+ if (aIm.ShapeType()!=TopAbs_FACE) {
+ continue;
+ }
+ //
+ const TopTools_ListOfShape& aLF=aItIm.Value();
+ aNbF=aLF.Extent();
+ if (aNbF!=2) {
+ continue;
+ }
+ //
+ TopoDS_Shape aSx[2], aFx[2];
+ //
+ aFx[0]=aLF.First();
+ aFx[1]=aLF.Last();
+ for (i=0; i<2; ++i) {
+ if (!aMFS.Contains(aFx[i])) {
+ continue;// it must not be so
+ }
+ //
+ const TopTools_ListOfShape& aLS=aMFS.FindFromKey(aFx[i]);
+ aNbS=aLS.Extent();
+ if (aNbS!=1) {
+ continue;
+ }
+ aSx[i]=aLS.First();
+ }
+ //
+ if (aSx[0].IsNull() || aSx[1].IsNull()) {
+ continue;
+ }
+ //
+ aPKSx.Clear();
+ aPKSx.SetIds(aSx[0], aSx[1]);
+ //
+ if (!aMPKLS.Contains(aPKSx)) {
+ TopTools_ListOfShape aLSx;
+ //
+ aLSx.Append(aSx[0]);
+ aLSx.Append(aSx[1]);
+ //
+ aMPKLS.Add(aPKSx, aLSx);
+ }
+ }
+ //
+ mySolidsToGlue.Clear();
+ mySolidsAlone.Clear();
+
+ //
+ aNbC=aMPKLS.Extent();
+ if (!aNbC) {
+ return;
+ }
+ //
+ for (i=1; i<=aNbC; ++i) {
+ const TopTools_ListOfShape& aLSx=aMPKLS(i);
+ const TopoDS_Shape& aSx1=aLSx.First();
+ const TopoDS_Shape& aSx2=aLSx.Last();
+ aCS.SetShape1(aSx1);
+ aCS.SetShape2(aSx2);
+ mySolidsToGlue.Append(aCS);
+ //
+ if (!aMx.Contains(aSx1)) {
+ aBB.Add(aCmp, aSx1);
+ aMx.Add(aSx1);
+ }
+ if (!aMx.Contains(aSx2)) {
+ aBB.Add(aCmp, aSx2);
+ aMx.Add(aSx2);
+ }
+ }
+ myResult=aCmp;
+ //
+ // check alone solids
+ TopExp::MapShapes(myShape, TopAbs_SOLID, aMS);
+ //
+ aNbX=aMx.Extent();
+ for (i=1; i<=aNbX; ++i) {
+ const TopoDS_Shape& aSx=aMx(i);
+ if (!aMS.Contains(aSx)) {
+ mySolidsAlone.Append(aSx);
+ }
+ }
+}
+
+/*
+// A
+ // Make vertices
+ aMV.Clear();
+ aItIm.Initialize(myImages);
+ for (; aItIm.More(); aItIm.Next()) {
+ const TopoDS_Shape& aV=aItIm.Key();
+ aMV.Add(aV);
+ const TopTools_ListOfShape& aLVSD=aItIm.Value();
+ MakeVertex(aLVSD, aVnew);//ZZ
+ myImages.Bind(aVnew, aLVSD);
+ }
+ //
+ aNbV=aMV.Extent();
+ for (i=1; i<=aNbV; ++i) {
+ const TopoDS_Shape& aV=aMV(i);
+ myImages.UnBind(aV);
+ }
+ //
+ */
--- /dev/null
+// File generated by CPPExt (Value)
+//
+// Copyright (C) 1991 - 2000 by
+// Matra Datavision SA. All rights reserved.
+//
+// Copyright (C) 2001 - 2004 by
+// Open CASCADE SA. All rights reserved.
+//
+// This file is part of the Open CASCADE Technology software.
+//
+// This software may be distributed and/or modified under the terms and
+// conditions of the Open CASCADE Public License as defined by Open CASCADE SA
+// and appearing in the file LICENSE included in the packaging of this file.
+//
+// This software is distributed on an "AS IS" basis, without warranty of any
+// kind, and Open CASCADE SA hereby disclaims all such warranties,
+// including without limitation, any warranties of merchantability, fitness
+// for a particular purpose or non-infringement. Please see the License for
+// the specific terms and conditions governing rights and limitations under the
+// License.
+
+#ifndef _GEOMAlgo_GlueAnalyser_HeaderFile
+#define _GEOMAlgo_GlueAnalyser_HeaderFile
+
+#ifndef _GEOMAlgo_ListOfCoupleOfShapes_HeaderFile
+#include <GEOMAlgo_ListOfCoupleOfShapes.hxx>
+#endif
+#ifndef _TopTools_ListOfShape_HeaderFile
+#include <TopTools_ListOfShape.hxx>
+#endif
+#ifndef _GEOMAlgo_Gluer_HeaderFile
+#include <GEOMAlgo_Gluer.hxx>
+#endif
+#ifndef _Standard_Boolean_HeaderFile
+#include <Standard_Boolean.hxx>
+#endif
+#ifndef _TopAbs_ShapeEnum_HeaderFile
+#include <TopAbs_ShapeEnum.hxx>
+#endif
+class GEOMAlgo_ListOfCoupleOfShapes;
+class TopTools_ListOfShape;
+
+
+#ifndef _Standard_HeaderFile
+#include <Standard.hxx>
+#endif
+#ifndef _Standard_Macro_HeaderFile
+#include <Standard_Macro.hxx>
+#endif
+
+class GEOMAlgo_GlueAnalyser : public GEOMAlgo_Gluer {
+
+public:
+
+ void* operator new(size_t,void* anAddress)
+ {
+ return anAddress;
+ }
+ void* operator new(size_t size)
+ {
+ return Standard::Allocate(size);
+ }
+ void operator delete(void *anAddress)
+ {
+ if (anAddress) Standard::Free((Standard_Address&)anAddress);
+ }
+ // Methods PUBLIC
+ //
+Standard_EXPORT GEOMAlgo_GlueAnalyser();
+Standard_EXPORT virtual ~GEOMAlgo_GlueAnalyser();
+Standard_EXPORT virtual void Perform() ;
+Standard_EXPORT Standard_Boolean HasSolidsToGlue() const;
+Standard_EXPORT const GEOMAlgo_ListOfCoupleOfShapes& SolidsToGlue() const;
+Standard_EXPORT Standard_Boolean HasSolidsAlone() const;
+Standard_EXPORT const TopTools_ListOfShape& SolidsAlone() const;
+
+
+
+
+
+protected:
+
+ // Methods PROTECTED
+ //
+Standard_EXPORT void DetectVertices() ;
+Standard_EXPORT void DetectEdges() ;
+Standard_EXPORT void DetectFaces() ;
+Standard_EXPORT void DetectShapes(const TopAbs_ShapeEnum aType) ;
+Standard_EXPORT void DetectSolids() ;
+
+
+ // Fields PROTECTED
+ //
+GEOMAlgo_ListOfCoupleOfShapes mySolidsToGlue;
+TopTools_ListOfShape mySolidsAlone;
+
+
+private:
+
+ // Methods PRIVATE
+ //
+
+
+ // Fields PRIVATE
+ //
+
+
+};
+
+
+
+
+
+// other Inline functions and methods (like "C++: function call" methods)
+//
+
+
+#endif
--- /dev/null
+// File generated by CPPExt (Value)
+//
+// Copyright (C) 1991 - 2000 by
+// Matra Datavision SA. All rights reserved.
+//
+// Copyright (C) 2001 - 2004 by
+// Open CASCADE SA. All rights reserved.
+//
+// This file is part of the Open CASCADE Technology software.
+//
+// This software may be distributed and/or modified under the terms and
+// conditions of the Open CASCADE Public License as defined by Open CASCADE SA
+// and appearing in the file LICENSE included in the packaging of this file.
+//
+// This software is distributed on an "AS IS" basis, without warranty of any
+// kind, and Open CASCADE SA hereby disclaims all such warranties,
+// including without limitation, any warranties of merchantability, fitness
+// for a particular purpose or non-infringement. Please see the License for
+// the specific terms and conditions governing rights and limitations under the
+// License.
+
+#include <GEOMAlgo_GlueAnalyser.jxx>
+
+
+
+
--- /dev/null
+#ifndef _GEOMAlgo_ListOfCoupleOfShapes_HeaderFile
+#include <GEOMAlgo_ListOfCoupleOfShapes.hxx>
+#endif
+#ifndef _TopTools_ListOfShape_HeaderFile
+#include <TopTools_ListOfShape.hxx>
+#endif
+#ifndef _GEOMAlgo_GlueAnalyser_HeaderFile
+#include <GEOMAlgo_GlueAnalyser.hxx>
+#endif
ShapeEnum from TopAbs,
Shape from TopoDS,
Edge from TopoDS,
- Face from TopoDS,
+ Face from TopoDS,
+ Vertex from TopoDS,
+ ListOfShape from TopTools,
DataMapOfShapeShape from TopTools,
DataMapOfShapeListOfShape from TopTools,
Context from IntTools,
PassKey from GEOMAlgo
+
--raises
is
returns Boolean from Standard;
Perform(me:out)
- is redefined;
-
+ is redefined;
+
+ AloneShapes(me)
+ returns Integer from Standard;
+
CheckData(me:out)
is redefined protected;
CheckResult (me:out)
is redefined protected;
- BuildResult (me:out)
- is protected;
-
MakeVertices(me:out)
is protected;
aPK:out PassKey from GEOMAlgo)
is protected;
+ MakeVertex(me:out;
+ aLV : ListOfShape from TopTools;
+ aNewV: out Vertex from TopoDS)
+ is protected;
MakeEdge(me:out;
aEdge : Edge from TopoDS;
aNewEdge: out Edge from TopoDS)
---C++:return const &
fields
+ myCheckGeometry : Boolean from Standard is protected;
+ myTol : Real from Standard is protected;
+ myImages : DataMapOfShapeListOfShape from TopTools is protected;
+ myOrigins : DataMapOfShapeShape from TopTools is protected;
+ myNbAlone : Integer from Standard is protected;
- myCheckGeometry : Boolean from Standard is protected;
-
- myImages : DataMapOfShapeListOfShape from TopTools is protected;
- myOrigins : DataMapOfShapeShape from TopTools is protected;
- myContext : Context from IntTools is protected;
- myTypeResult: ShapeEnum from TopAbs is protected;
- myTol : Real from Standard is protected;
-
end Gluer;
#include <gp_Pnt.hxx>
#include <gp_Dir.hxx>
+#include <gp_XYZ.hxx>
#include <Geom_Curve.hxx>
#include <Geom_Surface.hxx>
#include <Bnd_Box.hxx>
#include <Bnd_HArray1OfBox.hxx>
#include <Bnd_BoundSortBox.hxx>
-#include <BRepBndLib.hxx>
#include <TopLoc_Location.hxx>
#include <TopAbs_ShapeEnum.hxx>
#include <BRep_Tool.hxx>
#include <BRep_Builder.hxx>
+#include <BRepLib.hxx>
+#include <BRepTools.hxx>
+#include <BRepBndLib.hxx>
#include <IntTools_Context.hxx>
#include <BOPTools_Tools.hxx>
#include <BOPTools_Tools3D.hxx>
#include <BOPTools_Tools2D.hxx>
+#include <BOP_CorrectTolerances.hxx>
#include <GEOMAlgo_IndexedDataMapOfIntegerShape.hxx>
#include <GEOMAlgo_IndexedDataMapOfShapeBox.hxx>
myTolerance=0.0001;
myTol=myTolerance;
myCheckGeometry=Standard_True;
- myTypeResult=TopAbs_SOLID;
+ myNbAlone=0;
}
//=======================================================================
//function : ~GEOMAlgo_Gluer
{
return myCheckGeometry;
}
-
+//=======================================================================
+//function : AloneShapes
+//purpose :
+//=======================================================================
+Standard_Integer GEOMAlgo_Gluer::AloneShapes()const
+{
+ return myNbAlone;
+}
//=======================================================================
//function : Images
//purpose :
myWarningStatus=0;
//
Standard_Integer i;
- const Standard_Integer aNb=9;
+ const Standard_Integer aNb=8;
void (GEOMAlgo_Gluer::* pF[aNb])()={
&GEOMAlgo_Gluer::CheckData, &GEOMAlgo_Gluer::InnerTolerance,
&GEOMAlgo_Gluer::MakeVertices, &GEOMAlgo_Gluer::MakeEdges,
&GEOMAlgo_Gluer::MakeFaces, &GEOMAlgo_Gluer::MakeShells,
- &GEOMAlgo_Gluer::MakeSolids, &GEOMAlgo_Gluer::BuildResult,
- &GEOMAlgo_Gluer::CheckResult
+ &GEOMAlgo_Gluer::MakeSolids, &GEOMAlgo_Gluer::CheckResult
};
//
- //TimeReset();
- //StartChrono();
- //
for (i=0; i<aNb; ++i) {
(this->*pF[i])();
if (myErrorStatus) {
return;
}
}
- //
- //StopChrono();
- //TimeShow();
}
//=======================================================================
-//function : CheckResult
+//function : MakeVertices
//purpose :
//=======================================================================
-void GEOMAlgo_Gluer::CheckResult()
+void GEOMAlgo_Gluer::MakeVertices()
{
myErrorStatus=0;
//
- if (myResult.IsNull()) {
- myErrorStatus=6;
- return;
+ Standard_Integer j, i, aNbV, aIndex, aNbVSD;
+ TColStd_ListIteratorOfListOfInteger aIt;
+ Handle(Bnd_HArray1OfBox) aHAB;
+ Bnd_BoundSortBox aBSB;
+ TopoDS_Shape aSTmp, aVF;
+ TopoDS_Vertex aVnew;
+ TopTools_IndexedMapOfShape aMV, aMVProcessed;
+ TopTools_ListIteratorOfListOfShape aItS;
+ TopTools_DataMapIteratorOfDataMapOfShapeListOfShape aItIm;
+ TopTools_DataMapOfShapeListOfShape aMVV;
+ GEOMAlgo_IndexedDataMapOfIntegerShape aMIS;
+ GEOMAlgo_IndexedDataMapOfShapeBox aMSB;
+ //
+ TopExp::MapShapes(myShape, TopAbs_VERTEX, aMV);
+ aNbV=aMV.Extent();
+ if (!aNbV) {
+ myErrorStatus=2; // no vertices in source shape
+ return;
}
- //
- Standard_Boolean bFound;
- Standard_Integer i, j, aNbS, aNbFS, aNbSx;
- TopTools_IndexedMapOfShape aMS, aMFS;
- TopTools_IndexedDataMapOfShapeListOfShape aMFR;
//
- TopExp::MapShapesAndAncestors(myResult, TopAbs_FACE, myTypeResult, aMFR);
- TopExp::MapShapes(myResult, myTypeResult, aMS);
+ aHAB=new Bnd_HArray1OfBox(1, aNbV);
//
- aNbS=aMS.Extent();
- for (i=1; i<=aNbS; ++i) {
- const TopoDS_Shape& aSolid=aMS(i);
+ for (i=1; i<=aNbV; ++i) {
+ const TopoDS_Shape& aV=aMV(i);
+ Bnd_Box aBox;
//
- aMFS.Clear();
- TopExp::MapShapes(aSolid, TopAbs_FACE, aMFS);
+ aBox.SetGap(myTol);
+ BRepBndLib::Add(aV, aBox);
+ aHAB->SetValue(i, aBox);
+ aMIS.Add(i, aV);
+ aMSB.Add(aV, aBox);
+ }
+ //
+ aBSB.Initialize(aHAB);
+ //
+ for (i=1; i<=aNbV; ++i) {
+ const TopoDS_Shape& aV=aMV(i);
//
- bFound=Standard_False;
- aNbFS=aMFS.Extent();
- for (j=1; j<=aNbFS; ++j) {
- const TopoDS_Shape& aFS=aMFS(j);
- if (aMFR.Contains(aFS)) {
- const TopTools_ListOfShape& aLSx=aMFR.FindFromKey(aFS);
- aNbSx=aLSx.Extent();
- if (aNbSx==2) {
- bFound=!bFound;
- break;
- }
- }
+ if (aMVProcessed.Contains(aV)) {
+ continue;
}
//
- if (!bFound) {
- myWarningStatus=1;
- break;
+ const Bnd_Box& aBoxV=aMSB.FindFromKey(aV);
+ const TColStd_ListOfInteger& aLI=aBSB.Compare(aBoxV);
+ aNbVSD=aLI.Extent();
+ if (!aNbVSD) {
+ myErrorStatus=3; // it must not be
+ return;
}
+ //
+ // Images
+ //
+ TopTools_ListOfShape aLVSD;
+ //
+ aIt.Initialize(aLI);
+ for (j=0; aIt.More(); aIt.Next(), ++j) {
+ aIndex=aIt.Value();
+ const TopoDS_Shape& aVx=aMIS.FindFromKey(aIndex);
+ if(!j) {
+ aVF=aVx;
+ }
+ aLVSD.Append(aVx);
+ aMVProcessed.Add(aVx);
+ }
+ //
+ myImages.Bind(aVF, aLVSD);
}
-}
-//=======================================================================
-//function : CheckData
-//purpose :
-//=======================================================================
-void GEOMAlgo_Gluer::CheckData()
-{
- myErrorStatus=0;
//
- if (myShape.IsNull()) {
- myErrorStatus=5;
- return;
+ // Make new vertices
+ aMV.Clear();
+ aItIm.Initialize(myImages);
+ for (; aItIm.More(); aItIm.Next()) {
+ const TopoDS_Shape& aV=aItIm.Key();
+ const TopTools_ListOfShape& aLVSD=aItIm.Value();
+ aNbVSD=aLVSD.Extent();
+ if (aNbVSD>1) {
+ aMV.Add(aV);
+ MakeVertex(aLVSD, aVnew);
+ aMVV.Bind(aVnew, aLVSD);
+ }
}
-
-}
-//=======================================================================
-//function : InnerTolerance
-//purpose :
-//=======================================================================
-void GEOMAlgo_Gluer::InnerTolerance()
-{
- myErrorStatus=0;
- //
- Standard_Integer i;
- Standard_Real aX[3][2], dH, dHmin, aCoef, aTolTresh;
- Bnd_Box aBox;
//
- BRepBndLib::Add(myShape, aBox);
- aBox.Get(aX[0][0], aX[1][0], aX[2][0], aX[0][1], aX[1][1], aX[2][1]);
+ // UnBind old vertices
+ aNbV=aMV.Extent();
+ for (i=1; i<=aNbV; ++i) {
+ const TopoDS_Shape& aV=aMV(i);
+ myImages.UnBind(aV);
+ }
//
- dHmin=aX[0][1]-aX[0][0];
- for (i=1; i<3; ++i) {
- dH=aX[i][1]-aX[i][0];
- if (dH<dHmin) {
- dHmin=dH;
- }
+ // Bind new vertices
+ aItIm.Initialize(aMVV);
+ for (; aItIm.More(); aItIm.Next()) {
+ const TopoDS_Shape& aV=aItIm.Key();
+ const TopTools_ListOfShape& aLVSD=aItIm.Value();
+ myImages.Bind(aV, aLVSD);
}
//
- myTol=myTolerance;
- aCoef=0.01;
- aTolTresh=aCoef*dHmin;
- if (myTol>aTolTresh) {
- myTol=aTolTresh;
+ // Origins
+ aItIm.Initialize(myImages);
+ for (; aItIm.More(); aItIm.Next()) {
+ const TopoDS_Shape& aV=aItIm.Key();
+ const TopTools_ListOfShape& aLVSD=aItIm.Value();
+ //
+ aItS.Initialize(aLVSD);
+ for (; aItS.More(); aItS.Next()) {
+ const TopoDS_Shape& aVSD=aItS.Value();
+ if (!myOrigins.IsBound(aVSD)) {
+ myOrigins.Bind(aVSD, aV);
+ }
+ }
}
}
//=======================================================================
{
myErrorStatus=0;
//
- Standard_Integer i, aNbS;
+ Standard_Integer aNbS;
TopAbs_Orientation anOr;
+ TopoDS_Compound aCmp;
TopoDS_Solid aNewSolid;
TopTools_IndexedMapOfShape aMS;
- TopExp_Explorer aExp;
+ TopExp_Explorer aExpS, aExp;
BRep_Builder aBB;
//
- TopExp::MapShapes(myShape, TopAbs_SOLID, aMS);
+ aBB.MakeCompound(aCmp);
+ //
aNbS=aMS.Extent();
- for (i=1; i<=aNbS; ++i) {
- const TopoDS_Solid& aSolid=TopoDS::Solid(aMS(i));
+ aExpS.Init(myShape, TopAbs_SOLID);
+ for (; aExpS.More(); aExpS.Next()) {
+ const TopoDS_Solid& aSolid=TopoDS::Solid(aExpS.Current());
+ if (aMS.Contains(aSolid)) {
+ continue;
+ }
+ aMS.Add(aSolid);
+ //
anOr=aSolid.Orientation();
//
aBB.MakeSolid(aNewSolid);
const TopoDS_Shape& aShellR=myOrigins.Find(aShell);
aBB.Add(aNewSolid, aShellR);
}
+ //
TopTools_ListOfShape aLS;
//
aLS.Append(aSolid);
myImages.Bind(aNewSolid, aLS);
myOrigins.Bind(aSolid, aNewSolid);
+ //
+ aBB.Add(aCmp, aNewSolid);
+ }
+ //
+ myResult=aCmp;
+ //
+ aNbS=aMS.Extent();
+ if (aNbS) {
+ Standard_Real aTol=1.e-7;
+ BOP_CorrectTolerances::CorrectCurveOnSurface(myResult);
}
}
//=======================================================================
}
// check geometric coincidence
if (myCheckGeometry) {
- iErr=GEOMAlgo_Tools::RefineSDShapes(aMPKLF, myTol, myContext); //XX
+ iErr=GEOMAlgo_Tools::RefineSDShapes(aMPKLF, myTol, myContext);
if (iErr) {
myErrorStatus=200;
return;
}
}
//=======================================================================
-//function : MakeVertices
+//function : CheckResult
//purpose :
//=======================================================================
-void GEOMAlgo_Gluer::MakeVertices()
+void GEOMAlgo_Gluer::CheckResult()
{
myErrorStatus=0;
//
- Standard_Boolean bFound;
- Standard_Integer i, aNbV, aIndex, aNbVSD;
- TColStd_ListIteratorOfListOfInteger aIt;
- Handle(Bnd_HArray1OfBox) aHAB;
- Bnd_BoundSortBox aBSB;
- TopoDS_Shape aSTmp;
- TopTools_IndexedMapOfShape aMV;
- TopTools_ListIteratorOfListOfShape aItS;
- TopTools_DataMapIteratorOfDataMapOfShapeListOfShape aItIm;
- GEOMAlgo_IndexedDataMapOfIntegerShape aMIS;
- GEOMAlgo_IndexedDataMapOfShapeBox aMSB;
- //
- TopExp::MapShapes(myShape, TopAbs_VERTEX, aMV);
- aNbV=aMV.Extent();
- if (!aNbV) {
- myErrorStatus=2; // no vertices in source shape
- return;
- }
- //
- aHAB=new Bnd_HArray1OfBox(1, aNbV);
- //
- for (i=1; i<=aNbV; ++i) {
- const TopoDS_Shape& aV=aMV(i);
- Bnd_Box aBox;
- //
- aBox.SetGap(myTol);//XX
- BRepBndLib::Add(aV, aBox);
- aHAB->SetValue(i, aBox);
- aMIS.Add(i, aV);
- aMSB.Add(aV, aBox);
+ if (myResult.IsNull()) {
+ myErrorStatus=6;
+ return;
}
+ //
+ Standard_Boolean bFound;
+ Standard_Integer i, j, aNbS, aNbFS, aNbSx;
+ TopTools_IndexedMapOfShape aMS, aMFS;
+ TopTools_IndexedDataMapOfShapeListOfShape aMFR;
//
- aBSB.Initialize(aHAB);
+ TopExp::MapShapesAndAncestors(myResult, TopAbs_FACE, TopAbs_SOLID, aMFR);
+ TopExp::MapShapes(myResult, TopAbs_SOLID, aMS);
//
- for (i=1; i<=aNbV; ++i) {
- const TopoDS_Shape& aV=aMV(i);
- const Bnd_Box& aBoxV=aMSB.FindFromKey(aV);
- const TColStd_ListOfInteger& aLI=aBSB.Compare(aBoxV);
- aNbVSD=aLI.Extent();
- if (!aNbVSD) {
- myErrorStatus=3; // it must not be
- return;
- }
+
+ myNbAlone=0;
+ aNbS=aMS.Extent();
+ for (i=1; i<=aNbS; ++i) {
+ const TopoDS_Shape& aSolid=aMS(i);
//
- // Images
- TopTools_ListOfShape aLVSD;
- TopoDS_Shape aVF;
+ aMFS.Clear();
+ TopExp::MapShapes(aSolid, TopAbs_FACE, aMFS);
//
bFound=Standard_False;
- aIt.Initialize(aLI);
- for (; aIt.More(); aIt.Next()) {
- aIndex=aIt.Value();
- const TopoDS_Shape& aVx=aMIS.FindFromKey(aIndex);
- if (myImages.IsBound(aVx)) {
- bFound=Standard_True;
- aVF=aVx;
+ aNbFS=aMFS.Extent();
+ for (j=1; j<=aNbFS; ++j) {
+ const TopoDS_Shape& aFS=aMFS(j);
+ if (aMFR.Contains(aFS)) {
+ const TopTools_ListOfShape& aLSx=aMFR.FindFromKey(aFS);
+ aNbSx=aLSx.Extent();
+ if (aNbSx==2) {
+ bFound=!bFound;
+ break;
+ }
}
- aLVSD.Append(aVx);
}
- if (bFound) {
- TopTools_ListOfShape& aLVI=myImages.ChangeFind(aVF);
- aLVI.Append(aLVSD);
- }
- else {
- myImages.Bind(aV, aLVSD);
+ //
+ if (!bFound) {
+ myWarningStatus=1;
+ ++myNbAlone;
+ //break;
}
}
+}
+//=======================================================================
+//function : CheckData
+//purpose :
+//=======================================================================
+void GEOMAlgo_Gluer::CheckData()
+{
+ myErrorStatus=0;
//
- // Refine Images
- aItIm.Initialize(myImages);
- for (; aItIm.More(); aItIm.Next()) {
- TopTools_ListOfShape aLVSDNew;
- TopTools_MapOfShape aM;
- //
- const TopoDS_Shape& aV=aItIm.Key();
- const TopTools_ListOfShape& aLVSD=aItIm.Value();
- aItS.Initialize(aLVSD);
- for (; aItS.More(); aItS.Next()) {
- const TopoDS_Shape& aVSD=aItS.Value();
- if (aM.Add(aVSD)) {
- aLVSDNew.Append(aVSD);
- }
- }
- TopTools_ListOfShape& aLVI=myImages.ChangeFind(aV);
- aLVI.Clear();
- aLVI.Append(aLVSDNew);
+ if (myShape.IsNull()) {
+ myErrorStatus=5;
+ return;
}
+}
+//=======================================================================
+//function : InnerTolerance
+//purpose :
+//=======================================================================
+void GEOMAlgo_Gluer::InnerTolerance()
+{
+ myErrorStatus=0;
//
- // Origins
- aItIm.Initialize(myImages);
- for (; aItIm.More(); aItIm.Next()) {
- const TopoDS_Shape& aV=aItIm.Key();
- //
- const TopTools_ListOfShape& aLVSD=myImages.Find(aV);
- aItS.Initialize(aLVSD);
- for (; aItS.More(); aItS.Next()) {
- const TopoDS_Shape& aVSD=aItS.Value();
- if (!myOrigins.IsBound(aVSD)) {
- myOrigins.Bind(aVSD, aV);
- }
+ /*
+ Standard_Integer i;
+ Standard_Real aX[3][2], dH, dHmin, aCoef, aTolTresh;
+ Bnd_Box aBox;
+ //
+ BRepBndLib::Add(myShape, aBox);
+ aBox.Get(aX[0][0], aX[1][0], aX[2][0], aX[0][1], aX[1][1], aX[2][1]);
+ //
+ dHmin=aX[0][1]-aX[0][0];
+ for (i=1; i<3; ++i) {
+ dH=aX[i][1]-aX[i][0];
+ if (dH<dHmin) {
+ dHmin=dH;
}
}
//
+ myTol=myTolerance;
+ aCoef=0.01;
+ aTolTresh=aCoef*dHmin;
+ if (myTol>aTolTresh) {
+ myTol=aTolTresh;
+ }
+ */
+ myTol=myTolerance;
}
//=======================================================================
//function : FacePassKey
aPK.SetIds(aVR1, aVR2);
}
//=======================================================================
+//function : MakeVertex
+//purpose :
+//=======================================================================
+void GEOMAlgo_Gluer::MakeVertex(const TopTools_ListOfShape& aLV,
+ TopoDS_Vertex& aNewVertex)
+{
+ Standard_Integer aNbV;
+ Standard_Real aTolV, aD, aDmax;
+ gp_XYZ aGC;
+ gp_Pnt aP3D, aPGC;
+ TopoDS_Vertex aVx;
+ BRep_Builder aBB;
+ TopTools_ListIteratorOfListOfShape aIt;
+ //
+ aNbV=aLV.Extent();
+ if (!aNbV) {
+ return;
+ }
+ //
+ // center of gravity
+ aGC.SetCoord(0.,0.,0.);
+ aIt.Initialize(aLV);
+ for (; aIt.More(); aIt.Next()) {
+ aVx=TopoDS::Vertex(aIt.Value());
+ aP3D=BRep_Tool::Pnt(aVx);
+ aGC+=aP3D.XYZ();
+ }
+ aGC/=(Standard_Real)aNbV;
+ aPGC.SetXYZ(aGC);
+ //
+ // tolerance value
+ aDmax=-1.;
+ aIt.Initialize(aLV);
+ for (; aIt.More(); aIt.Next()) {
+ aVx=TopoDS::Vertex(aIt.Value());
+ aP3D=BRep_Tool::Pnt(aVx);
+ aTolV=BRep_Tool::Tolerance(aVx);
+ aD=aPGC.Distance(aP3D)+aTolV;
+ if (aD>aDmax) {
+ aDmax=aD;
+ }
+ }
+ //
+ aBB.MakeVertex (aNewVertex, aPGC, aDmax);
+}
+//=======================================================================
//function : MakeEdge
//purpose :
//=======================================================================
void GEOMAlgo_Gluer::MakeEdge(const TopoDS_Edge& aE,
TopoDS_Edge& aNewEdge)
{
+ //modified by NIZNHY-PKV Thu Dec 30 11:15:23 2004 f
myErrorStatus=0;
//
+ Standard_Boolean bIsDE;
Standard_Real aT1, aT2;
TopoDS_Vertex aV1, aV2, aVR1, aVR2;
TopoDS_Edge aEx;
//
+ bIsDE=BRep_Tool::Degenerated(aE);
+ //
aEx=aE;
aEx.Orientation(TopAbs_FORWARD);
//
aVR2=TopoDS::Vertex(myOrigins.Find(aV2));
aVR2.Orientation(TopAbs_REVERSED);
//
- BOPTools_Tools::MakeSplitEdge(aEx, aVR1, aT1, aVR2, aT2, aNewEdge);
+ if (bIsDE) {
+ Standard_Real aTol;
+ BRep_Builder aBB;
+ TopoDS_Edge E;
+ TopAbs_Orientation anOrE;
+ //
+ anOrE=aE.Orientation();
+ aTol=BRep_Tool::Tolerance(aE);
+ //
+ E=aEx;
+ E.EmptyCopy();
+ //
+ aBB.Add (E, aVR1);
+ aBB.Add (E, aVR2);
+ aBB.Range(E, aT1, aT2);
+ aBB.Degenerated(E, Standard_True);
+ aBB.UpdateEdge(E, aTol);
+ //
+ aNewEdge=E;
+ }
+ //
+ else {
+ BOPTools_Tools::MakeSplitEdge(aEx, aVR1, aT1, aVR2, aT2, aNewEdge);
+ }
+ //modified by NIZNHY-PKV Thu Dec 30 11:15:28 2004 t
}
//
//=======================================================================
{
myErrorStatus=0;
//
- Standard_Boolean bIsToReverse;
- Standard_Real aTol;
+ Standard_Boolean bIsToReverse, bIsUPeriodic;
+ Standard_Real aTol, aUMin, aUMax, aVMin, aVMax;
TopoDS_Edge aER;
TopoDS_Wire newWire;
TopoDS_Face aFFWD, newFace;
TopLoc_Location aLoc;
Handle(Geom_Surface) aS;
+ Handle(Geom2d_Curve) aC2D;
TopExp_Explorer aExpW, aExpE;
BRep_Builder aBB;
//
aFFWD.Orientation(TopAbs_FORWARD);
//
aS=BRep_Tool::Surface(aFFWD, aLoc);
+ bIsUPeriodic=GEOMAlgo_Tools::IsUPeriodic(aS);
aTol=BRep_Tool::Tolerance(aFFWD);
+ BRepTools::UVBounds(aF, aUMin, aUMax, aVMin, aVMax);
//
aBB.MakeFace (newFace, aS, aLoc, aTol);
//
for (; aExpE.More(); aExpE.Next()) {
const TopoDS_Edge& aE=TopoDS::Edge(aExpE.Current());
aER=TopoDS::Edge(myOrigins.Find(aE));
+ //
aER.Orientation(TopAbs_FORWARD);
- // build p-curve
- BOPTools_Tools2D::BuildPCurveForEdgeOnFace(aER, aFFWD);
- // orient image
- bIsToReverse=BOPTools_Tools3D::IsSplitToReverse1(aER, aE, myContext);
- if (bIsToReverse) {
- aER.Reverse();
+ if (!BRep_Tool::Degenerated(aER)) {//modified by NIZNHY-PKV Thu Dec 30 11:31:37 2004 ft
+ // build p-curve
+ if (bIsUPeriodic) {
+ GEOMAlgo_Tools::RefinePCurveForEdgeOnFace(aER, aFFWD, aUMin, aUMax);
+ }
+ BOPTools_Tools2D::BuildPCurveForEdgeOnFace(aER, aFFWD);
+
+ // orient image
+ bIsToReverse=BOPTools_Tools3D::IsSplitToReverse1(aER, aE, myContext);
+ if (bIsToReverse) {
+ aER.Reverse();
+ }
+ }
+ else {
+ aER.Orientation(aE.Orientation());
}
//
aBB.Add(newWire, aER);
bRet=Standard_False;
//
aExp.Init(aF, TopAbs_EDGE);
- if (!aExp.More()) {
- return bRet;
- }
- const TopoDS_Edge& aE=TopoDS::Edge(aExp.Current());
- const TopoDS_Edge& aER=TopoDS::Edge(myOrigins.Find(aE));
- //
- aC3D=BRep_Tool::Curve(aE, aT1, aT2);
- aT=BOPTools_Tools2D::IntermediatePoint(aT1, aT2);
- aC3D->D0(aT, aP);
- myContext.ProjectPointOnEdge(aP, aER, aTR);
- //
- BOPTools_Tools3D::GetNormalToFaceOnEdge (aE, aF, aT, aDNF);
- if (aF.Orientation()==TopAbs_REVERSED) {
- aDNF.Reverse();
- }
- //
- BOPTools_Tools3D::GetNormalToFaceOnEdge (aER, aFR, aTR, aDNFR);
- if (aFR.Orientation()==TopAbs_REVERSED) {
- aDNFR.Reverse();
- }
- //
- aScPr=aDNF*aDNFR;
- return (aScPr<0.);
-}
-//
-//=======================================================================
-//function : BuildResult
-//purpose :
-//=======================================================================
-void GEOMAlgo_Gluer::BuildResult()
-{
- TopoDS_Compound aCmp;
- BRep_Builder aBB;
- TopAbs_ShapeEnum aType;
- TopTools_DataMapIteratorOfDataMapOfShapeListOfShape aItIm;
- //
- aBB.MakeCompound(aCmp);
- //
- aItIm.Initialize(myImages);
- for (; aItIm.More(); aItIm.Next()) {
- const TopoDS_Shape& aIm=aItIm.Key();
- aType=aIm.ShapeType();
- if(aType==myTypeResult) {
- aBB.Add(aCmp, aIm);
+ for (; aExp.More(); aExp.Next()) {
+ const TopoDS_Edge& aE=TopoDS::Edge(aExp.Current());
+ //modified by NIZNHY-PKV Thu Dec 30 11:38:05 2004 f
+ if (BRep_Tool::Degenerated(aE)) {
+ continue;
+ }
+ //modified by NIZNHY-PKV Thu Dec 30 11:38:08 2004 t
+ const TopoDS_Edge& aER=TopoDS::Edge(myOrigins.Find(aE));
+ //
+ aC3D=BRep_Tool::Curve(aE, aT1, aT2);
+ aT=BOPTools_Tools2D::IntermediatePoint(aT1, aT2);
+ aC3D->D0(aT, aP);
+ myContext.ProjectPointOnEdge(aP, aER, aTR);
+ //
+ BOPTools_Tools3D::GetNormalToFaceOnEdge (aE, aF, aT, aDNF);
+ if (aF.Orientation()==TopAbs_REVERSED) {
+ aDNF.Reverse();
}
+ //
+ BOPTools_Tools3D::GetNormalToFaceOnEdge (aER, aFR, aTR, aDNFR);
+ if (aFR.Orientation()==TopAbs_REVERSED) {
+ aDNFR.Reverse();
+ }
+ //
+ aScPr=aDNF*aDNFR;
+ return (aScPr<0.);
}
- myResult=aCmp;
+ return bRet;
}
+//
+
//
// ErrorStatus
//
//
// 1 - some shapes can not be glued by faces
//
-
/*
-//
-// CHRONOMETER
-//
-#include <Standard_Static.hxx>
-#include <OSD_Chronometer.hxx>
-
-static Standard_Real S_ChronoTime;
-Standard_STATIC(OSD_Chronometer, S_Chrono);
-
-static void StartChrono();
-static void StopChrono();
-static void TimeShow();
-static void TimeReset();
-static int HasChrono();
-
-//=======================================================================
-//function : StartChrono
-//purpose :
//=======================================================================
-void StartChrono()
-{
- if (HasChrono()){
- S_Chrono().Reset();
- S_Chrono().Start();
- }
-}
-
-//=======================================================================
-//function : StopChrono
-//purpose :
-//=======================================================================
-void StopChrono()
-{
- if (HasChrono()) {
- Standard_Real Chrono;
- S_Chrono().Stop();
- S_Chrono().Show(Chrono);
- //
- S_ChronoTime+=Chrono;
- }
-}
-//=======================================================================
-//function : TimeReset
+//function : BuildResult
//purpose :
//=======================================================================
-void TimeReset()
+void GEOMAlgo_Gluer::BuildResult()
{
- if (HasChrono()){
- S_ChronoTime=0;
- }
-}
-//=======================================================================
-//function : TimeShow
-//purpose :
-//=======================================================================
-void TimeShow()
-{
- if (HasChrono()){
- cout << "Tps: " << S_ChronoTime << endl;
- }
-}
-//=======================================================================
-//function : HasChrono
-//purpose :
-//=======================================================================
-int HasChrono()
-{
- char *xr=getenv ("XCHRONO");
- if (xr!=NULL){
- if (!strcmp (xr, "yes")) {
- return 1;
+ Standard_Boolean bAdded;
+ TopoDS_Compound aCmp;
+ BRep_Builder aBB;
+ TopAbs_ShapeEnum aType;
+ TopTools_DataMapIteratorOfDataMapOfShapeListOfShape aItIm;
+ //
+ aBB.MakeCompound(aCmp);
+ //
+ bAdded=Standard_False;
+ aItIm.Initialize(myImages);
+ for (; aItIm.More(); aItIm.Next()) {
+ const TopoDS_Shape& aIm=aItIm.Key();
+ aType=aIm.ShapeType();
+ if(aType==TopAbs_SOLID) {
+ bAdded=Standard_True;
+ aBB.Add(aCmp, aIm);
}
}
- return 0;
+ myResult=aCmp;
+ //
+ if (bAdded) {
+ Standard_Real aTol=1.e-7;
+ BOP_CorrectTolerances::CorrectCurveOnSurface(myResult);
+ //BRepLib::SameParameter(myResult, aTol, bAdded);
+ }
}
*/
#ifndef _Standard_Boolean_HeaderFile
#include <Standard_Boolean.hxx>
#endif
+#ifndef _Standard_Real_HeaderFile
+#include <Standard_Real.hxx>
+#endif
#ifndef _TopTools_DataMapOfShapeListOfShape_HeaderFile
#include <TopTools_DataMapOfShapeListOfShape.hxx>
#endif
#ifndef _TopTools_DataMapOfShapeShape_HeaderFile
#include <TopTools_DataMapOfShapeShape.hxx>
#endif
-#ifndef _IntTools_Context_HeaderFile
-#include <IntTools_Context.hxx>
-#endif
-#ifndef _TopAbs_ShapeEnum_HeaderFile
-#include <TopAbs_ShapeEnum.hxx>
-#endif
-#ifndef _Standard_Real_HeaderFile
-#include <Standard_Real.hxx>
+#ifndef _Standard_Integer_HeaderFile
+#include <Standard_Integer.hxx>
#endif
#ifndef _GEOMAlgo_ShapeAlgo_HeaderFile
#include <GEOMAlgo_ShapeAlgo.hxx>
#endif
+#ifndef _TopAbs_ShapeEnum_HeaderFile
+#include <TopAbs_ShapeEnum.hxx>
+#endif
class TopoDS_Edge;
class GEOMAlgo_PassKey;
class TopoDS_Face;
+class TopTools_ListOfShape;
+class TopoDS_Vertex;
class TopTools_DataMapOfShapeListOfShape;
class TopTools_DataMapOfShapeShape;
Standard_EXPORT void SetCheckGeometry(const Standard_Boolean aFlag) ;
Standard_EXPORT Standard_Boolean CheckGeometry() const;
Standard_EXPORT virtual void Perform() ;
+Standard_EXPORT Standard_Integer AloneShapes() const;
Standard_EXPORT const TopTools_DataMapOfShapeListOfShape& Images() const;
Standard_EXPORT const TopTools_DataMapOfShapeShape& Origins() const;
//
Standard_EXPORT virtual void CheckData() ;
Standard_EXPORT virtual void CheckResult() ;
-Standard_EXPORT void BuildResult() ;
Standard_EXPORT void MakeVertices() ;
Standard_EXPORT void MakeEdges() ;
Standard_EXPORT void MakeFaces() ;
Standard_EXPORT void InnerTolerance() ;
Standard_EXPORT void EdgePassKey(const TopoDS_Edge& aE,GEOMAlgo_PassKey& aPK) ;
Standard_EXPORT void FacePassKey(const TopoDS_Face& aF,GEOMAlgo_PassKey& aPK) ;
+Standard_EXPORT void MakeVertex(const TopTools_ListOfShape& aLV,TopoDS_Vertex& aNewV) ;
Standard_EXPORT void MakeEdge(const TopoDS_Edge& aEdge,TopoDS_Edge& aNewEdge) ;
Standard_EXPORT void MakeFace(const TopoDS_Face& aFace,TopoDS_Face& aNewEdge) ;
Standard_EXPORT Standard_Boolean IsToReverse(const TopoDS_Face& aFR,const TopoDS_Face& aF) ;
// Fields PROTECTED
//
Standard_Boolean myCheckGeometry;
+Standard_Real myTol;
TopTools_DataMapOfShapeListOfShape myImages;
TopTools_DataMapOfShapeShape myOrigins;
-IntTools_Context myContext;
-TopAbs_ShapeEnum myTypeResult;
-Standard_Real myTol;
+Standard_Integer myNbAlone;
private:
#ifndef _TopoDS_Face_HeaderFile
#include <TopoDS_Face.hxx>
#endif
+#ifndef _TopTools_ListOfShape_HeaderFile
+#include <TopTools_ListOfShape.hxx>
+#endif
+#ifndef _TopoDS_Vertex_HeaderFile
+#include <TopoDS_Vertex.hxx>
+#endif
#ifndef _TopTools_DataMapOfShapeListOfShape_HeaderFile
#include <TopTools_DataMapOfShapeListOfShape.hxx>
#endif
--- /dev/null
+// File generated by CPPExt (Value)
+//
+// Copyright (C) 1991 - 2000 by
+// Matra Datavision SA. All rights reserved.
+//
+// Copyright (C) 2001 - 2004 by
+// Open CASCADE SA. All rights reserved.
+//
+// This file is part of the Open CASCADE Technology software.
+//
+// This software may be distributed and/or modified under the terms and
+// conditions of the Open CASCADE Public License as defined by Open CASCADE SA
+// and appearing in the file LICENSE included in the packaging of this file.
+//
+// This software is distributed on an "AS IS" basis, without warranty of any
+// kind, and Open CASCADE SA hereby disclaims all such warranties,
+// including without limitation, any warranties of merchantability, fitness
+// for a particular purpose or non-infringement. Please see the License for
+// the specific terms and conditions governing rights and limitations under the
+// License.
+
+#ifndef _GEOMAlgo_ListIteratorOfListOfCoupleOfShapes_HeaderFile
+#define _GEOMAlgo_ListIteratorOfListOfCoupleOfShapes_HeaderFile
+
+#ifndef _Standard_Address_HeaderFile
+#include <Standard_Address.hxx>
+#endif
+#ifndef _Handle_GEOMAlgo_ListNodeOfListOfCoupleOfShapes_HeaderFile
+#include <Handle_GEOMAlgo_ListNodeOfListOfCoupleOfShapes.hxx>
+#endif
+#ifndef _Standard_Boolean_HeaderFile
+#include <Standard_Boolean.hxx>
+#endif
+class Standard_NoMoreObject;
+class Standard_NoSuchObject;
+class GEOMAlgo_ListOfCoupleOfShapes;
+class GEOMAlgo_CoupleOfShapes;
+class GEOMAlgo_ListNodeOfListOfCoupleOfShapes;
+
+
+#ifndef _Standard_HeaderFile
+#include <Standard.hxx>
+#endif
+#ifndef _Standard_Macro_HeaderFile
+#include <Standard_Macro.hxx>
+#endif
+
+class GEOMAlgo_ListIteratorOfListOfCoupleOfShapes {
+
+public:
+
+ void* operator new(size_t,void* anAddress)
+ {
+ return anAddress;
+ }
+ void* operator new(size_t size)
+ {
+ return Standard::Allocate(size);
+ }
+ void operator delete(void *anAddress)
+ {
+ if (anAddress) Standard::Free((Standard_Address&)anAddress);
+ }
+ // Methods PUBLIC
+ //
+Standard_EXPORT GEOMAlgo_ListIteratorOfListOfCoupleOfShapes();
+Standard_EXPORT GEOMAlgo_ListIteratorOfListOfCoupleOfShapes(const GEOMAlgo_ListOfCoupleOfShapes& L);
+Standard_EXPORT void Initialize(const GEOMAlgo_ListOfCoupleOfShapes& L) ;
+ Standard_Boolean More() const;
+Standard_EXPORT void Next() ;
+Standard_EXPORT GEOMAlgo_CoupleOfShapes& Value() const;
+
+
+friend class GEOMAlgo_ListOfCoupleOfShapes;
+
+
+
+protected:
+
+ // Methods PROTECTED
+ //
+
+
+ // Fields PROTECTED
+ //
+
+
+private:
+
+ // Methods PRIVATE
+ //
+
+
+ // Fields PRIVATE
+ //
+Standard_Address current;
+Standard_Address previous;
+
+
+};
+
+#define Item GEOMAlgo_CoupleOfShapes
+#define Item_hxx <GEOMAlgo_CoupleOfShapes.hxx>
+#define TCollection_ListNode GEOMAlgo_ListNodeOfListOfCoupleOfShapes
+#define TCollection_ListNode_hxx <GEOMAlgo_ListNodeOfListOfCoupleOfShapes.hxx>
+#define TCollection_ListIterator GEOMAlgo_ListIteratorOfListOfCoupleOfShapes
+#define TCollection_ListIterator_hxx <GEOMAlgo_ListIteratorOfListOfCoupleOfShapes.hxx>
+#define Handle_TCollection_ListNode Handle_GEOMAlgo_ListNodeOfListOfCoupleOfShapes
+#define TCollection_ListNode_Type_() GEOMAlgo_ListNodeOfListOfCoupleOfShapes_Type_()
+#define TCollection_List GEOMAlgo_ListOfCoupleOfShapes
+#define TCollection_List_hxx <GEOMAlgo_ListOfCoupleOfShapes.hxx>
+
+#include <TCollection_ListIterator.lxx>
+
+#undef Item
+#undef Item_hxx
+#undef TCollection_ListNode
+#undef TCollection_ListNode_hxx
+#undef TCollection_ListIterator
+#undef TCollection_ListIterator_hxx
+#undef Handle_TCollection_ListNode
+#undef TCollection_ListNode_Type_
+#undef TCollection_List
+#undef TCollection_List_hxx
+
+
+// other Inline functions and methods (like "C++: function call" methods)
+//
+
+
+#endif
--- /dev/null
+// File generated by CPPExt (Value)
+//
+// Copyright (C) 1991 - 2000 by
+// Matra Datavision SA. All rights reserved.
+//
+// Copyright (C) 2001 - 2004 by
+// Open CASCADE SA. All rights reserved.
+//
+// This file is part of the Open CASCADE Technology software.
+//
+// This software may be distributed and/or modified under the terms and
+// conditions of the Open CASCADE Public License as defined by Open CASCADE SA
+// and appearing in the file LICENSE included in the packaging of this file.
+//
+// This software is distributed on an "AS IS" basis, without warranty of any
+// kind, and Open CASCADE SA hereby disclaims all such warranties,
+// including without limitation, any warranties of merchantability, fitness
+// for a particular purpose or non-infringement. Please see the License for
+// the specific terms and conditions governing rights and limitations under the
+// License.
+
+#include <GEOMAlgo_ListIteratorOfListOfCoupleOfShapes.hxx>
+
+#ifndef _Standard_NoMoreObject_HeaderFile
+#include <Standard_NoMoreObject.hxx>
+#endif
+#ifndef _Standard_NoSuchObject_HeaderFile
+#include <Standard_NoSuchObject.hxx>
+#endif
+#ifndef _GEOMAlgo_ListOfCoupleOfShapes_HeaderFile
+#include <GEOMAlgo_ListOfCoupleOfShapes.hxx>
+#endif
+#ifndef _GEOMAlgo_CoupleOfShapes_HeaderFile
+#include <GEOMAlgo_CoupleOfShapes.hxx>
+#endif
+#ifndef _GEOMAlgo_ListNodeOfListOfCoupleOfShapes_HeaderFile
+#include <GEOMAlgo_ListNodeOfListOfCoupleOfShapes.hxx>
+#endif
+
+
+#define Item GEOMAlgo_CoupleOfShapes
+#define Item_hxx <GEOMAlgo_CoupleOfShapes.hxx>
+#define TCollection_ListNode GEOMAlgo_ListNodeOfListOfCoupleOfShapes
+#define TCollection_ListNode_hxx <GEOMAlgo_ListNodeOfListOfCoupleOfShapes.hxx>
+#define TCollection_ListIterator GEOMAlgo_ListIteratorOfListOfCoupleOfShapes
+#define TCollection_ListIterator_hxx <GEOMAlgo_ListIteratorOfListOfCoupleOfShapes.hxx>
+#define Handle_TCollection_ListNode Handle_GEOMAlgo_ListNodeOfListOfCoupleOfShapes
+#define TCollection_ListNode_Type_() GEOMAlgo_ListNodeOfListOfCoupleOfShapes_Type_()
+#define TCollection_List GEOMAlgo_ListOfCoupleOfShapes
+#define TCollection_List_hxx <GEOMAlgo_ListOfCoupleOfShapes.hxx>
+#include <TCollection_ListIterator.gxx>
+
--- /dev/null
+// File generated by CPPExt (Transient)
+//
+//
+// Copyright (C) 1991 - 2000 by
+// Matra Datavision SA. All rights reserved.
+//
+// Copyright (C) 2001 - 2004 by
+// Open CASCADE SA. All rights reserved.
+//
+// This file is part of the Open CASCADE Technology software.
+//
+// This software may be distributed and/or modified under the terms and
+// conditions of the Open CASCADE Public License as defined by Open CASCADE SA
+// and appearing in the file LICENSE included in the packaging of this file.
+//
+// This software is distributed on an "AS IS" basis, without warranty of any
+// kind, and Open CASCADE SA hereby disclaims all such warranties,
+// including without limitation, any warranties of merchantability, fitness
+// for a particular purpose or non-infringement. Please see the License for
+// the specific terms and conditions governing rights and limitations under the
+// License.
+
+#ifndef _GEOMAlgo_ListNodeOfListOfCoupleOfShapes_HeaderFile
+#define _GEOMAlgo_ListNodeOfListOfCoupleOfShapes_HeaderFile
+
+#ifndef _Standard_HeaderFile
+#include <Standard.hxx>
+#endif
+#ifndef _Handle_GEOMAlgo_ListNodeOfListOfCoupleOfShapes_HeaderFile
+#include <Handle_GEOMAlgo_ListNodeOfListOfCoupleOfShapes.hxx>
+#endif
+
+#ifndef _GEOMAlgo_CoupleOfShapes_HeaderFile
+#include <GEOMAlgo_CoupleOfShapes.hxx>
+#endif
+#ifndef _TCollection_MapNode_HeaderFile
+#include <TCollection_MapNode.hxx>
+#endif
+#ifndef _TCollection_MapNodePtr_HeaderFile
+#include <TCollection_MapNodePtr.hxx>
+#endif
+class GEOMAlgo_CoupleOfShapes;
+class GEOMAlgo_ListOfCoupleOfShapes;
+class GEOMAlgo_ListIteratorOfListOfCoupleOfShapes;
+
+
+class GEOMAlgo_ListNodeOfListOfCoupleOfShapes : public TCollection_MapNode {
+
+public:
+
+ void* operator new(size_t,void* anAddress)
+ {
+ return anAddress;
+ }
+ void* operator new(size_t size)
+ {
+ return Standard::Allocate(size);
+ }
+ void operator delete(void *anAddress)
+ {
+ if (anAddress) Standard::Free((Standard_Address&)anAddress);
+ }
+ // Methods PUBLIC
+ //
+GEOMAlgo_ListNodeOfListOfCoupleOfShapes(const GEOMAlgo_CoupleOfShapes& I,const TCollection_MapNodePtr& n);
+ GEOMAlgo_CoupleOfShapes& Value() const;
+Standard_EXPORT ~GEOMAlgo_ListNodeOfListOfCoupleOfShapes();
+
+
+
+
+ // Type management
+ //
+ Standard_EXPORT friend Handle_Standard_Type& GEOMAlgo_ListNodeOfListOfCoupleOfShapes_Type_();
+ Standard_EXPORT const Handle(Standard_Type)& DynamicType() const;
+ Standard_EXPORT Standard_Boolean IsKind(const Handle(Standard_Type)&) const;
+
+protected:
+
+ // Methods PROTECTED
+ //
+
+
+ // Fields PROTECTED
+ //
+
+
+private:
+
+ // Methods PRIVATE
+ //
+
+
+ // Fields PRIVATE
+ //
+GEOMAlgo_CoupleOfShapes myValue;
+
+
+};
+
+#define Item GEOMAlgo_CoupleOfShapes
+#define Item_hxx <GEOMAlgo_CoupleOfShapes.hxx>
+#define TCollection_ListNode GEOMAlgo_ListNodeOfListOfCoupleOfShapes
+#define TCollection_ListNode_hxx <GEOMAlgo_ListNodeOfListOfCoupleOfShapes.hxx>
+#define TCollection_ListIterator GEOMAlgo_ListIteratorOfListOfCoupleOfShapes
+#define TCollection_ListIterator_hxx <GEOMAlgo_ListIteratorOfListOfCoupleOfShapes.hxx>
+#define Handle_TCollection_ListNode Handle_GEOMAlgo_ListNodeOfListOfCoupleOfShapes
+#define TCollection_ListNode_Type_() GEOMAlgo_ListNodeOfListOfCoupleOfShapes_Type_()
+#define TCollection_List GEOMAlgo_ListOfCoupleOfShapes
+#define TCollection_List_hxx <GEOMAlgo_ListOfCoupleOfShapes.hxx>
+
+#include <TCollection_ListNode.lxx>
+
+#undef Item
+#undef Item_hxx
+#undef TCollection_ListNode
+#undef TCollection_ListNode_hxx
+#undef TCollection_ListIterator
+#undef TCollection_ListIterator_hxx
+#undef Handle_TCollection_ListNode
+#undef TCollection_ListNode_Type_
+#undef TCollection_List
+#undef TCollection_List_hxx
+
+
+// other Inline functions and methods (like "C++: function call" methods)
+//
+
+
+#endif
--- /dev/null
+// File generated by CPPExt (Transient)
+//
+// Copyright (C) 1991 - 2000 by
+// Matra Datavision SA. All rights reserved.
+//
+// Copyright (C) 2001 - 2004 by
+// Open CASCADE SA. All rights reserved.
+//
+// This file is part of the Open CASCADE Technology software.
+//
+// This software may be distributed and/or modified under the terms and
+// conditions of the Open CASCADE Public License as defined by Open CASCADE SA
+// and appearing in the file LICENSE included in the packaging of this file.
+//
+// This software is distributed on an "AS IS" basis, without warranty of any
+// kind, and Open CASCADE SA hereby disclaims all such warranties,
+// including without limitation, any warranties of merchantability, fitness
+// for a particular purpose or non-infringement. Please see the License for
+// the specific terms and conditions governing rights and limitations under the
+// License.
+
+#include <GEOMAlgo_ListNodeOfListOfCoupleOfShapes.hxx>
+
+#ifndef _Standard_TypeMismatch_HeaderFile
+#include <Standard_TypeMismatch.hxx>
+#endif
+
+#ifndef _GEOMAlgo_CoupleOfShapes_HeaderFile
+#include <GEOMAlgo_CoupleOfShapes.hxx>
+#endif
+#ifndef _GEOMAlgo_ListOfCoupleOfShapes_HeaderFile
+#include <GEOMAlgo_ListOfCoupleOfShapes.hxx>
+#endif
+#ifndef _GEOMAlgo_ListIteratorOfListOfCoupleOfShapes_HeaderFile
+#include <GEOMAlgo_ListIteratorOfListOfCoupleOfShapes.hxx>
+#endif
+GEOMAlgo_ListNodeOfListOfCoupleOfShapes::~GEOMAlgo_ListNodeOfListOfCoupleOfShapes() {}
+
+
+
+Standard_EXPORT Handle_Standard_Type& GEOMAlgo_ListNodeOfListOfCoupleOfShapes_Type_()
+{
+
+ static Handle_Standard_Type aType1 = STANDARD_TYPE(TCollection_MapNode);
+ if ( aType1.IsNull()) aType1 = STANDARD_TYPE(TCollection_MapNode);
+ static Handle_Standard_Type aType2 = STANDARD_TYPE(MMgt_TShared);
+ if ( aType2.IsNull()) aType2 = STANDARD_TYPE(MMgt_TShared);
+ static Handle_Standard_Type aType3 = STANDARD_TYPE(Standard_Transient);
+ if ( aType3.IsNull()) aType3 = STANDARD_TYPE(Standard_Transient);
+
+
+ static Handle_Standard_Transient _Ancestors[]= {aType1,aType2,aType3,NULL};
+ static Handle_Standard_Type _aType = new Standard_Type("GEOMAlgo_ListNodeOfListOfCoupleOfShapes",
+ sizeof(GEOMAlgo_ListNodeOfListOfCoupleOfShapes),
+ 1,
+ (Standard_Address)_Ancestors,
+ (Standard_Address)NULL);
+
+ return _aType;
+}
+
+
+// DownCast method
+// allow safe downcasting
+//
+const Handle(GEOMAlgo_ListNodeOfListOfCoupleOfShapes) Handle(GEOMAlgo_ListNodeOfListOfCoupleOfShapes)::DownCast(const Handle(Standard_Transient)& AnObject)
+{
+ Handle(GEOMAlgo_ListNodeOfListOfCoupleOfShapes) _anOtherObject;
+
+ if (!AnObject.IsNull()) {
+ if (AnObject->IsKind(STANDARD_TYPE(GEOMAlgo_ListNodeOfListOfCoupleOfShapes))) {
+ _anOtherObject = Handle(GEOMAlgo_ListNodeOfListOfCoupleOfShapes)((Handle(GEOMAlgo_ListNodeOfListOfCoupleOfShapes)&)AnObject);
+ }
+ }
+
+ return _anOtherObject ;
+}
+const Handle(Standard_Type)& GEOMAlgo_ListNodeOfListOfCoupleOfShapes::DynamicType() const
+{
+ return STANDARD_TYPE(GEOMAlgo_ListNodeOfListOfCoupleOfShapes) ;
+}
+Standard_Boolean GEOMAlgo_ListNodeOfListOfCoupleOfShapes::IsKind(const Handle(Standard_Type)& AType) const
+{
+ return (STANDARD_TYPE(GEOMAlgo_ListNodeOfListOfCoupleOfShapes) == AType || TCollection_MapNode::IsKind(AType));
+}
+Handle_GEOMAlgo_ListNodeOfListOfCoupleOfShapes::~Handle_GEOMAlgo_ListNodeOfListOfCoupleOfShapes() {}
+#define Item GEOMAlgo_CoupleOfShapes
+#define Item_hxx <GEOMAlgo_CoupleOfShapes.hxx>
+#define TCollection_ListNode GEOMAlgo_ListNodeOfListOfCoupleOfShapes
+#define TCollection_ListNode_hxx <GEOMAlgo_ListNodeOfListOfCoupleOfShapes.hxx>
+#define TCollection_ListIterator GEOMAlgo_ListIteratorOfListOfCoupleOfShapes
+#define TCollection_ListIterator_hxx <GEOMAlgo_ListIteratorOfListOfCoupleOfShapes.hxx>
+#define Handle_TCollection_ListNode Handle_GEOMAlgo_ListNodeOfListOfCoupleOfShapes
+#define TCollection_ListNode_Type_() GEOMAlgo_ListNodeOfListOfCoupleOfShapes_Type_()
+#define TCollection_List GEOMAlgo_ListOfCoupleOfShapes
+#define TCollection_List_hxx <GEOMAlgo_ListOfCoupleOfShapes.hxx>
+#include <TCollection_ListNode.gxx>
+
--- /dev/null
+// File generated by CPPExt (Value)
+//
+// Copyright (C) 1991 - 2000 by
+// Matra Datavision SA. All rights reserved.
+//
+// Copyright (C) 2001 - 2004 by
+// Open CASCADE SA. All rights reserved.
+//
+// This file is part of the Open CASCADE Technology software.
+//
+// This software may be distributed and/or modified under the terms and
+// conditions of the Open CASCADE Public License as defined by Open CASCADE SA
+// and appearing in the file LICENSE included in the packaging of this file.
+//
+// This software is distributed on an "AS IS" basis, without warranty of any
+// kind, and Open CASCADE SA hereby disclaims all such warranties,
+// including without limitation, any warranties of merchantability, fitness
+// for a particular purpose or non-infringement. Please see the License for
+// the specific terms and conditions governing rights and limitations under the
+// License.
+
+#ifndef _GEOMAlgo_ListOfCoupleOfShapes_HeaderFile
+#define _GEOMAlgo_ListOfCoupleOfShapes_HeaderFile
+
+#ifndef _Standard_Address_HeaderFile
+#include <Standard_Address.hxx>
+#endif
+#ifndef _Handle_GEOMAlgo_ListNodeOfListOfCoupleOfShapes_HeaderFile
+#include <Handle_GEOMAlgo_ListNodeOfListOfCoupleOfShapes.hxx>
+#endif
+#ifndef _Standard_Integer_HeaderFile
+#include <Standard_Integer.hxx>
+#endif
+#ifndef _Standard_Boolean_HeaderFile
+#include <Standard_Boolean.hxx>
+#endif
+class Standard_NoSuchObject;
+class GEOMAlgo_ListIteratorOfListOfCoupleOfShapes;
+class GEOMAlgo_CoupleOfShapes;
+class GEOMAlgo_ListNodeOfListOfCoupleOfShapes;
+
+
+#ifndef _Standard_HeaderFile
+#include <Standard.hxx>
+#endif
+#ifndef _Standard_Macro_HeaderFile
+#include <Standard_Macro.hxx>
+#endif
+
+class GEOMAlgo_ListOfCoupleOfShapes {
+
+public:
+
+ void* operator new(size_t,void* anAddress)
+ {
+ return anAddress;
+ }
+ void* operator new(size_t size)
+ {
+ return Standard::Allocate(size);
+ }
+ void operator delete(void *anAddress)
+ {
+ if (anAddress) Standard::Free((Standard_Address&)anAddress);
+ }
+ // Methods PUBLIC
+ //
+Standard_EXPORT GEOMAlgo_ListOfCoupleOfShapes();
+Standard_EXPORT void Assign(const GEOMAlgo_ListOfCoupleOfShapes& Other) ;
+ void operator=(const GEOMAlgo_ListOfCoupleOfShapes& Other)
+{
+ Assign(Other);
+}
+
+Standard_EXPORT Standard_Integer Extent() const;
+Standard_EXPORT void Clear() ;
+~GEOMAlgo_ListOfCoupleOfShapes()
+{
+ Clear();
+}
+
+ Standard_Boolean IsEmpty() const;
+Standard_EXPORT void Prepend(const GEOMAlgo_CoupleOfShapes& I) ;
+Standard_EXPORT void Prepend(const GEOMAlgo_CoupleOfShapes& I,GEOMAlgo_ListIteratorOfListOfCoupleOfShapes& theIt) ;
+Standard_EXPORT void Prepend(GEOMAlgo_ListOfCoupleOfShapes& Other) ;
+Standard_EXPORT void Append(const GEOMAlgo_CoupleOfShapes& I) ;
+Standard_EXPORT void Append(const GEOMAlgo_CoupleOfShapes& I,GEOMAlgo_ListIteratorOfListOfCoupleOfShapes& theIt) ;
+Standard_EXPORT void Append(GEOMAlgo_ListOfCoupleOfShapes& Other) ;
+Standard_EXPORT GEOMAlgo_CoupleOfShapes& First() const;
+Standard_EXPORT GEOMAlgo_CoupleOfShapes& Last() const;
+Standard_EXPORT void RemoveFirst() ;
+Standard_EXPORT void Remove(GEOMAlgo_ListIteratorOfListOfCoupleOfShapes& It) ;
+Standard_EXPORT void InsertBefore(const GEOMAlgo_CoupleOfShapes& I,GEOMAlgo_ListIteratorOfListOfCoupleOfShapes& It) ;
+Standard_EXPORT void InsertBefore(GEOMAlgo_ListOfCoupleOfShapes& Other,GEOMAlgo_ListIteratorOfListOfCoupleOfShapes& It) ;
+Standard_EXPORT void InsertAfter(const GEOMAlgo_CoupleOfShapes& I,GEOMAlgo_ListIteratorOfListOfCoupleOfShapes& It) ;
+Standard_EXPORT void InsertAfter(GEOMAlgo_ListOfCoupleOfShapes& Other,GEOMAlgo_ListIteratorOfListOfCoupleOfShapes& It) ;
+
+
+friend class GEOMAlgo_ListIteratorOfListOfCoupleOfShapes;
+
+
+
+protected:
+
+ // Methods PROTECTED
+ //
+
+
+ // Fields PROTECTED
+ //
+
+
+private:
+
+ // Methods PRIVATE
+ //
+Standard_EXPORT GEOMAlgo_ListOfCoupleOfShapes(const GEOMAlgo_ListOfCoupleOfShapes& Other);
+
+
+ // Fields PRIVATE
+ //
+Standard_Address myFirst;
+Standard_Address myLast;
+
+
+};
+
+#define Item GEOMAlgo_CoupleOfShapes
+#define Item_hxx <GEOMAlgo_CoupleOfShapes.hxx>
+#define TCollection_ListNode GEOMAlgo_ListNodeOfListOfCoupleOfShapes
+#define TCollection_ListNode_hxx <GEOMAlgo_ListNodeOfListOfCoupleOfShapes.hxx>
+#define TCollection_ListIterator GEOMAlgo_ListIteratorOfListOfCoupleOfShapes
+#define TCollection_ListIterator_hxx <GEOMAlgo_ListIteratorOfListOfCoupleOfShapes.hxx>
+#define Handle_TCollection_ListNode Handle_GEOMAlgo_ListNodeOfListOfCoupleOfShapes
+#define TCollection_ListNode_Type_() GEOMAlgo_ListNodeOfListOfCoupleOfShapes_Type_()
+#define TCollection_List GEOMAlgo_ListOfCoupleOfShapes
+#define TCollection_List_hxx <GEOMAlgo_ListOfCoupleOfShapes.hxx>
+
+#include <TCollection_List.lxx>
+
+#undef Item
+#undef Item_hxx
+#undef TCollection_ListNode
+#undef TCollection_ListNode_hxx
+#undef TCollection_ListIterator
+#undef TCollection_ListIterator_hxx
+#undef Handle_TCollection_ListNode
+#undef TCollection_ListNode_Type_
+#undef TCollection_List
+#undef TCollection_List_hxx
+
+
+// other Inline functions and methods (like "C++: function call" methods)
+//
+
+
+#endif
--- /dev/null
+// File generated by CPPExt (Value)
+//
+// Copyright (C) 1991 - 2000 by
+// Matra Datavision SA. All rights reserved.
+//
+// Copyright (C) 2001 - 2004 by
+// Open CASCADE SA. All rights reserved.
+//
+// This file is part of the Open CASCADE Technology software.
+//
+// This software may be distributed and/or modified under the terms and
+// conditions of the Open CASCADE Public License as defined by Open CASCADE SA
+// and appearing in the file LICENSE included in the packaging of this file.
+//
+// This software is distributed on an "AS IS" basis, without warranty of any
+// kind, and Open CASCADE SA hereby disclaims all such warranties,
+// including without limitation, any warranties of merchantability, fitness
+// for a particular purpose or non-infringement. Please see the License for
+// the specific terms and conditions governing rights and limitations under the
+// License.
+
+#include <GEOMAlgo_ListOfCoupleOfShapes.hxx>
+
+#ifndef _Standard_NoSuchObject_HeaderFile
+#include <Standard_NoSuchObject.hxx>
+#endif
+#ifndef _GEOMAlgo_ListIteratorOfListOfCoupleOfShapes_HeaderFile
+#include <GEOMAlgo_ListIteratorOfListOfCoupleOfShapes.hxx>
+#endif
+#ifndef _GEOMAlgo_CoupleOfShapes_HeaderFile
+#include <GEOMAlgo_CoupleOfShapes.hxx>
+#endif
+#ifndef _GEOMAlgo_ListNodeOfListOfCoupleOfShapes_HeaderFile
+#include <GEOMAlgo_ListNodeOfListOfCoupleOfShapes.hxx>
+#endif
+
+
+#define Item GEOMAlgo_CoupleOfShapes
+#define Item_hxx <GEOMAlgo_CoupleOfShapes.hxx>
+#define TCollection_ListNode GEOMAlgo_ListNodeOfListOfCoupleOfShapes
+#define TCollection_ListNode_hxx <GEOMAlgo_ListNodeOfListOfCoupleOfShapes.hxx>
+#define TCollection_ListIterator GEOMAlgo_ListIteratorOfListOfCoupleOfShapes
+#define TCollection_ListIterator_hxx <GEOMAlgo_ListIteratorOfListOfCoupleOfShapes.hxx>
+#define Handle_TCollection_ListNode Handle_GEOMAlgo_ListNodeOfListOfCoupleOfShapes
+#define TCollection_ListNode_Type_() GEOMAlgo_ListNodeOfListOfCoupleOfShapes_Type_()
+#define TCollection_List GEOMAlgo_ListOfCoupleOfShapes
+#define TCollection_List_hxx <GEOMAlgo_ListOfCoupleOfShapes.hxx>
+#include <TCollection_List.gxx>
+
--- /dev/null
+-- File: GEOMAlgo_ShapeSolid.cdl
+-- Created: Thu Jan 13 12:44:07 2005
+-- Author: Peter KURNEV
+-- <pkv@irinox>
+---Copyright: Matra Datavision 2005
+
+
+deferred class ShapeSolid from GEOMAlgo
+ inherits Algo from GEOMAlgo
+
+ ---Purpose:
+
+uses
+ ListOfShape from TopTools,
+ State from GEOMAlgo,
+ PDSFiller from BOPTools,
+ DSFiller from BOPTools
+--raises
+
+is
+ Initialize
+ returns ShapeSolid from GEOMAlgo;
+
+
+ SetFiller(me:out;
+ aDSF:DSFiller from BOPTools);
+ ---C++: alias "Standard_EXPORT virtual ~GEOMAlgo_ShapeSolid();"
+
+ Shapes(me;
+ aState:State from GEOMAlgo)
+ returns ListOfShape from TopTools;
+ ---C++: return const &
+
+ BuildResult (me:out)
+ is deferred protected;
+
+ Prepare(me:out)
+ is deferred protected;
+
+fields
+ myLSIN : ListOfShape from TopTools is protected;
+ myLSOUT : ListOfShape from TopTools is protected;
+ myLSON : ListOfShape from TopTools is protected;
+
+ myLS : ListOfShape from TopTools is protected;
+ myRank : Integer from Standard is protected;
+ myDSFiller : PDSFiller from BOPTools is protected;
+
+end ShapeSolid;
--- /dev/null
+// File: GEOMAlgo_ShapeSolid.cxx
+// Created: Thu Jan 13 12:54:48 2005
+// Author: Peter KURNEV
+// <pkv@irinox>
+
+
+#include <GEOMAlgo_ShapeSolid.ixx>
+
+#include <TopTools_ListIteratorOfListOfShape.hxx>
+#include <TopTools_ListOfShape.hxx>
+
+//=======================================================================
+//function : GEOMAlgo_ShapeSolid
+//purpose :
+//=======================================================================
+GEOMAlgo_ShapeSolid::GEOMAlgo_ShapeSolid()
+:
+ GEOMAlgo_Algo(),
+ myRank(0),
+ myDSFiller(NULL)
+{
+}
+//=======================================================================
+//function : ~
+//purpose :
+//=======================================================================
+GEOMAlgo_ShapeSolid::~GEOMAlgo_ShapeSolid()
+{
+}
+//=======================================================================
+//function : SetFiller
+//purpose :
+//=======================================================================
+void GEOMAlgo_ShapeSolid::SetFiller(const BOPTools_DSFiller& aDSFiller)
+{
+ myDSFiller=(BOPTools_DSFiller*) &aDSFiller;
+}
+
+//=======================================================================
+// function: Shapes
+// purpose:
+//=======================================================================
+const TopTools_ListOfShape& GEOMAlgo_ShapeSolid::Shapes(const GEOMAlgo_State aState) const
+{
+ TopTools_ListIteratorOfListOfShape aIt;
+ //
+ TopTools_ListOfShape* pLS=(TopTools_ListOfShape*)&myLS;
+ //
+ pLS->Clear();
+ //
+ switch (aState) {
+ case GEOMAlgo_ST_IN: {
+ aIt.Initialize(myLSIN);
+ for (; aIt.More(); aIt.Next()) {
+ const TopoDS_Shape& aS=aIt.Value();
+ pLS->Append(aS);
+ }
+ }
+ break;
+ //
+ case GEOMAlgo_ST_OUT: {
+ aIt.Initialize(myLSOUT);
+ for (; aIt.More(); aIt.Next()) {
+ const TopoDS_Shape& aS=aIt.Value();
+ pLS->Append(aS);
+ }
+ }
+ break;
+ //
+ case GEOMAlgo_ST_ON: {
+ aIt.Initialize(myLSON);
+ for (; aIt.More(); aIt.Next()) {
+ const TopoDS_Shape& aS=aIt.Value();
+ pLS->Append(aS);
+ }
+ }
+ break;
+ //
+ case GEOMAlgo_ST_ONIN: {
+ aIt.Initialize(myLSON);
+ for (; aIt.More(); aIt.Next()) {
+ const TopoDS_Shape& aS=aIt.Value();
+ pLS->Append(aS);
+ }
+ aIt.Initialize(myLSIN);
+ for (; aIt.More(); aIt.Next()) {
+ const TopoDS_Shape& aS=aIt.Value();
+ pLS->Append(aS);
+ }
+ }
+ break;
+ //
+ case GEOMAlgo_ST_ONOUT: {
+ aIt.Initialize(myLSON);
+ for (; aIt.More(); aIt.Next()) {
+ const TopoDS_Shape& aS=aIt.Value();
+ pLS->Append(aS);
+ }
+ aIt.Initialize(myLSOUT);
+ for (; aIt.More(); aIt.Next()) {
+ const TopoDS_Shape& aS=aIt.Value();
+ pLS->Append(aS);
+ }
+ }
+ break;
+ //
+ case GEOMAlgo_ST_UNKNOWN:
+ case GEOMAlgo_ST_INOUT:
+ default:
+ break;
+ }
+ return myLS;
+}
+
--- /dev/null
+// File generated by CPPExt (Value)
+//
+// Copyright (C) 1991 - 2000 by
+// Matra Datavision SA. All rights reserved.
+//
+// Copyright (C) 2001 - 2004 by
+// Open CASCADE SA. All rights reserved.
+//
+// This file is part of the Open CASCADE Technology software.
+//
+// This software may be distributed and/or modified under the terms and
+// conditions of the Open CASCADE Public License as defined by Open CASCADE SA
+// and appearing in the file LICENSE included in the packaging of this file.
+//
+// This software is distributed on an "AS IS" basis, without warranty of any
+// kind, and Open CASCADE SA hereby disclaims all such warranties,
+// including without limitation, any warranties of merchantability, fitness
+// for a particular purpose or non-infringement. Please see the License for
+// the specific terms and conditions governing rights and limitations under the
+// License.
+
+#ifndef _GEOMAlgo_ShapeSolid_HeaderFile
+#define _GEOMAlgo_ShapeSolid_HeaderFile
+
+#ifndef _TopTools_ListOfShape_HeaderFile
+#include <TopTools_ListOfShape.hxx>
+#endif
+#ifndef _Standard_Integer_HeaderFile
+#include <Standard_Integer.hxx>
+#endif
+#ifndef _BOPTools_PDSFiller_HeaderFile
+#include <BOPTools_PDSFiller.hxx>
+#endif
+#ifndef _GEOMAlgo_Algo_HeaderFile
+#include <GEOMAlgo_Algo.hxx>
+#endif
+#ifndef _GEOMAlgo_State_HeaderFile
+#include <GEOMAlgo_State.hxx>
+#endif
+class BOPTools_DSFiller;
+class TopTools_ListOfShape;
+
+
+#ifndef _Standard_HeaderFile
+#include <Standard.hxx>
+#endif
+#ifndef _Standard_Macro_HeaderFile
+#include <Standard_Macro.hxx>
+#endif
+
+class GEOMAlgo_ShapeSolid : public GEOMAlgo_Algo {
+
+public:
+
+ void* operator new(size_t,void* anAddress)
+ {
+ return anAddress;
+ }
+ void* operator new(size_t size)
+ {
+ return Standard::Allocate(size);
+ }
+ void operator delete(void *anAddress)
+ {
+ if (anAddress) Standard::Free((Standard_Address&)anAddress);
+ }
+ // Methods PUBLIC
+ //
+Standard_EXPORT void SetFiller(const BOPTools_DSFiller& aDSF) ;
+Standard_EXPORT virtual ~GEOMAlgo_ShapeSolid();
+Standard_EXPORT const TopTools_ListOfShape& Shapes(const GEOMAlgo_State aState) const;
+
+
+
+
+
+protected:
+
+ // Methods PROTECTED
+ //
+Standard_EXPORT GEOMAlgo_ShapeSolid();
+Standard_EXPORT virtual void BuildResult() = 0;
+Standard_EXPORT virtual void Prepare() = 0;
+
+
+ // Fields PROTECTED
+ //
+TopTools_ListOfShape myLSIN;
+TopTools_ListOfShape myLSOUT;
+TopTools_ListOfShape myLSON;
+TopTools_ListOfShape myLS;
+Standard_Integer myRank;
+BOPTools_PDSFiller myDSFiller;
+
+
+private:
+
+ // Methods PRIVATE
+ //
+
+
+ // Fields PRIVATE
+ //
+
+
+};
+
+
+
+
+
+// other Inline functions and methods (like "C++: function call" methods)
+//
+
+
+#endif
--- /dev/null
+// File generated by CPPExt (Value)
+//
+// Copyright (C) 1991 - 2000 by
+// Matra Datavision SA. All rights reserved.
+//
+// Copyright (C) 2001 - 2004 by
+// Open CASCADE SA. All rights reserved.
+//
+// This file is part of the Open CASCADE Technology software.
+//
+// This software may be distributed and/or modified under the terms and
+// conditions of the Open CASCADE Public License as defined by Open CASCADE SA
+// and appearing in the file LICENSE included in the packaging of this file.
+//
+// This software is distributed on an "AS IS" basis, without warranty of any
+// kind, and Open CASCADE SA hereby disclaims all such warranties,
+// including without limitation, any warranties of merchantability, fitness
+// for a particular purpose or non-infringement. Please see the License for
+// the specific terms and conditions governing rights and limitations under the
+// License.
+
+#include <GEOMAlgo_ShapeSolid.jxx>
+
+
+
+
--- /dev/null
+#ifndef _BOPTools_DSFiller_HeaderFile
+#include <BOPTools_DSFiller.hxx>
+#endif
+#ifndef _TopTools_ListOfShape_HeaderFile
+#include <TopTools_ListOfShape.hxx>
+#endif
+#ifndef _GEOMAlgo_ShapeSolid_HeaderFile
+#include <GEOMAlgo_ShapeSolid.hxx>
+#endif
--- /dev/null
+-- File: GEOMAlgo_ShellSolid.cdl
+-- Created: Wed Jan 12 12:45:20 2005
+-- Author: Peter KURNEV
+-- <pkv@irinox>
+---Copyright: Matra Datavision 2005
+
+
+class ShellSolid from GEOMAlgo
+ inherits ShapeSolid from GEOMAlgo
+ ---Purpose:
+
+--uses
+--raises
+
+is
+ Create
+ returns ShellSolid from GEOMAlgo;
+ ---C++: alias "Standard_EXPORT virtual ~GEOMAlgo_ShellSolid();"
+
+ Perform (me:out)
+ is redefined;
+
+ Prepare(me:out)
+ is redefined protected;
+
+ BuildResult (me:out)
+ is redefined protected;
+
+ DetectSDFaces(me:out)
+ is protected;
+
+--fields
+
+end ShellSolid;
--- /dev/null
+// File: GEOMAlgo_ShellSolid.cxx
+// Created: Wed Jan 12 12:49:45 2005
+// Author: Peter KURNEV
+// <pkv@irinox>
+
+
+#include <GEOMAlgo_ShellSolid.ixx>
+
+#include <Standard_Failure.hxx>
+
+#include <gp_Pnt2d.hxx>
+#include <gp_Pnt.hxx>
+
+#include <TopoDS_Face.hxx>
+#include <TopoDS_Edge.hxx>
+#include <TopoDS.hxx>
+#include <TopoDS_Shape.hxx>
+#include <TopoDS_Solid.hxx>
+
+#include <BRep_Tool.hxx>
+
+#include <TopTools_ListIteratorOfListOfShape.hxx>
+#include <TopExp_Explorer.hxx>
+
+#include <BOPTColStd_Dump.hxx>
+
+#include <BRepClass3d_SolidClassifier.hxx>
+
+#include <IntTools_Context.hxx>
+
+#include <BooleanOperations_ShapesDataStructure.hxx>
+
+#include <BOPTools_PaveFiller.hxx>
+#include <BOPTools_SolidStateFiller.hxx>
+#include <BOPTools_PCurveMaker.hxx>
+#include <BOPTools_DEProcessor.hxx>
+#include <BOPTools_InterferencePool.hxx>
+#include <BOPTools_CArray1OfSSInterference.hxx>
+#include <BOPTools_ListOfPaveBlock.hxx>
+#include <BOPTools_ListIteratorOfListOfPaveBlock.hxx>
+#include <BOPTools_PaveBlock.hxx>
+#include <BOPTools_SSInterference.hxx>
+#include <BOPTools_SequenceOfCurves.hxx>
+#include <BOPTools_Curve.hxx>
+#include <BOPTools_PaveFiller.hxx>
+#include <BOPTools_SplitShapesPool.hxx>
+#include <BOPTools_Tools3D.hxx>
+#include <BOPTools_DSFiller.hxx>
+//
+#include <gp_Dir.hxx>
+#include <BOPTools_SSInterference.hxx>
+#include <TopoDS_Face.hxx>
+#include <TopoDS.hxx>
+#include <BOPTools_ListOfPaveBlock.hxx>
+#include <TopoDS_Edge.hxx>
+#include <BOPTools_Tools3D.hxx>
+#include <BOP_WireEdgeSet.hxx>
+#include <BOP_SDFWESFiller.hxx>
+#include <BOP_FaceBuilder.hxx>
+#include <TopTools_ListOfShape.hxx>
+#include <TopTools_ListIteratorOfListOfShape.hxx>
+#include <BRepTools.hxx>
+#include <IntTools_Context.hxx>
+#include <Geom_Surface.hxx>
+#include <TopExp_Explorer.hxx>
+#include <GeomAPI_ProjectPointOnSurf.hxx>
+
+static
+ Standard_Boolean CheckSameDomainFaceInside(const TopoDS_Face& theFace1,
+ const TopoDS_Face& theFace2);
+
+//=======================================================================
+//function : GEOMAlgo_ShellSolid
+//purpose :
+//=======================================================================
+GEOMAlgo_ShellSolid::GEOMAlgo_ShellSolid()
+:
+ GEOMAlgo_ShapeSolid()
+{
+}
+//=======================================================================
+//function : ~
+//purpose :
+//=======================================================================
+GEOMAlgo_ShellSolid::~GEOMAlgo_ShellSolid()
+{
+}
+//=======================================================================
+// function:
+// purpose:
+//=======================================================================
+void GEOMAlgo_ShellSolid::Perform()
+{
+ myErrorStatus=0;
+ //
+ try {
+ if (myDSFiller==NULL) {
+ myErrorStatus=10;
+ return;
+ }
+ if(!myDSFiller->IsDone()) {
+ myErrorStatus=11;
+ return;
+ }
+ //
+ Standard_Boolean bIsNewFiller;
+ //
+ bIsNewFiller=myDSFiller->IsNewFiller();
+ if (bIsNewFiller) {
+ Prepare();
+ myDSFiller->SetNewFiller(!bIsNewFiller);
+ }
+ //
+ myRank=(myDSFiller->DS().Object().ShapeType()==TopAbs_SHELL) ? 1 : 2;
+ BuildResult();
+ }
+ catch (Standard_Failure) {
+ myErrorStatus=12;
+ }
+}
+//=======================================================================
+// function: Prepare
+// purpose:
+//=======================================================================
+void GEOMAlgo_ShellSolid::Prepare()
+{
+ const BOPTools_PaveFiller& aPaveFiller=myDSFiller->PaveFiller();
+ //
+ // 1 States
+ BOPTools_SolidStateFiller aStateFiller(aPaveFiller);
+ aStateFiller.Do();
+ //
+ // 2 Project section edges on corresp. faces -> P-Curves on edges.
+ BOPTools_PCurveMaker aPCurveMaker(aPaveFiller);
+ aPCurveMaker.Do();
+ //
+ // 3. Degenerated Edges Processing
+ BOPTools_DEProcessor aDEProcessor(aPaveFiller);
+ aDEProcessor.Do();
+ //
+ // 4. Detect Same Domain Faces
+ DetectSDFaces();
+}
+//=================================================================================
+// function: BuildResult
+// purpose:
+//=================================================================================
+void GEOMAlgo_ShellSolid::BuildResult()
+{
+ Standard_Boolean bIsTouchCase;
+ Standard_Integer i, j, nF1, nF2, aNbFFs, aNbS, aNbCurves, nSp, iRank1;
+ Standard_Integer nE, nF, aNbPB, iBeg, iEnd;
+ BooleanOperations_StateOfShape aState;
+ TopExp_Explorer anExp;
+ TopAbs_ShapeEnum aType;
+ gp_Pnt2d aP2D;
+ gp_Pnt aP3D;
+ //
+ const BooleanOperations_ShapesDataStructure& aDS=myDSFiller->DS();
+ const BOPTools_InterferencePool& anInterfPool=myDSFiller->InterfPool();
+ BOPTools_InterferencePool* pInterfPool=(BOPTools_InterferencePool*) &anInterfPool;
+ BOPTools_CArray1OfSSInterference& aFFs=pInterfPool->SSInterferences();
+ const BOPTools_PaveFiller& aPaveFiller=myDSFiller->PaveFiller();
+ const BOPTools_SplitShapesPool& aSplitShapesPool=aPaveFiller.SplitShapesPool();
+ //
+ // 1. process pf non-interferring faces
+ iBeg=1;
+ iEnd=aDS.NumberOfShapesOfTheObject();
+ if (myRank==2) {
+ iBeg=iEnd+1;
+ iEnd=aDS.NumberOfSourceShapes();
+ }
+ //
+ for (i=iBeg; i<=iEnd; ++i) {
+ aType=aDS.GetShapeType(i);
+ if (aType!=TopAbs_FACE) {
+ continue;
+ }
+ //
+ const TopoDS_Face& aF1=TopoDS::Face(aDS.Shape(i));
+ aState=aDS.GetState(i);
+ if (aState==BooleanOperations_IN) {
+ myLSIN.Append(aF1);
+ }
+ else if (aState==BooleanOperations_OUT) {
+ myLSOUT.Append(aF1);
+ }
+ }
+ //
+ // 2. process pf interferred faces
+ aNbFFs=aFFs.Extent();
+ for (i=1; i<=aNbFFs; ++i) {
+ BOPTools_SSInterference& aFFi=aFFs(i);
+ //
+ nF1=aFFi.Index1();
+ nF2=aFFi.Index2();
+ iRank1=aDS.Rank(nF1);
+ nF=(iRank1==myRank) ? nF1 : nF2;
+ const TopoDS_Face& aF1=TopoDS::Face(aDS.Shape(nF));
+ //
+ bIsTouchCase=aFFi.IsTangentFaces();
+ //
+ if (bIsTouchCase) {
+ myLSON.Append(aF1);
+ continue;
+ }
+ //
+ // Has section edges ?
+ aNbS=0;
+ BOPTools_SequenceOfCurves& aBCurves=aFFi.Curves();
+ aNbCurves=aBCurves.Length();
+ for (j=1; j<=aNbCurves; j++) {
+ BOPTools_Curve& aBC=aBCurves(j);
+ const BOPTools_ListOfPaveBlock& aSectEdges=aBC.NewPaveBlocks();
+ aNbS=aSectEdges.Extent();
+ if (aNbS) {
+ break;
+ }
+ }
+ //
+ if (aNbS) { // it has
+ continue;
+ }
+ //
+ anExp.Init(aF1, TopAbs_EDGE);
+ for (; anExp.More(); anExp.Next()) {
+ const TopoDS_Edge& aE=TopoDS::Edge(anExp.Current());
+ if (BRep_Tool::Degenerated(aE)) {
+ continue;
+ }
+ //
+ nE=aDS.ShapeIndex(aE, myRank);
+ const BOPTools_ListOfPaveBlock& aLPB=aSplitShapesPool(aDS.RefEdge(nE));
+ aNbPB=aLPB.Extent();
+ //
+ if (aNbPB<2) {
+ nSp=nE;
+ if (aNbPB) {
+ const BOPTools_PaveBlock& aPB=aLPB.First();
+ nSp=aPB.Edge();
+ }
+ const TopoDS_Shape& aSp=aDS.Shape(nSp);
+ //
+ aState=aDS.GetState(nSp);
+ if (aState==BooleanOperations_IN) {
+ myLSIN.Append(aF1);
+ }
+ else if (aState==BooleanOperations_OUT) {
+ myLSOUT.Append(aF1);
+ }
+ else if (aState==BooleanOperations_ON) {
+ Standard_Real aTol;
+ TopAbs_State aSt;
+ //
+ //const TopoDS_Face& aF2=TopoDS::Face(aDS.Shape((iRank1==myRank)? nF2 : nF1));
+ //aTol=BRep_Tool::Tolerance(aF2);
+ aTol=1.e-7;
+ //
+ BOPTools_Tools3D::PointNearEdge(aE, aF1, aP2D, aP3D);
+ const TopoDS_Solid& aRefSolid=(myRank==1) ?
+ TopoDS::Solid(aDS.Tool()) : TopoDS::Solid(aDS.Object());
+ //
+ BOPTools_PaveFiller* pPF=(BOPTools_PaveFiller*)& aPaveFiller;
+ IntTools_Context& aCtx=pPF->ChangeContext();
+ //
+ BRepClass3d_SolidClassifier& aSC=aCtx.SolidClassifier(aRefSolid);
+ aSC.Perform(aP3D, aTol);
+ aSt=aSC.State();
+ if (aSt==TopAbs_IN) {
+ myLSIN.Append(aF1);
+ }
+ else if (aSt==TopAbs_OUT) {
+ myLSOUT.Append(aF1);
+ }
+ }
+ break;
+ } // if (aNbPB<2) {
+ } //for (; anExp.More(); anExp.Next())
+ }
+}
+//=======================================================================
+// function: DetectSDFaces
+// purpose:
+//=======================================================================
+void GEOMAlgo_ShellSolid::DetectSDFaces()
+{
+ const BooleanOperations_ShapesDataStructure& aDS=myDSFiller->DS();
+ BOPTools_InterferencePool* pIntrPool=(BOPTools_InterferencePool*)&myDSFiller->InterfPool();
+ BOPTools_CArray1OfSSInterference& aFFs=pIntrPool->SSInterferences();
+ //
+ Standard_Boolean bFlag;
+ Standard_Integer i, aNb, nF1, nF2, iZone, aNbSps, iSenseFlag;
+ gp_Dir aDNF1, aDNF2;
+
+ aNb=aFFs.Extent();
+ for (i=1; i<=aNb; i++) {
+ bFlag=Standard_False;
+
+ BOPTools_SSInterference& aFF=aFFs(i);
+
+ nF1=aFF.Index1();
+ nF2=aFF.Index2();
+ const TopoDS_Face& aF1=TopoDS::Face(aDS.Shape(nF1));
+ const TopoDS_Face& aF2=TopoDS::Face(aDS.Shape(nF2));
+ //
+ // iSenseFlag;
+ const BOPTools_ListOfPaveBlock& aLPB=aFF.PaveBlocks();
+ aNbSps=aLPB.Extent();
+
+ if (!aNbSps) {
+ continue;
+ }
+
+ const BOPTools_PaveBlock& aPB=aLPB.First();
+ const TopoDS_Edge& aSpE=TopoDS::Edge(aDS.Shape(aPB.Edge()));
+
+ BOPTools_Tools3D::GetNormalToFaceOnEdge (aSpE, aF1, aDNF1);
+ BOPTools_Tools3D::GetNormalToFaceOnEdge (aSpE, aF2, aDNF2);
+ iSenseFlag=BOPTools_Tools3D::SenseFlag (aDNF1, aDNF2);
+ //
+ if (iSenseFlag==1 || iSenseFlag==-1) {
+ //
+ //
+ TopoDS_Face aF1FWD=aF1;
+ aF1FWD.Orientation (TopAbs_FORWARD);
+
+ BOP_WireEdgeSet aWES (aF1FWD);
+ BOP_SDFWESFiller aWESFiller(nF1, nF2, *myDSFiller);
+ aWESFiller.SetSenseFlag(iSenseFlag);
+ aWESFiller.SetOperation(BOP_COMMON);
+ aWESFiller.Do(aWES);
+
+ BOP_FaceBuilder aFB;
+ aFB.Do(aWES);
+ const TopTools_ListOfShape& aLF=aFB.NewFaces();
+
+ iZone=0;
+ TopTools_ListIteratorOfListOfShape anIt(aLF);
+ for (; anIt.More(); anIt.Next()) {
+ const TopoDS_Shape& aFR=anIt.Value();
+
+ if (aFR.ShapeType()==TopAbs_FACE) {
+ const TopoDS_Face& aFaceResult=TopoDS::Face(aFR);
+ //
+ Standard_Boolean bIsValidIn2D, bNegativeFlag;
+ bIsValidIn2D=BOPTools_Tools3D::IsValidArea (aFaceResult, bNegativeFlag);
+ if (bIsValidIn2D) {
+ if(CheckSameDomainFaceInside(aFaceResult, aF2)) {
+ iZone=1;
+ break;
+ }
+ }
+ //
+ }
+ }
+
+ if (iZone) {
+ bFlag=Standard_True;
+ aFF.SetStatesMap(aWESFiller.StatesMap());
+ }
+
+ }// if (iSenseFlag)
+
+ aFF.SetTangentFacesFlag(bFlag);
+ aFF.SetSenseFlag (iSenseFlag);
+ }// end of for (i=1; i<=aNb; i++)
+}
+//=======================================================================
+//function : CheckSameDomainFaceInside
+//purpose :
+//=======================================================================
+Standard_Boolean CheckSameDomainFaceInside(const TopoDS_Face& theFace1,
+ const TopoDS_Face& theFace2)
+{
+ Standard_Real umin = 0., umax = 0., vmin = 0., vmax = 0.;
+ BRepTools::UVBounds(theFace1, umin, umax, vmin, vmax);
+ IntTools_Context aContext;
+ Handle(Geom_Surface) aSurface = BRep_Tool::Surface(theFace1);
+ Standard_Real aTolerance = BRep_Tool::Tolerance(theFace1);
+
+ TopExp_Explorer anExpE(theFace1, TopAbs_EDGE);
+
+ for(; anExpE.More(); anExpE.Next()) {
+ const TopoDS_Edge& anEdge = TopoDS::Edge(anExpE.Current());
+ Standard_Real anEdgeTol = BRep_Tool::Tolerance(anEdge);
+ aTolerance = (aTolerance < anEdgeTol) ? anEdgeTol : aTolerance;
+ }
+ aTolerance += BRep_Tool::Tolerance(theFace2);
+
+ Standard_Integer nbpoints = 5;
+ Standard_Real adeltau = (umax - umin) / (nbpoints + 1);
+ Standard_Real adeltav = (vmax - vmin) / (nbpoints + 1);
+ Standard_Real U = umin + adeltau;
+ GeomAPI_ProjectPointOnSurf& aProjector = aContext.ProjPS(theFace2);
+
+ for(Standard_Integer i = 1; i <= nbpoints; i++, U+=adeltau) {
+ Standard_Real V = vmin + adeltav;
+
+ for(Standard_Integer j = 1; j <= nbpoints; j++, V+=adeltav) {
+ gp_Pnt2d aPoint(U,V);
+
+ if(aContext.IsPointInFace(theFace1, aPoint)) {
+ gp_Pnt aP3d = aSurface->Value(U, V);
+ aProjector.Perform(aP3d);
+
+ if(aProjector.IsDone()) {
+
+ if(aProjector.LowerDistance() > aTolerance)
+ return Standard_False;
+ }
+ }
+ }
+ }
+
+ return Standard_True;
+}
--- /dev/null
+// File generated by CPPExt (Value)
+//
+// Copyright (C) 1991 - 2000 by
+// Matra Datavision SA. All rights reserved.
+//
+// Copyright (C) 2001 - 2004 by
+// Open CASCADE SA. All rights reserved.
+//
+// This file is part of the Open CASCADE Technology software.
+//
+// This software may be distributed and/or modified under the terms and
+// conditions of the Open CASCADE Public License as defined by Open CASCADE SA
+// and appearing in the file LICENSE included in the packaging of this file.
+//
+// This software is distributed on an "AS IS" basis, without warranty of any
+// kind, and Open CASCADE SA hereby disclaims all such warranties,
+// including without limitation, any warranties of merchantability, fitness
+// for a particular purpose or non-infringement. Please see the License for
+// the specific terms and conditions governing rights and limitations under the
+// License.
+
+#ifndef _GEOMAlgo_ShellSolid_HeaderFile
+#define _GEOMAlgo_ShellSolid_HeaderFile
+
+#ifndef _GEOMAlgo_ShapeSolid_HeaderFile
+#include <GEOMAlgo_ShapeSolid.hxx>
+#endif
+
+
+#ifndef _Standard_HeaderFile
+#include <Standard.hxx>
+#endif
+#ifndef _Standard_Macro_HeaderFile
+#include <Standard_Macro.hxx>
+#endif
+
+class GEOMAlgo_ShellSolid : public GEOMAlgo_ShapeSolid {
+
+public:
+
+ void* operator new(size_t,void* anAddress)
+ {
+ return anAddress;
+ }
+ void* operator new(size_t size)
+ {
+ return Standard::Allocate(size);
+ }
+ void operator delete(void *anAddress)
+ {
+ if (anAddress) Standard::Free((Standard_Address&)anAddress);
+ }
+ // Methods PUBLIC
+ //
+Standard_EXPORT GEOMAlgo_ShellSolid();
+Standard_EXPORT virtual ~GEOMAlgo_ShellSolid();
+Standard_EXPORT virtual void Perform() ;
+
+
+
+
+
+protected:
+
+ // Methods PROTECTED
+ //
+Standard_EXPORT virtual void Prepare() ;
+Standard_EXPORT virtual void BuildResult() ;
+Standard_EXPORT void DetectSDFaces() ;
+
+
+ // Fields PROTECTED
+ //
+
+
+private:
+
+ // Methods PRIVATE
+ //
+
+
+ // Fields PRIVATE
+ //
+
+
+};
+
+
+
+
+
+// other Inline functions and methods (like "C++: function call" methods)
+//
+
+
+#endif
--- /dev/null
+// File generated by CPPExt (Value)
+//
+// Copyright (C) 1991 - 2000 by
+// Matra Datavision SA. All rights reserved.
+//
+// Copyright (C) 2001 - 2004 by
+// Open CASCADE SA. All rights reserved.
+//
+// This file is part of the Open CASCADE Technology software.
+//
+// This software may be distributed and/or modified under the terms and
+// conditions of the Open CASCADE Public License as defined by Open CASCADE SA
+// and appearing in the file LICENSE included in the packaging of this file.
+//
+// This software is distributed on an "AS IS" basis, without warranty of any
+// kind, and Open CASCADE SA hereby disclaims all such warranties,
+// including without limitation, any warranties of merchantability, fitness
+// for a particular purpose or non-infringement. Please see the License for
+// the specific terms and conditions governing rights and limitations under the
+// License.
+
+#include <GEOMAlgo_ShellSolid.jxx>
+
+
+
+
--- /dev/null
+#ifndef _GEOMAlgo_ShellSolid_HeaderFile
+#include <GEOMAlgo_ShellSolid.hxx>
+#endif
--- /dev/null
+// File generated by CPPExt (Enum)
+//
+// Copyright (C) 1991 - 2000 by
+// Matra Datavision SA. All rights reserved.
+//
+// Copyright (C) 2001 - 2004 by
+// Open CASCADE SA. All rights reserved.
+//
+// This file is part of the Open CASCADE Technology software.
+//
+// This software may be distributed and/or modified under the terms and
+// conditions of the Open CASCADE Public License as defined by Open CASCADE SA
+// and appearing in the file LICENSE included in the packaging of this file.
+//
+// This software is distributed on an "AS IS" basis, without warranty of any
+// kind, and Open CASCADE SA hereby disclaims all such warranties,
+// including without limitation, any warranties of merchantability, fitness
+// for a particular purpose or non-infringement. Please see the License for
+// the specific terms and conditions governing rights and limitations under the
+// License.
+
+#ifndef _GEOMAlgo_State_HeaderFile
+#define _GEOMAlgo_State_HeaderFile
+
+enum GEOMAlgo_State {
+ GEOMAlgo_ST_UNKNOWN,
+GEOMAlgo_ST_IN,
+GEOMAlgo_ST_OUT,
+GEOMAlgo_ST_ON,
+GEOMAlgo_ST_ONIN,
+GEOMAlgo_ST_ONOUT,
+GEOMAlgo_ST_INOUT
+};
+
+
+#ifndef _Standard_PrimitiveTypes_HeaderFile
+#include <Standard_PrimitiveTypes.hxx>
+#endif
+
+#endif
---Purpose:
uses
- Pnt from gp,
+ Pnt from gp,
+ Surface from Geom,
Edge from TopoDS,
Face from TopoDS,
Shape from TopoDS,
aU :Real from Standard;
aV :Real from Standard;
aP3D:out Pnt from gp);
+
+ RefinePCurveForEdgeOnFace (myclass;
+ aE : Edge from TopoDS;
+ aF : Face from TopoDS;
+ aU1 : Real from Standard;
+ aU2 : Real from Standard);
+
+ IsUPeriodic(myclass;
+ aS:Surface from Geom)
+ returns Boolean from Standard;
--fields
end Tools;
#include <GEOMAlgo_Tools.ixx>
#include <gp_Pnt.hxx>
+#include <gp_Pnt2d.hxx>
#include <Geom_Surface.hxx>
#include <Geom_Curve.hxx>
+#include <Geom2d_Curve.hxx>
+#include <GeomAdaptor_Surface.hxx>
#include <GeomAPI_ProjectPointOnSurf.hxx>
#include <TopTools_IndexedMapOfShape.hxx>
#include <BRep_Tool.hxx>
-#include <BOPTools_Tools2D.hxx>
+#include <BRep_Builder.hxx>
#include <BRepTools.hxx>
#include <BOPTools_Tools2D.hxx>
#include <GEOMAlgo_PassKey.hxx>
#include <GEOMAlgo_IndexedDataMapOfPassKeyListOfShape.hxx>
-
+//
//=======================================================================
//function : RefineSDShapes
//purpose :
aNbE=aMPKLE.Extent();
for (i=1; i<=aNbE; ++i) {
TopTools_ListOfShape& aLSDE=aMPKLE.ChangeFromIndex(i);
- aMEE.Clear();
//
+ aMEE.Clear();
iErr=GEOMAlgo_Tools::FindSDShapes(aLSDE, aTol, aMEE, aCtx);
if (iErr) {
return iErr;
TopTools_ListOfShape aLESD;
TopTools_ListIteratorOfListOfShape aIt, aIt1;
TopTools_IndexedMapOfShape aMProcessed;
+ TopAbs_ShapeEnum aType;
//
aNbE=aLE.Extent();
if (!aNbE) {
return 3; // Err
- }
+ }
+ //modified by NIZNHY-PKV Thu Dec 30 10:56:52 2004 f
+ if (aNbE==1) {
+ return 0; // Nothing to do
+ }
+ //modified by NIZNHY-PKV Thu Dec 30 10:56:56 2004 t
//
while(1) {
aNbEProcessed=aMProcessed.Extent();
aIt.Initialize(aLE);
for (; aIt.More(); aIt.Next()) {
const TopoDS_Shape& aS=aIt.Value();
+ //
if (aMProcessed.Contains(aS)) {
continue;
}
//
+ //modified by NIZNHY-PKV Thu Dec 30 10:57:01 2004 f
+ aType=aS.ShapeType();
+ if (aType==TopAbs_EDGE) {
+ const TopoDS_Edge& aE=TopoDS::Edge(aS);
+ if (BRep_Tool::Degenerated(aE)) {
+ aMProcessed.Add(aE);
+ continue;
+ }
+ }
+ //modified by NIZNHY-PKV Thu Dec 30 10:57:03 2004 t
+ //
aLESD.Clear();
iErr=GEOMAlgo_Tools::FindSDShapes(aS, aLE, aTol, aLESD, aCtx);
if (iErr) {
aC3D=BRep_Tool::Curve(aE, aT1, aT2);
aC3D->D0(aT, aP3D);
}
-/*
//=======================================================================
-//function : FindSDEdges
+//function : RefinePCurveForEdgeOnFace
//purpose :
//=======================================================================
-Standard_Integer GEOMAlgo_Tools::FindSDEdges(const TopoDS_Edge& aE1,
- const TopTools_ListOfShape& aLE,
- const Standard_Real aTol,
- TopTools_ListOfShape& aLESD,
- IntTools_Context& aCtx)
+void GEOMAlgo_Tools::RefinePCurveForEdgeOnFace(const TopoDS_Edge& aE,
+ const TopoDS_Face& aF,
+ const Standard_Real aUMin,
+ const Standard_Real aUMax)
{
- Standard_Boolean bIsDone;
- Standard_Real aT2, aTol2, aD2;
- gp_Pnt aP1, aP2;
- TopTools_ListIteratorOfListOfShape aIt;
+ Standard_Real aT1, aT2, aTx, aUx, aTol, aTwoPI;
+ gp_Pnt2d aP2D;
+ Handle(Geom_Surface) aS;
+ Handle(Geom2d_Curve) aC2D;
+ BRep_Builder aBB;
//
- aTol2=aTol*aTol;
+ aTwoPI=PI+PI;
//
- GEOMAlgo_Tools::PointOnEdge(aE1, aP1);
- aIt.Initialize(aLE);
- for (; aIt.More(); aIt.Next()) {
- const TopoDS_Edge& aE2=TopoDS::Edge(aIt.Value());
- if (aE2.IsSame(aE1)) {
- aLESD.Append(aE2);
+ aC2D=BRep_Tool::CurveOnSurface(aE, aF, aT1, aT2);
+ if (!aC2D.IsNull()) {
+ if (BRep_Tool::IsClosed(aE, aF)) {
+ return;
}
- else {
- bIsDone=aCtx.ProjectPointOnEdge(aP1, aE2, aT2);
- if (!bIsDone) {
- return 1;
- }
- GEOMAlgo_Tools::PointOnEdge(aE2, aT2, aP2);
- aD2=aP1.SquareDistance(aP2);
- if(aD2<aTol2) {
- aLESD.Append(aE2);
- }
+ aTx=BOPTools_Tools2D::IntermediatePoint(aT1, aT2);
+ aC2D->D0(aTx, aP2D);
+ aUx=aP2D.X();
+ if (aUx < aUMin || aUx > aUMax) {
+ // need to rebuild
+ Handle(Geom2d_Curve) aC2Dx;
+ //
+ aTol=BRep_Tool::Tolerance(aE);
+ aBB.UpdateEdge(aE, aC2Dx, aF, aTol);
}
}
- return 0;
}
//=======================================================================
-//function : FindSDFaces
+//function : IsUPeriodic
//purpose :
//=======================================================================
-Standard_Integer GEOMAlgo_Tools::FindSDFaces(const TopoDS_Face& aF1,
- const TopTools_ListOfShape& aLF,
- const Standard_Real aTol,
- TopTools_ListOfShape& aLFSD,
- IntTools_Context& aCtx)
+Standard_Boolean GEOMAlgo_Tools::IsUPeriodic(const Handle(Geom_Surface) &aS)
{
- Standard_Boolean bIsDone;
- Standard_Real aTol2, aD2;
- gp_Pnt aP1, aP2;
- TopTools_ListIteratorOfListOfShape aIt;
+ Standard_Boolean bRet;
+ GeomAbs_SurfaceType aType;
+ GeomAdaptor_Surface aGAS;
//
- aTol2=aTol*aTol;
+ aGAS.Load(aS);
+ aType=aGAS.GetType();
+ bRet=(aType==GeomAbs_Cylinder||
+ aType==GeomAbs_Cone ||
+ aType==GeomAbs_Sphere);
//
- GEOMAlgo_Tools::PointOnFace(aF1, aP1);
- aIt.Initialize(aLF);
- for (; aIt.More(); aIt.Next()) {
- const TopoDS_Face& aF2=TopoDS::Face(aIt.Value());
- if (aF2.IsSame(aF1)) {
- aLFSD.Append(aF2);
- }
- else {
- GeomAPI_ProjectPointOnSurf& aProj=aCtx.ProjPS(aF2);
- aProj.Perform(aP1);
- bIsDone=aProj.IsDone();
- if (!bIsDone) {
- return 1; //??
- }
- //
- aP2=aProj.NearestPoint();
- aD2=aP1.SquareDistance(aP2);
- if(aD2<aTol2) {
- aLFSD.Append(aF2);
- }
- }
- }
- return 0;
+ return bRet;
}
-*/
#ifndef _Standard_Boolean_HeaderFile
#include <Standard_Boolean.hxx>
#endif
+#ifndef _Handle_Geom_Surface_HeaderFile
+#include <Handle_Geom_Surface.hxx>
+#endif
class GEOMAlgo_IndexedDataMapOfPassKeyListOfShape;
class IntTools_Context;
class TopTools_ListOfShape;
class gp_Pnt;
class TopoDS_Edge;
class TopoDS_Face;
+class Geom_Surface;
#ifndef _Standard_HeaderFile
Standard_EXPORT static void PointOnEdge(const TopoDS_Edge& aE,const Standard_Real aT,gp_Pnt& aP3D) ;
Standard_EXPORT static void PointOnFace(const TopoDS_Face& aF,gp_Pnt& aP3D) ;
Standard_EXPORT static void PointOnFace(const TopoDS_Face& aF,const Standard_Real aU,const Standard_Real aV,gp_Pnt& aP3D) ;
+Standard_EXPORT static void RefinePCurveForEdgeOnFace(const TopoDS_Edge& aE,const TopoDS_Face& aF,const Standard_Real aU1,const Standard_Real aU2) ;
+Standard_EXPORT static Standard_Boolean IsUPeriodic(const Handle(Geom_Surface)& aS) ;
#ifndef _TopoDS_Face_HeaderFile
#include <TopoDS_Face.hxx>
#endif
+#ifndef _Geom_Surface_HeaderFile
+#include <Geom_Surface.hxx>
+#endif
#ifndef _GEOMAlgo_Tools_HeaderFile
#include <GEOMAlgo_Tools.hxx>
#endif
--- /dev/null
+-- File: GEOMAlgo_VertexSolid.cdl
+-- Created: Wed Jan 12 16:34:53 2005
+-- Author: Peter KURNEV
+-- <pkv@irinox>
+---Copyright: Matra Datavision 2005
+
+
+class VertexSolid from GEOMAlgo
+ inherits ShapeSolid from GEOMAlgo
+
+ ---Purpose:
+
+--uses
+--raises
+
+is
+ Create
+ returns VertexSolid from GEOMAlgo;
+ ---C++: alias "Standard_EXPORT virtual ~GEOMAlgo_VertexSolid();"
+
+ Perform (me:out)
+ is redefined;
+
+ Prepare(me:out)
+ is redefined protected;
+
+ BuildResult (me:out)
+ is redefined protected;
+
+--fields
+
+end VertexSolid;
--- /dev/null
+// File: GEOMAlgo_VertexSolid.cxx
+// Created: Wed Jan 12 16:36:40 2005
+// Author: Peter KURNEV
+// <pkv@irinox>
+
+
+#include <GEOMAlgo_VertexSolid.ixx>
+
+#include <gp_Pnt.hxx>
+
+#include <TopAbs_ShapeEnum.hxx>
+#include <TopAbs_State.hxx>
+
+#include <TopTools_ListIteratorOfListOfShape.hxx>
+#include <TopTools_ListOfShape.hxx>
+#include <TopTools_IndexedMapOfShape.hxx>
+
+#include <TopoDS.hxx>
+#include <TopoDS_Solid.hxx>
+#include <TopoDS_Vertex.hxx>
+
+#include <TopExp.hxx>
+
+#include <BRep_Tool.hxx>
+#include <BRepClass3d_SolidClassifier.hxx>
+
+#include <BOPTColStd_Dump.hxx>
+
+#include <IntTools_Context.hxx>
+
+#include <BooleanOperations_StateOfShape.hxx>
+#include <BooleanOperations_ShapesDataStructure.hxx>
+
+#include <BOPTools_InterferencePool.hxx>
+#include <BOPTools_CArray1OfVVInterference.hxx>
+#include <BOPTools_VVInterference.hxx>
+#include <BOPTools_PaveFiller.hxx>
+#include <BOPTools_DSFiller.hxx>
+
+//=======================================================================
+//function : GEOMAlgo_VertexSolid
+//purpose :
+//=======================================================================
+GEOMAlgo_VertexSolid::GEOMAlgo_VertexSolid()
+:
+ GEOMAlgo_ShapeSolid()
+{
+}
+//=======================================================================
+//function : ~
+//purpose :
+//=======================================================================
+GEOMAlgo_VertexSolid::~GEOMAlgo_VertexSolid()
+{
+}
+//=======================================================================
+// function: Perform
+// purpose:
+//=======================================================================
+void GEOMAlgo_VertexSolid::Perform()
+{
+ myErrorStatus=0;
+ //
+ try {
+ if (myDSFiller==NULL) {
+ myErrorStatus=10;
+ return;
+ }
+ if(!myDSFiller->IsDone()) {
+ myErrorStatus=11;
+ return;
+ }
+ //
+ Standard_Boolean bIsNewFiller;
+ Standard_Integer aNbF;
+ TopTools_IndexedMapOfShape aM;
+ //
+ const BooleanOperations_ShapesDataStructure& aDS=myDSFiller->DS();
+ const TopoDS_Shape& aObj=aDS.Object();
+ //
+ TopExp::MapShapes(aObj, TopAbs_FACE, aM);
+ aNbF=aM.Extent();
+ myRank=(aNbF) ? 2 : 1;
+ //
+ bIsNewFiller=myDSFiller->IsNewFiller();
+
+ if (bIsNewFiller) {
+ Prepare();
+ myDSFiller->SetNewFiller(!bIsNewFiller);
+ }
+ BuildResult();
+ }
+ //
+ catch (Standard_Failure) {
+ myErrorStatus = 12;
+ }
+}
+//=======================================================================
+// function: Prepare
+// purpose:
+//=======================================================================
+void GEOMAlgo_VertexSolid::Prepare()
+{
+ Standard_Integer i, iBeg, iEnd, aNbVV, j, n1, n2, iFound;
+ Standard_Real aTol;
+ TopAbs_State aSt;
+ TopAbs_ShapeEnum aType;
+ BooleanOperations_StateOfShape aState;
+ gp_Pnt aP3D;
+ //
+ const BooleanOperations_ShapesDataStructure& aDS=myDSFiller->DS();
+ BooleanOperations_ShapesDataStructure* pDS=(BooleanOperations_ShapesDataStructure*)&aDS;
+ const BOPTools_InterferencePool& aIP=myDSFiller->InterfPool();
+ BOPTools_InterferencePool* pIP=(BOPTools_InterferencePool*) &aIP;
+ BOPTools_CArray1OfVVInterference& aVVs=pIP->VVInterferences();
+ const BOPTools_PaveFiller& aPF=myDSFiller->PaveFiller();
+ BOPTools_PaveFiller* pPF=(BOPTools_PaveFiller*)&aPF;
+ IntTools_Context& aCtx=pPF->ChangeContext();
+ //
+ const TopoDS_Shape& aObj=aDS.Object();
+ const TopoDS_Shape& aTool=aDS.Tool();
+ //
+ const TopoDS_Solid& aSolid=(myRank==1) ? TopoDS::Solid(aTool) : TopoDS::Solid(aObj);
+ const TopoDS_Shape& aSV =(myRank==1)? aObj : aTool;
+ //
+ BRepClass3d_SolidClassifier& aSC=aCtx.SolidClassifier(aSolid);
+ //
+ iBeg=1;
+ iEnd=aDS.NumberOfShapesOfTheObject();
+ if (myRank==2) {
+ iBeg=iEnd+1;
+ iEnd=aDS.NumberOfSourceShapes();
+ }
+ //
+ for (i=iBeg; i<=iEnd; ++i) {
+ aType=aDS.GetShapeType(i);
+ if (aType!=TopAbs_VERTEX) {
+ continue;
+ }
+ //
+ const TopoDS_Vertex& aV=TopoDS::Vertex(aDS.Shape(i));
+ //
+ aState=aDS.GetState(i);
+ if (aState==BooleanOperations_ON ||
+ aState==BooleanOperations_IN ||
+ aState==BooleanOperations_OUT) {
+ continue;
+ }
+ //
+ iFound=0;
+ aNbVV=aVVs.Extent();
+ for (j=1; j<=aNbVV; ++j) {
+ BOPTools_VVInterference& aVV=aVVs(j);
+ aVV.Indices(n1, n2);
+ if (n1==i || n2==i) {
+ pDS->SetState (n1, BooleanOperations_ON);
+ pDS->SetState (n2, BooleanOperations_ON);
+ iFound=1;
+ break;
+ }
+ }
+ if (iFound) {
+ continue;
+ }
+ //
+ aP3D=BRep_Tool::Pnt(aV);
+ aTol=1.E-7;
+ aSC.Perform(aP3D, aTol);
+ aSt=aSC.State();
+ if (aSt==TopAbs_IN) {
+ pDS->SetState (i, BooleanOperations_IN);
+ }
+ else if (aSt==TopAbs_OUT) {
+ pDS->SetState (i, BooleanOperations_OUT);
+ }
+ }
+}
+//=======================================================================
+// function: BuildResult
+// purpose:
+//=======================================================================
+void GEOMAlgo_VertexSolid::BuildResult()
+{
+ const BooleanOperations_ShapesDataStructure& aDS=myDSFiller->DS();
+ //
+ Standard_Integer i, iBeg, iEnd;
+ TopAbs_ShapeEnum aType;
+ BooleanOperations_StateOfShape aState;
+ //
+ myLSIN.Clear();
+ myLSOUT.Clear();
+ myLSON.Clear();
+ //
+ iBeg=1;
+ iEnd=aDS.NumberOfShapesOfTheObject();
+ if (myRank==2) {
+ iBeg=iEnd+1;
+ iEnd=aDS.NumberOfSourceShapes();
+ }
+ //
+ for (i=iBeg; i<=iEnd; ++i) {
+ aType=aDS.GetShapeType(i);
+ if (aType!=TopAbs_VERTEX) {
+ continue;
+ }
+ const TopoDS_Shape& aV=aDS.Shape(i);
+ aState=aDS.GetState(i);
+ //
+ if (aState==BooleanOperations_IN) {
+ myLSIN.Append(aV);
+ }
+ else if (aState==BooleanOperations_OUT) {
+ myLSOUT.Append(aV);
+ }
+ else if (aState==BooleanOperations_ON) {
+ myLSON.Append(aV);
+ }
+ }
+}
--- /dev/null
+// File generated by CPPExt (Value)
+//
+// Copyright (C) 1991 - 2000 by
+// Matra Datavision SA. All rights reserved.
+//
+// Copyright (C) 2001 - 2004 by
+// Open CASCADE SA. All rights reserved.
+//
+// This file is part of the Open CASCADE Technology software.
+//
+// This software may be distributed and/or modified under the terms and
+// conditions of the Open CASCADE Public License as defined by Open CASCADE SA
+// and appearing in the file LICENSE included in the packaging of this file.
+//
+// This software is distributed on an "AS IS" basis, without warranty of any
+// kind, and Open CASCADE SA hereby disclaims all such warranties,
+// including without limitation, any warranties of merchantability, fitness
+// for a particular purpose or non-infringement. Please see the License for
+// the specific terms and conditions governing rights and limitations under the
+// License.
+
+#ifndef _GEOMAlgo_VertexSolid_HeaderFile
+#define _GEOMAlgo_VertexSolid_HeaderFile
+
+#ifndef _GEOMAlgo_ShapeSolid_HeaderFile
+#include <GEOMAlgo_ShapeSolid.hxx>
+#endif
+
+
+#ifndef _Standard_HeaderFile
+#include <Standard.hxx>
+#endif
+#ifndef _Standard_Macro_HeaderFile
+#include <Standard_Macro.hxx>
+#endif
+
+class GEOMAlgo_VertexSolid : public GEOMAlgo_ShapeSolid {
+
+public:
+
+ void* operator new(size_t,void* anAddress)
+ {
+ return anAddress;
+ }
+ void* operator new(size_t size)
+ {
+ return Standard::Allocate(size);
+ }
+ void operator delete(void *anAddress)
+ {
+ if (anAddress) Standard::Free((Standard_Address&)anAddress);
+ }
+ // Methods PUBLIC
+ //
+Standard_EXPORT GEOMAlgo_VertexSolid();
+Standard_EXPORT virtual ~GEOMAlgo_VertexSolid();
+Standard_EXPORT virtual void Perform() ;
+
+
+
+
+
+protected:
+
+ // Methods PROTECTED
+ //
+Standard_EXPORT virtual void Prepare() ;
+Standard_EXPORT virtual void BuildResult() ;
+
+
+ // Fields PROTECTED
+ //
+
+
+private:
+
+ // Methods PRIVATE
+ //
+
+
+ // Fields PRIVATE
+ //
+
+
+};
+
+
+
+
+
+// other Inline functions and methods (like "C++: function call" methods)
+//
+
+
+#endif
--- /dev/null
+// File generated by CPPExt (Value)
+//
+// Copyright (C) 1991 - 2000 by
+// Matra Datavision SA. All rights reserved.
+//
+// Copyright (C) 2001 - 2004 by
+// Open CASCADE SA. All rights reserved.
+//
+// This file is part of the Open CASCADE Technology software.
+//
+// This software may be distributed and/or modified under the terms and
+// conditions of the Open CASCADE Public License as defined by Open CASCADE SA
+// and appearing in the file LICENSE included in the packaging of this file.
+//
+// This software is distributed on an "AS IS" basis, without warranty of any
+// kind, and Open CASCADE SA hereby disclaims all such warranties,
+// including without limitation, any warranties of merchantability, fitness
+// for a particular purpose or non-infringement. Please see the License for
+// the specific terms and conditions governing rights and limitations under the
+// License.
+
+#include <GEOMAlgo_VertexSolid.jxx>
+
+
+
+
--- /dev/null
+#ifndef _GEOMAlgo_VertexSolid_HeaderFile
+#include <GEOMAlgo_VertexSolid.hxx>
+#endif
--- /dev/null
+-- File: GEOMAlgo_WireSolid.cdl
+-- Created: Wed Jan 12 10:17:00 2005
+-- Author: Peter KURNEV
+-- <pkv@irinox>
+---Copyright: Matra Datavision 2005
+
+
+class WireSolid from GEOMAlgo
+ inherits ShapeSolid from GEOMAlgo
+ ---Purpose:
+
+--uses
+--raises
+
+is
+ Create
+ returns WireSolid from GEOMAlgo;
+ ---C++: alias "Standard_EXPORT virtual ~GEOMAlgo_WireSolid();"
+
+ Perform (me:out)
+ is redefined;
+
+ Prepare(me:out)
+ is redefined protected;
+
+ BuildResult (me:out)
+ is redefined protected;
+
+--fields
+
+end WireSolid;
--- /dev/null
+// File: GEOMAlgo_WireSolid.cxx
+// Created: Wed Jan 12 10:19:31 2005
+// Author: Peter KURNEV
+// <pkv@irinox>
+
+
+#include <GEOMAlgo_WireSolid.ixx>
+
+#include <Standard_Failure.hxx>
+
+#include <TopAbs_ShapeEnum.hxx>
+
+#include <TopTools_ListIteratorOfListOfShape.hxx>
+
+#include <BOPTColStd_Dump.hxx>
+
+#include <BooleanOperations_ShapesDataStructure.hxx>
+#include <BooleanOperations_StateOfShape.hxx>
+
+#include <BOPTools_PaveFiller.hxx>
+#include <BOPTools_SplitShapesPool.hxx>
+#include <BOPTools_PaveBlock.hxx>
+#include <BOPTools_ListOfPaveBlock.hxx>
+#include <BOPTools_DSFiller.hxx>
+#include <BOPTools_WireStateFiller.hxx>
+
+//=======================================================================
+//function : GEOMAlgo_WireSolid
+//purpose :
+//=======================================================================
+GEOMAlgo_WireSolid::GEOMAlgo_WireSolid()
+:
+ GEOMAlgo_ShapeSolid()
+{
+}
+//=======================================================================
+//function : ~
+//purpose :
+//=======================================================================
+GEOMAlgo_WireSolid::~GEOMAlgo_WireSolid()
+{
+}
+//=======================================================================
+// function: Perform
+// purpose:
+//=======================================================================
+void GEOMAlgo_WireSolid::Perform()
+{
+ myErrorStatus=0;
+ //
+ try {
+ if (myDSFiller==NULL) {
+ myErrorStatus=10;
+ return;
+ }
+ if(!myDSFiller->IsDone()) {
+ myErrorStatus=11;
+ return;
+ }
+ //
+ Standard_Boolean bIsNewFiller;
+ //
+ bIsNewFiller=myDSFiller->IsNewFiller();
+
+ if (bIsNewFiller) {
+ Prepare();
+ myDSFiller->SetNewFiller(!bIsNewFiller);
+ }
+ BuildResult();
+ }
+ //
+ catch (Standard_Failure) {
+ myErrorStatus= 12;
+ }
+}
+//=======================================================================
+// function: Prepare
+// purpose:
+//=======================================================================
+void GEOMAlgo_WireSolid::Prepare()
+{
+ const BOPTools_PaveFiller& aPaveFiller=myDSFiller->PaveFiller();
+ //
+ BOPTools_WireStateFiller aStateFiller(aPaveFiller);
+ aStateFiller.Do();
+ //
+}
+//=======================================================================
+// function: BuildResult
+// purpose:
+//=======================================================================
+void GEOMAlgo_WireSolid::BuildResult()
+{
+ const BooleanOperations_ShapesDataStructure& aDS=myDSFiller->DS();
+ const BOPTools_PaveFiller& aPaveFiller=myDSFiller->PaveFiller();
+ const BOPTools_SplitShapesPool& aSplitShapesPool=aPaveFiller.SplitShapesPool();
+ //
+ Standard_Integer i, aNbPB, nSp, iBeg, iEnd;
+ TopAbs_ShapeEnum aType;
+ BooleanOperations_StateOfShape aState;
+ //
+ myLSIN.Clear();
+ myLSOUT.Clear();
+ myLSON.Clear();
+ //
+ iBeg=1;
+ iEnd=aDS.NumberOfShapesOfTheObject();
+ if (aDS.Tool().ShapeType()==TopAbs_WIRE) {
+ iBeg=iEnd+1;
+ iEnd=aDS.NumberOfSourceShapes();
+ }
+ //
+ for (i=iBeg; i<=iEnd; ++i) {
+ aType=aDS.GetShapeType(i);
+ if (aType==TopAbs_EDGE) {
+ const TopoDS_Shape& aE=aDS.Shape(i);
+ const BOPTools_ListOfPaveBlock& aLPB=aSplitShapesPool(aDS.RefEdge(i));
+ aNbPB=aLPB.Extent();
+ //
+ if (!aNbPB) {
+ aState=aDS.GetState(i);
+ //
+ if (aState==BooleanOperations_IN) {
+ myLSIN.Append(aE);
+ }
+ else if (aState==BooleanOperations_OUT) {
+ myLSOUT.Append(aE);
+ }
+ else if (aState==BooleanOperations_ON) {
+ myLSON.Append(aE);
+ }
+ }
+ //
+ else if (aNbPB==1) {
+ const BOPTools_PaveBlock& aPB=aLPB.First();
+ nSp=aPB.Edge();
+ const TopoDS_Shape& aSp=aDS.Shape(nSp);
+ aState=aDS.GetState(nSp);
+ //
+ if (aState==BooleanOperations_IN) {
+ myLSIN.Append(aE);
+ }
+ else if (aState==BooleanOperations_OUT) {
+ myLSOUT.Append(aE);
+ }
+ else if (aState==BooleanOperations_ON) {
+ myLSON.Append(aE);
+ }
+ }
+ }
+ }
+}
--- /dev/null
+// File generated by CPPExt (Value)
+//
+// Copyright (C) 1991 - 2000 by
+// Matra Datavision SA. All rights reserved.
+//
+// Copyright (C) 2001 - 2004 by
+// Open CASCADE SA. All rights reserved.
+//
+// This file is part of the Open CASCADE Technology software.
+//
+// This software may be distributed and/or modified under the terms and
+// conditions of the Open CASCADE Public License as defined by Open CASCADE SA
+// and appearing in the file LICENSE included in the packaging of this file.
+//
+// This software is distributed on an "AS IS" basis, without warranty of any
+// kind, and Open CASCADE SA hereby disclaims all such warranties,
+// including without limitation, any warranties of merchantability, fitness
+// for a particular purpose or non-infringement. Please see the License for
+// the specific terms and conditions governing rights and limitations under the
+// License.
+
+#ifndef _GEOMAlgo_WireSolid_HeaderFile
+#define _GEOMAlgo_WireSolid_HeaderFile
+
+#ifndef _GEOMAlgo_ShapeSolid_HeaderFile
+#include <GEOMAlgo_ShapeSolid.hxx>
+#endif
+
+
+#ifndef _Standard_HeaderFile
+#include <Standard.hxx>
+#endif
+#ifndef _Standard_Macro_HeaderFile
+#include <Standard_Macro.hxx>
+#endif
+
+class GEOMAlgo_WireSolid : public GEOMAlgo_ShapeSolid {
+
+public:
+
+ void* operator new(size_t,void* anAddress)
+ {
+ return anAddress;
+ }
+ void* operator new(size_t size)
+ {
+ return Standard::Allocate(size);
+ }
+ void operator delete(void *anAddress)
+ {
+ if (anAddress) Standard::Free((Standard_Address&)anAddress);
+ }
+ // Methods PUBLIC
+ //
+Standard_EXPORT GEOMAlgo_WireSolid();
+Standard_EXPORT virtual ~GEOMAlgo_WireSolid();
+Standard_EXPORT virtual void Perform() ;
+
+
+
+
+
+protected:
+
+ // Methods PROTECTED
+ //
+Standard_EXPORT virtual void Prepare() ;
+Standard_EXPORT virtual void BuildResult() ;
+
+
+ // Fields PROTECTED
+ //
+
+
+private:
+
+ // Methods PRIVATE
+ //
+
+
+ // Fields PRIVATE
+ //
+
+
+};
+
+
+
+
+
+// other Inline functions and methods (like "C++: function call" methods)
+//
+
+
+#endif
--- /dev/null
+// File generated by CPPExt (Value)
+//
+// Copyright (C) 1991 - 2000 by
+// Matra Datavision SA. All rights reserved.
+//
+// Copyright (C) 2001 - 2004 by
+// Open CASCADE SA. All rights reserved.
+//
+// This file is part of the Open CASCADE Technology software.
+//
+// This software may be distributed and/or modified under the terms and
+// conditions of the Open CASCADE Public License as defined by Open CASCADE SA
+// and appearing in the file LICENSE included in the packaging of this file.
+//
+// This software is distributed on an "AS IS" basis, without warranty of any
+// kind, and Open CASCADE SA hereby disclaims all such warranties,
+// including without limitation, any warranties of merchantability, fitness
+// for a particular purpose or non-infringement. Please see the License for
+// the specific terms and conditions governing rights and limitations under the
+// License.
+
+#include <GEOMAlgo_WireSolid.jxx>
+
+
+
+
--- /dev/null
+#ifndef _GEOMAlgo_WireSolid_HeaderFile
+#include <GEOMAlgo_WireSolid.hxx>
+#endif
--- /dev/null
+// File generated by CPPExt (Transient)
+//
+// Copyright (C) 1991 - 2000 by
+// Matra Datavision SA. All rights reserved.
+//
+// Copyright (C) 2001 - 2004 by
+// Open CASCADE SA. All rights reserved.
+//
+// This file is part of the Open CASCADE Technology software.
+//
+// This software may be distributed and/or modified under the terms and
+// conditions of the Open CASCADE Public License as defined by Open CASCADE SA
+// and appearing in the file LICENSE included in the packaging of this file.
+//
+// This software is distributed on an "AS IS" basis, without warranty of any
+// kind, and Open CASCADE SA hereby disclaims all such warranties,
+// including without limitation, any warranties of merchantability, fitness
+// for a particular purpose or non-infringement. Please see the License for
+// the specific terms and conditions governing rights and limitations under the
+// License.
+
+#ifndef _Handle_BlockFix_BlockFixAPI_HeaderFile
+#define _Handle_BlockFix_BlockFixAPI_HeaderFile
+
+#ifndef _Standard_Macro_HeaderFile
+#include <Standard_Macro.hxx>
+#endif
+#ifndef _Standard_HeaderFile
+#include <Standard.hxx>
+#endif
+
+#ifndef _Handle_MMgt_TShared_HeaderFile
+#include <Handle_MMgt_TShared.hxx>
+#endif
+
+class Standard_Transient;
+class Handle_Standard_Type;
+class Handle(MMgt_TShared);
+class BlockFix_BlockFixAPI;
+Standard_EXPORT Handle_Standard_Type& STANDARD_TYPE(BlockFix_BlockFixAPI);
+
+class Handle(BlockFix_BlockFixAPI) : public Handle(MMgt_TShared) {
+ public:
+ void* operator new(size_t,void* anAddress)
+ {
+ return anAddress;
+ }
+ void* operator new(size_t size)
+ {
+ return Standard::Allocate(size);
+ }
+ void operator delete(void *anAddress)
+ {
+ if (anAddress) Standard::Free((Standard_Address&)anAddress);
+ }
+ Handle(BlockFix_BlockFixAPI)():Handle(MMgt_TShared)() {}
+ Handle(BlockFix_BlockFixAPI)(const Handle(BlockFix_BlockFixAPI)& aHandle) : Handle(MMgt_TShared)(aHandle)
+ {
+ }
+
+ Handle(BlockFix_BlockFixAPI)(const BlockFix_BlockFixAPI* anItem) : Handle(MMgt_TShared)((MMgt_TShared *)anItem)
+ {
+ }
+
+ Handle(BlockFix_BlockFixAPI)& operator=(const Handle(BlockFix_BlockFixAPI)& aHandle)
+ {
+ Assign(aHandle.Access());
+ return *this;
+ }
+
+ Handle(BlockFix_BlockFixAPI)& operator=(const BlockFix_BlockFixAPI* anItem)
+ {
+ Assign((Standard_Transient *)anItem);
+ return *this;
+ }
+
+ BlockFix_BlockFixAPI* operator->()
+ {
+ return (BlockFix_BlockFixAPI *)ControlAccess();
+ }
+
+ BlockFix_BlockFixAPI* operator->() const
+ {
+ return (BlockFix_BlockFixAPI *)ControlAccess();
+ }
+
+ Standard_EXPORT ~Handle(BlockFix_BlockFixAPI)();
+
+ Standard_EXPORT static const Handle(BlockFix_BlockFixAPI) DownCast(const Handle(Standard_Transient)& AnObject);
+};
+#endif
--- /dev/null
+// File generated by CPPExt (Transient)
+//
+// Copyright (C) 1991 - 2000 by
+// Matra Datavision SA. All rights reserved.
+//
+// Copyright (C) 2001 - 2004 by
+// Open CASCADE SA. All rights reserved.
+//
+// This file is part of the Open CASCADE Technology software.
+//
+// This software may be distributed and/or modified under the terms and
+// conditions of the Open CASCADE Public License as defined by Open CASCADE SA
+// and appearing in the file LICENSE included in the packaging of this file.
+//
+// This software is distributed on an "AS IS" basis, without warranty of any
+// kind, and Open CASCADE SA hereby disclaims all such warranties,
+// including without limitation, any warranties of merchantability, fitness
+// for a particular purpose or non-infringement. Please see the License for
+// the specific terms and conditions governing rights and limitations under the
+// License.
+
+#ifndef _Handle_BlockFix_PeriodicSurfaceModifier_HeaderFile
+#define _Handle_BlockFix_PeriodicSurfaceModifier_HeaderFile
+
+#ifndef _Standard_Macro_HeaderFile
+#include <Standard_Macro.hxx>
+#endif
+#ifndef _Standard_HeaderFile
+#include <Standard.hxx>
+#endif
+
+#ifndef _Handle_BRepTools_Modification_HeaderFile
+#include <Handle_BRepTools_Modification.hxx>
+#endif
+
+class Standard_Transient;
+class Handle_Standard_Type;
+class Handle(BRepTools_Modification);
+class BlockFix_PeriodicSurfaceModifier;
+Standard_EXPORT Handle_Standard_Type& STANDARD_TYPE(BlockFix_PeriodicSurfaceModifier);
+
+class Handle(BlockFix_PeriodicSurfaceModifier) : public Handle(BRepTools_Modification) {
+ public:
+ void* operator new(size_t,void* anAddress)
+ {
+ return anAddress;
+ }
+ void* operator new(size_t size)
+ {
+ return Standard::Allocate(size);
+ }
+ void operator delete(void *anAddress)
+ {
+ if (anAddress) Standard::Free((Standard_Address&)anAddress);
+ }
+ Handle(BlockFix_PeriodicSurfaceModifier)():Handle(BRepTools_Modification)() {}
+ Handle(BlockFix_PeriodicSurfaceModifier)(const Handle(BlockFix_PeriodicSurfaceModifier)& aHandle) : Handle(BRepTools_Modification)(aHandle)
+ {
+ }
+
+ Handle(BlockFix_PeriodicSurfaceModifier)(const BlockFix_PeriodicSurfaceModifier* anItem) : Handle(BRepTools_Modification)((BRepTools_Modification *)anItem)
+ {
+ }
+
+ Handle(BlockFix_PeriodicSurfaceModifier)& operator=(const Handle(BlockFix_PeriodicSurfaceModifier)& aHandle)
+ {
+ Assign(aHandle.Access());
+ return *this;
+ }
+
+ Handle(BlockFix_PeriodicSurfaceModifier)& operator=(const BlockFix_PeriodicSurfaceModifier* anItem)
+ {
+ Assign((Standard_Transient *)anItem);
+ return *this;
+ }
+
+ BlockFix_PeriodicSurfaceModifier* operator->()
+ {
+ return (BlockFix_PeriodicSurfaceModifier *)ControlAccess();
+ }
+
+ BlockFix_PeriodicSurfaceModifier* operator->() const
+ {
+ return (BlockFix_PeriodicSurfaceModifier *)ControlAccess();
+ }
+
+ Standard_EXPORT ~Handle(BlockFix_PeriodicSurfaceModifier)();
+
+ Standard_EXPORT static const Handle(BlockFix_PeriodicSurfaceModifier) DownCast(const Handle(Standard_Transient)& AnObject);
+};
+#endif
--- /dev/null
+// File generated by CPPExt (Transient)
+//
+// Copyright (C) 1991 - 2000 by
+// Matra Datavision SA. All rights reserved.
+//
+// Copyright (C) 2001 - 2004 by
+// Open CASCADE SA. All rights reserved.
+//
+// This file is part of the Open CASCADE Technology software.
+//
+// This software may be distributed and/or modified under the terms and
+// conditions of the Open CASCADE Public License as defined by Open CASCADE SA
+// and appearing in the file LICENSE included in the packaging of this file.
+//
+// This software is distributed on an "AS IS" basis, without warranty of any
+// kind, and Open CASCADE SA hereby disclaims all such warranties,
+// including without limitation, any warranties of merchantability, fitness
+// for a particular purpose or non-infringement. Please see the License for
+// the specific terms and conditions governing rights and limitations under the
+// License.
+
+#ifndef _Handle_BlockFix_SphereSpaceModifier_HeaderFile
+#define _Handle_BlockFix_SphereSpaceModifier_HeaderFile
+
+#ifndef _Standard_Macro_HeaderFile
+#include <Standard_Macro.hxx>
+#endif
+#ifndef _Standard_HeaderFile
+#include <Standard.hxx>
+#endif
+
+#ifndef _Handle_BRepTools_Modification_HeaderFile
+#include <Handle_BRepTools_Modification.hxx>
+#endif
+
+class Standard_Transient;
+class Handle_Standard_Type;
+class Handle(BRepTools_Modification);
+class BlockFix_SphereSpaceModifier;
+Standard_EXPORT Handle_Standard_Type& STANDARD_TYPE(BlockFix_SphereSpaceModifier);
+
+class Handle(BlockFix_SphereSpaceModifier) : public Handle(BRepTools_Modification) {
+ public:
+ void* operator new(size_t,void* anAddress)
+ {
+ return anAddress;
+ }
+ void* operator new(size_t size)
+ {
+ return Standard::Allocate(size);
+ }
+ void operator delete(void *anAddress)
+ {
+ if (anAddress) Standard::Free((Standard_Address&)anAddress);
+ }
+ Handle(BlockFix_SphereSpaceModifier)():Handle(BRepTools_Modification)() {}
+ Handle(BlockFix_SphereSpaceModifier)(const Handle(BlockFix_SphereSpaceModifier)& aHandle) : Handle(BRepTools_Modification)(aHandle)
+ {
+ }
+
+ Handle(BlockFix_SphereSpaceModifier)(const BlockFix_SphereSpaceModifier* anItem) : Handle(BRepTools_Modification)((BRepTools_Modification *)anItem)
+ {
+ }
+
+ Handle(BlockFix_SphereSpaceModifier)& operator=(const Handle(BlockFix_SphereSpaceModifier)& aHandle)
+ {
+ Assign(aHandle.Access());
+ return *this;
+ }
+
+ Handle(BlockFix_SphereSpaceModifier)& operator=(const BlockFix_SphereSpaceModifier* anItem)
+ {
+ Assign((Standard_Transient *)anItem);
+ return *this;
+ }
+
+ BlockFix_SphereSpaceModifier* operator->()
+ {
+ return (BlockFix_SphereSpaceModifier *)ControlAccess();
+ }
+
+ BlockFix_SphereSpaceModifier* operator->() const
+ {
+ return (BlockFix_SphereSpaceModifier *)ControlAccess();
+ }
+
+ Standard_EXPORT ~Handle(BlockFix_SphereSpaceModifier)();
+
+ Standard_EXPORT static const Handle(BlockFix_SphereSpaceModifier) DownCast(const Handle(Standard_Transient)& AnObject);
+};
+#endif
--- /dev/null
+// File generated by CPPExt (Transient)
+//
+// Copyright (C) 1991 - 2000 by
+// Matra Datavision SA. All rights reserved.
+//
+// Copyright (C) 2001 - 2004 by
+// Open CASCADE SA. All rights reserved.
+//
+// This file is part of the Open CASCADE Technology software.
+//
+// This software may be distributed and/or modified under the terms and
+// conditions of the Open CASCADE Public License as defined by Open CASCADE SA
+// and appearing in the file LICENSE included in the packaging of this file.
+//
+// This software is distributed on an "AS IS" basis, without warranty of any
+// kind, and Open CASCADE SA hereby disclaims all such warranties,
+// including without limitation, any warranties of merchantability, fitness
+// for a particular purpose or non-infringement. Please see the License for
+// the specific terms and conditions governing rights and limitations under the
+// License.
+
+#ifndef _Handle_GEOMAlgo_ListNodeOfListOfCoupleOfShapes_HeaderFile
+#define _Handle_GEOMAlgo_ListNodeOfListOfCoupleOfShapes_HeaderFile
+
+#ifndef _Standard_Macro_HeaderFile
+#include <Standard_Macro.hxx>
+#endif
+#ifndef _Standard_HeaderFile
+#include <Standard.hxx>
+#endif
+
+#ifndef _Handle_TCollection_MapNode_HeaderFile
+#include <Handle_TCollection_MapNode.hxx>
+#endif
+
+class Standard_Transient;
+class Handle_Standard_Type;
+class Handle(TCollection_MapNode);
+class GEOMAlgo_ListNodeOfListOfCoupleOfShapes;
+Standard_EXPORT Handle_Standard_Type& STANDARD_TYPE(GEOMAlgo_ListNodeOfListOfCoupleOfShapes);
+
+class Handle(GEOMAlgo_ListNodeOfListOfCoupleOfShapes) : public Handle(TCollection_MapNode) {
+ public:
+ void* operator new(size_t,void* anAddress)
+ {
+ return anAddress;
+ }
+ void* operator new(size_t size)
+ {
+ return Standard::Allocate(size);
+ }
+ void operator delete(void *anAddress)
+ {
+ if (anAddress) Standard::Free((Standard_Address&)anAddress);
+ }
+ Handle(GEOMAlgo_ListNodeOfListOfCoupleOfShapes)():Handle(TCollection_MapNode)() {}
+ Handle(GEOMAlgo_ListNodeOfListOfCoupleOfShapes)(const Handle(GEOMAlgo_ListNodeOfListOfCoupleOfShapes)& aHandle) : Handle(TCollection_MapNode)(aHandle)
+ {
+ }
+
+ Handle(GEOMAlgo_ListNodeOfListOfCoupleOfShapes)(const GEOMAlgo_ListNodeOfListOfCoupleOfShapes* anItem) : Handle(TCollection_MapNode)((TCollection_MapNode *)anItem)
+ {
+ }
+
+ Handle(GEOMAlgo_ListNodeOfListOfCoupleOfShapes)& operator=(const Handle(GEOMAlgo_ListNodeOfListOfCoupleOfShapes)& aHandle)
+ {
+ Assign(aHandle.Access());
+ return *this;
+ }
+
+ Handle(GEOMAlgo_ListNodeOfListOfCoupleOfShapes)& operator=(const GEOMAlgo_ListNodeOfListOfCoupleOfShapes* anItem)
+ {
+ Assign((Standard_Transient *)anItem);
+ return *this;
+ }
+
+ GEOMAlgo_ListNodeOfListOfCoupleOfShapes* operator->()
+ {
+ return (GEOMAlgo_ListNodeOfListOfCoupleOfShapes *)ControlAccess();
+ }
+
+ GEOMAlgo_ListNodeOfListOfCoupleOfShapes* operator->() const
+ {
+ return (GEOMAlgo_ListNodeOfListOfCoupleOfShapes *)ControlAccess();
+ }
+
+ Standard_EXPORT ~Handle(GEOMAlgo_ListNodeOfListOfCoupleOfShapes)();
+
+ Standard_EXPORT static const Handle(GEOMAlgo_ListNodeOfListOfCoupleOfShapes) DownCast(const Handle(Standard_Transient)& AnObject);
+};
+#endif
LIB = libGEOMAlgo.la
LIB_SRC = \
GEOMAlgo_Algo.cxx \
+ GEOMAlgo_CoupleOfShapes.cxx \
+ GEOMAlgo_GlueAnalyser.cxx \
GEOMAlgo_Gluer.cxx \
GEOMAlgo_IndexedDataMapNodeOfIndexedDataMapOfIntegerShape_0.cxx \
GEOMAlgo_IndexedDataMapNodeOfIndexedDataMapOfPassKeyListOfShape_0.cxx \
GEOMAlgo_IndexedDataMapOfIntegerShape_0.cxx \
GEOMAlgo_IndexedDataMapOfPassKeyListOfShape_0.cxx \
GEOMAlgo_IndexedDataMapOfShapeBox_0.cxx \
+ GEOMAlgo_ListIteratorOfListOfCoupleOfShapes_0.cxx \
+ GEOMAlgo_ListNodeOfListOfCoupleOfShapes_0.cxx \
+ GEOMAlgo_ListOfCoupleOfShapes_0.cxx \
GEOMAlgo_PassKey.cxx \
GEOMAlgo_PassKeyMapHasher.cxx \
GEOMAlgo_ShapeAlgo.cxx \
- GEOMAlgo_Tools.cxx
+ GEOMAlgo_Tools.cxx \
+ BlockFix.cxx \
+ BlockFix_BlockFixAPI.cxx \
+ BlockFix_CheckTool.cxx \
+ BlockFix_PeriodicSurfaceModifier.cxx \
+ BlockFix_SphereSpaceModifier.cxx \
+ BlockFix_UnionEdges.cxx \
+ BlockFix_UnionFaces.cxx \
+ GEOMAlgo_FinderShapeOn.cxx \
+ GEOMAlgo_ShapeSolid.cxx \
+ GEOMAlgo_ShellSolid.cxx \
+ GEOMAlgo_VertexSolid.cxx \
+ GEOMAlgo_WireSolid.cxx
LIB_CLIENT_IDL =
LIB_SERVER_IDL =
EXPORT_HEADERS = \
GEOMAlgo_Gluer.hxx \
GEOMAlgo_ShapeAlgo.hxx \
- GEOMAlgo_Algo.hxx
+ GEOMAlgo_Algo.hxx \
+ GEOMAlgo_GlueAnalyser.hxx \
+ GEOMAlgo_CoupleOfShapes.hxx \
+ GEOMAlgo_ListOfCoupleOfShapes.hxx \
+ GEOMAlgo_ListIteratorOfListOfCoupleOfShapes.hxx \
+ Handle_GEOMAlgo_ListNodeOfListOfCoupleOfShapes.hxx \
+ BlockFix_BlockFixAPI.hxx \
+ BlockFix_BlockFixAPI.lxx \
+ BlockFix_CheckTool.hxx \
+ Handle_BlockFix_BlockFixAPI.hxx \
+ GEOMAlgo_State.hxx \
+ GEOMAlgo_FinderShapeOn.hxx
# idl files
EXPORT_IDLS=
// Module : GEOM
// $Header$
+#include <strstream>
+
using namespace std;
+
#include "GEOM_Client.hxx"
#include <SALOMEconfig.h>
#include "OpUtil.hxx"
msgid "ICON_DLG_CHECKSHAPE"
msgstr "check.png"
+msgid "ICON_DLG_CHECK_COMPOUND_OF_BLOCKS"
+msgstr "check_blocks_compound.png"
+
#SupressFaceDlg
msgid "ICON_DLG_SUPRESS_FACE"
msgstr "supressface.png"
msgid "ICON_DLG_GLUE_FACES"
msgstr "glue.png"
+
+msgid "ICON_DLG_FREE_FACES"
+msgstr "free_faces.png"
+
+msgid "ICON_DLG_PROPAGATE"
+msgstr "propagate.png"
msgid "GEOM_CHECK_SHAPE"
msgstr "Check Shape"
+#Check Blocks Compound
+msgid "GEOM_CHECK_BLOCKS_COMPOUND"
+msgstr "Check Blocks Compound"
+
+#Check Blocks Compound Errors
+msgid "GEOM_CHECK_BLOCKS_COMPOUND_ERRORS"
+msgstr "Errors"
+
+#Check Blocks Compound Errors
+msgid "GEOM_CHECK_BLOCKS_COMPOUND_HAS_NO_ERRORS"
+msgstr "The Compound of Blocks has no errors"
+
+msgid "GEOM_CHECK_BLOCKS_COMPOUND_HAS_ERRORS"
+msgstr "The Compound of Blocks has errors"
+
+#Check Blocks Compound SubShapes
+msgid "GEOM_CHECK_BLOCKS_COMPOUND_SUBSHAPES"
+msgstr "Incriminated Sub-Shapes"
+
#Whatis
msgid "GEOM_WHATIS"
msgstr "Whatis"
msgid "GEOM_CHECK_TITLE"
msgstr "Check Shape Informations"
+#: MeasureGUI_CheckCompoundOfBlocks.cxx:61
+msgid "GEOM_CHECK_COMPOUND_BLOCKS_TITLE"
+msgstr "Check Blocks Compound"
+
#: GeometryGUI_CheckShape.cxx:83
msgid "GEOM_CHECK_INFOS"
msgstr "Object And Its Topological Informations"
msgid "GEOM_FREE_BOUNDARIES"
msgstr "Free boundaries"
+msgid "GEOM_FREE_FACES"
+msgstr "Free faces"
+
msgid "GEOM_BY_PARAMETER"
msgstr "By parameter"
msgid "GEOM_GLUE"
msgstr "Glue"
+msgid "GEOM_FREE_FACES_TITLE"
+msgstr "Free faces"
+
### New object names for RepairGUI ###
msgid "SEWING_NEW_OBJ_NAME"
msgstr "Sewing"
msgid "NON_GEOM_OBJECTS_SELECTED"
msgstr "There are objects selected which do not belong to %1 component."
+msgid "GEOM_PROPAGATE_TITLE"
+msgstr "Propagate"
+
+msgid "GEOM_PROPAGATE"
+msgstr "Propagate"
+
###
msgid "GEOM_CHECK_SHAPE"
msgstr "Check Shape"
+#Check Blocks Compound
+msgid "GEOM_CHECK_BLOCKS_COMPOUND"
+msgstr "Check Blocks Compound"
+
+#Check Blocks Compound Errors
+msgid "GEOM_CHECK_BLOCKS_COMPOUND_ERRORS"
+msgstr "Errors"
+
+#Check Blocks Compound Errors
+msgid "GEOM_CHECK_BLOCKS_COMPOUND_HAS_NO_ERRORS"
+msgstr "The Compound of Blocks has no errors"
+
+msgid "GEOM_CHECK_BLOCKS_COMPOUND_HAS_ERRORS"
+msgstr "The Compound of Blocks has errors"
+
+#Check Blocks Compound SubShapes
+msgid "GEOM_CHECK_BLOCKS_COMPOUND_SUBSHAPES"
+msgstr "Incriminated Sub-Shapes"
+
#Whatis
msgid "GEOM_WHATIS"
msgstr "Whatis"
msgid "GEOM_CHECK_TITLE"
msgstr "Check Shape"
+#: MeasureGUI_CheckCompoundOfBlocks.cxx:61
+msgid "GEOM_CHECK_COMPOUND_BLOCKS_TITLE"
+msgstr "Check Blocks Compound"
+
#: GeometryGUI_CheckShape.cxx:83
msgid "GEOM_CHECK_INFOS"
msgstr "Objet et ses Informations Topologiques"
#MZN: to be translated
msgid "GEOM_CREATE_SINGLE_SOLID"
msgstr "Create a single solid"
+
+msgid "GEOM_FREE_FACES"
+msgstr "Free faces"
+
+msgid "GEOM_FREE_FACES_TITLE"
+msgstr "Free faces"
+
+msgid "GEOM_PROPAGATE_TITLE"
+msgstr "Propagate"
+
+msgid "GEOM_PROPAGATE"
+msgstr "Propagate"
theCommandID == 607 || // MENU REPAIR - REMOVE INTERNAL WIRES
theCommandID == 608 || // MENU REPAIR - ADD POINT ON EDGE
theCommandID == 609 || // MENU REPAIR - FREE BOUNDARIES
+ theCommandID == 610 || // MENU REPAIR - FREE FACES
theCommandID == 602 ) { // MENU REPAIR - GLUE FACES
library = geomGUI->getLibrary( "libRepairGUI.so" );
}
- else if( theCommandID == 701 || // MENU MEASURE - PROPERTIES
- theCommandID == 702 || // MENU MEASURE - CDG
- theCommandID == 703 || // MENU MEASURE - INERTIA
- theCommandID == 7041 || // MENU MEASURE - BOUNDING BOX
- theCommandID == 7042 || // MENU MEASURE - MIN DISTANCE
- theCommandID == 705 || // MENU MEASURE - TOLERANCE
- theCommandID == 706 || // MENU MEASURE - WHATIS
- theCommandID == 707 || // MENU MEASURE - CHECK
+ else if( theCommandID == 701 || // MENU MEASURE - PROPERTIES
+ theCommandID == 702 || // MENU MEASURE - CDG
+ theCommandID == 703 || // MENU MEASURE - INERTIA
+ theCommandID == 7041 || // MENU MEASURE - BOUNDING BOX
+ theCommandID == 7042 || // MENU MEASURE - MIN DISTANCE
+ theCommandID == 705 || // MENU MEASURE - TOLERANCE
+ theCommandID == 706 || // MENU MEASURE - WHATIS
+ theCommandID == 707 || // MENU MEASURE - CHECK
+ theCommandID == 7072 || // MENU MEASURE - CHECK COMPOUND OF BLOCKS
theCommandID == 708 ) { // MENU MEASURE - POINT COORDINATES
library = geomGUI->getLibrary( "libMeasureGUI.so" );
}
theCommandID == 801 ) { // MENU GROUP - EDIT
library = geomGUI->getLibrary( "libGroupGUI.so" );
}
- else if( theCommandID == 9999 || // MENU BLOCKS - HEXAHEDRAL SOLID
- theCommandID == 9998 || // MENU BLOCKS - MULTI-TRANSFORMATION
- theCommandID == 9997 || // MENU BLOCKS - QUADRANGLE FACE
+ else if( theCommandID == 9999 || // MENU BLOCKS - HEXAHEDRAL SOLID
+ theCommandID == 9998 || // MENU BLOCKS - MULTI-TRANSFORMATION
+ theCommandID == 9997 || // MENU BLOCKS - QUADRANGLE FACE
+ theCommandID == 99991 || // MENU BLOCKS - PROPAGATE
theCommandID == 9995 ) { // MENU BLOCKS - EXPLODE ON BLOCKS
library = geomGUI->getLibrary( "libBlocksGUI.so" );
}
#include "GEOMImpl_Types.hxx"
#include "GEOMImpl_ILocalOperations.hxx"
#include "GEOMImpl_Block6Explorer.hxx"
+#include "GEOMImpl_IBlocksOperations.hxx"
+
#include "GEOM_Function.hxx"
#include "ShHealOper_Sewing.hxx"
#include "NMTAlgo_Splitter1.hxx"
+#include "BlockFix_BlockFixAPI.hxx"
+
+#include "utilities.h"
#include <TNaming_CopyShape.hxx>
} else {
}
- } else { // Multi-transformations
+ } else { // Multi-transformations and compound improving
- TopoDS_Shape aMulti;
- GEOMImpl_IBlockTrsf aCI (aFunction);
- Handle(GEOM_Function) aRefShape = aCI.GetOriginal();
- TopoDS_Shape aBlockIni = aRefShape->GetValue();
- if (aBlockIni.IsNull()) {
- Standard_NullObject::Raise("Null Block");
- }
+ if (aType == BLOCK_REMOVE_EXTRA ||
+ aType == BLOCK_COMPOUND_IMPROVE) {
+
+ GEOMImpl_IBlockTrsf aCI (aFunction);
+ Handle(GEOM_Function) aRefShape = aCI.GetOriginal();
+ TopoDS_Shape aBlockOrComp = aRefShape->GetValue();
+ if (aBlockOrComp.IsNull()) {
+ Standard_NullObject::Raise("Null Shape given");
+ }
+
+ // 1. Improve solids with seam and/or degenerated edges
+ BlockFix_BlockFixAPI aTool;
+ //aTool.Tolerance() = toler;
+ aTool.SetShape(aBlockOrComp);
+ aTool.Perform();
+
+ if (aType == BLOCK_REMOVE_EXTRA) {
+
+ aShape = aTool.Shape();
+ if (aShape == aBlockOrComp) {
+ MESSAGE("No modifications have been done");
+ }
+
+ } else { // aType == BLOCK_COMPOUND_IMPROVE
+
+ TopoDS_Shape aFixedExtra = aTool.Shape();
+
+ // 2. Separate non-blocks
+ TopTools_ListOfShape BLO; // All blocks from the given compound
+ TopTools_ListOfShape NOT; // Not blocks
+ TopTools_ListOfShape EXT; // Hexahedral solids, having degenerated and/or seam edges
+ GEOMImpl_IBlocksOperations::AddBlocksFrom(aFixedExtra, BLO, NOT, EXT);
- // Copy block to avoid problems (PAL6706)
- TColStd_IndexedDataMapOfTransientTransient aMap;
- TopoDS_Shape aBlock;
- TNaming_CopyShape::CopyTool(aBlockIni, aMap, aBlock);
+ if (NOT.Extent() > 0) {
+ MESSAGE("Some non-blocks have been removed");
+ }
+
+ // 3. Warn about staying extra-edges
+ if (EXT.Extent() > 0) {
+ MESSAGE("Warning: Not all seam or degenerated edges was removed");
+ }
+
+ // ??? Throw away standalone blocks ???
+
+ // 4. Create compound of all blocks
+ TopoDS_Compound aComp;
+ BRep_Builder BB;
+ BB.MakeCompound(aComp);
+ TopTools_ListIteratorOfListOfShape BLOit (BLO);
+ for (; BLOit.More(); BLOit.Next()) {
+ BB.Add(aComp, BLOit.Value());
+ }
- // Block tolerance in vertices
- Standard_Real aTol = prec;
- TopExp_Explorer expV (aBlock, TopAbs_VERTEX);
- TopTools_MapOfShape mapShape;
- for (; expV.More(); expV.Next()) {
- if (mapShape.Add(expV.Current())) {
- TopoDS_Vertex aV = TopoDS::Vertex(expV.Current());
- aTol = Max(BRep_Tool::Tolerance(aV), aTol);
+ // 5. Glue Faces
+ aShape = GEOMImpl_GlueDriver::GlueFaces(aComp, Precision::Confusion());
}
- }
- if (aType == BLOCK_MULTI_TRANSFORM_1D) {
- // Retrieve a faces by Ids
- Standard_Integer aFace1Id = aCI.GetFace1U();
- Standard_Integer aFace2Id = aCI.GetFace2U();
- TopoDS_Shape aFace1, aFace2;
- if (!GEOMImpl_ILocalOperations::GetSubShape(aBlock, aFace1Id, aFace1)) {
- Standard_NullObject::Raise("Can not retrieve a sub-shape with given Id");
+ } else if (aType == BLOCK_MULTI_TRANSFORM_1D ||
+ aType == BLOCK_MULTI_TRANSFORM_2D) {
+
+ TopoDS_Shape aMulti;
+ GEOMImpl_IBlockTrsf aCI (aFunction);
+ Handle(GEOM_Function) aRefShape = aCI.GetOriginal();
+ TopoDS_Shape aBlockIni = aRefShape->GetValue();
+ if (aBlockIni.IsNull()) {
+ Standard_NullObject::Raise("Null Block");
}
- if (aFace1.ShapeType() != TopAbs_FACE) {
- Standard_TypeMismatch::Raise("Sub-shape with given Id is not a face");
+
+ // Copy block to avoid problems (PAL6706)
+ TColStd_IndexedDataMapOfTransientTransient aMap;
+ TopoDS_Shape aBlock;
+ TNaming_CopyShape::CopyTool(aBlockIni, aMap, aBlock);
+
+ // Block tolerance in vertices
+ Standard_Real aTol = prec;
+ TopExp_Explorer expV (aBlock, TopAbs_VERTEX);
+ TopTools_MapOfShape mapShape;
+ for (; expV.More(); expV.Next()) {
+ if (mapShape.Add(expV.Current())) {
+ TopoDS_Vertex aV = TopoDS::Vertex(expV.Current());
+ aTol = Max(BRep_Tool::Tolerance(aV), aTol);
+ }
}
- if (aFace2Id > 0) {
- if (!GEOMImpl_ILocalOperations::GetSubShape(aBlock, aFace2Id, aFace2)) {
+ if (aType == BLOCK_MULTI_TRANSFORM_1D) {
+ // Retrieve a faces by Ids
+ Standard_Integer aFace1Id = aCI.GetFace1U();
+ Standard_Integer aFace2Id = aCI.GetFace2U();
+ TopoDS_Shape aFace1, aFace2;
+ if (!GEOMImpl_ILocalOperations::GetSubShape(aBlock, aFace1Id, aFace1)) {
Standard_NullObject::Raise("Can not retrieve a sub-shape with given Id");
}
- if (aFace2.ShapeType() != TopAbs_FACE) {
+ if (aFace1.ShapeType() != TopAbs_FACE) {
Standard_TypeMismatch::Raise("Sub-shape with given Id is not a face");
}
- }
-
- Standard_Integer aNbIter = aCI.GetNbIterU();
- MultiTransformate1D(aBlock, aFace1, aFace2, aNbIter, aMulti);
+ if (aFace2Id > 0) {
+ if (!GEOMImpl_ILocalOperations::GetSubShape(aBlock, aFace2Id, aFace2)) {
+ Standard_NullObject::Raise("Can not retrieve a sub-shape with given Id");
+ }
+ if (aFace2.ShapeType() != TopAbs_FACE) {
+ Standard_TypeMismatch::Raise("Sub-shape with given Id is not a face");
+ }
+ }
- } else if (aType == BLOCK_MULTI_TRANSFORM_2D) {
- // Retrieve a faces by Ids
- Standard_Integer aFace1UId = aCI.GetFace1U();
- Standard_Integer aFace2UId = aCI.GetFace2U();
- Standard_Integer aFace1VId = aCI.GetFace1V();
- Standard_Integer aFace2VId = aCI.GetFace2V();
+ Standard_Integer aNbIter = aCI.GetNbIterU();
- TopoDS_Shape aFace1U, aFace2U, aFace1V, aFace2V;
- if (!GEOMImpl_ILocalOperations::GetSubShape(aBlock, aFace1UId, aFace1U) ||
- !GEOMImpl_ILocalOperations::GetSubShape(aBlock, aFace1VId, aFace1V)) {
- Standard_NullObject::Raise("Can not retrieve a sub-shape with given Id");
- }
+ MultiTransformate1D(aBlock, aFace1, aFace2, aNbIter, aMulti);
- if (aFace1U.ShapeType() != TopAbs_FACE ||
- aFace1V.ShapeType() != TopAbs_FACE) {
- Standard_TypeMismatch::Raise("Sub-shape with given Id is not a face");
- }
+ } else { // aType == BLOCK_MULTI_TRANSFORM_2D
+ // Retrieve a faces by Ids
+ Standard_Integer aFace1UId = aCI.GetFace1U();
+ Standard_Integer aFace2UId = aCI.GetFace2U();
+ Standard_Integer aFace1VId = aCI.GetFace1V();
+ Standard_Integer aFace2VId = aCI.GetFace2V();
- if (aFace2UId > 0) {
- if (!GEOMImpl_ILocalOperations::GetSubShape(aBlock, aFace2UId, aFace2U)) {
+ TopoDS_Shape aFace1U, aFace2U, aFace1V, aFace2V;
+ if (!GEOMImpl_ILocalOperations::GetSubShape(aBlock, aFace1UId, aFace1U) ||
+ !GEOMImpl_ILocalOperations::GetSubShape(aBlock, aFace1VId, aFace1V)) {
Standard_NullObject::Raise("Can not retrieve a sub-shape with given Id");
}
- if (aFace2U.ShapeType() != TopAbs_FACE) {
+ if (aFace1U.ShapeType() != TopAbs_FACE ||
+ aFace1V.ShapeType() != TopAbs_FACE) {
Standard_TypeMismatch::Raise("Sub-shape with given Id is not a face");
}
- }
- if (aFace2VId > 0) {
- if (!GEOMImpl_ILocalOperations::GetSubShape(aBlock, aFace2VId, aFace2V)) {
- Standard_NullObject::Raise("Can not retrieve a sub-shape with given Id");
+ if (aFace2UId > 0) {
+ if (!GEOMImpl_ILocalOperations::GetSubShape(aBlock, aFace2UId, aFace2U)) {
+ Standard_NullObject::Raise("Can not retrieve a sub-shape with given Id");
+ }
+
+ if (aFace2U.ShapeType() != TopAbs_FACE) {
+ Standard_TypeMismatch::Raise("Sub-shape with given Id is not a face");
+ }
}
- if (aFace2V.ShapeType() != TopAbs_FACE) {
- Standard_TypeMismatch::Raise("Sub-shape with given Id is not a face");
+ if (aFace2VId > 0) {
+ if (!GEOMImpl_ILocalOperations::GetSubShape(aBlock, aFace2VId, aFace2V)) {
+ Standard_NullObject::Raise("Can not retrieve a sub-shape with given Id");
+ }
+
+ if (aFace2V.ShapeType() != TopAbs_FACE) {
+ Standard_TypeMismatch::Raise("Sub-shape with given Id is not a face");
+ }
}
- }
- Standard_Integer aNbIterU = aCI.GetNbIterU();
- Standard_Integer aNbIterV = aCI.GetNbIterV();
+ Standard_Integer aNbIterU = aCI.GetNbIterU();
+ Standard_Integer aNbIterV = aCI.GetNbIterV();
+
+ MultiTransformate2D(aBlock,
+ aFace1U, aFace2U, aNbIterU,
+ aFace1V, aFace2V, aNbIterV, aMulti);
+ }
- MultiTransformate2D(aBlock,
- aFace1U, aFace2U, aNbIterU,
- aFace1V, aFace2V, aNbIterV, aMulti);
+ if (aMulti.IsNull()) {
+ StdFail_NotDone::Raise("Multi-transformation failed");
+ }
- } else {
- return 0;
- }
+ // Glue faces of the multi-block
+ aShape = GEOMImpl_GlueDriver::GlueFaces(aMulti, aTol);
- if (aMulti.IsNull()) {
- StdFail_NotDone::Raise("Multi-transformation failed");
+ } else { // unknown function type
return 0;
}
-
- // Glue faces of the multi-block
- aShape = GEOMImpl_GlueDriver::GlueFaces(aMulti, aTol);
}
if (aShape.IsNull()) return 0;
#include <TopoDS_Shape.hxx>
#include <Standard_NullObject.hxx>
+#include <Standard_Failure.hxx>
//=======================================================================
//function : GEOMImpl_GlueDriver
return aGlueDriver;
}
+//=======================================================================
+//function : GlueFacesWithWarnings
+//purpose :
+//=======================================================================
+TopoDS_Shape GEOMImpl_GlueDriver::GlueFacesWithWarnings (const TopoDS_Shape& theShape,
+ const Standard_Real theTolerance,
+ TCollection_AsciiString& theWarning) const
+{
+ Standard_Integer iErr, iWrn;
+ TopoDS_Shape aRes;
+ GEOMAlgo_Gluer aGluer;
+
+ aGluer.SetShape(theShape);
+ aGluer.SetTolerance(theTolerance);
+ aGluer.SetCheckGeometry(Standard_True);
+
+ aGluer.Perform();
+
+ iErr = aGluer.ErrorStatus();
+ if (iErr) {
+ switch (iErr) {
+ case 2:
+ Standard_Failure::Raise("No vertices found in source shape");
+ break;
+ case 5:
+ Standard_Failure::Raise("Source shape is Null");
+ break;
+ case 6:
+ Standard_Failure::Raise("Result shape is Null");
+ break;
+ case 200:
+ Standard_Failure::Raise("Error occured during check of geometric coincidence");
+ break;
+ default:
+ {
+ // description of all errors see in GEOMAlgo_Gluer.cxx
+ TCollection_AsciiString aMsg ("Error in GEOMAlgo_Gluer with code ");
+ aMsg += TCollection_AsciiString(iErr);
+ Standard_Failure::Raise(aMsg.ToCString());
+ break;
+ }
+ }
+ return aRes;
+ }
+
+ iWrn = aGluer.WarningStatus();
+ if (iWrn) {
+ switch (iWrn) {
+ case 1:
+ {
+ Standard_Integer nbAlone = aGluer.AloneShapes();
+ theWarning = TCollection_AsciiString(nbAlone);
+ theWarning += " solid(s) can not be glued by faces";
+ }
+ break;
+ default:
+ // description of all warnings see in GEOMAlgo_Gluer.cxx
+ theWarning = "Warning in GEOMAlgo_Gluer with code ";
+ theWarning += TCollection_AsciiString(iWrn);
+ break;
+ }
+ }
+
+ aRes = aGluer.Result();
+
+ return aRes;
+}
+
//=======================================================================
//function : GlueFaces
//purpose :
Standard_Integer aType = aFunction->GetType();
TopoDS_Shape aShape;
+ TCollection_AsciiString aWrn;
if (aType == GLUE_FACES) {
Handle(GEOM_Function) aRefBase = aCI.GetBase();
}
Standard_Real tol3d = aCI.GetTolerance();
- aShape = GlueFaces(aShapeBase, tol3d);
+ aShape = GlueFacesWithWarnings(aShapeBase, tol3d, aWrn);
} else {
}
log.SetTouched(Label());
+ if (!aWrn.IsEmpty()) {
+ Standard_Failure::Raise(aWrn.ToCString());
+ }
+
return 1;
}
#include <Standard_CString.hxx>
#endif
#include <TopoDS_Shape.hxx>
+#include <TCollection_AsciiString.hxx>
class TColStd_SequenceOfExtendedString;
Standard_EXPORT static TopoDS_Shape GlueFaces (const TopoDS_Shape& theShape,
const Standard_Real theTolerance);
+Standard_EXPORT TopoDS_Shape GlueFacesWithWarnings (const TopoDS_Shape& theShape,
+ const Standard_Real theTolerance,
+ TCollection_AsciiString& theWarning) const;
+
// Type management
//
Standard_EXPORT friend Handle_Standard_Type& GEOMImpl_GlueDriver_Type_();
#include "GEOM_Function.hxx"
+#include "GEOMAlgo_GlueAnalyser.hxx"
+#include "GEOMAlgo_CoupleOfShapes.hxx"
+#include "GEOMAlgo_ListOfCoupleOfShapes.hxx"
+#include "GEOMAlgo_ListIteratorOfListOfCoupleOfShapes.hxx"
+#include "BlockFix_CheckTool.hxx"
+
#include "utilities.h"
#include "OpUtil.hxx"
#include "Utils_ExceptHandlers.hxx"
#include <TFunction_DriverTable.hxx>
#include <TFunction_Driver.hxx>
#include <TFunction_Logbook.hxx>
+#include <TDataStd_Integer.hxx>
#include <TDF_Tool.hxx>
#include <BRep_Tool.hxx>
+#include <BRep_Builder.hxx>
#include <BRepTools.hxx>
+#include <BRepTools_WireExplorer.hxx>
#include <BRepGProp.hxx>
#include <BRepBndLib.hxx>
#include <BRepAdaptor_Surface.hxx>
#include <TopoDS.hxx>
#include <TopoDS_Edge.hxx>
#include <TopoDS_Vertex.hxx>
+#include <TopoDS_Compound.hxx>
#include <TopoDS_Iterator.hxx>
#include <TopExp.hxx>
#include <TopExp_Explorer.hxx>
#include <TopTools_MapOfShape.hxx>
#include <TopTools_Array1OfShape.hxx>
#include <TopTools_IndexedMapOfShape.hxx>
+#include <TopTools_DataMapOfShapeInteger.hxx>
#include <TopTools_ListIteratorOfListOfShape.hxx>
#include <TopTools_IndexedDataMapOfShapeListOfShape.hxx>
+#include <TopTools_DataMapIteratorOfDataMapOfShapeInteger.hxx>
#include <Bnd_Box.hxx>
-#include <Precision.hxx>
#include <GProp_GProps.hxx>
+
+#include <Geom_Surface.hxx>
+#include <ShapeAnalysis_Surface.hxx>
+
#include <TColStd_MapOfInteger.hxx>
#include <TColStd_Array1OfReal.hxx>
#include <TColStd_Array1OfInteger.hxx>
#include <TColStd_Array2OfInteger.hxx>
+//#include <OSD_Timer.hxx>
+
+#include <Precision.hxx>
+
#include <Standard_ErrorHandler.hxx> // CAREFUL ! position of this file is critic : see Lucien PIGNOLONI / OCC
//=============================================================================
(Handle(GEOM_Object) theShape,
Handle(GEOM_Object) thePoint)
{
+// OSD_Timer timer1, timer2, timer3, timer4, timer5;
+// timer1.Start();
+
SetErrorCode(KO);
//New object
TopoDS_Vertex aVert = TopoDS::Vertex(anArg);
gp_Pnt aPnt = BRep_Tool::Pnt(aVert);
+ Standard_Real PX, PY, PZ;
+ aPnt.Coord(PX, PY, PZ);
- // 1. Explode blocks on faces
- TopTools_MapOfShape mapShape;
- Standard_Integer nbFaces = 0;
+// timer1.Stop();
+// timer2.Start();
+
+ // 1. Classify the point relatively each face
+ Standard_Integer nearest = 2, nbFound = 0;
+ TopTools_DataMapOfShapeInteger mapShapeDist;
TopExp_Explorer exp (aBlockOrComp, TopAbs_FACE);
for (; exp.More(); exp.Next()) {
- if (mapShape.Add(exp.Current())) {
- nbFaces++;
- }
- }
+ TopoDS_Shape aFace = exp.Current();
+
+ if (!mapShapeDist.IsBound(aFace)) {
+ Standard_Integer aDistance = 2;
+
+ // 1.a. Classify relatively Surface
+ Handle(Geom_Surface) aSurf = BRep_Tool::Surface(TopoDS::Face(aFace));
+ Handle(ShapeAnalysis_Surface) aSurfAna = new ShapeAnalysis_Surface (aSurf);
+ gp_Pnt2d p2dOnSurf = aSurfAna->ValueOfUV(aPnt, Precision::Confusion());
+ gp_Pnt p3dOnSurf = aSurfAna->Value(p2dOnSurf);
+ Standard_Real aDist = p3dOnSurf.Distance(aPnt);
+ if (aDist > Precision::Confusion()) {
+ // OUT of Surface
+ aDistance = 1;
+ } else {
+ // 1.b. Classify relatively the face itself
+ BRepClass_FaceClassifier FC (TopoDS::Face(aFace), p2dOnSurf, Precision::Confusion());
+ if (FC.State() == TopAbs_IN) {
+ aDistance = -1;
+ } else if (FC.State() == TopAbs_ON) {
+ aDistance = 0;
+ } else { // OUT
+ aDistance = 1;
+ }
+ }
- mapShape.Clear();
- Standard_Integer ind = 1;
- TopTools_Array1OfShape aFaces (1, nbFaces);
- TColStd_Array1OfInteger aDistances (1, nbFaces);
- for (exp.Init(aBlockOrComp, TopAbs_FACE); exp.More(); exp.Next()) {
- if (mapShape.Add(exp.Current())) {
- TopoDS_Shape aFace = exp.Current();
- aFaces(ind) = aFace;
-
- // 2. Classify the point relatively each face
- BRepClass_FaceClassifier FC (TopoDS::Face(aFace), aPnt, Precision::Confusion());
- if (FC.State() == TopAbs_IN) {
- aDistances(ind) = -1;
- } else if (FC.State() == TopAbs_ON) {
- aDistances(ind) = 0;
- } else { // OUT
- aDistances(ind) = 1;
+ if (aDistance < nearest) {
+ nearest = aDistance;
+ aShape = aFace;
+ nbFound = 1;
+
+ // A first found face, containing the point inside, will be returned.
+ // It is the solution, if there are no
+ // coincident or intersecting faces in the compound.
+ if (nearest == -1) break;
+
+ } else if (aDistance == nearest) {
+ nbFound++;
+ } else {
}
- ind++;
- }
- }
- // 3. Define face, containing the point or having minimum distance to it
- Standard_Integer nearest = 2, nbFound = 0;
- for (ind = 1; ind <= nbFaces; ind++) {
- if (aDistances(ind) < nearest) {
- nearest = aDistances(ind);
- aShape = aFaces(ind);
- nbFound = 1;
- } else if (aDistances(ind) == nearest) {
- nbFound++;
- } else {
- }
+ mapShapeDist.Bind(aFace, aDistance);
+ } // if (!mapShapeDist.IsBound(aFace))
}
+
+// timer2.Stop();
+// timer3.Start();
+
+ // 2. Define face, containing the point or having minimum distance to it
if (nbFound > 1) {
if (nearest == 0) {
// The point is on boundary of some faces and there are
// The point is outside some faces and there are
// no faces, having the point inside or on boundary.
// We will get a nearest face
- Standard_Real minDist = RealLast();
- for (ind = 1; ind <= nbFaces; ind++) {
- if (aDistances(ind) == 1) {
- BRepExtrema_DistShapeShape aDistTool (aVert, aFaces(ind));
- if (!aDistTool.IsDone()) {
- SetErrorCode("Can not find a distance from the given point to one of faces");
- return NULL;
+ Standard_Real bigReal = RealLast();
+ Standard_Real minDist = bigReal;
+ TopTools_DataMapIteratorOfDataMapOfShapeInteger mapShapeDistIter (mapShapeDist);
+ for (; mapShapeDistIter.More(); mapShapeDistIter.Next()) {
+ if (mapShapeDistIter.Value() == 1) {
+ TopoDS_Shape aFace = mapShapeDistIter.Key();
+ Standard_Real aDist = bigReal;
+
+ // 2.a. Fast check of distance - if point projection on surface is on face
+ Handle(Geom_Surface) aSurf = BRep_Tool::Surface(TopoDS::Face(aFace));
+ Handle(ShapeAnalysis_Surface) aSurfAna = new ShapeAnalysis_Surface (aSurf);
+ gp_Pnt2d p2dOnSurf = aSurfAna->ValueOfUV(aPnt, Precision::Confusion());
+ gp_Pnt p3dOnSurf = aSurfAna->Value(p2dOnSurf);
+ aDist = p3dOnSurf.Distance(aPnt);
+
+ BRepClass_FaceClassifier FC (TopoDS::Face(aFace), p2dOnSurf, Precision::Confusion());
+ if (FC.State() == TopAbs_OUT) {
+ if (aDist < minDist) {
+ // 2.b. Slow check - if point projection on surface is outside of face
+ BRepExtrema_DistShapeShape aDistTool (aVert, aFace);
+ if (!aDistTool.IsDone()) {
+ SetErrorCode("Can not find a distance from the given point to one of faces");
+ return NULL;
+ }
+ aDist = aDistTool.Value();
+ } else {
+ aDist = bigReal;
+ }
}
- Standard_Real aDist = aDistTool.Value();
- if (aDist < minDist) {
- minDist = aDist;
- aShape = aFaces(ind);
- }
- }
- }
- } else { // nearest == -1
- // The point is inside some faces.
- // We will get a face with nearest center
- Standard_Real minDist = RealLast();
- for (ind = 1; ind <= nbFaces; ind++) {
- if (aDistances(ind) == -1) {
- GProp_GProps aSystem;
- BRepGProp::SurfaceProperties(aFaces(ind), aSystem);
- gp_Pnt aCenterMass = aSystem.CentreOfMass();
- Standard_Real aDist = aCenterMass.Distance(aPnt);
if (aDist < minDist) {
minDist = aDist;
- aShape = aFaces(ind);
+ aShape = aFace;
}
}
}
+ } else { // nearest == -1
+// // The point is inside some faces.
+// // We will get a face with nearest center
+// Standard_Real minDist = RealLast();
+// TopTools_DataMapIteratorOfDataMapOfShapeInteger mapShapeDistIter (mapShapeDist);
+// for (; mapShapeDistIter.More(); mapShapeDistIter.Next()) {
+// if (mapShapeDistIter.Value() == -1) {
+// TopoDS_Shape aFace = mapShapeDistIter.Key();
+// GProp_GProps aSystem;
+// BRepGProp::SurfaceProperties(aFace, aSystem);
+// gp_Pnt aCenterMass = aSystem.CentreOfMass();
+//
+// Standard_Real aDist = aCenterMass.Distance(aPnt);
+// if (aDist < minDist) {
+// minDist = aDist;
+// aShape = aFace;
+// }
+// }
+// }
}
- }
+ } // if (nbFound > 1)
+
+// timer3.Stop();
+// timer4.Start();
if (nbFound == 0) {
SetErrorCode("There are no faces near the given point");
anArray->SetValue(1, anIndices.FindIndex(aShape));
aResult = GetEngine()->AddSubShape(theShape, anArray);
}
+
+// timer4.Stop();
}
catch (Standard_Failure) {
Handle(Standard_Failure) aFail = Standard_Failure::Caught();
return NULL;
}
+// timer5.Start();
+
//The GetFaceNearPoint() doesn't change object so no new function is required.
Handle(GEOM_Function) aFunction = theShape->GetLastFunction();
aFunction->SetDescription(aNewDescr);
SetErrorCode(OK);
+
+// timer5.Stop();
+//
+// cout << "Show current face times:" << endl;
+// timer1.Show();
+// timer2.Show();
+// timer3.Show();
+// timer4.Show();
+// timer5.Show();
+
return aResult;
}
* Set of functions, used by CheckCompoundOfBlocks() method
*/
//=============================================================================
-void AddBlocksFrom (const TopoDS_Shape& theShape,
- TopTools_ListOfShape& BLO,
- TopTools_ListOfShape& NOT)
+void GEOMImpl_IBlocksOperations::AddBlocksFrom (const TopoDS_Shape& theShape,
+ TopTools_ListOfShape& BLO,
+ TopTools_ListOfShape& NOT,
+ TopTools_ListOfShape& EXT)
+{
+ TopAbs_ShapeEnum aType = theShape.ShapeType();
+ switch (aType) {
+ case TopAbs_COMPOUND:
+ case TopAbs_COMPSOLID:
+ {
+ TopoDS_Iterator It (theShape);
+ for (; It.More(); It.Next()) {
+ AddBlocksFrom(It.Value(), BLO, NOT, EXT);
+ }
+ }
+ break;
+ case TopAbs_SOLID:
+ {
+ // Check, if there are seam or degenerated edges
+ BlockFix_CheckTool aTool;
+ aTool.SetShape(theShape);
+ aTool.Perform();
+ if (aTool.NbPossibleBlocks() > 0) {
+ EXT.Append(theShape);
+ } else {
+ // Count faces and edges in each face to recognize blocks
+ TopTools_MapOfShape mapFaces;
+ Standard_Integer nbFaces = 0;
+ Standard_Boolean hasNonQuadr = Standard_False;
+ TopExp_Explorer expF (theShape, TopAbs_FACE);
+
+ for (; expF.More(); expF.Next()) {
+ if (mapFaces.Add(expF.Current())) {
+ nbFaces++;
+ if (nbFaces > 6) break;
+
+ // get wire
+ TopoDS_Shape aF = expF.Current();
+ TopExp_Explorer wires (aF, TopAbs_WIRE);
+ if (!wires.More()) {
+ // no wire in the face
+ hasNonQuadr = Standard_True;
+ break;
+ }
+ TopoDS_Shape aWire = wires.Current();
+ wires.Next();
+ if (wires.More()) {
+ // multiple wires in the face
+ hasNonQuadr = Standard_True;
+ break;
+ }
+
+ // Check number of edges in the face
+ Standard_Integer nbEdges = 0;
+ TopTools_MapOfShape mapEdges;
+ TopExp_Explorer expW (aWire, TopAbs_EDGE);
+ for (; expW.More(); expW.Next()) {
+ if (mapEdges.Add(expW.Current())) {
+ nbEdges++;
+ if (nbEdges > 4) break;
+ }
+ }
+ if (nbEdges != 4) {
+ hasNonQuadr = Standard_True;
+ }
+ }
+ }
+
+ if (nbFaces == 6 && !hasNonQuadr) {
+ BLO.Append(theShape);
+ } else {
+ NOT.Append(theShape);
+ }
+ }
+ }
+ break;
+ default:
+ NOT.Append(theShape);
+ }
+}
+
+void AddBlocksFromOld (const TopoDS_Shape& theShape,
+ TopTools_ListOfShape& BLO,
+ TopTools_ListOfShape& NOT,
+ TopTools_ListOfShape& DEG,
+ TopTools_ListOfShape& SEA)
{
TopAbs_ShapeEnum aType = theShape.ShapeType();
switch (aType) {
{
TopoDS_Iterator It (theShape);
for (; It.More(); It.Next()) {
- AddBlocksFrom(It.Value(), BLO, NOT);
+ AddBlocksFromOld(It.Value(), BLO, NOT, DEG, SEA);
}
}
break;
TopTools_MapOfShape mapFaces;
TopExp_Explorer expF (theShape, TopAbs_FACE);
Standard_Integer nbFaces = 0;
- Standard_Integer nbEdges = 0;
+ Standard_Boolean hasNonQuadr = Standard_False;
+ Standard_Boolean hasDegenerated = Standard_False;
+ Standard_Boolean hasSeam = Standard_False;
for (; expF.More(); expF.Next()) {
if (mapFaces.Add(expF.Current())) {
nbFaces++;
if (nbFaces > 6) break;
// Check number of edges in the face
+ Standard_Integer nbEdges = 0;
+ TopTools_MapOfShape mapEdges;
+
+ // get wire
TopoDS_Shape aF = expF.Current();
- TopExp_Explorer expE (aF, TopAbs_EDGE);
- nbEdges = 0;
- for (; expE.More(); expE.Next()) {
- nbEdges++;
- if (nbEdges > 4) break;
+ TopExp_Explorer wires (aF, TopAbs_WIRE);
+ if (!wires.More()) {
+ // no wire in the face
+ hasNonQuadr = Standard_True;
+ break;
+ }
+ TopoDS_Shape aWire = wires.Current();
+ wires.Next();
+ if (wires.More()) {
+ // multiple wires in the face
+ hasNonQuadr = Standard_True;
+ break;
+ }
+
+ // iterate on wire
+ BRepTools_WireExplorer aWE (TopoDS::Wire(aWire), TopoDS::Face(aF));
+ for (; aWE.More(); aWE.Next(), nbEdges++) {
+ if (BRep_Tool::Degenerated(aWE.Current())) {
+ // degenerated edge found
+ hasDegenerated = Standard_True;
+// break;
+ }
+ if (mapEdges.Contains(aWE.Current())) {
+ // seam edge found
+ hasSeam = Standard_True;
+// break;
+ }
+ mapEdges.Add(aWE.Current());
+ }
+ if (nbEdges != 4) {
+ hasNonQuadr = Standard_True;
}
- if (nbEdges != 4) break;
}
}
- if (nbFaces == 6 && nbEdges == 4) {
- BLO.Append(theShape);
+ if (nbFaces == 6) {
+ if (hasDegenerated || hasSeam) {
+ if (hasDegenerated) {
+ DEG.Append(theShape);
+ }
+ if (hasSeam) {
+ SEA.Append(theShape);
+ }
+ } else if (hasNonQuadr) {
+ NOT.Append(theShape);
+ } else {
+ BLO.Append(theShape);
+ }
} else {
NOT.Append(theShape);
}
Bnd_Box B1, B2;
BRepBndLib::Add(theBlock1, B1);
BRepBndLib::Add(theBlock2, B2);
-// BRepBndLib::AddClose(theBlock1, B1);
-// BRepBndLib::AddClose(theBlock2, B2);
B1.Get(Xmin1, Ymin1, Zmin1, Xmax1, Ymax1, Zmax1);
B2.Get(Xmin2, Ymin2, Zmin2, Xmax2, Ymax2, Zmax2);
if (Xmax2 < Xmin1 || Xmax1 < Xmin2 ||
Ymax2 < Ymin1 || Ymax1 < Ymin2 ||
Zmax2 < Zmin1 || Zmax1 < Zmin2) {
-// Standard_Real prec = Precision::Confusion();
-// if (prec < Xmin1 - Xmax2 || prec < Xmin2 - Xmax1 ||
-// prec < Ymin1 - Ymax2 || prec < Ymin2 - Ymax1 ||
-// prec < Zmin1 - Zmax2 || prec < Zmin2 - Zmax1) {
return REL_NOT_CONNECTED;
}
- // to be done
BRepExtrema_DistShapeShape dst (theBlock1, theBlock2);
if (!dst.IsDone()) {
//=============================================================================
/*!
- * CheckCompoundOfBlocks
+ * CheckCompoundOfBlocksOld
*/
//=============================================================================
-Standard_Boolean GEOMImpl_IBlocksOperations::CheckCompoundOfBlocks
+Standard_Boolean GEOMImpl_IBlocksOperations::CheckCompoundOfBlocksOld
(Handle(GEOM_Object) theCompound,
list<BCError>& theErrors)
{
// 1. Report non-blocks
TopTools_ListOfShape NOT; // Not blocks
+ TopTools_ListOfShape DEG; // Hexahedral solids, having degenerated edges
+ TopTools_ListOfShape SEA; // Hexahedral solids, having seam edges
TopTools_ListOfShape BLO; // All blocks from the given compound
- AddBlocksFrom(aBlockOrComp, BLO, NOT);
+ AddBlocksFromOld(aBlockOrComp, BLO, NOT, DEG, SEA);
if (NOT.Extent() > 0) {
isCompOfBlocks = Standard_False;
BCError anErr;
anErr.error = NOT_BLOCK;
- TopTools_ListIteratorOfListOfShape NOTit (NOT);
- for (; NOTit.More(); NOTit.Next()) {
- anErr.incriminated.push_back(anIndices.FindIndex(NOTit.Value()));
+ TopTools_ListIteratorOfListOfShape it (NOT);
+ for (; it.More(); it.Next()) {
+ anErr.incriminated.push_back(anIndices.FindIndex(it.Value()));
}
theErrors.push_back(anErr);
}
+ if (DEG.Extent() > 0 || SEA.Extent() > 0) {
+ isCompOfBlocks = Standard_False;
+ BCError anErr;
+ anErr.error = EXTRA_EDGE;
+
+ TopTools_ListIteratorOfListOfShape itDEG (DEG);
+ for (; itDEG.More(); itDEG.Next()) {
+ anErr.incriminated.push_back(anIndices.FindIndex(itDEG.Value()));
+ }
+
+ TopTools_ListIteratorOfListOfShape itSEA (SEA);
+ for (; itSEA.More(); itSEA.Next()) {
+ anErr.incriminated.push_back(anIndices.FindIndex(itSEA.Value()));
+ }
+
+ theErrors.push_back(anErr);
+ }
+
Standard_Integer nbBlocks = BLO.Extent();
if (nbBlocks == 0) {
isCompOfBlocks = Standard_False;
TColStd_MapOfInteger aCurrentSet;
for (ibl = 1; ibl <= nbBlocks; ibl++) {
if (!aProcessedMap.Contains(ibl)) {
+ aCurrentSet.Clear();
FindConnected(ibl, aRelations, aProcessedMap, aCurrentSet);
if (aCurrentSet.Extent() > aLargestSet.Extent()) {
aLargestSet = aCurrentSet;
case NOT_BLOCK:
aDescr += "\nNot a Blocks: ";
break;
+ case EXTRA_EDGE:
+ aDescr += "\nHexahedral solids with degenerated and/or seam edges: ";
+ break;
case INVALID_CONNECTION:
aDescr += "\nInvalid connection between two blocks: ";
break;
return aDescr;
}
+//=============================================================================
+/*!
+ * CheckCompoundOfBlocks
+ */
+//=============================================================================
+Standard_Boolean GEOMImpl_IBlocksOperations::CheckCompoundOfBlocks
+ (Handle(GEOM_Object) theCompound,
+ list<BCError>& theErrors)
+{
+ SetErrorCode(KO);
+
+ if (theCompound.IsNull()) return Standard_False;
+ TopoDS_Shape aBlockOrComp = theCompound->GetValue();
+
+ Standard_Boolean isCompOfBlocks = Standard_True;
+
+ // Map sub-shapes and their indices
+ TopTools_IndexedMapOfShape anIndices;
+ TopExp::MapShapes(aBlockOrComp, anIndices);
+
+ // 1. Separate blocks from non-blocks
+ TopTools_ListOfShape NOT; // Not blocks
+ TopTools_ListOfShape EXT; // Hexahedral solids, having degenerated and/or seam edges
+ TopTools_ListOfShape BLO; // All blocks from the given compound
+ AddBlocksFrom(aBlockOrComp, BLO, NOT, EXT);
+
+ // Report non-blocks
+ if (NOT.Extent() > 0) {
+ isCompOfBlocks = Standard_False;
+ BCError anErr;
+ anErr.error = NOT_BLOCK;
+ TopTools_ListIteratorOfListOfShape it (NOT);
+ for (; it.More(); it.Next()) {
+ anErr.incriminated.push_back(anIndices.FindIndex(it.Value()));
+ }
+ theErrors.push_back(anErr);
+ }
+
+ // Report solids, having degenerated and/or seam edges
+ if (EXT.Extent() > 0) {
+ isCompOfBlocks = Standard_False;
+ BCError anErr;
+ anErr.error = EXTRA_EDGE;
+ TopTools_ListIteratorOfListOfShape it (EXT);
+ for (; it.More(); it.Next()) {
+ anErr.incriminated.push_back(anIndices.FindIndex(it.Value()));
+ }
+ theErrors.push_back(anErr);
+ }
+
+ Standard_Integer nbBlocks = BLO.Extent();
+ if (nbBlocks == 0) {
+ isCompOfBlocks = Standard_False;
+ SetErrorCode(OK);
+ return isCompOfBlocks;
+ }
+ if (nbBlocks == 1) {
+ SetErrorCode(OK);
+ return isCompOfBlocks;
+ }
+
+ // Prepare data for 2. and 3.
+ TColStd_Array2OfInteger aRelations (1, nbBlocks, 1, nbBlocks);
+ aRelations.Init(REL_NOT_CONNECTED);
+
+ TopTools_IndexedMapOfShape mapBlocks;
+
+ BRep_Builder BB;
+ TopoDS_Compound aComp;
+ BB.MakeCompound(aComp);
+
+ TopTools_ListIteratorOfListOfShape BLOit (BLO);
+ for (; BLOit.More(); BLOit.Next()) {
+ mapBlocks.Add(BLOit.Value());
+ BB.Add(aComp, BLOit.Value());
+ }
+
+ // 2. Find glued blocks (having shared faces)
+ TopTools_IndexedDataMapOfShapeListOfShape mapFaceBlocks;
+ GEOMImpl_Block6Explorer::MapShapesAndAncestors
+ (aComp, TopAbs_FACE, TopAbs_SOLID, mapFaceBlocks);
+
+ Standard_Integer prevInd = 0, curInd = 0;
+ Standard_Integer ind = 1, nbFaces = mapFaceBlocks.Extent();
+ for (; ind <= nbFaces; ind++) {
+ const TopTools_ListOfShape& aGluedBlocks = mapFaceBlocks.FindFromIndex(ind);
+ if (aGluedBlocks.Extent() > 1) { // Shared face found
+ TopTools_ListIteratorOfListOfShape aGluedBlocksIt (aGluedBlocks);
+ TopoDS_Shape prevBlock, curBlock;
+ for (; aGluedBlocksIt.More(); aGluedBlocksIt.Next()) {
+ curBlock = aGluedBlocksIt.Value();
+ if (!prevBlock.IsNull()) {
+ prevInd = mapBlocks.FindIndex(prevBlock);
+ curInd = mapBlocks.FindIndex(curBlock);
+ aRelations.SetValue(prevInd, curInd, REL_OK);
+ aRelations.SetValue(curInd, prevInd, REL_OK);
+ }
+ prevBlock = curBlock;
+ }
+ }
+ }
+
+ // 3. Find not glued blocks
+ GEOMAlgo_GlueAnalyser aGD;
+
+ aGD.SetShape(aComp);
+ aGD.SetTolerance(Precision::Confusion());
+ aGD.SetCheckGeometry(Standard_True);
+ aGD.Perform();
+
+ Standard_Integer iErr, iWrn;
+ iErr = aGD.ErrorStatus();
+ if (iErr) {
+ SetErrorCode("Error in GEOMAlgo_GlueAnalyser");
+ return isCompOfBlocks;
+ }
+ iWrn = aGD.WarningStatus();
+ if (iWrn) {
+ MESSAGE("Warning in GEOMAlgo_GlueAnalyser");
+ }
+
+ // Report not glued blocks
+ if (aGD.HasSolidsToGlue()) {
+ isCompOfBlocks = Standard_False;
+ Standard_Integer aSx1Ind, aSx2Ind;
+
+ const GEOMAlgo_ListOfCoupleOfShapes& aLCS = aGD.SolidsToGlue();
+ GEOMAlgo_ListIteratorOfListOfCoupleOfShapes aItCS (aLCS);
+ for (; aItCS.More(); aItCS.Next()) {
+ const GEOMAlgo_CoupleOfShapes& aCS = aItCS.Value();
+ const TopoDS_Shape& aSx1 = aCS.Shape1();
+ const TopoDS_Shape& aSx2 = aCS.Shape2();
+
+ aSx1Ind = mapBlocks.FindIndex(aSx1);
+ aSx2Ind = mapBlocks.FindIndex(aSx2);
+ aRelations.SetValue(aSx1Ind, aSx2Ind, NOT_GLUED);
+ aRelations.SetValue(aSx2Ind, aSx1Ind, NOT_GLUED);
+
+ BCError anErr;
+ anErr.error = NOT_GLUED;
+ anErr.incriminated.push_back(anIndices.FindIndex(aSx1));
+ anErr.incriminated.push_back(anIndices.FindIndex(aSx2));
+ theErrors.push_back(anErr);
+ }
+ }
+
+ // 4. Find largest set of connected (good connection or not glued) blocks
+ Standard_Integer ibl = 1;
+ TColStd_MapOfInteger aProcessedMap;
+ TColStd_MapOfInteger aLargestSet;
+ TColStd_MapOfInteger aCurrentSet;
+ for (ibl = 1; ibl <= nbBlocks; ibl++) {
+ if (!aProcessedMap.Contains(ibl)) {
+ aCurrentSet.Clear();
+ FindConnected(ibl, aRelations, aProcessedMap, aCurrentSet);
+ if (aCurrentSet.Extent() > aLargestSet.Extent()) {
+ aLargestSet = aCurrentSet;
+ }
+ }
+ }
+
+ // 5. Report all blocks, isolated from <aLargestSet>
+ BCError anErr;
+ anErr.error = NOT_CONNECTED;
+ Standard_Boolean hasIsolated = Standard_False;
+ for (ibl = 1; ibl <= nbBlocks; ibl++) {
+ if (!aLargestSet.Contains(ibl)) {
+ aProcessedMap.Clear();
+ if (!HasAnyConnection(ibl, aLargestSet, aRelations, aProcessedMap)) {
+ // report connection absence
+ hasIsolated = Standard_True;
+ anErr.incriminated.push_back(anIndices.FindIndex(mapBlocks.FindKey(ibl)));
+ }
+ }
+ }
+ if (hasIsolated) {
+ isCompOfBlocks = Standard_False;
+ theErrors.push_back(anErr);
+ }
+
+ SetErrorCode(OK);
+ return isCompOfBlocks;
+}
+
+//=============================================================================
+/*!
+ * RemoveExtraEdges
+ */
+//=============================================================================
+Handle(GEOM_Object) GEOMImpl_IBlocksOperations::RemoveExtraEdges
+ (Handle(GEOM_Object) theObject)
+{
+ SetErrorCode(KO);
+
+ if (theObject.IsNull()) return NULL;
+
+ Handle(GEOM_Function) aLastFunction = theObject->GetLastFunction();
+ if (aLastFunction.IsNull()) return NULL; //There is no function which creates an object to be fixed
+
+ //Add a new Copy object
+ Handle(GEOM_Object) aCopy = GetEngine()->AddObject(GetDocID(), GEOM_COPY);
+
+ //Add a function
+ Handle(GEOM_Function) aFunction =
+ aCopy->AddFunction(GEOMImpl_BlockDriver::GetID(), BLOCK_REMOVE_EXTRA);
+
+ //Check if the function is set correctly
+ if (aFunction->GetDriverGUID() != GEOMImpl_BlockDriver::GetID()) return NULL;
+
+ GEOMImpl_IBlockTrsf aTI (aFunction);
+ aTI.SetOriginal(aLastFunction);
+
+ //Compute the fixed shape
+ try {
+ if (!GetSolver()->ComputeFunction(aFunction)) {
+ SetErrorCode("Block driver failed to remove extra edges of the given shape");
+ return NULL;
+ }
+ }
+ catch (Standard_Failure) {
+ Handle(Standard_Failure) aFail = Standard_Failure::Caught();
+ SetErrorCode(aFail->GetMessageString());
+ return NULL;
+ }
+
+ //Make a Python command
+ TCollection_AsciiString anEntry, aDescr;
+ TDF_Tool::Entry(aCopy->GetEntry(), anEntry);
+ aDescr += anEntry + " = IBlocksOperations.RemoveExtraEdges(";
+ TDF_Tool::Entry(theObject->GetEntry(), anEntry);
+ aDescr += anEntry + ")";
+
+ aFunction->SetDescription(aDescr);
+
+ SetErrorCode(OK);
+ return aCopy;
+}
+
+//=============================================================================
+/*!
+ * CheckAndImprove
+ */
+//=============================================================================
+Handle(GEOM_Object) GEOMImpl_IBlocksOperations::CheckAndImprove
+ (Handle(GEOM_Object) theObject)
+{
+ SetErrorCode(KO);
+
+ if (theObject.IsNull()) return NULL;
+
+ Handle(GEOM_Function) aLastFunction = theObject->GetLastFunction();
+ if (aLastFunction.IsNull()) return NULL; //There is no function which creates an object to be fixed
+
+ //Add a new Copy object
+ Handle(GEOM_Object) aCopy = GetEngine()->AddObject(GetDocID(), GEOM_COPY);
+
+ //Add a function
+ Handle(GEOM_Function) aFunction =
+ aCopy->AddFunction(GEOMImpl_BlockDriver::GetID(), BLOCK_COMPOUND_IMPROVE);
+
+ //Check if the function is set correctly
+ if (aFunction->GetDriverGUID() != GEOMImpl_BlockDriver::GetID()) return NULL;
+
+ GEOMImpl_IBlockTrsf aTI (aFunction);
+ aTI.SetOriginal(aLastFunction);
+
+ //Compute the fixed shape
+ try {
+ if (!GetSolver()->ComputeFunction(aFunction)) {
+ SetErrorCode("Block driver failed to improve the given blocks compound");
+ return NULL;
+ }
+ }
+ catch (Standard_Failure) {
+ Handle(Standard_Failure) aFail = Standard_Failure::Caught();
+ SetErrorCode(aFail->GetMessageString());
+ return NULL;
+ }
+
+ //Make a Python command
+ TCollection_AsciiString anEntry, aDescr;
+ TDF_Tool::Entry(aCopy->GetEntry(), anEntry);
+ aDescr += anEntry + " = IBlocksOperations.CheckAndImprove(";
+ TDF_Tool::Entry(theObject->GetEntry(), anEntry);
+ aDescr += anEntry + ")";
+
+ aFunction->SetDescription(aDescr);
+
+ SetErrorCode(OK);
+ return aCopy;
+}
+
//=============================================================================
/*!
* ExplodeCompoundOfBlocks
}
if (aBlockOrComp.ShapeType() != TopAbs_COMPOUND &&
aBlockOrComp.ShapeType() != TopAbs_COMPSOLID) {
- SetErrorCode("Shape is neither a block, nor a compound of blocks");
+ SetErrorCode("Shape to find block in is not a compound");
return NULL;
}
TopoDS_Shape anArg = thePoint->GetValue();
if (anArg.IsNull()) {
- SetErrorCode("Null shape is given as argument");
+ SetErrorCode("Point is null");
return NULL;
}
if (anArg.ShapeType() != TopAbs_VERTEX) {
- SetErrorCode("Element for block identification is not a vertex");
+ SetErrorCode("Shape for block identification is not a vertex");
return NULL;
}
//Compute the Block value
try {
TopoDS_Shape aShape;
+
TopoDS_Vertex aVert = TopoDS::Vertex(anArg);
gp_Pnt aPnt = BRep_Tool::Pnt(aVert);
+ Standard_Real PX, PY, PZ;
+ aPnt.Coord(PX, PY, PZ);
- // 1. Explode compound on blocks
- TopTools_MapOfShape mapShape;
- Standard_Integer nbSolids = 0;
+ // 1. Classify the point relatively each block
+ Standard_Integer nearest = 2, nbFound = 0;
+ TopTools_DataMapOfShapeInteger mapShapeDist;
TopExp_Explorer exp (aBlockOrComp, TopAbs_SOLID);
for (; exp.More(); exp.Next()) {
- if (mapShape.Add(exp.Current())) {
- nbSolids++;
- }
- }
+ TopoDS_Shape aSolid = exp.Current();
+
+ if (!mapShapeDist.IsBound(aSolid)) {
+ Standard_Integer aDistance = 2;
+
+ // 1.a. Classify relatively Bounding box
+ Standard_Real Xmin, Ymin, Zmin, Xmax, Ymax, Zmax;
+ Bnd_Box BB;
+ BRepBndLib::Add(aSolid, BB);
+ BB.Get(Xmin, Ymin, Zmin, Xmax, Ymax, Zmax);
+ if (PX < Xmin || Xmax < PX ||
+ PY < Ymin || Ymax < PY ||
+ PZ < Zmin || Zmax < PZ) {
+ // OUT of bounding box
+ aDistance = 1;
+ } else {
+ // 1.b. Classify relatively the solid itself
+ BRepClass3d_SolidClassifier SC (aSolid, aPnt, Precision::Confusion());
+ if (SC.State() == TopAbs_IN) {
+ aDistance = -1;
+ } else if (SC.State() == TopAbs_ON) {
+ aDistance = 0;
+ } else { // OUT
+ aDistance = 1;
+ }
+ }
- mapShape.Clear();
- Standard_Integer ind = 1;
- TopTools_Array1OfShape aSolids (1, nbSolids);
- TColStd_Array1OfInteger aDistances (1, nbSolids);
- for (exp.Init(aBlockOrComp, TopAbs_SOLID); exp.More(); exp.Next()) {
- if (mapShape.Add(exp.Current())) {
- TopoDS_Shape aSolid = exp.Current();
- aSolids(ind) = aSolid;
+ if (aDistance < nearest) {
+ nearest = aDistance;
+ aShape = aSolid;
+ nbFound = 1;
+
+ // A first found block, containing the point inside, will be returned.
+ // It is the solution, if there are no intersecting blocks in the compound.
+ if (nearest == -1) break;
- // 2. Classify the point relatively each block
- BRepClass3d_SolidClassifier SC (aSolid, aPnt, Precision::Confusion());
- if (SC.State() == TopAbs_IN) {
- aDistances(ind) = -1;
- } else if (SC.State() == TopAbs_ON) {
- aDistances(ind) = 0;
- } else { // OUT
- aDistances(ind) = 1;
+ } else if (aDistance == nearest) {
+ nbFound++;
+ } else {
}
- ind++;
- }
- }
- // 3. Define block, containing the point or having minimum distance to it
- Standard_Integer nearest = 2, nbFound = 0;
- for (ind = 1; ind <= nbSolids; ind++) {
- if (aDistances(ind) < nearest) {
- nearest = aDistances(ind);
- aShape = aSolids(ind);
- nbFound = 1;
- } else if (aDistances(ind) == nearest) {
- nbFound++;
- } else {
- }
+ mapShapeDist.Bind(aSolid, aDistance);
+ } // if (!mapShapeDist.IsBound(aSolid))
}
+
+ // 2. Define block, containing the point or having minimum distance to it
if (nbFound > 1) {
if (nearest == 0) {
// The point is on boundary of some blocks and there are
// no blocks, having the point inside or on boundary.
// We will get a nearest block
Standard_Real minDist = RealLast();
- for (ind = 1; ind <= nbSolids; ind++) {
- if (aDistances(ind) == 1) {
- BRepExtrema_DistShapeShape aDistTool (aVert, aSolids(ind));
+ TopTools_DataMapIteratorOfDataMapOfShapeInteger mapShapeDistIter (mapShapeDist);
+ for (; mapShapeDistIter.More(); mapShapeDistIter.Next()) {
+ if (mapShapeDistIter.Value() == 1) {
+ TopoDS_Shape aSolid = mapShapeDistIter.Key();
+ BRepExtrema_DistShapeShape aDistTool (aVert, aSolid);
if (!aDistTool.IsDone()) {
SetErrorCode("Can not find a distance from the given point to one of blocks");
return NULL;
Standard_Real aDist = aDistTool.Value();
if (aDist < minDist) {
minDist = aDist;
- aShape = aSolids(ind);
+ aShape = aSolid;
}
}
}
} else { // nearest == -1
- // The point is inside some blocks.
- // We will get a block with nearest center
- Standard_Real minDist = RealLast();
- for (ind = 1; ind <= nbSolids; ind++) {
- if (aDistances(ind) == -1) {
- GProp_GProps aSystem;
- BRepGProp::VolumeProperties(aSolids(ind), aSystem);
- gp_Pnt aCenterMass = aSystem.CentreOfMass();
-
- Standard_Real aDist = aCenterMass.Distance(aPnt);
- if (aDist < minDist) {
- minDist = aDist;
- aShape = aSolids(ind);
- }
- }
- }
+// // The point is inside some blocks.
+// // We will get a block with nearest center
+// Standard_Real minDist = RealLast();
+// TopTools_DataMapIteratorOfDataMapOfShapeInteger mapShapeDistIter (mapShapeDist);
+// for (; mapShapeDistIter.More(); mapShapeDistIter.Next()) {
+// if (mapShapeDistIter.Value() == -1) {
+// TopoDS_Shape aSolid = mapShapeDistIter.Key();
+// GProp_GProps aSystem;
+// BRepGProp::VolumeProperties(aSolid, aSystem);
+// gp_Pnt aCenterMass = aSystem.CentreOfMass();
+//
+// Standard_Real aDist = aCenterMass.Distance(aPnt);
+// if (aDist < minDist) {
+// minDist = aDist;
+// aShape = aSolid;
+// }
+// }
+// }
}
- }
+ } // if (nbFound > 1)
if (nbFound == 0) {
SetErrorCode("There are no blocks near the given point");
SetErrorCode(OK);
return aCopy;
}
+
+//=============================================================================
+/*!
+ * Propagate
+ */
+//=============================================================================
+Handle(TColStd_HSequenceOfTransient) GEOMImpl_IBlocksOperations::Propagate
+ (Handle(GEOM_Object) theShape)
+{
+ SetErrorCode(KO);
+
+ if (theShape.IsNull()) return NULL;
+
+ TopoDS_Shape aShape = theShape->GetValue();
+ if (aShape.IsNull()) return NULL;
+
+ TopTools_IndexedMapOfShape anIndices;
+ TopExp::MapShapes(aShape, anIndices);
+
+ TopTools_IndexedDataMapOfShapeListOfShape MEW;
+ GEOMImpl_Block6Explorer::MapShapesAndAncestors
+ (aShape, TopAbs_EDGE, TopAbs_WIRE, MEW);
+ Standard_Integer ie, nbEdges = MEW.Extent();
+
+ // Result
+ Handle(TColStd_HSequenceOfTransient) aSeq = new TColStd_HSequenceOfTransient;
+
+ TopTools_MapOfShape mapAcceptedEdges;
+
+ for (ie = 1; ie <= nbEdges; ie++) {
+ TopoDS_Shape curE = MEW.FindKey(ie);
+
+ if (mapAcceptedEdges.Contains(curE)) continue;
+
+ // Build the chain
+ TopTools_ListOfShape currentChain;
+ TopTools_ListOfShape listPrevEdges;
+
+ currentChain.Append(curE);
+ listPrevEdges.Append(curE);
+ mapAcceptedEdges.Add(curE);
+
+ // Collect all edges pass by pass
+ while (listPrevEdges.Extent() > 0) {
+ // List of edges, added to chain on this cycle pass
+ TopTools_ListOfShape listCurEdges;
+
+ // Find the next portion of edges
+ TopTools_ListIteratorOfListOfShape itE (listPrevEdges);
+ for (; itE.More(); itE.Next()) {
+ TopoDS_Shape anE = itE.Value();
+
+ // Iterate on faces, having edge <anE>
+ TopTools_ListIteratorOfListOfShape itW (MEW.FindFromKey(anE));
+ for (; itW.More(); itW.Next()) {
+ TopoDS_Shape aW = itW.Value();
+ TopoDS_Shape anOppE;
+
+ BRepTools_WireExplorer aWE (TopoDS::Wire(aW));
+ Standard_Integer nb = 1, found = 0;
+ TopTools_Array1OfShape anEdges (1,4);
+ for (; aWE.More(); aWE.Next(), nb++) {
+ if (nb > 4) {
+ found = 0;
+ break;
+ }
+ anEdges(nb) = aWE.Current();
+ if (anEdges(nb).IsSame(anE)) found = nb;
+ }
+
+ if (nb == 5 && found > 0) {
+ // Quadrangle face found, get an opposite edge
+ Standard_Integer opp = found + 2;
+ if (opp > 4) opp -= 4;
+ anOppE = anEdges(opp);
+
+ if (!mapAcceptedEdges.Contains(anOppE)) {
+ // Add found edge to the chain
+ currentChain.Append(anOppE);
+ listCurEdges.Append(anOppE);
+ mapAcceptedEdges.Add(anOppE);
+ }
+ } // if (nb == 5 && found > 0)
+ } // for (; itF.More(); itF.Next())
+ } // for (; itE.More(); itE.Next())
+
+ listPrevEdges = listCurEdges;
+ } // while (listPrevEdges.Extent() > 0)
+
+ // Store the chain in the document
+ Handle(TColStd_HArray1OfInteger) anArray =
+ new TColStd_HArray1OfInteger (1, currentChain.Extent());
+
+ // Fill array of sub-shape indices
+ TopTools_ListIteratorOfListOfShape itSub (currentChain);
+ for (int index = 1; itSub.More(); itSub.Next(), ++index) {
+ int id = anIndices.FindIndex(itSub.Value());
+ anArray->SetValue(index, id);
+ }
+
+ // Add a new group object
+ Handle(GEOM_Object) aChain = GetEngine()->AddSubShape(theShape, anArray);
+
+ // Set a GROUP type
+ aChain->SetType(GEOM_GROUP);
+
+ // Set a sub shape type
+ TDF_Label aFreeLabel = aChain->GetFreeLabel();
+ TDataStd_Integer::Set(aFreeLabel, (Standard_Integer)TopAbs_EDGE);
+
+ // Add the chain to the result
+ aSeq->Append(aChain);
+ }
+
+ if (aSeq->IsEmpty()) {
+ SetErrorCode("There are no quadrangle faces in the shape");
+ return aSeq;
+ }
+
+ // The Propagation doesn't change object so no new function is required.
+ Handle(GEOM_Function) aFunction = theShape->GetLastFunction();
+
+ // Make a Python command
+ TCollection_AsciiString aDescr
+ ("\nlistPropagationChains = IShapesOperations.Propagate(");
+ TCollection_AsciiString anEntry;
+ TDF_Tool::Entry(theShape->GetEntry(), anEntry);
+ aDescr += (anEntry + ")");
+
+ TCollection_AsciiString anOldDescr = aFunction->GetDescription();
+ anOldDescr = anOldDescr + aDescr;
+ aFunction->SetDescription(anOldDescr);
+
+ SetErrorCode(OK);
+ return aSeq;
+}
enum BCErrorType {
NOT_BLOCK,
+ EXTRA_EDGE,
INVALID_CONNECTION,
NOT_CONNECTED,
NOT_GLUED
list<int> incriminated;
};
+ Standard_Boolean CheckCompoundOfBlocksOld (Handle(GEOM_Object) theCompound,
+ list<BCError>& theErrors);
+
Standard_Boolean CheckCompoundOfBlocks (Handle(GEOM_Object) theCompound,
list<BCError>& theErrors);
TCollection_AsciiString PrintBCErrors (Handle(GEOM_Object) theCompound,
const list<BCError>& theErrors);
+ Handle(GEOM_Object) RemoveExtraEdges (Handle(GEOM_Object) theShape);
+
+ Handle(GEOM_Object) CheckAndImprove (Handle(GEOM_Object) theCompound);
+
+ static void AddBlocksFrom (const TopoDS_Shape& theShape,
+ TopTools_ListOfShape& BLO,
+ TopTools_ListOfShape& NOT,
+ TopTools_ListOfShape& EXT);
+
// Extract blocks from blocks compounds
Handle(TColStd_HSequenceOfTransient) ExplodeCompoundOfBlocks
(Handle(GEOM_Object) theCompound,
const Standard_Integer theDirFace1V,
const Standard_Integer theDirFace2V,
const Standard_Integer theNbTimesV);
+
+ // Build groups for Propagation of 1D hypotheses
+ Handle(TColStd_HSequenceOfTransient) Propagate (Handle(GEOM_Object) theShape);
};
#endif
#include "GEOMImpl_IShapes.hxx"
#include "GEOMImpl_IGlue.hxx"
+#include "GEOMImpl_Block6Explorer.hxx"
+
#include "GEOM_Function.hxx"
#include "utilities.h"
#include <TFunction_DriverTable.hxx>
#include <TFunction_Driver.hxx>
#include <TFunction_Logbook.hxx>
+#include <TDataStd_Integer.hxx>
#include <TDF_Tool.hxx>
+#include <BRepExtrema_ExtCF.hxx>
+
#include <BRep_Tool.hxx>
#include <BRepGProp.hxx>
+#include <BRepAdaptor_Curve.hxx>
+#include <BRepBuilderAPI_MakeFace.hxx>
#include <TopAbs.hxx>
#include <TopExp.hxx>
#include <TopoDS.hxx>
#include <TopoDS_Shape.hxx>
+#include <TopoDS_Face.hxx>
+#include <TopoDS_Edge.hxx>
+#include <TopoDS_Vertex.hxx>
#include <TopoDS_Iterator.hxx>
#include <TopExp_Explorer.hxx>
+#include <TopLoc_Location.hxx>
#include <TopTools_MapOfShape.hxx>
#include <TopTools_Array1OfShape.hxx>
#include <TopTools_ListIteratorOfListOfShape.hxx>
#include <TopTools_IndexedMapOfShape.hxx>
+#include <Geom_Surface.hxx>
+#include <Geom_Plane.hxx>
+#include <Geom_SphericalSurface.hxx>
+#include <Geom_CylindricalSurface.hxx>
+#include <GeomAdaptor_Surface.hxx>
+
+#include <Geom2d_Curve.hxx>
+
#include <GProp_GProps.hxx>
#include <gp_Pnt.hxx>
+#include <gp_Lin.hxx>
#include <TColStd_Array1OfReal.hxx>
#include <TColStd_HArray1OfInteger.hxx>
+//#include <OSD_Timer.hxx>
+
#include <Standard_ErrorHandler.hxx> // CAREFUL ! position of this file is critic : see Lucien PIGNOLONI / OCC
//=============================================================================
*/
//=============================================================================
Handle(GEOM_Object) GEOMImpl_IShapesOperations::MakeFaceWires
- (list<Handle(GEOM_Object)> theShapes, bool isPlanarWanted)
+ (list<Handle(GEOM_Object)> theShapes,
+ const bool isPlanarWanted)
{
SetErrorCode(KO);
aCI.SetTolerance(theTolerance);
//Compute the sub-shape value
+ Standard_Boolean isWarning = Standard_False;
try {
if (!GetSolver()->ComputeFunction(aFunction)) {
SetErrorCode("Shape driver failed to glue faces");
catch (Standard_Failure) {
Handle(Standard_Failure) aFail = Standard_Failure::Caught();
SetErrorCode(aFail->GetMessageString());
- return NULL;
+ // to provide warning
+ if (!aFunction->GetValue().IsNull()) {
+ isWarning = Standard_True;
+ } else {
+ return NULL;
+ }
}
//Make a Python command
aFunction->SetDescription(aDescr);
- SetErrorCode(OK);
+ // to provide warning
+ if (!isWarning) SetErrorCode(OK);
return aGlued;
}
const Standard_Integer theShapeType,
const Standard_Boolean isSorted)
{
+// OSD_Timer timer1, timer2, timer3, timer4;
+// timer1.Start();
+
SetErrorCode(KO);
if (theShape.IsNull()) return NULL;
return aSeq;
}
+// timer1.Stop();
+// timer2.Start();
+
if (isSorted)
SortShapes(listShape);
+// timer2.Stop();
+// timer3.Start();
+
TopTools_IndexedMapOfShape anIndices;
TopExp::MapShapes(aShape, anIndices);
Handle(TColStd_HArray1OfInteger) anArray;
anAsciiList += ",";
}
+// timer3.Stop();
+// timer4.Start();
+
anAsciiList.Trunc(anAsciiList.Length() - 1);
anAsciiList += "]";
SetErrorCode(OK);
+// timer4.Stop();
+
+// cout << "Explosure takes:" << endl;
+// timer1.Show();
+// cout << "Sorting takes:" << endl;
+// timer2.Show();
+// cout << "Sub-shapes addition takes:" << endl;
+// timer3.Show();
+// cout << "Update Description takes:" << endl;
+// timer4.Show();
+
+ return aSeq;
+}
+
+//=============================================================================
+/*!
+ * GetSubShapeAllIDs
+ */
+//=============================================================================
+Handle(TColStd_HSequenceOfInteger) GEOMImpl_IShapesOperations::SubShapeAllIDs
+ (Handle(GEOM_Object) theShape,
+ const Standard_Integer theShapeType,
+ const Standard_Boolean isSorted)
+{
+ SetErrorCode(KO);
+
+ if (theShape.IsNull()) return NULL;
+ TopoDS_Shape aShape = theShape->GetValue();
+ if (aShape.IsNull()) return NULL;
+
+ Handle(TColStd_HSequenceOfInteger) aSeq = new TColStd_HSequenceOfInteger;
+ TopTools_MapOfShape mapShape;
+ TopTools_ListOfShape listShape;
+
+ if (aShape.ShapeType() == TopAbs_COMPOUND &&
+ (TopAbs_ShapeEnum(theShapeType) == TopAbs_SHAPE ||
+ TopAbs_ShapeEnum(theShapeType) == TopAbs_COMPSOLID ||
+ TopAbs_ShapeEnum(theShapeType) == TopAbs_COMPOUND)) {
+ TopoDS_Iterator It (aShape, Standard_True, Standard_True);
+ for (; It.More(); It.Next()) {
+ if (mapShape.Add(It.Value())) {
+ if (TopAbs_ShapeEnum(theShapeType) == TopAbs_SHAPE ||
+ TopAbs_ShapeEnum(theShapeType) == It.Value().ShapeType()) {
+ listShape.Append(It.Value());
+ }
+ }
+ }
+ } else {
+ TopExp_Explorer exp (aShape, TopAbs_ShapeEnum(theShapeType));
+ for (; exp.More(); exp.Next())
+ if (mapShape.Add(exp.Current()))
+ listShape.Append(exp.Current());
+ }
+
+ if (listShape.IsEmpty()) {
+ SetErrorCode("The given shape has no sub-shapes of the requested type");
+ return aSeq;
+ }
+
+ if (isSorted)
+ SortShapes(listShape);
+
+ TopTools_IndexedMapOfShape anIndices;
+ TopExp::MapShapes(aShape, anIndices);
+ Handle(TColStd_HArray1OfInteger) anArray;
+
+ TopTools_ListIteratorOfListOfShape itSub (listShape);
+ for (int index = 1; itSub.More(); itSub.Next(), ++index) {
+ TopoDS_Shape aValue = itSub.Value();
+ aSeq->Append(anIndices.FindIndex(aValue));
+ }
+
+ //The explode doesn't change object so no new function is required.
+ Handle(GEOM_Function) aFunction = theShape->GetLastFunction();
+
+ //Make a Python command
+ TCollection_AsciiString aDescr
+ ("\nlistSubShapeAllIDs = IShapesOperations.SubShapeAllIDs(");
+ TCollection_AsciiString anEntry;
+ TDF_Tool::Entry(theShape->GetEntry(), anEntry);
+ aDescr += (anEntry + ",");
+ if (isSorted)
+ aDescr += (TCollection_AsciiString(theShapeType) + ", 1)");
+ else
+ aDescr += (TCollection_AsciiString(theShapeType) + ", 0)");
+
+ TCollection_AsciiString anOldDescr = aFunction->GetDescription();
+ anOldDescr = anOldDescr + aDescr;
+ aFunction->SetDescription(anOldDescr);
+
+ SetErrorCode(OK);
return aSeq;
}
return aReversed;
}
+//=============================================================================
+/*!
+ * GetFreeFacesIDs
+ */
+//=============================================================================
+Handle(TColStd_HSequenceOfInteger) GEOMImpl_IShapesOperations::GetFreeFacesIDs
+ (Handle(GEOM_Object) theShape)
+{
+ SetErrorCode(KO);
+
+ if (theShape.IsNull()) return NULL;
+ TopoDS_Shape aShape = theShape->GetValue();
+ if (aShape.IsNull()) return NULL;
+
+ Handle(TColStd_HSequenceOfInteger) aSeq = new TColStd_HSequenceOfInteger;
+
+ TopTools_IndexedDataMapOfShapeListOfShape mapFaceBlocks;
+ GEOMImpl_Block6Explorer::MapShapesAndAncestors
+ (aShape, TopAbs_FACE, TopAbs_SOLID, mapFaceBlocks);
+
+ Standard_Integer ind = 1, nbFaces = mapFaceBlocks.Extent();
+
+ if (nbFaces == 0) {
+ SetErrorCode("The given shape has no faces");
+ return aSeq;
+ }
+
+ TopTools_IndexedMapOfShape anIndices;
+ TopExp::MapShapes(aShape, anIndices);
+
+ Standard_Integer id;
+ for (; ind <= nbFaces; ind++) {
+ if (mapFaceBlocks.FindFromIndex(ind).Extent() != 2) {
+ id = anIndices.FindIndex(mapFaceBlocks.FindKey(ind));
+ aSeq->Append(id);
+ }
+ }
+
+ //The explode doesn't change object so no new function is required.
+ Handle(GEOM_Function) aFunction = theShape->GetLastFunction();
+
+ //Make a Python command
+ TCollection_AsciiString aDescr ("\nlistFreeFacesIDs = IShapesOperations.GetFreeFacesIDs(");
+ TCollection_AsciiString anEntry;
+ TDF_Tool::Entry(theShape->GetEntry(), anEntry);
+ aDescr += (anEntry + ")");
+
+ TCollection_AsciiString anOldDescr = aFunction->GetDescription();
+ anOldDescr = anOldDescr + aDescr;
+ aFunction->SetDescription(anOldDescr);
+
+ SetErrorCode(OK);
+ return aSeq;
+}
+
+//=============================================================================
+/*!
+ * GetSharedShapes
+ */
+//=============================================================================
+Handle(TColStd_HSequenceOfTransient) GEOMImpl_IShapesOperations::GetSharedShapes
+ (Handle(GEOM_Object) theShape1,
+ Handle(GEOM_Object) theShape2,
+ const Standard_Integer theShapeType)
+{
+ SetErrorCode(KO);
+
+ if (theShape1.IsNull() || theShape2.IsNull()) return NULL;
+
+ TopoDS_Shape aShape1 = theShape1->GetValue();
+ TopoDS_Shape aShape2 = theShape2->GetValue();
+
+ if (aShape1.IsNull() || aShape2.IsNull()) return NULL;
+
+ TopTools_IndexedMapOfShape anIndices;
+ TopExp::MapShapes(aShape1, anIndices);
+ Handle(TColStd_HArray1OfInteger) anArray;
+
+ TopTools_IndexedMapOfShape mapShape1;
+ TopExp::MapShapes(aShape1, TopAbs_ShapeEnum(theShapeType), mapShape1);
+
+ Handle(GEOM_Object) anObj;
+ Handle(TColStd_HSequenceOfTransient) aSeq = new TColStd_HSequenceOfTransient;
+
+ TopTools_MapOfShape mapShape2;
+ TopExp_Explorer exp (aShape2, TopAbs_ShapeEnum(theShapeType));
+ for (; exp.More(); exp.Next()) {
+ TopoDS_Shape aSS = exp.Current();
+ if (mapShape2.Add(aSS) && mapShape1.Contains(aSS)) {
+ anArray = new TColStd_HArray1OfInteger(1,1);
+ anArray->SetValue(1, anIndices.FindIndex(aSS));
+ anObj = GetEngine()->AddSubShape(theShape1, anArray);
+ aSeq->Append(anObj);
+ }
+ }
+
+ if (aSeq->IsEmpty()) {
+ SetErrorCode("The given shapes have no shared sub-shapes of the requested type");
+ return aSeq;
+ }
+
+ //The explode doesn't change object so no new function is required.
+ Handle(GEOM_Function) aFunction = theShape1->GetLastFunction();
+
+ //Make a Python command
+ TCollection_AsciiString aDescr
+ ("\nlistSharedShapes = IShapesOperations.GetSharedShapes(");
+ TCollection_AsciiString anEntry;
+ TDF_Tool::Entry(theShape1->GetEntry(), anEntry);
+ aDescr += (anEntry + ",");
+ TDF_Tool::Entry(theShape2->GetEntry(), anEntry);
+ aDescr += (anEntry + ",");
+ aDescr += TCollection_AsciiString(theShapeType) + ")";
+
+ TCollection_AsciiString anOldDescr = aFunction->GetDescription();
+ anOldDescr = anOldDescr + aDescr;
+ aFunction->SetDescription(anOldDescr);
+
+ SetErrorCode(OK);
+ return aSeq;
+}
+
+//=============================================================================
+/*!
+ * GetShapesOnPlane
+ */
+//=============================================================================
+Handle(GEOM_Object) GEOMImpl_IShapesOperations::GetShapesOnPlane
+ (Handle(GEOM_Object) theShape,
+ const Standard_Integer theShapeType,
+ Handle(GEOM_Object) thePlane)
+{
+ SetErrorCode(KO);
+
+ if (theShape.IsNull() || thePlane.IsNull()) return NULL;
+
+ TopoDS_Shape aShape = theShape->GetValue();
+ TopoDS_Shape aPlane = thePlane->GetValue();
+
+ if (aShape.IsNull() || aPlane.IsNull()) return NULL;
+
+ TopAbs_ShapeEnum aShapeType = TopAbs_ShapeEnum(theShapeType);
+ if (aShapeType != TopAbs_VERTEX &&
+ aShapeType != TopAbs_EDGE &&
+ aShapeType != TopAbs_FACE) {
+ SetErrorCode("Not implemented for the given sub-shape type");
+ return NULL;
+ }
+
+ //Get plane parameters
+ if (aPlane.IsNull() || aPlane.ShapeType() != TopAbs_FACE) return NULL;
+ TopoDS_Face aFace = TopoDS::Face(aPlane);
+ Handle(Geom_Surface) surf = BRep_Tool::Surface(aFace);
+ Handle(Geom_Plane) pln = Handle(Geom_Plane)::DownCast(surf);
+ if (pln.IsNull()) {
+ SetErrorCode("Not planar face given");
+ return NULL;
+ }
+ const gp_Ax3 pos = pln->Position();
+ const gp_Pnt loc = pos.Location();
+ const gp_Dir dir = pos.Direction();
+
+ //Find sub-shapes on the plane
+ TopTools_ListOfShape listSS;
+ TopTools_MapOfShape mapShapes;
+ TopExp_Explorer exp (aShape, aShapeType);
+ for (; exp.More(); exp.Next()) {
+ TopoDS_Shape aSS = exp.Current();
+ if (mapShapes.Add(aSS)) {
+ switch (aShapeType) {
+ case TopAbs_VERTEX:
+ {
+ TopoDS_Vertex aV = TopoDS::Vertex(aSS);
+ gp_Pnt aP = BRep_Tool::Pnt(aV);
+ gp_Vec vecToLoc (aP, loc);
+ if (vecToLoc.IsNormal(dir, Precision::Angular())) {
+ listSS.Append(aSS);
+ }
+ }
+ break;
+ case TopAbs_EDGE:
+ {
+ TopoDS_Edge anEdge = TopoDS::Edge(aSS);
+ Standard_Real f, l;
+ Handle(Geom2d_Curve) PC;
+ Handle(Geom_Surface) cur_surf;
+ TopLoc_Location L;
+ Standard_Integer i = 0;
+
+ // iterate on the surfaces of the edge
+ while (Standard_True) {
+ i++;
+ BRep_Tool::CurveOnSurface(anEdge, PC , cur_surf, L, f, l, i);
+ if (cur_surf.IsNull()) break;
+
+ Handle(Geom_Plane) cur_pln = Handle(Geom_Plane)::DownCast(cur_surf);
+ if (!cur_pln.IsNull()) {
+ const gp_Ax3 cur_pos = cur_pln->Position();
+ const gp_Pnt cur_loc = cur_pos.Location();
+ const gp_Dir cur_dir = cur_pos.Direction();
+ gp_Vec vecToLoc (cur_loc, loc);
+ if (vecToLoc.IsNormal(dir, Precision::Angular()) &&
+ cur_dir.IsParallel(dir, Precision::Angular())) {
+ listSS.Append(aSS);
+ }
+ }
+ }
+ }
+ break;
+ case TopAbs_FACE:
+ {
+ TopoDS_Face aF = TopoDS::Face(aSS);
+ Handle(Geom_Surface) cur_surf = BRep_Tool::Surface(aF);
+ Handle(Geom_Plane) cur_pln = Handle(Geom_Plane)::DownCast(cur_surf);
+ if (!cur_pln.IsNull()) {
+ const gp_Ax3 cur_pos = cur_pln->Position();
+ const gp_Pnt cur_loc = cur_pos.Location();
+ const gp_Dir cur_dir = cur_pos.Direction();
+ gp_Vec vecToLoc (cur_loc, loc);
+ if (vecToLoc.IsNormal(dir, Precision::Angular()) &&
+ cur_dir.IsParallel(dir, Precision::Angular())) {
+ listSS.Append(aSS);
+ }
+ }
+ }
+ break;
+ default:
+ break;
+ }
+ }
+ }
+
+ if (listSS.Extent() < 1) {
+ SetErrorCode("Not a single sub-shape of the requested type found on the given plane");
+ return NULL;
+ }
+
+ //Fill array of indices
+ TopTools_IndexedMapOfShape anIndices;
+ TopExp::MapShapes(aShape, anIndices);
+
+ Handle(TColStd_HArray1OfInteger) anArray =
+ new TColStd_HArray1OfInteger (1, listSS.Extent());
+ TopTools_ListIteratorOfListOfShape itSub (listSS);
+ for (int index = 1; itSub.More(); itSub.Next(), ++index) {
+ int id = anIndices.FindIndex(itSub.Value());
+ anArray->SetValue(index, id);
+ }
+
+ //Add a new group object
+ Handle(GEOM_Object) aGroup = GetEngine()->AddSubShape(theShape, anArray);
+
+ //Set a GROUP type
+ aGroup->SetType(GEOM_GROUP);
+
+ //Set a sub shape type
+ TDF_Label aFreeLabel = aGroup->GetFreeLabel();
+ TDataStd_Integer::Set(aFreeLabel, (Standard_Integer)theShapeType);
+
+ //Make a Python command
+ TCollection_AsciiString anEntry, aDescr;
+ TDF_Tool::Entry(aGroup->GetEntry(), anEntry);
+ aDescr += anEntry;
+ aDescr += " = IShapesOperations.GetShapesOnPlane(";
+ TDF_Tool::Entry(theShape->GetEntry(), anEntry);
+ aDescr += anEntry + TCollection_AsciiString(theShapeType) + ",";
+ TDF_Tool::Entry(thePlane->GetEntry(), anEntry);
+ aDescr += anEntry + ")";
+
+ Handle(GEOM_Function) aFunction = aGroup->GetFunction(1);
+ aFunction->SetDescription(aDescr);
+
+ SetErrorCode(OK);
+ return aGroup;
+}
+
+//=============================================================================
+/*!
+ * GetShapesOnCylinder
+ */
+//=============================================================================
+Handle(GEOM_Object) GEOMImpl_IShapesOperations::GetShapesOnCylinder
+ (Handle(GEOM_Object) theShape,
+ const Standard_Integer theShapeType,
+ Handle(GEOM_Object) theAxis,
+ const Standard_Real theRadius)
+{
+ SetErrorCode(KO);
+
+ if (theShape.IsNull() || theAxis.IsNull()) return NULL;
+
+ TopoDS_Shape aShape = theShape->GetValue();
+ TopoDS_Shape anAxis = theAxis->GetValue();
+
+ if (aShape.IsNull() || anAxis.IsNull()) return NULL;
+
+ TopAbs_ShapeEnum aShapeType = TopAbs_ShapeEnum(theShapeType);
+ if (aShapeType != TopAbs_VERTEX &&
+ aShapeType != TopAbs_EDGE &&
+ aShapeType != TopAbs_FACE) {
+ SetErrorCode("Not implemented for the given sub-shape type");
+ return NULL;
+ }
+
+ //Axis of the cylinder
+ if (anAxis.ShapeType() != TopAbs_EDGE) {
+ SetErrorCode("Not an edge given for the axis");
+ return NULL;
+ }
+ TopoDS_Edge anEdge = TopoDS::Edge(anAxis);
+ TopoDS_Vertex V1, V2;
+ TopExp::Vertices(anEdge, V1, V2, Standard_True);
+ if (V1.IsNull() || V2.IsNull()) {
+ SetErrorCode("Bad edge given for the axis");
+ return NULL;
+ }
+ gp_Pnt loc = BRep_Tool::Pnt(V1);
+ gp_Vec aVec (loc, BRep_Tool::Pnt(V2));
+ gp_Dir dir (aVec);
+ gp_Lin aLin (loc, aVec);
+
+ //Find sub-shapes on the cylinder
+ TopTools_ListOfShape listSS;
+ TopTools_MapOfShape mapShapes;
+ TopExp_Explorer exp (aShape, aShapeType);
+ for (; exp.More(); exp.Next()) {
+ TopoDS_Shape aSS = exp.Current();
+ if (mapShapes.Add(aSS)) {
+ switch (aShapeType) {
+ case TopAbs_VERTEX:
+ {
+ TopoDS_Vertex aV = TopoDS::Vertex(aSS);
+ gp_Pnt aP = BRep_Tool::Pnt(aV);
+ if (Abs(aLin.Distance(aP) - theRadius) < Precision::Confusion()) {
+ listSS.Append(aSS);
+ }
+ }
+ break;
+ case TopAbs_EDGE:
+ {
+ TopoDS_Edge anEdge = TopoDS::Edge(aSS);
+ Standard_Real f, l;
+ Handle(Geom2d_Curve) PC;
+ Handle(Geom_Surface) cur_surf;
+ TopLoc_Location L;
+ Standard_Integer i = 0;
+
+ // iterate on the surfaces of the edge
+ while (Standard_True) {
+ i++;
+ BRep_Tool::CurveOnSurface(anEdge, PC , cur_surf, L, f, l, i);
+ if (cur_surf.IsNull()) break;
+
+ Handle(Geom_CylindricalSurface) cur_cyl =
+ Handle(Geom_CylindricalSurface)::DownCast(cur_surf);
+ if (!cur_cyl.IsNull()) {
+ const gp_Ax3 cur_pos = cur_cyl->Position();
+ const gp_Pnt cur_loc = cur_pos.Location();
+ const gp_Dir cur_dir = cur_pos.Direction();
+ const Standard_Real cur_rad = cur_cyl->Radius();
+ gp_Vec vecToLoc (cur_loc, loc);
+ if (vecToLoc.IsParallel(dir, Precision::Angular()) &&
+ cur_dir.IsParallel(dir, Precision::Angular()) &&
+ Abs(cur_rad - theRadius) < Precision::Confusion()) {
+ listSS.Append(aSS);
+ }
+ }
+ }
+ }
+ break;
+ case TopAbs_FACE:
+ {
+ TopoDS_Face aF = TopoDS::Face(aSS);
+ Handle(Geom_Surface) cur_surf = BRep_Tool::Surface(aF);
+ Handle(Geom_CylindricalSurface) cur_cyl =
+ Handle(Geom_CylindricalSurface)::DownCast(cur_surf);
+ if (!cur_cyl.IsNull()) {
+ const gp_Ax3 cur_pos = cur_cyl->Position();
+ const gp_Pnt cur_loc = cur_pos.Location();
+ const gp_Dir cur_dir = cur_pos.Direction();
+ const Standard_Real cur_rad = cur_cyl->Radius();
+ gp_Vec vecToLoc (cur_loc, loc);
+ if (vecToLoc.IsParallel(dir, Precision::Angular()) &&
+ cur_dir.IsParallel(dir, Precision::Angular()) &&
+ Abs(cur_rad - theRadius) < Precision::Confusion()) {
+ listSS.Append(aSS);
+ }
+ }
+ }
+ break;
+ default:
+ break;
+ }
+ }
+ }
+
+ if (listSS.Extent() < 1) {
+ SetErrorCode("Not a single sub-shape of the requested type found on the given cylinder");
+ return NULL;
+ }
+
+ //Fill array of indices
+ TopTools_IndexedMapOfShape anIndices;
+ TopExp::MapShapes(aShape, anIndices);
+
+ Handle(TColStd_HArray1OfInteger) anArray =
+ new TColStd_HArray1OfInteger (1, listSS.Extent());
+ TopTools_ListIteratorOfListOfShape itSub (listSS);
+ for (int index = 1; itSub.More(); itSub.Next(), ++index) {
+ int id = anIndices.FindIndex(itSub.Value());
+ anArray->SetValue(index, id);
+ }
+
+ //Add a new group object
+ Handle(GEOM_Object) aGroup = GetEngine()->AddSubShape(theShape, anArray);
+
+ //Set a GROUP type
+ aGroup->SetType(GEOM_GROUP);
+
+ //Set a sub shape type
+ TDF_Label aFreeLabel = aGroup->GetFreeLabel();
+ TDataStd_Integer::Set(aFreeLabel, (Standard_Integer)theShapeType);
+
+ //Make a Python command
+ TCollection_AsciiString anEntry, aDescr;
+ TDF_Tool::Entry(aGroup->GetEntry(), anEntry);
+ aDescr += anEntry;
+ aDescr += " = IShapesOperations.GetShapesOnCylinder(";
+ TDF_Tool::Entry(theShape->GetEntry(), anEntry);
+ aDescr += anEntry + TCollection_AsciiString(theShapeType) + ",";
+ TDF_Tool::Entry(theAxis->GetEntry(), anEntry);
+ aDescr += anEntry + TCollection_AsciiString(theRadius) + ")";
+
+ Handle(GEOM_Function) aFunction = aGroup->GetFunction(1);
+ aFunction->SetDescription(aDescr);
+
+ SetErrorCode(OK);
+ return aGroup;
+}
+
+//=============================================================================
+/*!
+ * GetShapesOnSphere
+ */
+//=============================================================================
+Handle(GEOM_Object) GEOMImpl_IShapesOperations::GetShapesOnSphere
+ (Handle(GEOM_Object) theShape,
+ const Standard_Integer theShapeType,
+ Handle(GEOM_Object) theCenter,
+ const Standard_Real theRadius)
+{
+ SetErrorCode(KO);
+
+ if (theShape.IsNull() || theCenter.IsNull()) return NULL;
+
+ TopoDS_Shape aShape = theShape->GetValue();
+ TopoDS_Shape aCenter = theCenter->GetValue();
+
+ if (aShape.IsNull() || aCenter.IsNull()) return NULL;
+
+ TopAbs_ShapeEnum aShapeType = TopAbs_ShapeEnum(theShapeType);
+ if (aShapeType != TopAbs_VERTEX &&
+ aShapeType != TopAbs_EDGE &&
+ aShapeType != TopAbs_FACE) {
+ SetErrorCode("Not implemented for the given sub-shape type");
+ return NULL;
+ }
+
+ //Center of the sphere
+ if (aCenter.ShapeType() != TopAbs_VERTEX) return NULL;
+ gp_Pnt aC = BRep_Tool::Pnt(TopoDS::Vertex(aCenter));
+
+ //Find sub-shapes on the sphere
+ TopTools_ListOfShape listSS;
+ TopTools_MapOfShape mapShapes;
+ TopExp_Explorer exp (aShape, aShapeType);
+ for (; exp.More(); exp.Next()) {
+ TopoDS_Shape aSS = exp.Current();
+ if (mapShapes.Add(aSS)) {
+ switch (aShapeType) {
+ case TopAbs_VERTEX:
+ {
+ TopoDS_Vertex aV = TopoDS::Vertex(aSS);
+ gp_Pnt aP = BRep_Tool::Pnt(aV);
+ if (Abs(aP.Distance(aC) - theRadius) < Precision::Confusion()) {
+ listSS.Append(aSS);
+ }
+ }
+ break;
+ case TopAbs_EDGE:
+ {
+ TopoDS_Edge anEdge = TopoDS::Edge(aSS);
+ Standard_Real f, l;
+ Handle(Geom2d_Curve) PC;
+ Handle(Geom_Surface) cur_surf;
+ TopLoc_Location L;
+ Standard_Integer i = 0;
+
+ // iterate on the surfaces of the edge
+ while (Standard_True) {
+ i++;
+ BRep_Tool::CurveOnSurface(anEdge, PC , cur_surf, L, f, l, i);
+ if (cur_surf.IsNull()) break;
+
+ Handle(Geom_SphericalSurface) cur_sph =
+ Handle(Geom_SphericalSurface)::DownCast(cur_surf);
+ if (!cur_sph.IsNull()) {
+ const gp_Ax3 cur_pos = cur_sph->Position();
+ const gp_Pnt cur_loc = cur_pos.Location();
+ const Standard_Real cur_rad = cur_sph->Radius();
+ if (cur_loc.Distance(aC) < Precision::Confusion() &&
+ Abs(cur_rad - theRadius) < Precision::Confusion()) {
+ listSS.Append(aSS);
+ }
+ }
+ }
+ }
+ break;
+ case TopAbs_FACE:
+ {
+ TopoDS_Face aF = TopoDS::Face(aSS);
+ Handle(Geom_Surface) cur_surf = BRep_Tool::Surface(aF);
+ Handle(Geom_SphericalSurface) cur_sph =
+ Handle(Geom_SphericalSurface)::DownCast(cur_surf);
+ if (!cur_sph.IsNull()) {
+ const gp_Ax3 cur_pos = cur_sph->Position();
+ const gp_Pnt cur_loc = cur_pos.Location();
+ const Standard_Real cur_rad = cur_sph->Radius();
+ if (cur_loc.Distance(aC) < Precision::Confusion() &&
+ Abs(cur_rad - theRadius) < Precision::Confusion()) {
+ listSS.Append(aSS);
+ }
+ }
+ }
+ break;
+ default:
+ break;
+ }
+ }
+ }
+
+ if (listSS.Extent() < 1) {
+ SetErrorCode("Not a single sub-shape of the requested type found on the given sphere");
+ return NULL;
+ }
+
+ //Fill array of indices
+ TopTools_IndexedMapOfShape anIndices;
+ TopExp::MapShapes(aShape, anIndices);
+
+ Handle(TColStd_HArray1OfInteger) anArray =
+ new TColStd_HArray1OfInteger (1, listSS.Extent());
+ TopTools_ListIteratorOfListOfShape itSub (listSS);
+ for (int index = 1; itSub.More(); itSub.Next(), ++index) {
+ int id = anIndices.FindIndex(itSub.Value());
+ anArray->SetValue(index, id);
+ }
+
+ //Add a new group object
+ Handle(GEOM_Object) aGroup = GetEngine()->AddSubShape(theShape, anArray);
+
+ //Set a GROUP type
+ aGroup->SetType(GEOM_GROUP);
+
+ //Set a sub shape type
+ TDF_Label aFreeLabel = aGroup->GetFreeLabel();
+ TDataStd_Integer::Set(aFreeLabel, (Standard_Integer)theShapeType);
+
+ //Make a Python command
+ TCollection_AsciiString anEntry, aDescr;
+ TDF_Tool::Entry(aGroup->GetEntry(), anEntry);
+ aDescr += anEntry;
+ aDescr += " = IShapesOperations.GetShapesOnSphere(";
+ TDF_Tool::Entry(theShape->GetEntry(), anEntry);
+ aDescr += anEntry + TCollection_AsciiString(theShapeType) + ",";
+ TDF_Tool::Entry(theCenter->GetEntry(), anEntry);
+ aDescr += anEntry + TCollection_AsciiString(theRadius) + ")";
+
+ Handle(GEOM_Function) aFunction = aGroup->GetFunction(1);
+ aFunction->SetDescription(aDescr);
+
+ SetErrorCode(OK);
+ return aGroup;
+}
+
+//=============================================================================
+/*!
+ * GetInPlace
+ */
+//=============================================================================
+Handle(GEOM_Object) GEOMImpl_IShapesOperations::GetInPlace
+ (Handle(GEOM_Object) theShapeWhere,
+ Handle(GEOM_Object) theShapeWhat)
+{
+ SetErrorCode(KO);
+
+ if (theShapeWhere.IsNull() || theShapeWhat.IsNull()) return NULL;
+
+ TopoDS_Shape aWhere = theShapeWhere->GetValue();
+ TopoDS_Shape aWhat = theShapeWhat->GetValue();
+
+ if (aWhere.IsNull() || aWhat.IsNull()) return NULL;
+
+ //Fill array of indices
+ TopTools_IndexedMapOfShape anIndices;
+ TopExp::MapShapes(aWhere, anIndices);
+
+// Handle(TColStd_HArray1OfInteger) anArray =
+// new TColStd_HArray1OfInteger (1, listSS.Extent());
+// TopTools_ListIteratorOfListOfShape itSub (listSS);
+// for (int index = 1; itSub.More(); itSub.Next(), ++index) {
+// int id = anIndices.FindIndex(itSub.Value());
+// anArray->SetValue(index, id);
+// }
+//
+// //Add a new group object
+// Handle(GEOM_Object) aGroup = GetEngine()->AddSubShape(theShape, anArray);
+//
+// //Set a GROUP type
+// aGroup->SetType(GEOM_GROUP);
+//
+// //Set a sub shape type
+// TDF_Label aFreeLabel = aGroup->GetFreeLabel();
+// TDataStd_Integer::Set(aFreeLabel, (Standard_Integer)theShapeType);
+//
+// //Make a Python command
+// TCollection_AsciiString anEntry, aDescr;
+// TDF_Tool::Entry(aGroup->GetEntry(), anEntry);
+// aDescr += anEntry;
+// aDescr += " = IShapesOperations.GetInPlace(";
+// TDF_Tool::Entry(theShapeWhere->GetEntry(), anEntry);
+// aDescr += anEntry + ",";
+// TDF_Tool::Entry(theShapeWhat->GetEntry(), anEntry);
+// aDescr += anEntry + ")";
+//
+// Handle(GEOM_Function) aFunction = aGroup->GetFunction(1);
+// aFunction->SetDescription(aDescr);
+
+// SetErrorCode(OK);
+// return aGroup;
+ SetErrorCode("Not implemented");
+ return NULL;
+}
+
//=======================================================================
//function : SortShapes
#include <TopTools_ListOfShape.hxx>
#include <TColStd_HSequenceOfTransient.hxx>
+#include <TColStd_HSequenceOfInteger.hxx>
#include <list>
Handle(GEOM_Object) MakeWire (list<Handle(GEOM_Object)> theEdgesAndWires);
- Handle(GEOM_Object) MakeFace (Handle(GEOM_Object) theWire, bool isPlanarWanted);
+ Handle(GEOM_Object) MakeFace (Handle(GEOM_Object) theWire, const bool isPlanarWanted);
- Handle(GEOM_Object) MakeFaceWires (list<Handle(GEOM_Object)> theWires, bool isPlanarWanted);
+ Handle(GEOM_Object) MakeFaceWires (list<Handle(GEOM_Object)> theWires,
+ const bool isPlanarWanted);
Handle(GEOM_Object) MakeShell (list<Handle(GEOM_Object)> theShapes);
const Standard_Integer theShapeType,
const Standard_Boolean isSorted);
+ Handle(TColStd_HSequenceOfInteger) SubShapeAllIDs (Handle(GEOM_Object) theShape,
+ const Standard_Integer theShapeType,
+ const Standard_Boolean isSorted);
+
Handle(GEOM_Object) GetSubShape (Handle(GEOM_Object) theMainShape,
const Standard_Integer theID);
Handle(GEOM_Object) ReverseShape(Handle(GEOM_Object) theShapes);
+ Handle(TColStd_HSequenceOfInteger) GetFreeFacesIDs (Handle(GEOM_Object) theShape);
+
+ Handle(TColStd_HSequenceOfTransient) GetSharedShapes (Handle(GEOM_Object) theShape1,
+ Handle(GEOM_Object) theShape2,
+ const Standard_Integer theShapeType);
+
+ Handle(GEOM_Object) GetShapesOnPlane (Handle(GEOM_Object) theShape,
+ const Standard_Integer theShapeType,
+ Handle(GEOM_Object) thePlane);
+
+ Handle(GEOM_Object) GetShapesOnCylinder (Handle(GEOM_Object) theShape,
+ const Standard_Integer theShapeType,
+ Handle(GEOM_Object) theAxis,
+ const Standard_Real theRadius);
+
+ Handle(GEOM_Object) GetShapesOnSphere (Handle(GEOM_Object) theShape,
+ const Standard_Integer theShapeType,
+ Handle(GEOM_Object) theCenter,
+ const Standard_Real theRadius);
+
+ Handle(GEOM_Object) GetInPlace (Handle(GEOM_Object) theShapeWhere,
+ Handle(GEOM_Object) theShapeWhat);
+
static void SortShapes (TopTools_ListOfShape& SL);
private:
#define BLOCK_TWO_FACES 5
#define BLOCK_MULTI_TRANSFORM_1D 6
#define BLOCK_MULTI_TRANSFORM_2D 7
-#define BLOCK_COMPOUND_GLUE 8
+#define BLOCK_COMPOUND_GLUE 8
+#define BLOCK_REMOVE_EXTRA 9
+#define BLOCK_COMPOUND_IMPROVE 10
// Marker
#define MARKER_CS 1
+#include <strstream>
+
using namespace std;
#include "GEOM_Gen_i.hh"
case GEOMImpl_IBlocksOperations::NOT_BLOCK:
anError->error = GEOM::GEOM_IBlocksOperations::NOT_BLOCK;
break;
+ case GEOMImpl_IBlocksOperations::EXTRA_EDGE:
+ anError->error = GEOM::GEOM_IBlocksOperations::EXTRA_EDGE;
+ break;
case GEOMImpl_IBlocksOperations::INVALID_CONNECTION:
anError->error = GEOM::GEOM_IBlocksOperations::INVALID_CONNECTION;
break;
case GEOM::GEOM_IBlocksOperations::NOT_BLOCK:
errStruct.error = GEOMImpl_IBlocksOperations::NOT_BLOCK;
break;
+ case GEOM::GEOM_IBlocksOperations::EXTRA_EDGE:
+ errStruct.error = GEOMImpl_IBlocksOperations::EXTRA_EDGE;
+ break;
case GEOM::GEOM_IBlocksOperations::INVALID_CONNECTION:
errStruct.error = GEOMImpl_IBlocksOperations::INVALID_CONNECTION;
break;
return CORBA::string_dup(aDescr.ToCString());
}
+//=============================================================================
+/*!
+ * RemoveExtraEdges
+ */
+//=============================================================================
+GEOM::GEOM_Object_ptr GEOM_IBlocksOperations_i::RemoveExtraEdges (GEOM::GEOM_Object_ptr theShape)
+{
+ GEOM::GEOM_Object_var aGEOMObject;
+
+ //Set a not done flag
+ GetOperations()->SetNotDone();
+
+ if (theShape == NULL) return aGEOMObject._retn();
+
+ //Get the reference Objects
+ Handle(GEOM_Object) aShape = GetOperations()->GetEngine()->GetObject
+ (theShape->GetStudyID(), theShape->GetEntry());
+
+ if (aShape.IsNull()) return aGEOMObject._retn();
+
+ //Get the result
+ Handle(GEOM_Object) anObject =
+ GetOperations()->RemoveExtraEdges(aShape);
+ if (!GetOperations()->IsDone() || anObject.IsNull())
+ return aGEOMObject._retn();
+
+ return GetObject(anObject);
+}
+
+//=============================================================================
+/*!
+ * CheckAndImprove
+ */
+//=============================================================================
+GEOM::GEOM_Object_ptr GEOM_IBlocksOperations_i::CheckAndImprove (GEOM::GEOM_Object_ptr theCompound)
+{
+ GEOM::GEOM_Object_var aGEOMObject;
+
+ //Set a not done flag
+ GetOperations()->SetNotDone();
+
+ if (theCompound == NULL) return aGEOMObject._retn();
+
+ //Get the reference Objects
+ Handle(GEOM_Object) aCompound = GetOperations()->GetEngine()->GetObject
+ (theCompound->GetStudyID(), theCompound->GetEntry());
+
+ if (aCompound.IsNull()) return aGEOMObject._retn();
+
+ //Get the result
+ Handle(GEOM_Object) anObject =
+ GetOperations()->CheckAndImprove(aCompound);
+ if (!GetOperations()->IsDone() || anObject.IsNull())
+ return aGEOMObject._retn();
+
+ return GetObject(anObject);
+}
+
//=============================================================================
/*!
* GetBlockNearPoint
return GetObject(anObject);
}
+
+//=============================================================================
+/*!
+ * Propagate
+ */
+//=============================================================================
+GEOM::ListOfGO* GEOM_IBlocksOperations_i::Propagate (GEOM::GEOM_Object_ptr theShape)
+{
+ GEOM::ListOfGO_var aSeq = new GEOM::ListOfGO;
+
+ //Set a not done flag
+ GetOperations()->SetNotDone();
+
+ if (theShape == NULL) return aSeq._retn();
+
+ //Get the reference Shape
+ Handle(GEOM_Object) aShape = GetOperations()->GetEngine()->GetObject
+ (theShape->GetStudyID(), theShape->GetEntry());
+
+ if (aShape.IsNull()) return aSeq._retn();
+
+ //Get the Propagation chains
+ Handle(TColStd_HSequenceOfTransient) aHSeq =
+ GetOperations()->Propagate(aShape);
+ if (!GetOperations()->IsDone() || aHSeq.IsNull())
+ return aSeq._retn();
+
+ Standard_Integer aLength = aHSeq->Length();
+ aSeq->length(aLength);
+ for (Standard_Integer i = 1; i <= aLength; i++)
+ aSeq[i-1] = GetObject(Handle(GEOM_Object)::DownCast(aHSeq->Value(i)));
+
+ return aSeq._retn();
+}
char* PrintBCErrors (GEOM::GEOM_Object_ptr theCompound,
const GEOM::GEOM_IBlocksOperations::BCErrors& theErrors);
+ GEOM::GEOM_Object_ptr RemoveExtraEdges (GEOM::GEOM_Object_ptr theShape);
+
+ GEOM::GEOM_Object_ptr CheckAndImprove (GEOM::GEOM_Object_ptr theCompound);
+
// Extract blocks from blocks compounds
GEOM::ListOfGO* ExplodeCompoundOfBlocks (GEOM::GEOM_Object_ptr theCompound,
const CORBA::Long theMinNbFaces,
const CORBA::Long theDirFace2V,
const CORBA::Long theNbTimesV);
+ // Build groups for Propagation of 1D hypotheses
+ GEOM::ListOfGO* Propagate (GEOM::GEOM_Object_ptr theShape);
+
::GEOMImpl_IBlocksOperations* GetOperations()
{ return (::GEOMImpl_IBlocksOperations*)GetImpl(); }
};
*/
//=============================================================================
GEOM::GEOM_Object_ptr GEOM_IShapesOperations_i::MakeFace
- (GEOM::GEOM_Object_ptr theWire, CORBA::Boolean isPlanarWanted)
+ (GEOM::GEOM_Object_ptr theWire,
+ const CORBA::Boolean isPlanarWanted)
{
GEOM::GEOM_Object_var aGEOMObject;
//=============================================================================
GEOM::GEOM_Object_ptr GEOM_IShapesOperations_i::MakeFaceWires
(const GEOM::ListOfGO& theWires,
- CORBA::Boolean isPlanarWanted)
+ const CORBA::Boolean isPlanarWanted)
{
GEOM::GEOM_Object_var aGEOMObject;
if (aShape.IsNull()) return aGEOMObject._retn();
- //Perform the glueing
+ //Perform the gluing
Handle(GEOM_Object) anObject =
GetOperations()->MakeGlueFaces(aShape, theTolerance);
- if (!GetOperations()->IsDone() || anObject.IsNull())
+ //if (!GetOperations()->IsDone() || anObject.IsNull())
+ // to allow warning
+ if (anObject.IsNull())
return aGEOMObject._retn();
return GetObject(anObject);
const CORBA::Boolean isSorted)
{
GEOM::ListOfGO_var aSeq = new GEOM::ListOfGO;
- if (theShape == NULL) return aSeq._retn();
- Handle(GEOM_Object) aShape = GetOperations()->GetEngine()->GetObject(theShape->GetStudyID(), theShape->GetEntry());
- Handle(TColStd_HSequenceOfTransient) aHSeq = GetOperations()->MakeExplode(aShape, theShapeType, isSorted);
- if (!GetOperations()->IsDone() || aHSeq.IsNull()) return aSeq._retn();
+ if (theShape == NULL) return aSeq._retn();
+
+ Handle(GEOM_Object) aShape = GetOperations()->GetEngine()->GetObject
+ (theShape->GetStudyID(), theShape->GetEntry());
+
+ Handle(TColStd_HSequenceOfTransient) aHSeq =
+ GetOperations()->MakeExplode(aShape, theShapeType, isSorted);
+ if (!GetOperations()->IsDone() || aHSeq.IsNull())
+ return aSeq._retn();
Standard_Integer aLength = aHSeq->Length();
aSeq->length(aLength);
return aSeq._retn();
}
+//=============================================================================
+/*!
+ * SubShapeAllIDs
+ */
+//=============================================================================
+GEOM::ListOfLong* GEOM_IShapesOperations_i::SubShapeAllIDs (GEOM::GEOM_Object_ptr theShape,
+ const CORBA::Long theShapeType,
+ const CORBA::Boolean isSorted)
+{
+ GEOM::ListOfLong_var aSeq = new GEOM::ListOfLong;
+ if (theShape == NULL) return aSeq._retn();
+
+ Handle(GEOM_Object) aShape = GetOperations()->GetEngine()->GetObject
+ (theShape->GetStudyID(), theShape->GetEntry());
+
+ Handle(TColStd_HSequenceOfInteger) aHSeq =
+ GetOperations()->SubShapeAllIDs(aShape, theShapeType, isSorted);
+ if (!GetOperations()->IsDone() || aHSeq.IsNull()) return aSeq._retn();
+
+ Standard_Integer aLength = aHSeq->Length();
+ aSeq->length(aLength);
+ for (Standard_Integer i = 1; i <= aLength; i++)
+ aSeq[i-1] = aHSeq->Value(i);
+
+ return aSeq._retn();
+}
+
//=============================================================================
/*!
* GetSubShape
//=============================================================================
/*!
- * ReverseOrientation
+ * ChangeOrientation
*/
//=============================================================================
GEOM::GEOM_Object_ptr GEOM_IShapesOperations_i::ChangeOrientation
return GetObject(anObject);
}
+//=============================================================================
+/*!
+ * GetFreeFacesIDs
+ */
+//=============================================================================
+GEOM::ListOfLong* GEOM_IShapesOperations_i::GetFreeFacesIDs (GEOM::GEOM_Object_ptr theShape)
+{
+ GEOM::ListOfLong_var aSeq = new GEOM::ListOfLong;
+ if (theShape == NULL) return aSeq._retn();
+
+ Handle(GEOM_Object) aShape = GetOperations()->GetEngine()->GetObject
+ (theShape->GetStudyID(), theShape->GetEntry());
+
+ Handle(TColStd_HSequenceOfInteger) aHSeq =
+ GetOperations()->GetFreeFacesIDs(aShape);
+ if (!GetOperations()->IsDone() || aHSeq.IsNull()) return aSeq._retn();
+
+ Standard_Integer aLength = aHSeq->Length();
+ aSeq->length(aLength);
+ for (Standard_Integer i = 1; i <= aLength; i++)
+ aSeq[i-1] = aHSeq->Value(i);
+
+ return aSeq._retn();
+}
+
+//=============================================================================
+/*!
+ * GetSharedShapes
+ */
+//=============================================================================
+GEOM::ListOfGO* GEOM_IShapesOperations_i::GetSharedShapes
+ (GEOM::GEOM_Object_ptr theShape1,
+ GEOM::GEOM_Object_ptr theShape2,
+ const CORBA::Long theShapeType)
+{
+ GEOM::ListOfGO_var aSeq = new GEOM::ListOfGO;
+ if (theShape1 == NULL ||
+ theShape2 == NULL) return aSeq._retn();
+
+ Handle(GEOM_Object) aShape1 = GetOperations()->GetEngine()->GetObject
+ (theShape1->GetStudyID(), theShape1->GetEntry());
+ Handle(GEOM_Object) aShape2 = GetOperations()->GetEngine()->GetObject
+ (theShape2->GetStudyID(), theShape2->GetEntry());
+
+ if (aShape1.IsNull() ||
+ aShape2.IsNull()) return aSeq._retn();
+
+ Handle(TColStd_HSequenceOfTransient) aHSeq =
+ GetOperations()->GetSharedShapes(aShape1, aShape2, theShapeType);
+ if (!GetOperations()->IsDone() || aHSeq.IsNull())
+ return aSeq._retn();
+
+ Standard_Integer aLength = aHSeq->Length();
+ aSeq->length(aLength);
+ for (Standard_Integer i = 1; i <= aLength; i++)
+ aSeq[i-1] = GetObject(Handle(GEOM_Object)::DownCast(aHSeq->Value(i)));
+
+ return aSeq._retn();
+}
+
+//=============================================================================
+/*!
+ * GetShapesOnPlane
+ */
+//=============================================================================
+GEOM::GEOM_Object_ptr GEOM_IShapesOperations_i::GetShapesOnPlane
+ (GEOM::GEOM_Object_ptr theShape,
+ const CORBA::Long theShapeType,
+ GEOM::GEOM_Object_ptr thePlane)
+{
+ GEOM::GEOM_Object_var aGEOMObject;
+
+ //Set a not done flag
+ GetOperations()->SetNotDone();
+
+ if (theShape == NULL ||
+ thePlane == NULL) return aGEOMObject._retn();
+
+ //Get the reference objects
+ Handle(GEOM_Object) aShape = GetOperations()->GetEngine()->GetObject
+ (theShape->GetStudyID(), theShape->GetEntry());
+ Handle(GEOM_Object) aPlane = GetOperations()->GetEngine()->GetObject
+ (thePlane->GetStudyID(), thePlane->GetEntry());
+
+ if (aShape.IsNull() ||
+ aPlane.IsNull()) return aGEOMObject._retn();
+
+ //Get Shapes On Plane
+ Handle(GEOM_Object) anObject =
+ GetOperations()->GetShapesOnPlane(aShape, theShapeType, aPlane);
+ if (!GetOperations()->IsDone() || anObject.IsNull())
+ return aGEOMObject._retn();
+
+ return GetObject(anObject);
+}
+
+//=============================================================================
+/*!
+ * GetShapesOnCylinder
+ */
+//=============================================================================
+GEOM::GEOM_Object_ptr GEOM_IShapesOperations_i::GetShapesOnCylinder
+ (GEOM::GEOM_Object_ptr theShape,
+ const CORBA::Long theShapeType,
+ GEOM::GEOM_Object_ptr theAxis,
+ const CORBA::Double theRadius)
+{
+ GEOM::GEOM_Object_var aGEOMObject;
+
+ //Set a not done flag
+ GetOperations()->SetNotDone();
+
+ if (theShape == NULL ||
+ theAxis == NULL) return aGEOMObject._retn();
+
+ //Get the reference objects
+ Handle(GEOM_Object) aShape = GetOperations()->GetEngine()->GetObject
+ (theShape->GetStudyID(), theShape->GetEntry());
+ Handle(GEOM_Object) anAxis = GetOperations()->GetEngine()->GetObject
+ (theAxis->GetStudyID(), theAxis->GetEntry());
+
+ if (aShape.IsNull() ||
+ anAxis.IsNull()) return aGEOMObject._retn();
+
+ //Get Shapes On Cylinder
+ Handle(GEOM_Object) anObject =
+ GetOperations()->GetShapesOnCylinder(aShape, theShapeType, anAxis, theRadius);
+ if (!GetOperations()->IsDone() || anObject.IsNull())
+ return aGEOMObject._retn();
+
+ return GetObject(anObject);
+}
+
+//=============================================================================
+/*!
+ * GetShapesOnSphere
+ */
+//=============================================================================
+GEOM::GEOM_Object_ptr GEOM_IShapesOperations_i::GetShapesOnSphere
+ (GEOM::GEOM_Object_ptr theShape,
+ const CORBA::Long theShapeType,
+ GEOM::GEOM_Object_ptr theCenter,
+ const CORBA::Double theRadius)
+{
+ GEOM::GEOM_Object_var aGEOMObject;
+
+ //Set a not done flag
+ GetOperations()->SetNotDone();
+
+ if (theShape == NULL ||
+ theCenter == NULL) return aGEOMObject._retn();
+
+ //Get the reference objects
+ Handle(GEOM_Object) aShape = GetOperations()->GetEngine()->GetObject
+ (theShape->GetStudyID(), theShape->GetEntry());
+ Handle(GEOM_Object) aCenter = GetOperations()->GetEngine()->GetObject
+ (theCenter->GetStudyID(), theCenter->GetEntry());
+
+ if (aShape.IsNull() ||
+ aCenter.IsNull()) return aGEOMObject._retn();
+
+ //Get Shapes On Sphere
+ Handle(GEOM_Object) anObject =
+ GetOperations()->GetShapesOnSphere(aShape, theShapeType, aCenter, theRadius);
+ if (!GetOperations()->IsDone() || anObject.IsNull())
+ return aGEOMObject._retn();
+
+ return GetObject(anObject);
+}
+
+//=============================================================================
+/*!
+ * GetInPlace
+ */
+//=============================================================================
+GEOM::GEOM_Object_ptr GEOM_IShapesOperations_i::GetInPlace
+ (GEOM::GEOM_Object_ptr theShapeWhere,
+ GEOM::GEOM_Object_ptr theShapeWhat)
+{
+ GEOM::GEOM_Object_var aGEOMObject;
+
+ //Set a not done flag
+ GetOperations()->SetNotDone();
+
+ if (theShapeWhere == NULL ||
+ theShapeWhat == NULL) return aGEOMObject._retn();
+
+ //Get the reference objects
+ Handle(GEOM_Object) aShapeWhere = GetOperations()->GetEngine()->GetObject
+ (theShapeWhere->GetStudyID(), theShapeWhere->GetEntry());
+ Handle(GEOM_Object) aShapeWhat = GetOperations()->GetEngine()->GetObject
+ (theShapeWhat->GetStudyID(), theShapeWhat->GetEntry());
+
+ if (aShapeWhere.IsNull() ||
+ aShapeWhat.IsNull()) return aGEOMObject._retn();
+
+ //Get Shapes in place of aShapeWhat
+ Handle(GEOM_Object) anObject =
+ GetOperations()->GetInPlace(aShapeWhere, aShapeWhat);
+ if (!GetOperations()->IsDone() || anObject.IsNull())
+ return aGEOMObject._retn();
+
+ return GetObject(anObject);
+}
public virtual GEOM_IOperations_i
{
public:
- GEOM_IShapesOperations_i (PortableServer::POA_ptr thePOA, GEOM::GEOM_Gen_ptr theEngine,
+ GEOM_IShapesOperations_i (PortableServer::POA_ptr thePOA,
+ GEOM::GEOM_Gen_ptr theEngine,
::GEOMImpl_IShapesOperations* theImpl);
~GEOM_IShapesOperations_i();
GEOM::GEOM_Object_ptr MakeWire (const GEOM::ListOfGO& theEdgesAndWires);
GEOM::GEOM_Object_ptr MakeFace (GEOM::GEOM_Object_ptr theWire,
- CORBA::Boolean isPlanarWanted);
+ const CORBA::Boolean isPlanarWanted);
GEOM::GEOM_Object_ptr MakeFaceWires (const GEOM::ListOfGO& theWires,
- CORBA::Boolean isPlanarWanted);
+ const CORBA::Boolean isPlanarWanted);
GEOM::GEOM_Object_ptr MakeShell (const GEOM::ListOfGO& theFacesAndShells);
const CORBA::Double theTolerance);
GEOM::ListOfGO* MakeExplode (GEOM::GEOM_Object_ptr theShape,
- const CORBA::Long theShapeType,
- const CORBA::Boolean isSorted);
+ const CORBA::Long theShapeType,
+ const CORBA::Boolean isSorted);
+
+ GEOM::ListOfLong* SubShapeAllIDs (GEOM::GEOM_Object_ptr theShape,
+ const CORBA::Long theShapeType,
+ const CORBA::Boolean isSorted);
GEOM::GEOM_Object_ptr GetSubShape (GEOM::GEOM_Object_ptr theMainShape,
const CORBA::Long theID);
GEOM::GEOM_Object_ptr ChangeOrientation (GEOM::GEOM_Object_ptr theShape);
+ GEOM::ListOfLong* GetFreeFacesIDs (GEOM::GEOM_Object_ptr theShape);
+
+ GEOM::ListOfGO* GetSharedShapes (GEOM::GEOM_Object_ptr theShape1,
+ GEOM::GEOM_Object_ptr theShape2,
+ const CORBA::Long theShapeType);
+
+ GEOM::GEOM_Object_ptr GetShapesOnPlane (GEOM::GEOM_Object_ptr theShape,
+ const CORBA::Long theShapeType,
+ GEOM::GEOM_Object_ptr thePlane);
+
+ GEOM::GEOM_Object_ptr GetShapesOnCylinder (GEOM::GEOM_Object_ptr theShape,
+ const CORBA::Long theShapeType,
+ GEOM::GEOM_Object_ptr theAxis,
+ const CORBA::Double theRadius);
+
+ GEOM::GEOM_Object_ptr GetShapesOnSphere (GEOM::GEOM_Object_ptr theShape,
+ const CORBA::Long theShapeType,
+ GEOM::GEOM_Object_ptr theCenter,
+ const CORBA::Double theRadius);
+
+ GEOM::GEOM_Object_ptr GetInPlace (GEOM::GEOM_Object_ptr theShapeWhere,
+ GEOM::GEOM_Object_ptr theShapeWhat);
+
::GEOMImpl_IShapesOperations* GetOperations()
{ return (::GEOMImpl_IShapesOperations*)GetImpl(); }
};
# additionnal information to compil and link file
CPPFLAGS += $(OCC_INCLUDES) $(QT_INCLUDES) -I${KERNEL_ROOT_DIR}/include/salome $(BOOST_CPPFLAGS)
CXXFLAGS += $(OCC_CXXFLAGS) -I${KERNEL_ROOT_DIR}/include/salome
-LDFLAGS += -lGEOMEngine -lSalomeNS -lSalomeContainer -L${KERNEL_ROOT_DIR}/lib/salome -lSalomeGenericObj
+LDFLAGS += -lGEOMEngine -lSalomeNS -lSalomeLifeCycleCORBA -lSalomeContainer -L${KERNEL_ROOT_DIR}/lib/salome -lSalomeGenericObj
# additional file to be cleaned
MOSTLYCLEAN =
# Module : GEOM
# $Header$
-def GetFaceNearPoint (geompy, block, pnt):
- anObj = geompy.BlocksOp.GetFaceNearPoint(block, pnt)
- if anObj is None:
- print "GetFaceNearPoint : ", geompy.BlocksOp.GetErrorCode()
- return anObj
-
-def GetOppositeFace (geompy, block, face):
- anObj = geompy.BlocksOp.GetOppositeFace(block, face)
- if anObj is None:
- print "GetOppositeFace : ", geompy.BlocksOp.GetErrorCode()
- return anObj
-
-def GetFaceByNormale (geompy, block, vec):
- anObj = geompy.BlocksOp.GetFaceByNormale(block, vec)
- if anObj is None:
- print "GetFaceByNormale : ", geompy.BlocksOp.GetErrorCode()
- return anObj
-
-def GetBlockNearPoint (geompy, comp, pnt):
- anObj = geompy.BlocksOp.GetBlockNearPoint(comp, pnt)
- if anObj is None:
- print "GetBlockNearPoint : ", geompy.BlocksOp.GetErrorCode()
- return anObj
-
############# MakeSpanner #############
def MakeSpanner (salome, geompy, math, isBlocksTest = 0, isMeshTest = 0, smesh = None, hasGUI = 0):
Edge21 = geompy.MakeEdge(p_15_0, p_15_20)
id_edge21 = geompy.addToStudy(Edge21, "1 Edge for Block 2")
- Edge22 = BlocksOp.GetEdge(Block1, p_10_0, p_10_25)
- if Edge22 is None:
- print "BlocksOp.GetEdge(Block1, p_10_0, p_10_25) : ", BlocksOp.GetErrorCode()
+ Edge22 = geompy.GetEdge(Block1, p_10_0, p_10_25)
id_edge22 = geompy.addToStudy(Edge22, "2 Edge for Block 2")
Face21 = geompy.MakeQuad2Edges(Edge21, Edge22);
p_15_10_1 = geompy.MakeVertex(15., 10., 1.)
- Face31 = GetFaceNearPoint(geompy, Block2, p_15_10_1)
+ Face31 = geompy.GetFaceNearPoint(Block2, p_15_10_1)
id_face31 = geompy.addToStudy(Face31, "1 Face for Block 3")
Prism1 = geompy.MakePrismVecH(Face31, vx, 5);
### Block 4 ###
- Face41 = GetOppositeFace(geompy, Block3, Face31)
+ Face41 = geompy.GetOppositeFace(Block3, Face31)
id_face41 = geompy.addToStudy(Face41, "1 Face for Block 4")
p_25_5 = geompy.MakeVertex(25., 5., 0.)
p_30_0_1 = geompy.MakeVertex(30., 0., 1.)
- Face2s = GetFaceNearPoint(geompy, Block1s, p_30_0_1)
+ Face2s = geompy.GetFaceNearPoint(Block1s, p_30_0_1)
id_face2s = geompy.addToStudy(Face2s, "2 Face of Block 1s")
f2s_ind = geompy.LocalOp.GetSubShapeIndex(Block1s, Face2s)
p_55_0_1 = geompy.MakeVertex(55., 0., 1.)
p_55_110_1 = geompy.MakeVertex(55., -110., 1.)
- Face11l = GetFaceNearPoint(geompy, Block5, p_55_0_1)
+ Face11l = geompy.GetFaceNearPoint(Block5, p_55_0_1)
id_face11l = geompy.addToStudy(Face11l, "1 Face for Linking Block 1")
- Face12l = GetFaceNearPoint(geompy, Gear, p_55_110_1)
+ Face12l = geompy.GetFaceNearPoint(Gear, p_55_110_1)
id_face12l = geompy.addToStudy(Face12l, "2 Face for Linking Block 1")
Block1l = geompy.MakeHexa2Faces(Face11l, Face12l)
p_25_0_1 = geompy.MakeVertex(25., 0., 1.)
p_45_110_1 = geompy.MakeVertex(45., -110., 1.)
- Face21l = GetFaceNearPoint(geompy, Block4, p_25_0_1)
+ Face21l = geompy.GetFaceNearPoint(Block4, p_25_0_1)
id_face21l = geompy.addToStudy(Face21l, "1 Face for Linking Block 2")
- Face22l = GetFaceNearPoint(geompy, Gear, p_45_110_1)
+ Face22l = geompy.GetFaceNearPoint(Gear, p_45_110_1)
id_face22l = geompy.addToStudy(Face22l, "2 Face for Linking Block 2")
Block2l = geompy.MakeHexa2Faces(Face21l, Face22l)
p_55_30_1 = geompy.MakeVertex(55., 30., 1.)
p_65_110_1 = geompy.MakeVertex(65., -110., 1.)
- Face31l = GetFaceNearPoint(geompy, Mirror1, p_55_30_1)
+ Face31l = geompy.GetFaceNearPoint(Mirror1, p_55_30_1)
id_face31l = geompy.addToStudy(Face31l, "1 Face for Linking Block 3")
- Face32l = GetFaceNearPoint(geompy, Gear, p_65_110_1)
+ Face32l = geompy.GetFaceNearPoint(Gear, p_65_110_1)
id_face32l = geompy.addToStudy(Face32l, "2 Face for Linking Block 3")
Block3l = geompy.MakeHexa2Faces(Face31l, Face32l)
Handle = geompy.MakeGlueFaces(CompLB, 1e-5)
id_handle = geompy.addToStudy(Handle, "Handle")
- Block1h = GetBlockNearPoint(geompy, Handle, p_45_110_1)
+ Block1h = geompy.GetBlockNearPoint(Handle, p_45_110_1)
id_block1h = geompy.addToStudyInFather(Handle, Block1h, "Block 1 of Handle")
- Block2h = GetBlockNearPoint(geompy, Handle, p_65_110_1)
+ Block2h = geompy.GetBlockNearPoint(Handle, p_65_110_1)
id_block2h = geompy.addToStudyInFather(Handle, Block2h, "Block 2 of Handle")
- Face11h = GetFaceByNormale(geompy, Block1h, vx)
+ Face11h = geompy.GetFaceByNormale(Block1h, vx)
id_face11h = geompy.addToStudyInFather(Block1h, Face11h, "Face 1")
- Face12h = GetOppositeFace(geompy, Block1h, Face11h)
+ Face12h = geompy.GetOppositeFace(Block1h, Face11h)
id_face12h = geompy.addToStudyInFather(Block1h, Face12h, "Face 2")
- Face21h = GetFaceByNormale(geompy, Block2h, vx)
+ Face21h = geompy.GetFaceByNormale(Block2h, vx)
id_face21h = geompy.addToStudyInFather(Block2h, Face21h, "Face 1")
- Face22h = GetOppositeFace(geompy, Block2h, Face21h)
+ Face22h = geompy.GetOppositeFace(Block2h, Face21h)
id_face22h = geompy.addToStudyInFather(Block2h, Face22h, "Face 2")
Block3h = BlocksOp.GetBlockByParts(Handle, [Face11h, Face21h])
### Check the Spanner ###
- isCompOfBlocks6 = BlocksOp.IsCompoundOfBlocks(Spanner, 6, 6)
+ isCompOfBlocks6 = BlocksOp.CheckCompoundOfBlocks(Spanner)
if isCompOfBlocks6 == 0:
print "Spanner is not a compound of hexahedral solids"
else:
### Get Blocks 4 and 5 from the spanner ###
- Face42_sp = BlocksOp.GetFaceByEdges(Spanner, Edge41, Edge42)
- if Face42_sp is None:
- print "BlocksOp.GetFaceByEdges(Spanner, Edge41, Edge42) : ", BlocksOp.GetErrorCode()
+ Face42_sp = geompy.GetFaceByEdges(Spanner, Edge41, Edge42)
id_face42_sp = geompy.addToStudyInFather(Spanner, Face42_sp, "Face 4_2")
- Blocks_f4_sp = BlocksOp.GetBlocksByParts(Spanner, [Face42_sp])
- if Blocks_f4_sp is None:
- print "BlocksOp.GetBlocksByParts() : ", BlocksOp.GetErrorCode()
+ Blocks_f4_sp = geompy.GetBlocksByParts(Spanner, [Face42_sp])
+
+ isMRot2D = 0
for aBlock in Blocks_f4_sp:
name = geompy.SubShapeName(aBlock, Spanner)
f42_sp_ind = geompy.LocalOp.GetSubShapeIndex(aBlock, Face42_sp)
- Face_5_horiz = GetFaceByNormale(geompy, aBlock, vz)
+ Face_5_horiz = geompy.GetFaceByNormale(aBlock, vz)
f_5_horiz_ind = geompy.LocalOp.GetSubShapeIndex(aBlock, Face_5_horiz)
MRot = geompy.MakeMultiTransformation2D(aBlock, f42_sp_ind, 0, 3, f_5_horiz_ind, 0, 5)
if MRot is not None:
+ isMRot2D = 1
p_z100 = geompy.MakeVertex(0., 0., 100.)
MRot_tr = geompy.MakeTranslationTwoPoints(MRot, p0, p_z100)
id_MRot_tr = geompy.addToStudy(MRot_tr, "Multi-rotated block 5")
- if BlocksOp.IsDone() == 0:
- print "Operation failed"
+ if isMRot2D == 0:
+ print "2D Multi Transformation failed"
### Get one face of the Gear ###
p_40_0_tr = geompy.MakeTranslationTwoPoints(p_40_0 , p0, p_60_150_0)
p_40_0_r_tr = geompy.MakeTranslationTwoPoints(p_40_0_r, p0, p_60_150_0)
- Face_g_1 = BlocksOp.GetFaceByPoints(Gear, p_20_0_tr, p_20_0_r_tr, p_40_0_tr, p_40_0_r_tr)
- if Face_g_1 is None:
- print "BlocksOp.GetFaceByPoints(Gear, ...) : ", BlocksOp.GetErrorCode()
+ Face_g_1 = geompy.GetFaceByPoints(Gear, p_20_0_tr, p_20_0_r_tr, p_40_0_tr, p_40_0_r_tr)
id_face_g_1 = geompy.addToStudyInFather(Gear, Face_g_1, "Face of Gear by four points")
edgesNb = geompy.ShapesOp.NumberOfEdges(Face_g_1)
# ---- add a middle block of spanner handle in study
p_45_0_1 = geompy.MakeVertex(45., 0., 1.)
- BlockMh = GetBlockNearPoint(geompy, Spanner, p_45_0_1)
+ BlockMh = geompy.GetBlockNearPoint(Spanner, p_45_0_1)
id_blockMh = geompy.addToStudyInFather(Spanner, BlockMh, "Middle Block of Spanner Handle")
# ---- add the top face of the middle block in study
- FaceTop = GetFaceByNormale(geompy, BlockMh, vz)
+ FaceTop = geompy.GetFaceByNormale(BlockMh, vz)
id_facetop = geompy.addToStudyInFather(BlockMh, FaceTop, "Top Face")
# ---- add long edges of the top face in study
#Transform objects
Translation = geompy.MakeTranslationTwoPoints(Box, px, pz) #(3 GEOM_Object_ptr)->GEOM_Object_ptr
+ TranslVect = geompy.MakeTranslationVector(Box, vxyz) #(2 GEOM_Object_ptr)->GEOM_Object_ptr
Rotation = geompy.MakeRotation(Box, vz, angle1) #(2 GEOM_Object_ptr, Double)->GEOM_Object_ptr
Scale = geompy.MakeScaleTransform(Box, p0, factor) #
Mirror = geompy.MakeMirrorByPlane(Box, Plane) #(2 GEOM_Object_ptr)->GEOM_Object_ptr
+ MirrorAxis = geompy.MakeMirrorByAxis(Box, Line1) #
+ MirrorPnt = geompy.MakeMirrorByPoint(Box, p200) #
Position = geompy.MakePosition(Box, cs1, cs2) #(3 GEOM_Object_ptr)->GEOM_Object_ptr
Offset = geompy.MakeOffset(Box, 10.) #(GEOM_Object_ptr, Double)->GEOM_Object_ptr
Orientation = geompy.ChangeOrientation(Box)
print "CheckShape(Prism) = ", CheckShape
#Partition objects
- Partition = geompy.MakePartition([Box], [Plane]) #(2 Lists Of GEOM_Object_ptr)->GEOM_Object_ptr
+ Partition = geompy.MakePartition([Box], [Plane]) #(2 Lists Of GEOM_Object_ptr)->GEOM_Object_ptr
+ Partition1 = geompy.MakeHalfPartition(Box, Plane) #(2 GEOM_Object_ptr)->GEOM_Object_ptr
#Add In Study
id_Sewing = geompy.addToStudy(Sewing, "Sewing")
id_Translation = geompy.addToStudy(Translation, "Translation")
+ id_TranslVect = geompy.addToStudy(TranslVect , "Translation along vector")
id_Rotation = geompy.addToStudy(Rotation, "Rotation")
id_Scale = geompy.addToStudy(Scale, "Scale")
- id_Mirror = geompy.addToStudy(Mirror, "Mirror")
+ id_Mirror = geompy.addToStudy(Mirror, "Mirror by Plane")
+ id_MirrorAxis = geompy.addToStudy(MirrorAxis, "Mirror by Axis")
+ id_MirrorPnt = geompy.addToStudy(MirrorPnt, "Mirror by Point")
id_Position = geompy.addToStudy(Position, "Positioned box")
id_Offset = geompy.addToStudy(Offset, "Offset")
id_Orientation = geompy.addToStudy(Orientation, "Orientation")
id_CDG = geompy.addToStudy(CDG, "CDG")
id_Archimede = geompy.addToStudy(Archimede, "Archimede")
- id_Partition = geompy.addToStudy(Partition, "Partition")
+ id_Partition = geompy.addToStudy(Partition, "Partition")
+ id_Partition1 = geompy.addToStudy(Partition1, "Half Partition")
#Decompose objects
SubFace = geompy.SubShape(Box, geompy.ShapeType["FACE"], [2])
id_ImportIGES = geompy.addToStudy(ImportIGES, "ImportIGES")
id_ImportSTEP = geompy.addToStudy(ImportSTEP, "ImportSTEP")
+ # NumberOfFaces
+ NumberOfFaces = geompy.NumberOfFaces(Box)
+ if NumberOfFaces != 6:
+ print "Bad number of faces in BOX!"
+
+ # NumberOfEdges
+ NumberOfEdges = geompy.NumberOfEdges(Box)
+ if NumberOfEdges != 12:
+ print "Bad number of edges in BOX!"
+
# MakeBlockExplode
Compound = geompy.MakeCompound([Box, Sphere])
MakeBlockExplode = geompy.MakeBlockExplode(Compound, 6, 6)
print "Group of Box's faces includes the following IDs:"
for ObjectID in GetObjectIDs:
print " ", ObjectID
+
+ BoxCopy = geompy.GetMainShape(CreateGroup)
+
+ # -----------------------------------------------------------------------------
+ # enumeration ShapeTypeString as a dictionary
+ # -----------------------------------------------------------------------------
+ ShapeTypeString = {'0':"COMPOUND", '1':"COMPSOLID", '2':"SOLID", '3':"SHELL", '4':"FACE", '5':"WIRE", '6':"EDGE", '7':"VERTEX", '8':"SHAPE"}
+
+ GroupType = geompy.GetType(CreateGroup)
+ print "Type of elements of the created group is ", ShapeTypeString[`GroupType`]
+
+ # Prepare data for the following operations
+ p0 = geompy.MakeVertex(0, 0, 0)
+ b0 = geompy.MakeBox(-50, -50, -50, 50, 50, 50)
+ s0 = geompy.MakeSphereR(100)
+
+ id_b0 = geompy.addToStudy(b0, "b0")
+ id_s0 = geompy.addToStudy(s0, "s0")
+
+ v_0pp = geompy.MakeVectorDXDYDZ( 0, 1, 1)
+ v_0np = geompy.MakeVectorDXDYDZ( 0, -1, 1)
+ v_p0p = geompy.MakeVectorDXDYDZ( 1, 0, 1)
+ v_n0p = geompy.MakeVectorDXDYDZ(-1, 0, 1)
+ v_pp0 = geompy.MakeVectorDXDYDZ( 1, 1, 0)
+ v_np0 = geompy.MakeVectorDXDYDZ(-1, 1, 0)
+
+ pln_0pp = geompy.MakePlane(p0, v_0pp, 200)
+ pln_0np = geompy.MakePlane(p0, v_0np, 200)
+ pln_p0p = geompy.MakePlane(p0, v_p0p, 200)
+ pln_n0p = geompy.MakePlane(p0, v_n0p, 200)
+ pln_pp0 = geompy.MakePlane(p0, v_pp0, 200)
+ pln_np0 = geompy.MakePlane(p0, v_np0, 200)
+
+ part_tool = geompy.MakePartition([b0, pln_0pp, pln_0np, pln_p0p, pln_n0p, pln_pp0, pln_np0],
+ [],
+ [],
+ [b0])
+ id_part_tool = geompy.addToStudy(part_tool, "part_tool")
+
+ part = geompy.MakePartition([s0], [part_tool])
+ geompy.addToStudy(part, "part")
+
+ # GetFreeFacesIDs
+ anIDs = geompy.GetFreeFacesIDs(part)
+ freeFaces = geompy.GetSubShape(part, anIDs)
+
+ geompy.addToStudy(freeFaces, "freeFaces")
+
+ # RemoveExtraEdges
+ freeFacesWithoutExtra = geompy.RemoveExtraEdges(freeFaces)
+
+ geompy.addToStudy(freeFacesWithoutExtra, "freeFacesWithoutExtra")
+
+ # GetSharedShapes
+ sharedFaces = geompy.GetSharedShapes(part, freeFacesWithoutExtra, geompy.ShapeType["FACE"])
+
+ for shFace in sharedFaces:
+ geompy.addToStudy(shFace, "sharedFace")
+
+ # CheckAndImprove
+ blocksComp = geompy.CheckAndImprove(part)
+
+ geompy.addToStudy(blocksComp, "blocksComp")
+
+ # Propagate
+ listChains = geompy.Propagate(blocksComp)
+
+ for chain in listChains:
+ geompy.addToStudyInFather(blocksComp, chain, "propagation chain")
+
+ # GetPoint(theShape, theX, theY, theZ, theEpsilon)
+ #
+ # (-50, 50, 50) .-----. (50, 50, 50)
+ # pb0_top_1 | |
+ # | . pmidle
+ # | |
+ # (-50, -50, 50) '-----' (50, -50, 50)
+ #
+ pb0_top_1 = geompy.GetPoint(blocksComp, -50, 50, 50, 0.01)
+ pb0_bot_1 = geompy.GetPoint(blocksComp, -50, -50, -50, 0.01)
+
+ geompy.addToStudyInFather(blocksComp, pb0_top_1, "point from blocksComp (-50, 50, 50)")
+ geompy.addToStudyInFather(blocksComp, pb0_bot_1, "point from blocksComp (-50, -50, -50)")
+
+ # GetEdgeNearPoint(theShape, thePoint)
+ pmidle = geompy.MakeVertex(50, 0, 50)
+ edge1 = geompy.GetEdgeNearPoint(blocksComp, pmidle)
+
+ geompy.addToStudyInFather(blocksComp, edge1, "edge near point (50, 0, 50)")
+
+ # GetBlockByParts(theCompound, theParts)
+ b0_image = geompy.GetBlockByParts(blocksComp, [pb0_top_1, pb0_bot_1, edge1])
+
+ geompy.addToStudyInFather(blocksComp, b0_image, "b0 image")
+
+ # GetShapesOnPlane(theShape, theShapeType, thePlane)
+ # GetShapesOnCylinder(theShape, theShapeType, theAxis, theRadius)
+ # GetShapesOnSphere(theShape, theShapeType, theCenter, theRadius)
+
+ # GetInPlace(theShapeWhere, theShapeWhat)
# Basic primitives
# -----------------------------------------------------------------------------
-def MakeVertex(x,y,z):
- anObj = BasicOp.MakePointXYZ(x,y,z)
+def MakeVertex(theX, theY, theZ):
+ anObj = BasicOp.MakePointXYZ(theX, theY, theZ)
if BasicOp.IsDone() == 0:
print "MakePointXYZ : ", BasicOp.GetErrorCode()
return anObj
print "MakeCompound : ", ShapesOp.GetErrorCode()
return anObj
+def NumberOfFaces(theShape):
+ nb_faces = ShapesOp.NumberOfFaces(theShape)
+ if ShapesOp.IsDone() == 0:
+ print "NumberOfFaces : ", ShapesOp.GetErrorCode()
+ return nb_faces
+
+def NumberOfEdges(theShape):
+ nb_edges = ShapesOp.NumberOfEdges(theShape)
+ if ShapesOp.IsDone() == 0:
+ print "NumberOfEdges : ", ShapesOp.GetErrorCode()
+ return nb_edges
+
def ChangeOrientation(Shape):
anObj = ShapesOp.ChangeOrientation(Shape)
if ShapesOp.IsDone() == 0:
anObj = ChangeOrientation(Shape)
return anObj
+def GetFreeFacesIDs(theShape):
+ anIDs = ShapesOp.GetFreeFacesIDs(theShape)
+ if ShapesOp.IsDone() == 0:
+ print "GetFreeFacesIDs : ", ShapesOp.GetErrorCode()
+ return anIDs
+
+def GetSharedShapes(theShape1, theShape2, theShapeType):
+ aList = ShapesOp.GetSharedShapes(theShape1, theShape2, theShapeType)
+ if ShapesOp.IsDone() == 0:
+ print "GetSharedShapes : ", ShapesOp.GetErrorCode()
+ return aList
+
+#def GetShapesOnPlane(theShape, theShapeType, thePlane):
+# anObj = ShapesOp.GetShapesOnPlane(theShape, theShapeType, thePlane)
+# if ShapesOp.IsDone() == 0:
+# print "GetShapesOnPlane : ", ShapesOp.GetErrorCode()
+# return anObj
+#
+#def GetShapesOnCylinder(theShape, theShapeType, theAxis, theRadius):
+# anObj = ShapesOp.GetShapesOnCylinder(theShape, theShapeType, theAxis, theRadius)
+# if ShapesOp.IsDone() == 0:
+# print "GetShapesOnCylinder : ", ShapesOp.GetErrorCode()
+# return anObj
+#
+#def GetShapesOnSphere(theShape, theShapeType, theCenter, theRadius):
+# anObj = ShapesOp.GetShapesOnSphere(theShape, theShapeType, theCenter, theRadius)
+# if ShapesOp.IsDone() == 0:
+# print "GetShapesOnSphere : ", ShapesOp.GetErrorCode()
+# return anObj
+#
+#def GetInPlace(theShapeWhere, theShapeWhat):
+# anObj = ShapesOp.GetInPlace(theShapeWhere, theShapeWhat)
+# if ShapesOp.IsDone() == 0:
+# print "GetInPlace : ", ShapesOp.GetErrorCode()
+# return anObj
+
# -----------------------------------------------------------------------------
# Access to sub-shapes by their unique IDs inside the main shape.
# -----------------------------------------------------------------------------
print "MakeExplode : ", ShapesOp.GetErrorCode()
return ListObj
-def SubShapeAllSorted(aShape,aType):
+def SubShapeAllIDs(aShape, aType):
+ ListObj = ShapesOp.SubShapeAllIDs(aShape,aType,0)
+ if ShapesOp.IsDone() == 0:
+ print "SubShapeAllIDs : ", ShapesOp.GetErrorCode()
+ return ListObj
+
+def SubShapeAllSorted(aShape, aType):
ListObj = ShapesOp.MakeExplode(aShape,aType,1)
if ShapesOp.IsDone() == 0:
print "MakeExplode : ", ShapesOp.GetErrorCode()
return ListObj
+def SubShapeAllSortedIDs(aShape, aType):
+ ListIDs = ShapesOp.SubShapeAllIDs(aShape,aType,1)
+ if ShapesOp.IsDone() == 0:
+ print "SubShapeAllSortedIDs : ", ShapesOp.GetErrorCode()
+ return ListObj
+
# Obtain a compound of sub-shapes of <aShape>,
# selected by they indices in list of all sub-shapes of type <aType>
def SubShape(aShape, aType, ListOfInd):
Limit, RemoveWebs, ListMaterials);
return anObj
+def MakeHalfPartition(theShape, thePlane):
+ anObj = BoolOp.MakeHalfPartition(theShape, thePlane)
+ if BoolOp.IsDone() == 0:
+ print "MakeHalfPartition : ", BoolOp.GetErrorCode()
+ return anObj
+
# -----------------------------------------------------------------------------
# Transform objects
# -----------------------------------------------------------------------------
print "TranslateDXDYDZCopy : ", TrsfOp.GetErrorCode()
return anObj
+def MakeTranslationVector(theObject, theVector):
+ anObj = TrsfOp.TranslateVectorCopy(theObject, theVector)
+ if TrsfOp.IsDone() == 0:
+ print "TranslateVectorCopy : ", TrsfOp.GetErrorCode()
+ return anObj
+
def MakeRotation(aShape,axis,angle):
anObj = TrsfOp.RotateCopy(aShape,axis,angle)
if TrsfOp.IsDone() == 0:
print "MirrorPlaneCopy : ", TrsfOp.GetErrorCode()
return anObj
+def MakeMirrorByAxis(theObject, theAxis):
+ anObj = TrsfOp.MirrorAxisCopy(theObject, theAxis)
+ if TrsfOp.IsDone() == 0:
+ print "MirrorAxisCopy : ", TrsfOp.GetErrorCode()
+ return anObj
+
+def MakeMirrorByPoint(theObject, thePoint):
+ anObj = TrsfOp.MirrorPointCopy(theObject, thePoint)
+ if TrsfOp.IsDone() == 0:
+ print "MirrorPointCopy : ", TrsfOp.GetErrorCode()
+ return anObj
+
def MakePosition(aShape,theStartLCS,theEndLCS):
anObj = TrsfOp.PositionShapeCopy(aShape,theStartLCS,theEndLCS)
if TrsfOp.IsDone() == 0:
print "MakeHexa2Faces : ", BlocksOp.GetErrorCode()
return anObj
+def GetPoint(theShape, theX, theY, theZ, theEpsilon):
+ anObj = BlocksOp.GetPoint(theShape, theX, theY, theZ, theEpsilon)
+ if BlocksOp.IsDone() == 0:
+ print "GetPoint : ", BlocksOp.GetErrorCode()
+ return anObj
+
+def GetEdge(theShape, thePoint1, thePoint2):
+ anObj = BlocksOp.GetEdge(theShape, thePoint1, thePoint2)
+ if BlocksOp.IsDone() == 0:
+ print "GetEdge : ", BlocksOp.GetErrorCode()
+ return anObj
+
+def GetEdgeNearPoint(theShape, thePoint):
+ anObj = BlocksOp.GetEdgeNearPoint(theShape, thePoint)
+ if BlocksOp.IsDone() == 0:
+ print "GetEdgeNearPoint : ", BlocksOp.GetErrorCode()
+ return anObj
+
+def GetFaceByPoints(theShape, thePoint1, thePoint2, thePoint3, thePoint4):
+ anObj = BlocksOp.GetFaceByPoints(theShape, thePoint1, thePoint2, thePoint3, thePoint4)
+ if BlocksOp.IsDone() == 0:
+ print "GetFaceByPoints : ", BlocksOp.GetErrorCode()
+ return anObj
+
+def GetFaceByEdges(theShape, theEdge1, theEdge2):
+ anObj = BlocksOp.GetFaceByEdges(theShape, theEdge1, theEdge2)
+ if BlocksOp.IsDone() == 0:
+ print "GetFaceByEdges : ", BlocksOp.GetErrorCode()
+ return anObj
+
+def GetOppositeFace(theBlock, theFace):
+ anObj = BlocksOp.GetOppositeFace(theBlock, theFace)
+ if BlocksOp.IsDone() == 0:
+ print "GetOppositeFace : ", BlocksOp.GetErrorCode()
+ return anObj
+
+def GetFaceNearPoint(theShape, thePoint):
+ anObj = BlocksOp.GetFaceNearPoint(theShape, thePoint)
+ if BlocksOp.IsDone() == 0:
+ print "GetFaceNearPoint : ", BlocksOp.GetErrorCode()
+ return anObj
+
+def GetFaceByNormale(theBlock, theVector):
+ anObj = BlocksOp.GetFaceByNormale(theBlock, theVector)
+ if BlocksOp.IsDone() == 0:
+ print "GetFaceByNormale : ", BlocksOp.GetErrorCode()
+ return anObj
+
+def CheckCompoundOfBlocks(theCompound):
+ (IsValid, BCErrors) = BlocksOp.CheckCompoundOfBlocks(theCompound)
+ if BlocksOp.IsDone() == 0:
+ print "CheckCompoundOfBlocks : ", BlocksOp.GetErrorCode()
+ else:
+ if IsValid == 0:
+ Descr = BlocksOp.PrintBCErrors(theCompound, BCErrors)
+ print Descr
+ return IsValid
+
+def RemoveExtraEdges(theShape):
+ anObj = BlocksOp.RemoveExtraEdges(theShape)
+ if BlocksOp.IsDone() == 0:
+ print "RemoveExtraEdges : ", BlocksOp.GetErrorCode()
+ return anObj
+
+def CheckAndImprove(theShape):
+ anObj = BlocksOp.CheckAndImprove(theShape)
+ if BlocksOp.IsDone() == 0:
+ print "CheckAndImprove : ", BlocksOp.GetErrorCode()
+ return anObj
+
+def MakeBlockExplode(theCompound, theMinNbFaces, theMaxNbFaces):
+ aList = BlocksOp.ExplodeCompoundOfBlocks(theCompound, theMinNbFaces, theMaxNbFaces)
+ if BlocksOp.IsDone() == 0:
+ print "MakeBlockExplode : ", BlocksOp.GetErrorCode()
+ return aList
+
+def GetBlockNearPoint(theCompound, thePoint):
+ anObj = BlocksOp.GetBlockNearPoint(theCompound, thePoint)
+ if BlocksOp.IsDone() == 0:
+ print "GetBlockNearPoint : ", BlocksOp.GetErrorCode()
+ return anObj
+
+def GetBlockByParts(theCompound, theParts):
+ anObj = BlocksOp.GetBlockByParts(theCompound, theParts)
+ if BlocksOp.IsDone() == 0:
+ print "GetBlockByParts : ", BlocksOp.GetErrorCode()
+ return anObj
+
+def GetBlocksByParts(theCompound, theParts):
+ aList = BlocksOp.GetBlocksByParts(theCompound, theParts)
+ if BlocksOp.IsDone() == 0:
+ print "GetBlocksByParts : ", BlocksOp.GetErrorCode()
+ return aList
+
def MakeMultiTransformation1D(Block, DirFaceID1, DirFaceID2, NbTimes):
anObj = BlocksOp.MakeMultiTransformation1D(Block, DirFaceID1, DirFaceID2, NbTimes)
if BlocksOp.IsDone() == 0:
print "MakeMultiTransformation2D : ", BlocksOp.GetErrorCode()
return anObj
-def MakeBlockExplode(Compound, MinNbFaces, MaxNbFaces):
- aList = BlocksOp.ExplodeCompoundOfBlocks(Compound, MinNbFaces, MaxNbFaces)
- if BlocksOp.IsDone() == 0:
- print "MakeBlockExplode : ", BlocksOp.GetErrorCode()
- return aList
-
-def CheckCompoundOfBlocks(Compound):
- (IsValid, BCErrors) = BlocksOp.CheckCompoundOfBlocks(Compound)
+def Propagate(theShape):
+ listChains = BlocksOp.Propagate(theShape)
if BlocksOp.IsDone() == 0:
- print "CheckCompoundOfBlocks : ", BlocksOp.GetErrorCode()
- else:
- if IsValid == 0:
- Descr = BlocksOp.PrintBCErrors(Compound, BCErrors)
- print Descr
- return IsValid
+ print "Propagate : ", BlocksOp.GetErrorCode()
+ return listChains
# -----------------------------------------------------------------------------
# Group operations
print "GetObjectIDs : ", GroupOp.GetErrorCode()
return ListIDs
+def GetType(theGroup):
+ aType = GroupOp.GetType(theGroup)
+ if GroupOp.IsDone() == 0:
+ print "GetType : ", GroupOp.GetErrorCode()
+ return aType
+
+def GetMainShape(theGroup):
+ anObj = GroupOp.GetMainShape(theGroup)
+ if GroupOp.IsDone() == 0:
+ print "GetMainShape : ", GroupOp.GetErrorCode()
+ return anObj
+
+# Add Path to the system path
+#
def addPath(Path):
if (sys.path.count(Path) < 1):
sys.path.append(Path)
from salome import *
import GEOM
+"""
+ \namespace geompy
+ \brief Module geompy
+"""
+
g = lcc.FindOrLoadComponent("FactoryServer", "GEOM")
geom = g._narrow( GEOM.GEOM_Gen )
myBuilder = myStudy.NewBuilder()
gg = ImportComponentGUI("GEOM")
-# * Get name for sub-shape aSubObj of shape aMainObj
-#
-# * Example: see GEOM_TestAll.py
-#
+"""
+ * Get name for sub-shape aSubObj of shape aMainObj
+
+ * Example: see GEOM_TestAll.py
+"""
def SubShapeName(aSubObj, aMainObj):
aSubId = orb.object_to_string(aSubObj)
aMainId = orb.object_to_string(aMainObj)
name = gg.getShapeTypeString(aSubId) + "_%d"%(index)
return name
-# * Publish in study aShape with name aName
-#
-# * Example: see GEOM_TestAll.py
-#
+"""
+ * Publish in study aShape with name aName
+
+ * Example: see GEOM_TestAll.py
+"""
def addToStudy(aShape, aName):
try:
aSObject = geom.AddInStudy(myStudy, aShape, aName, None)
return ""
return aShape.GetStudyEntry()
-# * Publish in study aShape with name aName as sub-object of previously published aFather
-#
-# * Example: see GEOM_TestAll.py
-#
+"""
+ * Publish in study aShape with name aName as sub-object of previously published aFather
+
+ * Example: see GEOM_TestAll.py
+"""
def addToStudyInFather(aFather, aShape, aName):
try:
aSObject = geom.AddInStudy(myStudy, aShape, aName, aFather)
# Basic primitives
# -----------------------------------------------------------------------------
-# * Create point by three coordinates.
-# * \param theX The X coordinate of the point.
-# * \param theY The Y coordinate of the point.
-# * \param theZ The Z coordinate of the point.
-# * \return New GEOM_Object, containing the created point.
-#
-# * Example: see GEOM_TestAll.py
-#
+"""
+ * Create point by three coordinates.
+ * \param theX The X coordinate of the point.
+ * \param theY The Y coordinate of the point.
+ * \param theZ The Z coordinate of the point.
+ * \return New GEOM_Object, containing the created point.
+
+ * Example: see GEOM_TestAll.py
+"""
def MakeVertex(theX, theY, theZ):
anObj = BasicOp.MakePointXYZ(theX, theY, theZ)
if BasicOp.IsDone() == 0:
print "MakePointXYZ : ", BasicOp.GetErrorCode()
return anObj
-# * Create a point, distant from the referenced point
-# * on the given distances along the coordinate axes.
-# * \param theReference The referenced point.
-# * \param theX Displacement from the referenced point along OX axis.
-# * \param theY Displacement from the referenced point along OY axis.
-# * \param theZ Displacement from the referenced point along OZ axis.
-# * \return New GEOM_Object, containing the created point.
-#
-# * Example: see GEOM_TestAll.py
-#
+"""
+ * Create a point, distant from the referenced point
+ * on the given distances along the coordinate axes.
+ * \param theReference The referenced point.
+ * \param theX Displacement from the referenced point along OX axis.
+ * \param theY Displacement from the referenced point along OY axis.
+ * \param theZ Displacement from the referenced point along OZ axis.
+ * \return New GEOM_Object, containing the created point.
+
+ * Example: see GEOM_TestAll.py
+"""
def MakeVertexWithRef(theReference, theX, theY, theZ):
anObj = BasicOp.MakePointWithReference(theReference, theX, theY, theZ)
if BasicOp.IsDone() == 0:
print "MakePointWithReference : ", BasicOp.GetErrorCode()
return anObj
-# * Create a point, corresponding to the given parameter on the given curve.
-# * \param theRefCurve The referenced curve.
-# * \param theParameter Value of parameter on the referenced curve.
-# * \return New GEOM_Object, containing the created point.
-#
-# * Example: see GEOM_TestAll.py
-#
+"""
+ * Create a point, corresponding to the given parameter on the given curve.
+ * \param theRefCurve The referenced curve.
+ * \param theParameter Value of parameter on the referenced curve.
+ * \return New GEOM_Object, containing the created point.
+
+ * Example: see GEOM_TestAll.py
+"""
def MakeVertexOnCurve(theRefCurve, theParameter):
anObj = BasicOp.MakePointOnCurve(theRefCurve, theParameter)
if BasicOp.IsDone() == 0:
print "MakePointOnCurve : ", BasicOp.GetErrorCode()
return anObj
-# * Create a vector with the given components.
-# * \param theDX X component of the vector.
-# * \param theDY Y component of the vector.
-# * \param theDZ Z component of the vector.
-# * \return New GEOM_Object, containing the created vector.
-#
-# * Example: see GEOM_TestAll.py
-#
+"""
+ * Create a vector with the given components.
+ * \param theDX X component of the vector.
+ * \param theDY Y component of the vector.
+ * \param theDZ Z component of the vector.
+ * \return New GEOM_Object, containing the created vector.
+
+ * Example: see GEOM_TestAll.py
+"""
def MakeVectorDXDYDZ(theDX, theDY, theDZ):
anObj = BasicOp.MakeVectorDXDYDZ(theDX, theDY, theDZ)
if BasicOp.IsDone() == 0:
print "MakeVectorDXDYDZ : ", BasicOp.GetErrorCode()
return anObj
-# * Create a vector between two points.
-# * \param thePnt1 Start point for the vector.
-# * \param thePnt2 End point for the vector.
-# * \return New GEOM_Object, containing the created vector.
-#
-# * Example: see GEOM_TestAll.py
-#
+"""
+ * Create a vector between two points.
+ * \param thePnt1 Start point for the vector.
+ * \param thePnt2 End point for the vector.
+ * \return New GEOM_Object, containing the created vector.
+
+ * Example: see GEOM_TestAll.py
+"""
def MakeVector(thePnt1, thePnt2):
anObj = BasicOp.MakeVectorTwoPnt(thePnt1, thePnt2)
if BasicOp.IsDone() == 0:
print "MakeVectorTwoPnt : ", BasicOp.GetErrorCode()
return anObj
-# * Create a line, passing through the given point
-# * and parrallel to the given direction
-# * \param thePnt Point. The resulting line will pass through it.
-# * \param theDir Direction. The resulting line will be parallel to it.
-# * \return New GEOM_Object, containing the created line.
-#
-# * Example: see GEOM_TestAll.py
-#
+"""
+ * Create a line, passing through the given point
+ * and parrallel to the given direction
+ * \param thePnt Point. The resulting line will pass through it.
+ * \param theDir Direction. The resulting line will be parallel to it.
+ * \return New GEOM_Object, containing the created line.
+
+ * Example: see GEOM_TestAll.py
+"""
def MakeLine(thePnt, theDir):
anObj = BasicOp.MakeLine(thePnt, theDir)
if BasicOp.IsDone() == 0:
print "MakeLine : ", BasicOp.GetErrorCode()
return anObj
-# * Create a line, passing through the given points
-# * \param thePnt1 First of two points, defining the line.
-# * \param thePnt2 Second of two points, defining the line.
-# * \return New GEOM_Object, containing the created line.
-#
-# * Example: see GEOM_TestAll.py
-#
+"""
+ * Create a line, passing through the given points
+ * \param thePnt1 First of two points, defining the line.
+ * \param thePnt2 Second of two points, defining the line.
+ * \return New GEOM_Object, containing the created line.
+
+ * Example: see GEOM_TestAll.py
+"""
def MakeLineTwoPnt(thePnt1, thePnt2):
anObj = BasicOp.MakeLineTwoPnt(thePnt1, thePnt2)
if BasicOp.IsDone() == 0:
print "MakeLineTwoPnt : ", BasicOp.GetErrorCode()
return anObj
-# * Create a plane, passing through the given point
-# * and normal to the given vector.
-# * \param thePnt Point, the plane has to pass through.
-# * \param theVec Vector, defining the plane normal direction.
-# * \param theTrimSize Half size of a side of quadrangle face, representing the plane.
-# * \return New GEOM_Object, containing the created plane.
-#
-# * Example: see GEOM_TestAll.py
-#
+"""
+ * Create a plane, passing through the given point
+ * and normal to the given vector.
+ * \param thePnt Point, the plane has to pass through.
+ * \param theVec Vector, defining the plane normal direction.
+ * \param theTrimSize Half size of a side of quadrangle face, representing the plane.
+ * \return New GEOM_Object, containing the created plane.
+
+ * Example: see GEOM_TestAll.py
+"""
def MakePlane(thePnt, theVec, theTrimSize):
anObj = BasicOp.MakePlanePntVec(thePnt, theVec, theTrimSize)
if BasicOp.IsDone() == 0:
print "MakePlanePntVec : ", BasicOp.GetErrorCode()
return anObj
-# * Create a plane, passing through the three given points
-# * \param thePnt1 First of three points, defining the plane.
-# * \param thePnt2 Second of three points, defining the plane.
-# * \param thePnt3 Fird of three points, defining the plane.
-# * \param theTrimSize Half size of a side of quadrangle face, representing the plane.
-# * \return New GEOM_Object, containing the created plane.
-#
-# * Example: see GEOM_TestAll.py
-#
+"""
+ * Create a plane, passing through the three given points
+ * \param thePnt1 First of three points, defining the plane.
+ * \param thePnt2 Second of three points, defining the plane.
+ * \param thePnt3 Fird of three points, defining the plane.
+ * \param theTrimSize Half size of a side of quadrangle face, representing the plane.
+ * \return New GEOM_Object, containing the created plane.
+
+ * Example: see GEOM_TestAll.py
+"""
def MakePlaneThreePnt(thePnt1, thePnt2, thePnt3, theTrimSize):
anObj = BasicOp.MakePlaneThreePnt(thePnt1, thePnt2, thePnt3, theTrimSize)
if BasicOp.IsDone() == 0:
print "MakePlaneThreePnt : ", BasicOp.GetErrorCode()
return anObj
-# * Create a plane, similar to the existing one, but with another size of representing face.
-# * \param theFace Referenced plane.
-# * \param theTrimSize New half size of a side of quadrangle face, representing the plane.
-# * \return New GEOM_Object, containing the created plane.
-#
-# * Example: see GEOM_TestAll.py
-#
+"""
+ * Create a plane, similar to the existing one, but with another size of representing face.
+ * \param theFace Referenced plane.
+ * \param theTrimSize New half size of a side of quadrangle face, representing the plane.
+ * \return New GEOM_Object, containing the created plane.
+
+ * Example: see GEOM_TestAll.py
+"""
def MakePlaneFace(theFace, theTrimSize):
anObj = BasicOp.MakePlaneFace(theFace, theTrimSize)
if BasicOp.IsDone() == 0:
print "MakePlaneFace : ", BasicOp.GetErrorCode()
return anObj
-# * Create a local coordinate system.
-# * \param OX,OY,OZ Three coordinates of coordinate system origin.
-# * \param XDX,XDY,XDZ Three components of OX direction
-# * \param YDX,YDY,YDZ Three components of OY direction
-# * \return New GEOM_Object, containing the created coordinate system.
-#
-# * Example: see GEOM_TestAll.py
-#
+"""
+ * Create a local coordinate system.
+ * \param OX,OY,OZ Three coordinates of coordinate system origin.
+ * \param XDX,XDY,XDZ Three components of OX direction
+ * \param YDX,YDY,YDZ Three components of OY direction
+ * \return New GEOM_Object, containing the created coordinate system.
+
+ * Example: see GEOM_TestAll.py
+"""
def MakeMarker(OX,OY,OZ, XDX,XDY,XDZ, YDX,YDY,YDZ):
anObj = BasicOp.MakeMarker(OX,OY,OZ, XDX,XDY,XDZ, YDX,YDY,YDZ)
if BasicOp.IsDone() == 0:
# Curves
# -----------------------------------------------------------------------------
-# * Create an arc of circle, passing through three given points.
-# * \param thePnt1 Start point of the arc.
-# * \param thePnt2 Middle point of the arc.
-# * \param thePnt3 End point of the arc.
-# * \return New GEOM_Object, containing the created arc.
-#
-# * Example: see GEOM_TestAll.py
-#
+"""
+ * Create an arc of circle, passing through three given points.
+ * \param thePnt1 Start point of the arc.
+ * \param thePnt2 Middle point of the arc.
+ * \param thePnt3 End point of the arc.
+ * \return New GEOM_Object, containing the created arc.
+
+ * Example: see GEOM_TestAll.py
+"""
def MakeArc(thePnt1, thePnt2, thePnt3):
anObj = CurvesOp.MakeArc(thePnt1, thePnt2, thePnt3)
if CurvesOp.IsDone() == 0:
print "MakeArc : ", CurvesOp.GetErrorCode()
return anObj
-# * Create a circle with given center, normal vector and radius.
-# * \param thePnt Circle center.
-# * \param theVec Vector, normal to the plane of the circle.
-# * \param theR Circle radius.
-# * \return New GEOM_Object, containing the created circle.
-#
-# * Example: see GEOM_TestAll.py
-#
+"""
+ * Create a circle with given center, normal vector and radius.
+ * \param thePnt Circle center.
+ * \param theVec Vector, normal to the plane of the circle.
+ * \param theR Circle radius.
+ * \return New GEOM_Object, containing the created circle.
+
+ * Example: see GEOM_TestAll.py
+"""
def MakeCircle(thePnt, theVec, theR):
anObj = CurvesOp.MakeCirclePntVecR(thePnt, theVec, theR)
if CurvesOp.IsDone() == 0:
print "MakeCirclePntVecR : ", CurvesOp.GetErrorCode()
return anObj
-# * Create a circle, passing through three given points
-# * \param thePnt1,thePnt2,thePnt3 Points, defining the circle.
-# * \return New GEOM_Object, containing the created circle.
-#
-# * Example: see GEOM_TestAll.py
-#
+"""
+ * Create a circle, passing through three given points
+ * \param thePnt1,thePnt2,thePnt3 Points, defining the circle.
+ * \return New GEOM_Object, containing the created circle.
+
+ * Example: see GEOM_TestAll.py
+"""
def MakeCircleThreePnt(thePnt1, thePnt2, thePnt3):
anObj = CurvesOp.MakeCircleThreePnt(thePnt1, thePnt2, thePnt3)
if CurvesOp.IsDone() == 0:
print "MakeCircleThreePnt : ", CurvesOp.GetErrorCode()
return anObj
-# * Create an ellipse with given center, normal vector and radiuses.
-# * \param thePnt Ellipse center.
-# * \param theVec Vector, normal to the plane of the ellipse.
-# * \param theRMajor Major ellipse radius.
-# * \param theRMinor Minor ellipse radius.
-# * \return New GEOM_Object, containing the created ellipse.
-#
-# * Example: see GEOM_TestAll.py
-#
+"""
+ * Create an ellipse with given center, normal vector and radiuses.
+ * \param thePnt Ellipse center.
+ * \param theVec Vector, normal to the plane of the ellipse.
+ * \param theRMajor Major ellipse radius.
+ * \param theRMinor Minor ellipse radius.
+ * \return New GEOM_Object, containing the created ellipse.
+
+ * Example: see GEOM_TestAll.py
+"""
def MakeEllipse(thePnt, theVec, theRMajor, theRMinor):
anObj = CurvesOp.MakeEllipse(thePnt, theVec, theRMajor, theRMinor)
if CurvesOp.IsDone() == 0:
print "MakeEllipse : ", CurvesOp.GetErrorCode()
return anObj
-# * Create a polyline on the set of points.
-# * \param thePoints Sequence of points for the polyline.
-# * \return New GEOM_Object, containing the created polyline.
-#
-# * Example: see GEOM_TestAll.py
-#
+"""
+ * Create a polyline on the set of points.
+ * \param thePoints Sequence of points for the polyline.
+ * \return New GEOM_Object, containing the created polyline.
+
+ * Example: see GEOM_TestAll.py
+"""
def MakePolyline(thePoints):
anObj = CurvesOp.MakePolyline(thePoints)
if CurvesOp.IsDone() == 0:
print "MakePolyline : ", CurvesOp.GetErrorCode()
return anObj
-# * Create bezier curve on the set of points.
-# * \param thePoints Sequence of points for the bezier curve.
-# * \return New GEOM_Object, containing the created bezier curve.
-#
-# * Example: see GEOM_TestAll.py
-#
+"""
+ * Create bezier curve on the set of points.
+ * \param thePoints Sequence of points for the bezier curve.
+ * \return New GEOM_Object, containing the created bezier curve.
+
+ * Example: see GEOM_TestAll.py
+"""
def MakeBezier(thePoints):
anObj = CurvesOp.MakeSplineBezier(thePoints)
if CurvesOp.IsDone() == 0:
print "MakeSplineBezier : ", CurvesOp.GetErrorCode()
return anObj
-# * Create B-Spline curve on the set of points.
-# * \param thePoints Sequence of points for the B-Spline curve.
-# * \return New GEOM_Object, containing the created B-Spline curve.
-#
-# * Example: see GEOM_TestAll.py
-#
+"""
+ * Create B-Spline curve on the set of points.
+ * \param thePoints Sequence of points for the B-Spline curve.
+ * \return New GEOM_Object, containing the created B-Spline curve.
+
+ * Example: see GEOM_TestAll.py
+"""
def MakeInterpol(thePoints):
anObj = CurvesOp.MakeSplineInterpolation(thePoints)
if CurvesOp.IsDone() == 0:
print "MakeSplineInterpolation : ", CurvesOp.GetErrorCode()
return anObj
-# * Create a sketcher (wire or face), following the textual description,
-# * passed through \a theCommand argument. \n
-# * Edges of the resulting wire or face will be arcs of circles and/or linear segments. \n
-# * Format of the description string have to be the following:
-# *
-# * "Sketcher[:F x1 y1]:CMD[:CMD[:CMD...]]"
-# *
-# * Where:
-# * - x1, y1 are coordinates of the first sketcher point (zero by default),
-# * - CMD is one of
-# * - "R angle" : Set the direction by angle
-# * - "D dx dy" : Set the direction by DX & DY
-# * .
-# * \n
-# * - "TT x y" : Create segment by point at X & Y
-# * - "T dx dy" : Create segment by point with DX & DY
-# * - "L length" : Create segment by direction & Length
-# * - "IX x" : Create segment by direction & Intersect. X
-# * - "IY y" : Create segment by direction & Intersect. Y
-# * .
-# * \n
-# * - "C radius length" : Create arc by direction, radius and length(in degree)
-# * .
-# * \n
-# * - "WW" : Close Wire (to finish)
-# * - "WF" : Close Wire and build face (to finish)
-# *
-# * \param theCommand String, defining the sketcher in local
-# * coordinates of the working plane.
-# * \param theWorkingPlane Nine double values, defining origin,
-# * OZ and OX directions of the working plane.
-# * \return New GEOM_Object, containing the created wire.
-#
-# * Example: see GEOM_TestAll.py
-#
+"""
+ * Create a sketcher (wire or face), following the textual description,
+ * passed through \a theCommand argument. \n
+ * Edges of the resulting wire or face will be arcs of circles and/or linear segments. \n
+ * Format of the description string have to be the following:
+ *
+ * "Sketcher[:F x1 y1]:CMD[:CMD[:CMD...]]"
+ *
+ * Where:
+ * - x1, y1 are coordinates of the first sketcher point (zero by default),
+ * - CMD is one of
+ * - "R angle" : Set the direction by angle
+ * - "D dx dy" : Set the direction by DX & DY
+ * .
+ * \n
+ * - "TT x y" : Create segment by point at X & Y
+ * - "T dx dy" : Create segment by point with DX & DY
+ * - "L length" : Create segment by direction & Length
+ * - "IX x" : Create segment by direction & Intersect. X
+ * - "IY y" : Create segment by direction & Intersect. Y
+ * .
+ * \n
+ * - "C radius length" : Create arc by direction, radius and length(in degree)
+ * .
+ * \n
+ * - "WW" : Close Wire (to finish)
+ * - "WF" : Close Wire and build face (to finish)
+ *
+ * \param theCommand String, defining the sketcher in local
+ * coordinates of the working plane.
+ * \param theWorkingPlane Nine double values, defining origin,
+ * OZ and OX directions of the working plane.
+ * \return New GEOM_Object, containing the created wire.
+
+ * Example: see GEOM_TestAll.py
+"""
def MakeSketcher(theCommand, theWorkingPlane = [0,0,0, 0,0,1, 1,0,0]):
anObj = CurvesOp.MakeSketcher(theCommand, theWorkingPlane)
if CurvesOp.IsDone() == 0:
# Create 3D Primitives
# -----------------------------------------------------------------------------
-# * Create a box by coordinates of two opposite vertices.
-#
-# * Example: see GEOM_TestAll.py
-#
+"""
+ * Create a box by coordinates of two opposite vertices.
+
+ * Example: see GEOM_TestAll.py
+"""
def MakeBox(x1,y1,z1,x2,y2,z2):
pnt1 = MakeVertex(x1,y1,z1)
pnt2 = MakeVertex(x2,y2,z2)
return MakeBoxTwoPnt(pnt1,pnt2)
-# * Create a box with specified dimensions along the coordinate axes
-# * and with edges, parallel to the coordinate axes.
-# * Center of the box will be at point (DX/2, DY/2, DZ/2).
-# * \param theDX Length of Box edges, parallel to OX axis.
-# * \param theDY Length of Box edges, parallel to OY axis.
-# * \param theDZ Length of Box edges, parallel to OZ axis.
-# * \return New GEOM_Object, containing the created box.
-#
-# * Example: see GEOM_TestAll.py
-#
+"""
+ * Create a box with specified dimensions along the coordinate axes
+ * and with edges, parallel to the coordinate axes.
+ * Center of the box will be at point (DX/2, DY/2, DZ/2).
+ * \param theDX Length of Box edges, parallel to OX axis.
+ * \param theDY Length of Box edges, parallel to OY axis.
+ * \param theDZ Length of Box edges, parallel to OZ axis.
+ * \return New GEOM_Object, containing the created box.
+
+ * Example: see GEOM_TestAll.py
+"""
def MakeBoxDXDYDZ(theDX, theDY, theDZ):
anObj = PrimOp.MakeBoxDXDYDZ(theDX, theDY, theDZ)
if PrimOp.IsDone() == 0:
print "MakeBoxDXDYDZ : ", PrimOp.GetErrorCode()
return anObj
-# * Create a box with two specified opposite vertices,
-# * and with edges, parallel to the coordinate axes
-# * \param thePnt1 First of two opposite vertices.
-# * \param thePnt2 Second of two opposite vertices.
-# * \return New GEOM_Object, containing the created box.
-#
-# * Example: see GEOM_TestAll.py
-#
+"""
+ * Create a box with two specified opposite vertices,
+ * and with edges, parallel to the coordinate axes
+ * \param thePnt1 First of two opposite vertices.
+ * \param thePnt2 Second of two opposite vertices.
+ * \return New GEOM_Object, containing the created box.
+
+ * Example: see GEOM_TestAll.py
+"""
def MakeBoxTwoPnt(thePnt1, thePnt2):
anObj = PrimOp.MakeBoxTwoPnt(thePnt1, thePnt2)
if PrimOp.IsDone() == 0:
print "MakeBoxTwoPnt : ", PrimOp.GetErrorCode()
return anObj
-# * Create a cylinder with given base point, axis, radius and height.
-# * \param thePnt Central point of cylinder base.
-# * \param theAxis Cylinder axis.
-# * \param theR Cylinder radius.
-# * \param theH Cylinder height.
-# * \return New GEOM_Object, containing the created cylinder.
-#
-# * Example: see GEOM_TestAll.py
-#
+"""
+ * Create a cylinder with given base point, axis, radius and height.
+ * \param thePnt Central point of cylinder base.
+ * \param theAxis Cylinder axis.
+ * \param theR Cylinder radius.
+ * \param theH Cylinder height.
+ * \return New GEOM_Object, containing the created cylinder.
+
+ * Example: see GEOM_TestAll.py
+"""
def MakeCylinder(thePnt, theAxis, theR, theH):
anObj = PrimOp.MakeCylinderPntVecRH(thePnt, theAxis, theR, theH)
if PrimOp.IsDone() == 0:
print "MakeCylinderPntVecRH : ", PrimOp.GetErrorCode()
return anObj
-# * Create a cylinder with given radius and height at
-# * the origin of coordinate system. Axis of the cylinder
-# * will be collinear to the OZ axis of the coordinate system.
-# * \param theR Cylinder radius.
-# * \param theH Cylinder height.
-# * \return New GEOM_Object, containing the created cylinder.
-#
-# * Example: see GEOM_TestAll.py
-#
+"""
+ * Create a cylinder with given radius and height at
+ * the origin of coordinate system. Axis of the cylinder
+ * will be collinear to the OZ axis of the coordinate system.
+ * \param theR Cylinder radius.
+ * \param theH Cylinder height.
+ * \return New GEOM_Object, containing the created cylinder.
+
+ * Example: see GEOM_TestAll.py
+"""
def MakeCylinderRH(theR, theH):
anObj = PrimOp.MakeCylinderRH(theR, theH)
if PrimOp.IsDone() == 0:
print "MakeCylinderRH : ", PrimOp.GetErrorCode()
return anObj
-# * Create a sphere with given center and radius.
-# * \param thePnt Sphere center.
-# * \param theR Sphere radius.
-# * \return New GEOM_Object, containing the created sphere.
-#
-# * Example: see GEOM_TestAll.py
-#
+"""
+ * Create a sphere with given center and radius.
+ * \param thePnt Sphere center.
+ * \param theR Sphere radius.
+ * \return New GEOM_Object, containing the created sphere.
+
+ * Example: see GEOM_TestAll.py
+"""
def MakeSpherePntR(thePnt, theR):
anObj = PrimOp.MakeSpherePntR(thePnt, theR)
if PrimOp.IsDone() == 0:
print "MakeSpherePntR : ", PrimOp.GetErrorCode()
return anObj
-# * Create a sphere with given center and radius.
-# * \param x,y,z Coordinates of sphere center.
-# * \param theR Sphere radius.
-# * \return New GEOM_Object, containing the created sphere.
-#
-# * Example: see GEOM_TestAll.py
-#
+"""
+ * Create a sphere with given center and radius.
+ * \param x,y,z Coordinates of sphere center.
+ * \param theR Sphere radius.
+ * \return New GEOM_Object, containing the created sphere.
+
+ * Example: see GEOM_TestAll.py
+"""
def MakeSphere(x, y, z, theR):
point = MakeVertex(x, y, z)
anObj = MakeSpherePntR(point, theR)
return anObj
-# * Create a sphere with given radius at the origin of coordinate system.
-# * \param theR Sphere radius.
-# * \return New GEOM_Object, containing the created sphere.
-#
-# * Example: see GEOM_TestAll.py
-#
+"""
+ * Create a sphere with given radius at the origin of coordinate system.
+ * \param theR Sphere radius.
+ * \return New GEOM_Object, containing the created sphere.
+
+ * Example: see GEOM_TestAll.py
+"""
def MakeSphereR(theR):
anObj = PrimOp.MakeSphereR(theR)
if PrimOp.IsDone() == 0:
print "MakeSphereR : ", PrimOp.GetErrorCode()
return anObj
-# * Create a cone with given base point, axis, height and radiuses.
-# * \param thePnt Central point of the first cone base.
-# * \param theAxis Cone axis.
-# * \param theR1 Radius of the first cone base.
-# * \param theR2 Radius of the second cone base.
-# * \note If both radiuses are non-zero, the cone will be truncated.
-# * \note If the radiuses are equal, a cylinder will be created instead.
-# * \param theH Cone height.
-# * \return New GEOM_Object, containing the created cone.
-#
-# * Example: see GEOM_TestAll.py
-#
+"""
+ * Create a cone with given base point, axis, height and radiuses.
+ * \param thePnt Central point of the first cone base.
+ * \param theAxis Cone axis.
+ * \param theR1 Radius of the first cone base.
+ * \param theR2 Radius of the second cone base.
+ * \note If both radiuses are non-zero, the cone will be truncated.
+ * \note If the radiuses are equal, a cylinder will be created instead.
+ * \param theH Cone height.
+ * \return New GEOM_Object, containing the created cone.
+
+ * Example: see GEOM_TestAll.py
+"""
def MakeCone(thePnt, theAxis, theR1, theR2, theH):
anObj = PrimOp.MakeConePntVecR1R2H(thePnt, theAxis, theR1, theR2, theH)
if PrimOp.IsDone() == 0:
print "MakeConePntVecR1R2H : ", PrimOp.GetErrorCode()
return anObj
-# * Create a cone with given height and radiuses at
-# * the origin of coordinate system. Axis of the cone will
-# * be collinear to the OZ axis of the coordinate system.
-# * \param theR1 Radius of the first cone base.
-# * \param theR2 Radius of the second cone base.
-# * \note If both radiuses are non-zero, the cone will be truncated.
-# * \note If the radiuses are equal, a cylinder will be created instead.
-# * \param theH Cone height.
-# * \return New GEOM_Object, containing the created cone.
-#
-# * Example: see GEOM_TestAll.py
-#
+"""
+ * Create a cone with given height and radiuses at
+ * the origin of coordinate system. Axis of the cone will
+ * be collinear to the OZ axis of the coordinate system.
+ * \param theR1 Radius of the first cone base.
+ * \param theR2 Radius of the second cone base.
+ * \note If both radiuses are non-zero, the cone will be truncated.
+ * \note If the radiuses are equal, a cylinder will be created instead.
+ * \param theH Cone height.
+ * \return New GEOM_Object, containing the created cone.
+
+ * Example: see GEOM_TestAll.py
+"""
def MakeConeR1R2H(theR1, theR2, theH):
anObj = PrimOp.MakeConeR1R2H(theR1, theR2, theH)
if PrimOp.IsDone() == 0:
print "MakeConeR1R2H : ", PrimOp.GetErrorCode()
return anObj
-# * Create a torus with given center, normal vector and radiuses.
-# * \param thePnt Torus central point.
-# * \param theVec Torus axis of symmetry.
-# * \param theRMajor Torus major radius.
-# * \param theRMinor Torus minor radius.
-# * \return New GEOM_Object, containing the created torus.
-#
-# * Example: see GEOM_TestAll.py
-#
+"""
+ * Create a torus with given center, normal vector and radiuses.
+ * \param thePnt Torus central point.
+ * \param theVec Torus axis of symmetry.
+ * \param theRMajor Torus major radius.
+ * \param theRMinor Torus minor radius.
+ * \return New GEOM_Object, containing the created torus.
+
+ * Example: see GEOM_TestAll.py
+"""
def MakeTorus(thePnt, theVec, theRMajor, theRMinor):
anObj = PrimOp.MakeTorusPntVecRR(thePnt, theVec, theRMajor, theRMinor)
if PrimOp.IsDone() == 0:
print "MakeTorusPntVecRR : ", PrimOp.GetErrorCode()
return anObj
-# * Create a torus with given radiuses at the origin of coordinate system.
-# * \param theRMajor Torus major radius.
-# * \param theRMinor Torus minor radius.
-# * \return New GEOM_Object, containing the created torus.
-#
-# * Example: see GEOM_TestAll.py
-#
+"""
+ * Create a torus with given radiuses at the origin of coordinate system.
+ * \param theRMajor Torus major radius.
+ * \param theRMinor Torus minor radius.
+ * \return New GEOM_Object, containing the created torus.
+
+ * Example: see GEOM_TestAll.py
+"""
def MakeTorusRR(theRMajor, theRMinor):
anObj = PrimOp.MakeTorusRR(theRMajor, theRMinor)
if PrimOp.IsDone() == 0:
print "MakeTorusRR : ", PrimOp.GetErrorCode()
return anObj
-# * Create a shape by extrusion of the base shape along a vector, defined by two points.
-# * \param theBase Base shape to be extruded.
-# * \param thePoint1 First end of extrusion vector.
-# * \param thePoint2 Second end of extrusion vector.
-# * \return New GEOM_Object, containing the created prism.
-#
-# * Example: see GEOM_TestAll.py
-#
+"""
+ * Create a shape by extrusion of the base shape along a vector, defined by two points.
+ * \param theBase Base shape to be extruded.
+ * \param thePoint1 First end of extrusion vector.
+ * \param thePoint2 Second end of extrusion vector.
+ * \return New GEOM_Object, containing the created prism.
+
+ * Example: see GEOM_TestAll.py
+"""
def MakePrism(theBase, thePoint1, thePoint2):
anObj = PrimOp.MakePrismTwoPnt(theBase, thePoint1, thePoint2)
if PrimOp.IsDone() == 0:
print "MakePrismTwoPnt : ", PrimOp.GetErrorCode()
return anObj
-# * Create a shape by extrusion of the base shape along the vector,
-# * i.e. all the space, transfixed by the base shape during its translation
-# * along the vector on the given distance.
-# * \param theBase Base shape to be extruded.
-# * \param theVec Direction of extrusion.
-# * \param theH Prism dimension along theVec.
-# * \return New GEOM_Object, containing the created prism.
-#
-# * Example: see GEOM_TestAll.py
-#
+"""
+ * Create a shape by extrusion of the base shape along the vector,
+ * i.e. all the space, transfixed by the base shape during its translation
+ * along the vector on the given distance.
+ * \param theBase Base shape to be extruded.
+ * \param theVec Direction of extrusion.
+ * \param theH Prism dimension along theVec.
+ * \return New GEOM_Object, containing the created prism.
+
+ * Example: see GEOM_TestAll.py
+"""
def MakePrismVecH(theBase, theVec, theH):
anObj = PrimOp.MakePrismVecH(theBase, theVec, theH)
if PrimOp.IsDone() == 0:
print "MakePrismVecH : ", PrimOp.GetErrorCode()
return anObj
-# * Create a shape by extrusion of the base shape along
-# * the path shape. The path shape can be a wire or an edge.
-# * \param theBase Base shape to be extruded.
-# * \param thePath Path shape to extrude the base shape along it.
-# * \return New GEOM_Object, containing the created pipe.
-#
-# * Example: see GEOM_TestAll.py
-#
+"""
+ * Create a shape by extrusion of the base shape along
+ * the path shape. The path shape can be a wire or an edge.
+ * \param theBase Base shape to be extruded.
+ * \param thePath Path shape to extrude the base shape along it.
+ * \return New GEOM_Object, containing the created pipe.
+
+ * Example: see GEOM_TestAll.py
+"""
def MakePipe(theBase, thePath):
anObj = PrimOp.MakePipe(theBase, thePath)
if PrimOp.IsDone() == 0:
print "MakePipe : ", PrimOp.GetErrorCode()
return anObj
-# * Create a shape by revolution of the base shape around the axis
-# * on the given angle, i.e. all the space, transfixed by the base
-# * shape during its rotation around the axis on the given angle.
-# * \param theBase Base shape to be rotated.
-# * \param theAxis Rotation axis.
-# * \param theAngle Rotation angle in radians.
-# * \return New GEOM_Object, containing the created revolution.
-#
-# * Example: see GEOM_TestAll.py
-#
+"""
+ * Create a shape by revolution of the base shape around the axis
+ * on the given angle, i.e. all the space, transfixed by the base
+ * shape during its rotation around the axis on the given angle.
+ * \param theBase Base shape to be rotated.
+ * \param theAxis Rotation axis.
+ * \param theAngle Rotation angle in radians.
+ * \return New GEOM_Object, containing the created revolution.
+
+ * Example: see GEOM_TestAll.py
+"""
def MakeRevolution(theBase, theAxis, theAngle):
anObj = PrimOp.MakeRevolutionAxisAngle(theBase, theAxis, theAngle)
if PrimOp.IsDone() == 0:
# Create base shapes
# -----------------------------------------------------------------------------
-# * Create a linear edge with specified ends.
-# * \param thePnt1 Point for the first end of edge.
-# * \param thePnt2 Point for the second end of edge.
-# * \return New GEOM_Object, containing the created edge.
-#
-# * Example: see GEOM_TestAll.py
-#
+"""
+ * Create a linear edge with specified ends.
+ * \param thePnt1 Point for the first end of edge.
+ * \param thePnt2 Point for the second end of edge.
+ * \return New GEOM_Object, containing the created edge.
+
+ * Example: see GEOM_TestAll.py
+"""
def MakeEdge(thePnt1, thePnt2):
anObj = ShapesOp.MakeEdge(thePnt1, thePnt2)
if ShapesOp.IsDone() == 0:
print "MakeEdge : ", ShapesOp.GetErrorCode()
return anObj
-# * Create a wire from the set of edges and wires.
-# * \param theEdgesAndWires List of edges and/or wires.
-# * \return New GEOM_Object, containing the created wire.
-#
-# * Example: see GEOM_TestAll.py
-#
+"""
+ * Create a wire from the set of edges and wires.
+ * \param theEdgesAndWires List of edges and/or wires.
+ * \return New GEOM_Object, containing the created wire.
+
+ * Example: see GEOM_TestAll.py
+"""
def MakeWire(theEdgesAndWires):
anObj = ShapesOp.MakeWire(theEdgesAndWires)
if ShapesOp.IsDone() == 0:
print "MakeWire : ", ShapesOp.GetErrorCode()
return anObj
-# * Create a face on the given wire.
-# * \param theWire Wire to build the face on.
-# * \param isPlanarWanted If TRUE, only planar face will be built.
-# * If impossible, NULL object will be returned.
-# * \return New GEOM_Object, containing the created face.
-#
-# * Example: see GEOM_TestAll.py
-#
+"""
+ * Create a face on the given wire.
+ * \param theWire Wire to build the face on.
+ * \param isPlanarWanted If TRUE, only planar face will be built.
+ * If impossible, NULL object will be returned.
+ * \return New GEOM_Object, containing the created face.
+
+ * Example: see GEOM_TestAll.py
+"""
def MakeFace(theWire, isPlanarWanted):
anObj = ShapesOp.MakeFace(theWire, isPlanarWanted)
if ShapesOp.IsDone() == 0:
print "MakeFace : ", ShapesOp.GetErrorCode()
return anObj
-# * Create a face on the given wires set.
-# * \param theWires List of wires to build the face on.
-# * \param isPlanarWanted If TRUE, only planar face will be built.
-# * If impossible, NULL object will be returned.
-# * \return New GEOM_Object, containing the created face.
-#
-# * Example: see GEOM_TestAll.py
-#
+"""
+ * Create a face on the given wires set.
+ * \param theWires List of wires to build the face on.
+ * \param isPlanarWanted If TRUE, only planar face will be built.
+ * If impossible, NULL object will be returned.
+ * \return New GEOM_Object, containing the created face.
+
+ * Example: see GEOM_TestAll.py
+"""
def MakeFaceWires(theWires, isPlanarWanted):
anObj = ShapesOp.MakeFaceWires(theWires, isPlanarWanted)
if ShapesOp.IsDone() == 0:
print "MakeFaceWires : ", ShapesOp.GetErrorCode()
return anObj
-# * Shortcut to MakeFaceWires()
-#
-# * Example: see GEOM_TestOthers.py
-#
+"""
+ * Shortcut to MakeFaceWires()
+
+ * Example: see GEOM_TestOthers.py
+"""
def MakeFaces(theWires, isPlanarWanted):
anObj = MakeFaceWires(theWires, isPlanarWanted)
return anObj
-# * Create a shell from the set of faces and shells.
-# * \param theFacesAndShells List of faces and/or shells.
-# * \return New GEOM_Object, containing the created shell.
-#
-# * Example: see GEOM_TestAll.py
-#
+"""
+ * Create a shell from the set of faces and shells.
+ * \param theFacesAndShells List of faces and/or shells.
+ * \return New GEOM_Object, containing the created shell.
+
+ * Example: see GEOM_TestAll.py
+"""
def MakeShell(theFacesAndShells):
anObj = ShapesOp.MakeShell(theFacesAndShells)
if ShapesOp.IsDone() == 0:
print "MakeShell : ", ShapesOp.GetErrorCode()
return anObj
-# * Create a solid, bounded by the given shells.
-# * \param theShells Sequence of bounding shells.
-# * \return New GEOM_Object, containing the created solid.
-#
-# * Example: see GEOM_TestAll.py
-#
+"""
+ * Create a solid, bounded by the given shells.
+ * \param theShells Sequence of bounding shells.
+ * \return New GEOM_Object, containing the created solid.
+
+ * Example: see GEOM_TestAll.py
+"""
def MakeSolid(theShells):
anObj = ShapesOp.MakeSolidShells(theShells)
if ShapesOp.IsDone() == 0:
print "MakeSolid : ", ShapesOp.GetErrorCode()
return anObj
-# * Create a compound of the given shapes.
-# * \param theShapes List of shapes to put in compound.
-# * \return New GEOM_Object, containing the created compound.
-#
-# * Example: see GEOM_TestAll.py
-#
+"""
+ * Create a compound of the given shapes.
+ * \param theShapes List of shapes to put in compound.
+ * \return New GEOM_Object, containing the created compound.
+
+ * Example: see GEOM_TestAll.py
+"""
def MakeCompound(theShapes):
anObj = ShapesOp.MakeCompound(theShapes)
if ShapesOp.IsDone() == 0:
print "MakeCompound : ", ShapesOp.GetErrorCode()
return anObj
-# * Reverses an orientation the given shape.
-# * \param theShape Shape to be reversed.
-# * \return The reversed copy of theShape.
-#
-# * Example: see GEOM_TestAll.py
-#
+"""
+ * Gives quantity of faces in the given shape.
+ * \param theShape Shape to count faces of.
+ * \return Quantity of faces.
+
+ * Example: see GEOM_TestOthers.py
+"""
+def NumberOfFaces(theShape):
+ nb_faces = ShapesOp.NumberOfFaces(theShape)
+ if ShapesOp.IsDone() == 0:
+ print "NumberOfFaces : ", ShapesOp.GetErrorCode()
+ return nb_faces
+
+"""
+ * Gives quantity of edges in the given shape.
+ * \param theShape Shape to count edges of.
+ * \return Quantity of edges.
+
+ * Example: see GEOM_TestOthers.py
+"""
+def NumberOfEdges(theShape):
+ nb_edges = ShapesOp.NumberOfEdges(theShape)
+ if ShapesOp.IsDone() == 0:
+ print "NumberOfEdges : ", ShapesOp.GetErrorCode()
+ return nb_edges
+
+"""
+ * Reverses an orientation the given shape.
+ * \param theShape Shape to be reversed.
+ * \return The reversed copy of theShape.
+
+ * Example: see GEOM_TestAll.py
+"""
def ChangeOrientation(theShape):
anObj = ShapesOp.ChangeOrientation(theShape)
if ShapesOp.IsDone() == 0:
print "ChangeOrientation : ", ShapesOp.GetErrorCode()
return anObj
-# * Shortcut to ChangeOrientation()
-#
-# * Example: see GEOM_TestOthers.py
-#
+"""
+ * Shortcut to ChangeOrientation()
+
+ * Example: see GEOM_TestOthers.py
+"""
def OrientationChange(theShape):
anObj = ChangeOrientation(theShape)
return anObj
+"""
+ * Retrieve all free faces from the given shape.
+ * Free face is a face, which is not shared between two shells of the shape.
+ * \param theShape Shape to find free faces in.
+ * \return List of IDs of all free faces, contained in theShape.
+
+ * Example: see GEOM_TestOthers.py
+"""
+def GetFreeFacesIDs(theShape):
+ anIDs = ShapesOp.GetFreeFacesIDs(theShape)
+ if ShapesOp.IsDone() == 0:
+ print "GetFreeFacesIDs : ", ShapesOp.GetErrorCode()
+ return anIDs
+
+"""
+ * Get all sub-shapes of theShape1 of the given type, shared with theShape2.
+ * \param theShape1 Shape to find sub-shapes in.
+ * \param theShape2 Shape to find shared sub-shapes with.
+ * \param theShapeType Type of sub-shapes to be retrieved.
+ * \return List of sub-shapes of theShape1, shared with theShape2.
+
+ * Example: see GEOM_TestOthers.py
+"""
+def GetSharedShapes(theShape1, theShape2, theShapeType):
+ aList = ShapesOp.GetSharedShapes(theShape1, theShape2, theShapeType)
+ if ShapesOp.IsDone() == 0:
+ print "GetSharedShapes : ", ShapesOp.GetErrorCode()
+ return aList
+
+"""
+ * Get sub-shapes of theShape of the given type,
+ * laying on the specified plane.
+ * \param theShape Shape to find sub-shapes of.
+ * \param theShapeType Type of sub-shapes to be retrieved.
+ * \param thePlane Face, specifying the plane to find shapes on.
+ * \return Group of all found sub-shapes.
+
+ * Example: see GEOM_TestOthers.py
+"""
+def GetShapesOnPlane(theShape, theShapeType, thePlane):
+ anObj = ShapesOp.GetShapesOnPlane(theShape, theShapeType, thePlane)
+ if ShapesOp.IsDone() == 0:
+ print "GetShapesOnPlane : ", ShapesOp.GetErrorCode()
+ return anObj
+
+"""
+ * Get sub-shape of theShape of the given type,
+ * laying on the specified cylinder.
+ * \param theShape Shape to find sub-shapes of.
+ * \param theShapeType Type of sub-shapes to be retrieved.
+ * \param theAxis Vector (or line, or linear edge), specifying
+ * axis of the cylinder to find shapes on.
+ * \param theRadius Radius of the cylinder to find shapes on.
+ * \return Group of all found sub-shapes.
+
+ * Example: see GEOM_TestOthers.py
+"""
+def GetShapesOnCylinder(theShape, theShapeType, theAxis, theRadius):
+ anObj = ShapesOp.GetShapesOnCylinder(theShape, theShapeType, theAxis, theRadius)
+ if ShapesOp.IsDone() == 0:
+ print "GetShapesOnCylinder : ", ShapesOp.GetErrorCode()
+ return anObj
+
+"""
+ * Get sub-shape of theShape of the given type,
+ * laying on the specified sphere.
+ * \param theShape Shape to find sub-shapes of.
+ * \param theShapeType Type of sub-shapes to be retrieved.
+ * \param theCenter Point, specifying center of the sphere to find shapes on.
+ * \param theRadius Radius of the sphere to find shapes on.
+ * \return Group of all found sub-shapes.
+
+ * Example: see GEOM_TestOthers.py
+"""
+def GetShapesOnSphere(theShape, theShapeType, theCenter, theRadius):
+ anObj = ShapesOp.GetShapesOnSphere(theShape, theShapeType, theCenter, theRadius)
+ if ShapesOp.IsDone() == 0:
+ print "GetShapesOnSphere : ", ShapesOp.GetErrorCode()
+ return anObj
+
+"""
+ * Get sub-shape(s) of theShapeWhere, which are
+ * coincident with \a theShapeWhat or could be a part of it.
+ * \param theShapeWhere Shape to find sub-shapes of.
+ * \param theShapeWhat Shape, specifying what to find.
+ * \return Group of all found sub-shapes or a single found sub-shape.
+
+ * Example: see GEOM_TestOthers.py
+"""
+def GetInPlace(theShapeWhere, theShapeWhat):
+ anObj = ShapesOp.GetInPlace(theShapeWhere, theShapeWhat)
+ if ShapesOp.IsDone() == 0:
+ print "GetInPlace : ", ShapesOp.GetErrorCode()
+ return anObj
+
# -----------------------------------------------------------------------------
# Access to sub-shapes by their unique IDs inside the main shape.
# -----------------------------------------------------------------------------
-# * Obtain a composite sub-shape of <aShape>, composed from sub-shapes
-# * of <aShape>, selected by their unique IDs inside <aShape>
-#
-# * Example: see GEOM_TestAll.py
-#
+"""
+ * Obtain a composite sub-shape of <aShape>, composed from sub-shapes
+ * of <aShape>, selected by their unique IDs inside <aShape>
+
+ * Example: see GEOM_TestAll.py
+"""
def GetSubShape(aShape, ListOfID):
anObj = geom.AddSubShape(aShape,ListOfID)
return anObj
-# * Obtain unique ID of sub-shape <aSubShape> inside <aShape>
-#
-# * Example: see GEOM_TestAll.py
-#
+"""
+ * Obtain unique ID of sub-shape <aSubShape> inside <aShape>
+
+ * Example: see GEOM_TestAll.py
+"""
def GetSubShapeID(aShape, aSubShape):
anID = LocalOp.GetSubShapeIndex(aShape, aSubShape)
if LocalOp.IsDone() == 0:
# Decompose objects
# -----------------------------------------------------------------------------
-# * Explode a shape on subshapes of a given type.
-# * \param theShape Shape to be exploded.
-# * \param theShapeType Type of sub-shapes to be retrieved.
-# * \return List of sub-shapes of type theShapeType, contained in theShape.
-#
-# * Example: see GEOM_TestAll.py
-#
+"""
+ * Explode a shape on subshapes of a given type.
+ * \param theShape Shape to be exploded.
+ * \param theShapeType Type of sub-shapes to be retrieved.
+ * \return List of sub-shapes of type theShapeType, contained in theShape.
+
+ * Example: see GEOM_TestAll.py
+"""
def SubShapeAll(aShape, aType):
ListObj = ShapesOp.MakeExplode(aShape,aType,0)
if ShapesOp.IsDone() == 0:
print "MakeExplode : ", ShapesOp.GetErrorCode()
return ListObj
-# * Explode a shape on subshapes of a given type.
-# * Sub-shapes will be sorted by coordinates of their gravity centers.
-# * \param theShape Shape to be exploded.
-# * \param theShapeType Type of sub-shapes to be retrieved.
-# * \return List of sub-shapes of type theShapeType, contained in theShape.
-#
-# * Example: see GEOM_TestAll.py
-#
+"""
+ * Explode a shape on subshapes of a given type.
+ * \param theShape Shape to be exploded.
+ * \param theShapeType Type of sub-shapes to be retrieved.
+ * \return List of IDs of sub-shapes.
+"""
+def SubShapeAllIDs(aShape, aType):
+ ListObj = ShapesOp.SubShapeAllIDs(aShape,aType,0)
+ if ShapesOp.IsDone() == 0:
+ print "SubShapeAllIDs : ", ShapesOp.GetErrorCode()
+ return ListObj
+
+"""
+ * Explode a shape on subshapes of a given type.
+ * Sub-shapes will be sorted by coordinates of their gravity centers.
+ * \param theShape Shape to be exploded.
+ * \param theShapeType Type of sub-shapes to be retrieved.
+ * \return List of sub-shapes of type theShapeType, contained in theShape.
+
+ * Example: see GEOM_TestAll.py
+"""
def SubShapeAllSorted(aShape, aType):
ListObj = ShapesOp.MakeExplode(aShape,aType,1)
if ShapesOp.IsDone() == 0:
print "MakeExplode : ", ShapesOp.GetErrorCode()
return ListObj
-# * Obtain a compound of sub-shapes of <aShape>,
-# * selected by they indices in list of all sub-shapes of type <aType>.
-# * Each index is in range [1, Nb_Sub-Shapes_Of_Given_Type]
-#
-# * Example: see GEOM_TestAll.py
-#
+"""
+ * Explode a shape on subshapes of a given type.
+ * Sub-shapes will be sorted by coordinates of their gravity centers.
+ * \param theShape Shape to be exploded.
+ * \param theShapeType Type of sub-shapes to be retrieved.
+ * \return List of IDs of sub-shapes.
+"""
+def SubShapeAllSortedIDs(aShape, aType):
+ ListIDs = ShapesOp.SubShapeAllIDs(aShape,aType,1)
+ if ShapesOp.IsDone() == 0:
+ print "SubShapeAllSortedIDs : ", ShapesOp.GetErrorCode()
+ return ListObj
+
+"""
+ * Obtain a compound of sub-shapes of <aShape>,
+ * selected by they indices in list of all sub-shapes of type <aType>.
+ * Each index is in range [1, Nb_Sub-Shapes_Of_Given_Type]
+
+ * Example: see GEOM_TestAll.py
+"""
def SubShape(aShape, aType, ListOfInd):
ListOfIDs = []
AllShapeList = SubShapeAll(aShape, aType)
anObj = GetSubShape(aShape, ListOfIDs)
return anObj
-# * Obtain a compound of sub-shapes of <aShape>,
-# * selected by they indices in sorted list of all sub-shapes of type <aType>.
-# * Each index is in range [1, Nb_Sub-Shapes_Of_Given_Type]
-#
-# * Example: see GEOM_TestAll.py
-#
+"""
+ * Obtain a compound of sub-shapes of <aShape>,
+ * selected by they indices in sorted list of all sub-shapes of type <aType>.
+ * Each index is in range [1, Nb_Sub-Shapes_Of_Given_Type]
+
+ * Example: see GEOM_TestAll.py
+"""
def SubShapeSorted(aShape, aType, ListOfInd):
ListOfIDs = []
AllShapeList = SubShapeAllSorted(aShape, aType)
# Healing operations
# -----------------------------------------------------------------------------
-# * Apply a sequence of Shape Healing operators to the given object.
-# * \param theShape Shape to be processed.
-# * \param theOperators List of names of operators ("FixShape", "SplitClosedFaces", etc.).
-# * \param theParameters List of names of parameters
-# * ("FixShape.Tolerance3d", "SplitClosedFaces.NbSplitPoints", etc.).
-# * \param theValues List of values of parameters, in the same order
-# * as parameters are listed in \a theParameters list.
-# * \return New GEOM_Object, containing processed shape.
-#
-# * Example: see GEOM_TestHealing.py
-#
+"""
+ * Apply a sequence of Shape Healing operators to the given object.
+ * \param theShape Shape to be processed.
+ * \param theOperators List of names of operators ("FixShape", "SplitClosedFaces", etc.).
+ * \param theParameters List of names of parameters
+ * ("FixShape.Tolerance3d", "SplitClosedFaces.NbSplitPoints", etc.).
+ * \param theValues List of values of parameters, in the same order
+ * as parameters are listed in \a theParameters list.
+ * \return New GEOM_Object, containing processed shape.
+
+ * Example: see GEOM_TestHealing.py
+"""
def ProcessShape(theShape, theOperators, theParameters, theValues):
anObj = HealOp.ProcessShape(theShape, theOperators, theParameters, theValues)
if HealOp.IsDone() == 0:
print "ProcessShape : ", HealOp.GetErrorCode()
return anObj
-# * Remove faces from the given object (shape).
-# * \param theObject Shape to be processed.
-# * \param theFaces Indices of faces to be removed, if EMPTY then the method
-# * removes ALL faces of the given object.
-# * \return New GEOM_Object, containing processed shape.
-#
-# * Example: see GEOM_TestHealing.py
-#
+"""
+ * Remove faces from the given object (shape).
+ * \param theObject Shape to be processed.
+ * \param theFaces Indices of faces to be removed, if EMPTY then the method
+ * removes ALL faces of the given object.
+ * \return New GEOM_Object, containing processed shape.
+
+ * Example: see GEOM_TestHealing.py
+"""
def SuppressFaces(theObject, theFaces):
anObj = HealOp.SuppressFaces(theObject, theFaces)
if HealOp.IsDone() == 0:
print "SuppressFaces : ", HealOp.GetErrorCode()
return anObj
-# * Sewing of some shapes into single shape.
-#
-# * Example: see GEOM_TestHealing.py
-#
+"""
+ * Sewing of some shapes into single shape.
+
+ * Example: see GEOM_TestHealing.py
+"""
def MakeSewing(ListShape, theTolerance):
comp = MakeCompound(ListShape)
anObj = Sew(comp, theTolerance)
return anObj
-# * Sewing of the given object.
-# * \param theObject Shape to be processed.
-# * \param theTolerance Required tolerance value.
-# * \return New GEOM_Object, containing processed shape.
-#
-# * Example: see MakeSewing() above
-#
+"""
+ * Sewing of the given object.
+ * \param theObject Shape to be processed.
+ * \param theTolerance Required tolerance value.
+ * \return New GEOM_Object, containing processed shape.
+
+ * Example: see MakeSewing() above
+"""
def Sew(theObject, theTolerance):
anObj = HealOp.Sew(theObject, theTolerance)
if HealOp.IsDone() == 0:
print "Sew : ", HealOp.GetErrorCode()
return anObj
-# * Remove internal wires and edges from the given object (face).
-# * \param theObject Shape to be processed.
-# * \param theWires Indices of wires to be removed, if EMPTY then the method
-# * removes ALL internal wires of the given object.
-# * \return New GEOM_Object, containing processed shape.
-#
-# * Example: see GEOM_TestHealing.py
-#
+"""
+ * Remove internal wires and edges from the given object (face).
+ * \param theObject Shape to be processed.
+ * \param theWires Indices of wires to be removed, if EMPTY then the method
+ * removes ALL internal wires of the given object.
+ * \return New GEOM_Object, containing processed shape.
+
+ * Example: see GEOM_TestHealing.py
+"""
def SuppressInternalWires(theObject, theWires):
anObj = HealOp.RemoveIntWires(theObject, theWires)
if HealOp.IsDone() == 0:
print "SuppressInternalWires : ", HealOp.GetErrorCode()
return anObj
-# * Remove internal closed contours (holes) from the given object.
-# * \param theObject Shape to be processed.
-# * \param theWires Indices of wires to be removed, if EMPTY then the method
-# * removes ALL internal holes of the given object
-# * \return New GEOM_Object, containing processed shape.
-#
-# * Example: see GEOM_TestHealing.py
-#
+"""
+ * Remove internal closed contours (holes) from the given object.
+ * \param theObject Shape to be processed.
+ * \param theWires Indices of wires to be removed, if EMPTY then the method
+ * removes ALL internal holes of the given object
+ * \return New GEOM_Object, containing processed shape.
+
+ * Example: see GEOM_TestHealing.py
+"""
def SuppressHoles(theObject, theWires):
anObj = HealOp.FillHoles(theObject, theWires)
if HealOp.IsDone() == 0:
print "SuppressHoles : ", HealOp.GetErrorCode()
return anObj
-# * Close an open wire.
-# * \param theObject Shape to be processed.
-# * \param theWires Indexes of edge(s) and wire(s) to be closed within <VAR>theObject</VAR>'s shape,
-# * if -1, then theObject itself is a wire.
-# * \param isCommonVertex If TRUE : closure by creation of a common vertex,
-# * If FALS : closure by creation of an edge between ends.
-# * \return New GEOM_Object, containing processed shape.
-#
-# * Example: see GEOM_TestHealing.py
-#
+"""
+ * Close an open wire.
+ * \param theObject Shape to be processed.
+ * \param theWires Indexes of edge(s) and wire(s) to be closed within <VAR>theObject</VAR>'s shape,
+ * if -1, then theObject itself is a wire.
+ * \param isCommonVertex If TRUE : closure by creation of a common vertex,
+ * If FALS : closure by creation of an edge between ends.
+ * \return New GEOM_Object, containing processed shape.
+
+ * Example: see GEOM_TestHealing.py
+"""
def CloseContour(theObject, theWires, isCommonVertex):
anObj = HealOp.CloseContour(theObject, theWires, isCommonVertex)
if HealOp.IsDone() == 0:
print "CloseContour : ", HealOp.GetErrorCode()
return anObj
-# * Addition of a point to a given edge object.
-# * \param theObject Shape to be processed.
-# * \param theEdgeIndex Index of edge to be divided within theObject's shape,
-# * if -1, then theObject itself is the edge.
-# * \param theValue Value of parameter on edge or length parameter,
-# * depending on \a isByParameter.
-# * \param isByParameter If TRUE : \a theValue is treated as a curve parameter [0..1],
-# * if FALSE : \a theValue is treated as a length parameter [0..1]
-# * \return New GEOM_Object, containing processed shape.
-#
-# * Example: see GEOM_TestHealing.py
-#
+"""
+ * Addition of a point to a given edge object.
+ * \param theObject Shape to be processed.
+ * \param theEdgeIndex Index of edge to be divided within theObject's shape,
+ * if -1, then theObject itself is the edge.
+ * \param theValue Value of parameter on edge or length parameter,
+ * depending on \a isByParameter.
+ * \param isByParameter If TRUE : \a theValue is treated as a curve parameter [0..1],
+ * if FALSE : \a theValue is treated as a length parameter [0..1]
+ * \return New GEOM_Object, containing processed shape.
+
+ * Example: see GEOM_TestHealing.py
+"""
def DivideEdge(theObject, theEdgeIndex, theValue, isByParameter):
anObj = HealOp.DivideEdge(theObject, theEdgeIndex, theValue, isByParameter)
if HealOp.IsDone() == 0:
print "DivideEdge : ", HealOp.GetErrorCode()
return anObj
-# * Get a list of wires (wrapped in GEOM_Object-s),
-# * that constitute a free boundary of the given shape.
-# * \param theObject Shape to get free boundary of.
-# * \return [status, theClosedWires, theOpenWires]
-# * status: FALSE, if an error(s) occured during the method execution.
-# * theClosedWires: Closed wires on the free boundary of the given shape.
-# * theOpenWires: Open wires on the free boundary of the given shape.
-#
-# * Example: see GEOM_TestHealing.py
-#
+"""
+ * Get a list of wires (wrapped in GEOM_Object-s),
+ * that constitute a free boundary of the given shape.
+ * \param theObject Shape to get free boundary of.
+ * \return [status, theClosedWires, theOpenWires]
+ * status: FALSE, if an error(s) occured during the method execution.
+ * theClosedWires: Closed wires on the free boundary of the given shape.
+ * theOpenWires: Open wires on the free boundary of the given shape.
+
+ * Example: see GEOM_TestHealing.py
+"""
def GetFreeBoundary(theObject):
anObj = HealOp.GetFreeBoundary(theObject)
if HealOp.IsDone() == 0:
# Create advanced objects
# -----------------------------------------------------------------------------
-# * Create a copy of the given object
-#
-# * Example: see GEOM_TestAll.py
-#
+"""
+ * Create a copy of the given object
+
+ * Example: see GEOM_TestAll.py
+"""
def MakeCopy(theOriginal):
anObj = InsertOp.MakeCopy(theOriginal)
if InsertOp.IsDone() == 0:
print "MakeCopy : ", InsertOp.GetErrorCode()
return anObj
-# * Create a filling from the given compound of contours.
-# * \param theShape the compound of contours
-# * \param theMinDeg a minimal degree
-# * \param theMaxDeg a maximal degree
-# * \param theTol2D a 2d tolerance
-# * \param theTol3D a 3d tolerance
-# * \param theNbIter a number of iteration
-# * \return New GEOM_Object, containing the created filling surface.
-#
-# * Example: see GEOM_TestAll.py
-#
+"""
+ * Create a filling from the given compound of contours.
+ * \param theShape the compound of contours
+ * \param theMinDeg a minimal degree
+ * \param theMaxDeg a maximal degree
+ * \param theTol2D a 2d tolerance
+ * \param theTol3D a 3d tolerance
+ * \param theNbIter a number of iteration
+ * \return New GEOM_Object, containing the created filling surface.
+
+ * Example: see GEOM_TestAll.py
+"""
def MakeFilling(theShape, theMinDeg, theMaxDeg, theTol2D, theTol3D, theNbIter):
anObj = PrimOp.MakeFilling(theShape, theMinDeg, theMaxDeg, theTol2D, theTol3D, theNbIter)
if PrimOp.IsDone() == 0:
print "MakeFilling : ", PrimOp.GetErrorCode()
return anObj
-# * Replace coincident faces in theShape by one face.
-# * \param theShape Initial shape.
-# * \param theTolerance Maximum distance between faces, which can be considered as coincident.
-# * \return New GEOM_Object, containing a copy of theShape without coincident faces.
-#
-# * Example: see GEOM_Spanner.py
-#
+"""
+ * Replace coincident faces in theShape by one face.
+ * \param theShape Initial shape.
+ * \param theTolerance Maximum distance between faces, which can be considered as coincident.
+ * \return New GEOM_Object, containing a copy of theShape without coincident faces.
+
+ * Example: see GEOM_Spanner.py
+"""
def MakeGlueFaces(theShape, theTolerance):
anObj = ShapesOp.MakeGlueFaces(theShape, theTolerance)
if ShapesOp.IsDone() == 0:
# Boolean (Common, Cut, Fuse, Section)
# -----------------------------------------------------------------------------
-# * Perform one of boolean operations on two given shapes.
-# * \param theShape1 First argument for boolean operation.
-# * \param theShape2 Second argument for boolean operation.
-# * \param theOperation Indicates the operation to be done:
-# * 1 - Common, 2 - Cut, 3 - Fuse, 4 - Section.
-# * \return New GEOM_Object, containing the result shape.
-#
-# * Example: see GEOM_TestAll.py
-#
+"""
+ * Perform one of boolean operations on two given shapes.
+ * \param theShape1 First argument for boolean operation.
+ * \param theShape2 Second argument for boolean operation.
+ * \param theOperation Indicates the operation to be done:
+ * 1 - Common, 2 - Cut, 3 - Fuse, 4 - Section.
+ * \return New GEOM_Object, containing the result shape.
+
+ * Example: see GEOM_TestAll.py
+"""
def MakeBoolean(theShape1, theShape2, theOperation):
anObj = BoolOp.MakeBoolean(theShape1, theShape2, theOperation)
if BoolOp.IsDone() == 0:
print "MakeBoolean : ", BoolOp.GetErrorCode()
return anObj
-# * Shortcuts to MakeBoolean() for certain operations
-#
-# * Example: see GEOM_TestOthers.py
-#
+"""
+ * Shortcuts to MakeBoolean() for certain operations
+
+ * Example: see GEOM_TestOthers.py
+"""
def MakeCommon(s1, s2):
return MakeBoolean(s1, s2, 1)
-#
+
def MakeCut(s1, s2):
return MakeBoolean(s1, s2, 2)
-#
+
def MakeFuse(s1, s2):
return MakeBoolean(s1, s2, 3)
-#
+
def MakeSection(s1, s2):
return MakeBoolean(s1, s2, 4)
-# * Perform partition operation.
-# * \param ListShapes Shapes to be intersected.
-# * \param ListTools Shapes to intersect theShapes.
-# * \param ListKeepInside Shapes, outside which the results will be deleted.
-# * Each shape from theKeepInside must belong to theShapes also.
-# * \param ListRemoveInside Shapes, inside which the results will be deleted.
-# * Each shape from theRemoveInside must belong to theShapes also.
-# * \param Limit Type of resulting shapes (corresponding to TopAbs_ShapeEnum).
-# * \param RemoveWebs If TRUE, perform Glue 3D algorithm.
-# * \param ListMaterials Material indices for each shape. Make sence, only if theRemoveWebs is TRUE.
-# * \return New GEOM_Object, containing the result shapes.
-#
-# * Example: see GEOM_TestAll.py
-#
+"""
+ * Perform partition operation.
+ * \param ListShapes Shapes to be intersected.
+ * \param ListTools Shapes to intersect theShapes.
+ * \param ListKeepInside Shapes, outside which the results will be deleted.
+ * Each shape from theKeepInside must belong to theShapes also.
+ * \param ListRemoveInside Shapes, inside which the results will be deleted.
+ * Each shape from theRemoveInside must belong to theShapes also.
+ * \param Limit Type of resulting shapes (corresponding to TopAbs_ShapeEnum).
+ * \param RemoveWebs If TRUE, perform Glue 3D algorithm.
+ * \param ListMaterials Material indices for each shape. Make sence, only if theRemoveWebs is TRUE.
+ * \return New GEOM_Object, containing the result shapes.
+
+ * Example: see GEOM_TestAll.py
+"""
def MakePartition(ListShapes, ListTools=[], ListKeepInside=[], ListRemoveInside=[],
Limit=ShapeType["SHAPE"], RemoveWebs=0, ListMaterials=[]):
anObj = BoolOp.MakePartition(ListShapes, ListTools,
print "MakePartition : ", BoolOp.GetErrorCode()
return anObj
-# * Shortcut to MakePartition()
-#
-# * Example: see GEOM_TestOthers.py
-#
+"""
+ * Shortcut to MakePartition()
+
+ * Example: see GEOM_TestOthers.py
+"""
def Partition(ListShapes, ListTools=[], ListKeepInside=[], ListRemoveInside=[],
Limit=ShapeType["SHAPE"], RemoveWebs=0, ListMaterials=[]):
anObj = MakePartition(ListShapes, ListTools,
Limit, RemoveWebs, ListMaterials);
return anObj
+"""
+ * Perform partition of the Shape with the Plane
+ * \param theShape Shape to be intersected.
+ * \param thePlane Tool shape, to intersect theShape.
+ * \return New GEOM_Object, containing the result shape.
+
+ * Example: see GEOM_TestAll.py
+"""
+def MakeHalfPartition(theShape, thePlane):
+ anObj = BoolOp.MakeHalfPartition(theShape, thePlane)
+ if BoolOp.IsDone() == 0:
+ print "MakeHalfPartition : ", BoolOp.GetErrorCode()
+ return anObj
+
# -----------------------------------------------------------------------------
# Transform objects
# -----------------------------------------------------------------------------
-# * Translate the given object along the vector, specified
-# * by its end points, creating its copy before the translation.
-# * \param theObject The object to be translated.
-# * \param thePoint1 Start point of translation vector.
-# * \param thePoint2 End point of translation vector.
-# * \return New GEOM_Object, containing the translated object.
-#
-# * Example: see GEOM_TestAll.py
-#
+"""
+ * Translate the given object along the vector, specified
+ * by its end points, creating its copy before the translation.
+ * \param theObject The object to be translated.
+ * \param thePoint1 Start point of translation vector.
+ * \param thePoint2 End point of translation vector.
+ * \return New GEOM_Object, containing the translated object.
+
+ * Example: see GEOM_TestAll.py
+"""
def MakeTranslationTwoPoints(theObject, thePoint1, thePoint2):
anObj = TrsfOp.TranslateTwoPointsCopy(theObject, thePoint1, thePoint2)
if TrsfOp.IsDone() == 0:
print "TranslateTwoPointsCopy : ", TrsfOp.GetErrorCode()
return anObj
-# * Translate the given object along the vector, specified
-# * by its components, creating its copy before the translation.
-# * \param theObject The object to be translated.
-# * \param theDX,theDY,theDZ Components of translation vector.
-# * \return New GEOM_Object, containing the translated object.
-#
-# * Example: see GEOM_TestAll.py
-#
+"""
+ * Translate the given object along the vector, specified
+ * by its components, creating its copy before the translation.
+ * \param theObject The object to be translated.
+ * \param theDX,theDY,theDZ Components of translation vector.
+ * \return New GEOM_Object, containing the translated object.
+
+ * Example: see GEOM_TestAll.py
+"""
def MakeTranslation(theObject, theDX, theDY, theDZ):
anObj = TrsfOp.TranslateDXDYDZCopy(theObject, theDX, theDY, theDZ)
if TrsfOp.IsDone() == 0:
print "TranslateDXDYDZCopy : ", TrsfOp.GetErrorCode()
return anObj
-# * Rotate the given object around the given axis
-# * on the given angle, creating its copy before the rotatation.
-# * \param theObject The object to be rotated.
-# * \param theAxis Rotation axis.
-# * \param theAngle Rotation angle in radians.
-# * \return New GEOM_Object, containing the rotated object.
-#
-# * Example: see GEOM_TestAll.py
-#
+"""
+ * Translate the given object along the given vector,
+ * creating its copy before the translation.
+ * \param theObject The object to be translated.
+ * \param theVector The translation vector.
+ * \return New GEOM_Object, containing the translated object.
+
+ * Example: see GEOM_TestAll.py
+"""
+def MakeTranslationVector(theObject, theVector):
+ anObj = TrsfOp.TranslateVectorCopy(theObject, theVector)
+ if TrsfOp.IsDone() == 0:
+ print "TranslateVectorCopy : ", TrsfOp.GetErrorCode()
+ return anObj
+
+"""
+ * Rotate the given object around the given axis
+ * on the given angle, creating its copy before the rotatation.
+ * \param theObject The object to be rotated.
+ * \param theAxis Rotation axis.
+ * \param theAngle Rotation angle in radians.
+ * \return New GEOM_Object, containing the rotated object.
+
+ * Example: see GEOM_TestAll.py
+"""
def MakeRotation(theObject, theAxis, theAngle):
anObj = TrsfOp.RotateCopy(theObject, theAxis, theAngle)
if TrsfOp.IsDone() == 0:
print "RotateCopy : ", TrsfOp.GetErrorCode()
return anObj
-# * Scale the given object by the factor, creating its copy before the scaling.
-# * \param theObject The object to be scaled.
-# * \param thePoint Center point for scaling.
-# * \param theFactor Scaling factor value.
-# * \return New GEOM_Object, containing the scaled shape.
-#
-# * Example: see GEOM_TestAll.py
-#
+"""
+ * Scale the given object by the factor, creating its copy before the scaling.
+ * \param theObject The object to be scaled.
+ * \param thePoint Center point for scaling.
+ * \param theFactor Scaling factor value.
+ * \return New GEOM_Object, containing the scaled shape.
+
+ * Example: see GEOM_TestAll.py
+"""
def MakeScaleTransform(theObject, thePoint, theFactor):
anObj = TrsfOp.ScaleShapeCopy(theObject, thePoint, theFactor)
if TrsfOp.IsDone() == 0:
print "ScaleShapeCopy : ", TrsfOp.GetErrorCode()
return anObj
-# * Create an object, symmetrical
-# * to the given one relatively the given plane.
-# * \param theObject The object to be mirrored.
-# * \param thePlane Plane of symmetry.
-# * \return New GEOM_Object, containing the mirrored shape.
-#
-# * Example: see GEOM_TestAll.py
-#
+"""
+ * Create an object, symmetrical
+ * to the given one relatively the given plane.
+ * \param theObject The object to be mirrored.
+ * \param thePlane Plane of symmetry.
+ * \return New GEOM_Object, containing the mirrored shape.
+
+ * Example: see GEOM_TestAll.py
+"""
def MakeMirrorByPlane(theObject, thePlane):
anObj = TrsfOp.MirrorPlaneCopy(theObject, thePlane)
if TrsfOp.IsDone() == 0:
print "MirrorPlaneCopy : ", TrsfOp.GetErrorCode()
return anObj
-# * Modify the Location of the given object by LCS
-# * creating its copy before the setting
-#
-# * Example: see GEOM_TestAll.py
-#
+"""
+ * Create an object, symmetrical
+ * to the given one relatively the given axis.
+ * \param theObject The object to be mirrored.
+ * \param theAxis Axis of symmetry.
+ * \return New GEOM_Object, containing the mirrored shape.
+
+ * Example: see GEOM_TestAll.py
+"""
+def MakeMirrorByAxis(theObject, theAxis):
+ anObj = TrsfOp.MirrorAxisCopy(theObject, theAxis)
+ if TrsfOp.IsDone() == 0:
+ print "MirrorAxisCopy : ", TrsfOp.GetErrorCode()
+ return anObj
+
+"""
+ * Create an object, symmetrical
+ * to the given one relatively the given point.
+ * \param theObject The object to be mirrored.
+ * \param thePoint Point of symmetry.
+ * \return New GEOM_Object, containing the mirrored shape.
+
+ * Example: see GEOM_TestAll.py
+"""
+def MakeMirrorByPoint(theObject, thePoint):
+ anObj = TrsfOp.MirrorPointCopy(theObject, thePoint)
+ if TrsfOp.IsDone() == 0:
+ print "MirrorPointCopy : ", TrsfOp.GetErrorCode()
+ return anObj
+
+"""
+ * Modify the Location of the given object by LCS
+ * creating its copy before the setting
+
+ * Example: see GEOM_TestAll.py
+"""
def MakePosition(theObject, theStartLCS, theEndLCS):
anObj = TrsfOp.PositionShapeCopy(theObject, theStartLCS, theEndLCS)
if TrsfOp.IsDone() == 0:
print "PositionShapeCopy : ", TrsfOp.GetErrorCode()
return anObj
-# * Create new object as offset of the given one.
-# * \param theObject The base object for the offset.
-# * \param theOffset Offset value.
-# * \return New GEOM_Object, containing the offset object.
-#
-# * Example: see GEOM_TestAll.py
-#
+"""
+ * Create new object as offset of the given one.
+ * \param theObject The base object for the offset.
+ * \param theOffset Offset value.
+ * \return New GEOM_Object, containing the offset object.
+
+ * Example: see GEOM_TestAll.py
+"""
def MakeOffset(theObject, theOffset):
anObj = TrsfOp.OffsetShapeCopy(theObject, theOffset)
if TrsfOp.IsDone() == 0:
# Patterns
# -----------------------------------------------------------------------------
-# * Translate the given object along the given vector a given number times
-# * \param theObject The object to be translated.
-# * \param theVector Direction of the translation.
-# * \param theStep Distance to translate on.
-# * \param theNbTimes Quantity of translations to be done.
-# * \return New GEOM_Object, containing compound of all
-# * the shapes, obtained after each translation.
-#
-# * Example: see GEOM_TestAll.py
-#
+"""
+ * Translate the given object along the given vector a given number times
+ * \param theObject The object to be translated.
+ * \param theVector Direction of the translation.
+ * \param theStep Distance to translate on.
+ * \param theNbTimes Quantity of translations to be done.
+ * \return New GEOM_Object, containing compound of all
+ * the shapes, obtained after each translation.
+
+ * Example: see GEOM_TestAll.py
+"""
def MakeMultiTranslation1D(theObject, theVector, theStep, theNbTimes):
anObj = TrsfOp.MultiTranslate1D(theObject, theVector, theStep, theNbTimes)
if TrsfOp.IsDone() == 0:
print "MultiTranslate1D : ", TrsfOp.GetErrorCode()
return anObj
-# * Conseqently apply two specified translations to theObject specified number of times.
-# * \param theObject The object to be translated.
-# * \param theVector1 Direction of the first translation.
-# * \param theStep1 Step of the first translation.
-# * \param theNbTimes1 Quantity of translations to be done along theVector1.
-# * \param theVector2 Direction of the second translation.
-# * \param theStep2 Step of the second translation.
-# * \param theNbTimes2 Quantity of translations to be done along theVector2.
-# * \return New GEOM_Object, containing compound of all
-# * the shapes, obtained after each translation.
-#
-# * Example: see GEOM_TestAll.py
-#
+"""
+ * Conseqently apply two specified translations to theObject specified number of times.
+ * \param theObject The object to be translated.
+ * \param theVector1 Direction of the first translation.
+ * \param theStep1 Step of the first translation.
+ * \param theNbTimes1 Quantity of translations to be done along theVector1.
+ * \param theVector2 Direction of the second translation.
+ * \param theStep2 Step of the second translation.
+ * \param theNbTimes2 Quantity of translations to be done along theVector2.
+ * \return New GEOM_Object, containing compound of all
+ * the shapes, obtained after each translation.
+
+ * Example: see GEOM_TestAll.py
+"""
def MakeMultiTranslation2D(theObject, theVector1, theStep1, theNbTimes1,
theVector2, theStep2, theNbTimes2):
anObj = TrsfOp.MultiTranslate2D(theObject, theVector1, theStep1, theNbTimes1,
print "MultiTranslate2D : ", TrsfOp.GetErrorCode()
return anObj
-# * Rotate the given object around the given axis a given number times.
-# * Rotation angle will be 2*PI/theNbTimes.
-# * \param theObject The object to be rotated.
-# * \param theAxis The rotation axis.
-# * \param theNbTimes Quantity of rotations to be done.
-# * \return New GEOM_Object, containing compound of all the
-# * shapes, obtained after each rotation.
-#
-# * Example: see GEOM_TestAll.py
-#
+"""
+ * Rotate the given object around the given axis a given number times.
+ * Rotation angle will be 2*PI/theNbTimes.
+ * \param theObject The object to be rotated.
+ * \param theAxis The rotation axis.
+ * \param theNbTimes Quantity of rotations to be done.
+ * \return New GEOM_Object, containing compound of all the
+ * shapes, obtained after each rotation.
+
+ * Example: see GEOM_TestAll.py
+"""
def MultiRotate1D(theObject, theAxis, theNbTimes):
anObj = TrsfOp.MultiRotate1D(theObject, theAxis, theNbTimes)
if TrsfOp.IsDone() == 0:
print "MultiRotate1D : ", TrsfOp.GetErrorCode()
return anObj
-# * Rotate the given object around the
-# * given axis on the given angle a given number
-# * times and multi-translate each rotation result.
-# * Translation direction passes through center of gravity
-# * of rotated shape and its projection on the rotation axis.
-# * \param theObject The object to be rotated.
-# * \param theAxis Rotation axis.
-# * \param theAngle Rotation angle in graduces.
-# * \param theNbTimes1 Quantity of rotations to be done.
-# * \param theStep Translation distance.
-# * \param theNbTimes2 Quantity of translations to be done.
-# * \return New GEOM_Object, containing compound of all the
-# * shapes, obtained after each transformation.
-#
-# * Example: see GEOM_TestAll.py
-#
+"""
+ * Rotate the given object around the
+ * given axis on the given angle a given number
+ * times and multi-translate each rotation result.
+ * Translation direction passes through center of gravity
+ * of rotated shape and its projection on the rotation axis.
+ * \param theObject The object to be rotated.
+ * \param theAxis Rotation axis.
+ * \param theAngle Rotation angle in graduces.
+ * \param theNbTimes1 Quantity of rotations to be done.
+ * \param theStep Translation distance.
+ * \param theNbTimes2 Quantity of translations to be done.
+ * \return New GEOM_Object, containing compound of all the
+ * shapes, obtained after each transformation.
+
+ * Example: see GEOM_TestAll.py
+"""
def MultiRotate2D(theObject, theAxis, theAngle, theNbTimes1, theStep, theNbTimes2):
anObj = TrsfOp.MultiRotate2D(theObject, theAxis, theAngle, theNbTimes1, theStep, theNbTimes2)
if TrsfOp.IsDone() == 0:
print "MultiRotate2D : ", TrsfOp.GetErrorCode()
return anObj
-# * The same, as MultiRotate1D(), but axis is given by direction and point
-#
-# * Example: see GEOM_TestOthers.py
-#
+"""
+ * The same, as MultiRotate1D(), but axis is given by direction and point
+
+ * Example: see GEOM_TestOthers.py
+"""
def MakeMultiRotation1D(aShape,aDir,aPoint,aNbTimes):
aVec = MakeLine(aPoint,aDir)
anObj = MultiRotate1D(aShape,aVec,aNbTimes)
return anObj
-# * The same, as MultiRotate2D(), but axis is given by direction and point
-#
-# * Example: see GEOM_TestOthers.py
-#
+"""
+ * The same, as MultiRotate2D(), but axis is given by direction and point
+
+ * Example: see GEOM_TestOthers.py
+"""
def MakeMultiRotation2D(aShape,aDir,aPoint,anAngle,nbtimes1,aStep,nbtimes2):
aVec = MakeLine(aPoint,aDir)
anObj = MultiRotate2D(aShape,aVec,anAngle,nbtimes1,aStep,nbtimes2)
# Local operations
# -----------------------------------------------------------------------------
-# * Perform a fillet on all edges of the given shape.
-# * \param theShape Shape, to perform fillet on.
-# * \param theR Fillet radius.
-# * \return New GEOM_Object, containing the result shape.
-#
-# * Example: see GEOM_TestOthers.py
-#
+"""
+ * Perform a fillet on all edges of the given shape.
+ * \param theShape Shape, to perform fillet on.
+ * \param theR Fillet radius.
+ * \return New GEOM_Object, containing the result shape.
+
+ * Example: see GEOM_TestOthers.py
+"""
def MakeFilletAll(theShape, theR):
anObj = LocalOp.MakeFilletAll(theShape, theR)
if LocalOp.IsDone() == 0:
print "MakeFilletAll : ", LocalOp.GetErrorCode()
return anObj
-# * Perform a fillet on the specified edges/faces of the given shape
-# * \param theShape Shape, to perform fillet on.
-# * \param theR Fillet radius.
-# * \param theShapeType Type of shapes in <theListShapes>.
-# * \param theListShapes Global indices of edges/faces to perform fillet on.
-# * \note Global index of sub-shape can be obtained, using method geompy.GetSubShapeID().
-# * \return New GEOM_Object, containing the result shape.
-#
-# * Example: see GEOM_TestAll.py
-#
+"""
+ * Perform a fillet on the specified edges/faces of the given shape
+ * \param theShape Shape, to perform fillet on.
+ * \param theR Fillet radius.
+ * \param theShapeType Type of shapes in <theListShapes>.
+ * \param theListShapes Global indices of edges/faces to perform fillet on.
+ * \note Global index of sub-shape can be obtained, using method geompy.GetSubShapeID().
+ * \return New GEOM_Object, containing the result shape.
+
+ * Example: see GEOM_TestAll.py
+"""
def MakeFillet(theShape, theR, theShapeType, theListShapes):
anObj = None
if theShapeType == ShapeType["EDGE"]:
print "MakeFillet : ", LocalOp.GetErrorCode()
return anObj
-# * Perform a symmetric chamfer on all edges of the given shape.
-# * \param theShape Shape, to perform chamfer on.
-# * \param theD Chamfer size along each face.
-# * \return New GEOM_Object, containing the result shape.
-#
-# * Example: see GEOM_TestOthers.py
-#
+"""
+ * Perform a symmetric chamfer on all edges of the given shape.
+ * \param theShape Shape, to perform chamfer on.
+ * \param theD Chamfer size along each face.
+ * \return New GEOM_Object, containing the result shape.
+
+ * Example: see GEOM_TestOthers.py
+"""
def MakeChamferAll(theShape, theD):
anObj = LocalOp.MakeChamferAll(theShape, theD)
if LocalOp.IsDone() == 0:
print "MakeChamferAll : ", LocalOp.GetErrorCode()
return anObj
-# * Perform a chamfer on edges, common to the specified faces,
-# * with distance D1 on the Face1
-# * \param theShape Shape, to perform chamfer on.
-# * \param theD1 Chamfer size along \a theFace1.
-# * \param theD2 Chamfer size along \a theFace2.
-# * \param theFace1,theFace2 Global indices of two faces of \a theShape.
-# * \note Global index of sub-shape can be obtained, using method geompy.GetSubShapeID().
-# * \return New GEOM_Object, containing the result shape.
-#
-# * Example: see GEOM_TestAll.py
-#
+"""
+ * Perform a chamfer on edges, common to the specified faces,
+ * with distance D1 on the Face1
+ * \param theShape Shape, to perform chamfer on.
+ * \param theD1 Chamfer size along \a theFace1.
+ * \param theD2 Chamfer size along \a theFace2.
+ * \param theFace1,theFace2 Global indices of two faces of \a theShape.
+ * \note Global index of sub-shape can be obtained, using method geompy.GetSubShapeID().
+ * \return New GEOM_Object, containing the result shape.
+
+ * Example: see GEOM_TestAll.py
+"""
def MakeChamferEdge(theShape, theD1, theD2, theFace1, theFace2):
anObj = LocalOp.MakeChamferEdge(theShape, theD1, theD2, theFace1, theFace2)
if LocalOp.IsDone() == 0:
print "MakeChamferEdge : ", LocalOp.GetErrorCode()
return anObj
-# * Perform a chamfer on all edges of the specified faces,
-# * with distance D1 on the first specified face (if several for one edge)
-# * \param theShape Shape, to perform chamfer on.
-# * \param theD1 Chamfer size along face from \a theFaces. If both faces,
-# * connected to the edge, are in \a theFaces, \a theD1
-# * will be get along face, which is nearer to \a theFaces beginning.
-# * \param theD2 Chamfer size along another of two faces, connected to the edge.
-# * \param theFaces Sequence of global indices of faces of \a theShape.
-# * \note Global index of sub-shape can be obtained, using method geompy.GetSubShapeIndex().
-# * \return New GEOM_Object, containing the result shape.
-#
-# * Example: see GEOM_TestAll.py
-#
+"""
+ * Perform a chamfer on all edges of the specified faces,
+ * with distance D1 on the first specified face (if several for one edge)
+ * \param theShape Shape, to perform chamfer on.
+ * \param theD1 Chamfer size along face from \a theFaces. If both faces,
+ * connected to the edge, are in \a theFaces, \a theD1
+ * will be get along face, which is nearer to \a theFaces beginning.
+ * \param theD2 Chamfer size along another of two faces, connected to the edge.
+ * \param theFaces Sequence of global indices of faces of \a theShape.
+ * \note Global index of sub-shape can be obtained, using method geompy.GetSubShapeID().
+ * \return New GEOM_Object, containing the result shape.
+
+ * Example: see GEOM_TestAll.py
+"""
def MakeChamferFaces(theShape, theD1, theD2, theFaces):
anObj = LocalOp.MakeChamferFaces(theShape, theD1, theD2, theFaces)
if LocalOp.IsDone() == 0:
print "MakeChamferFaces : ", LocalOp.GetErrorCode()
return anObj
-# * Shortcut to MakeChamferEdge() and MakeChamferFaces()
-#
-# * Example: see GEOM_TestOthers.py
-#
+"""
+ * Shortcut to MakeChamferEdge() and MakeChamferFaces()
+
+ * Example: see GEOM_TestOthers.py
+"""
def MakeChamfer(aShape,d1,d2,aShapeType,ListShape):
anObj = None
if aShapeType == ShapeType["EDGE"]:
anObj = MakeChamferFaces(aShape,d1,d2,ListShape)
return anObj
-# * Perform an Archimde operation on the given shape with given parameters.
-# * The object presenting the resulting face is returned
-# * \param theShape Shape to be put in water.
-# * \param theWeight Weight og the shape.
-# * \param theWaterDensity Density of the water.
-# * \param theMeshDeflection Deflection of the mesh, using to compute the section.
-# * \return New GEOM_Object, containing a section of \a theShape
-# * by a plane, corresponding to water level.
-#
-# * Example: see GEOM_TestAll.py
-#
+"""
+ * Perform an Archimde operation on the given shape with given parameters.
+ * The object presenting the resulting face is returned
+ * \param theShape Shape to be put in water.
+ * \param theWeight Weight og the shape.
+ * \param theWaterDensity Density of the water.
+ * \param theMeshDeflection Deflection of the mesh, using to compute the section.
+ * \return New GEOM_Object, containing a section of \a theShape
+ * by a plane, corresponding to water level.
+
+ * Example: see GEOM_TestAll.py
+"""
def Archimede(theShape, theWeight, theWaterDensity, theMeshDeflection):
anObj = LocalOp.MakeArchimede(theShape, theWeight, theWaterDensity, theMeshDeflection)
if LocalOp.IsDone() == 0:
# Information objects
# -----------------------------------------------------------------------------
-# * Get point coordinates
-# * \return [x, y, z]
-#
-# * Example: see GEOM_TestMeasures.py
-#
+"""
+ * Get point coordinates
+ * \return [x, y, z]
+
+ * Example: see GEOM_TestMeasures.py
+"""
def PointCoordinates(Point):
aTuple = MeasuOp.PointCoordinates(Point)
if MeasuOp.IsDone() == 0:
print "PointCoordinates : ", MeasuOp.GetErrorCode()
return aTuple
-# * Get summarized length of all wires,
-# * area of surface and volume of the given shape.
-# * \param theShape Shape to define properties of.
-# * \return [theLength, theSurfArea, theVolume]
-# * theLength: Summarized length of all wires of the given shape.
-# * theSurfArea: Area of surface of the given shape.
-# * theVolume: Volume of the given shape.
-#
-# * Example: see GEOM_TestMeasures.py
-#
+"""
+ * Get summarized length of all wires,
+ * area of surface and volume of the given shape.
+ * \param theShape Shape to define properties of.
+ * \return [theLength, theSurfArea, theVolume]
+ * theLength: Summarized length of all wires of the given shape.
+ * theSurfArea: Area of surface of the given shape.
+ * theVolume: Volume of the given shape.
+
+ * Example: see GEOM_TestMeasures.py
+"""
def BasicProperties(theShape):
aTuple = MeasuOp.GetBasicProperties(theShape)
if MeasuOp.IsDone() == 0:
print "BasicProperties : ", MeasuOp.GetErrorCode()
return aTuple
-# * Get parameters of bounding box of the given shape
-# * \param theShape Shape to obtain bounding box of.
-# * \return [Xmin,Xmax, Ymin,Ymax, Zmin,Zmax]
-# * Xmin,Xmax: Limits of shape along OX axis.
-# * Ymin,Ymax: Limits of shape along OY axis.
-# * Zmin,Zmax: Limits of shape along OZ axis.
-#
-# * Example: see GEOM_TestMeasures.py
-#
+"""
+ * Get parameters of bounding box of the given shape
+ * \param theShape Shape to obtain bounding box of.
+ * \return [Xmin,Xmax, Ymin,Ymax, Zmin,Zmax]
+ * Xmin,Xmax: Limits of shape along OX axis.
+ * Ymin,Ymax: Limits of shape along OY axis.
+ * Zmin,Zmax: Limits of shape along OZ axis.
+
+ * Example: see GEOM_TestMeasures.py
+"""
def BoundingBox(theShape):
aTuple = MeasuOp.GetBoundingBox(theShape)
if MeasuOp.IsDone() == 0:
print "BoundingBox : ", MeasuOp.GetErrorCode()
return aTuple
-# * Get inertia matrix and moments of inertia of theShape.
-# * \param theShape Shape to calculate inertia of.
-# * \return [I11,I12,I13, I21,I22,I23, I31,I32,I33, Ix,Iy,Iz]
-# * I(1-3)(1-3): Components of the inertia matrix of the given shape.
-# * Ix,Iy,Iz: Moments of inertia of the given shape.
-#
-# * Example: see GEOM_TestMeasures.py
-#
+"""
+ * Get inertia matrix and moments of inertia of theShape.
+ * \param theShape Shape to calculate inertia of.
+ * \return [I11,I12,I13, I21,I22,I23, I31,I32,I33, Ix,Iy,Iz]
+ * I(1-3)(1-3): Components of the inertia matrix of the given shape.
+ * Ix,Iy,Iz: Moments of inertia of the given shape.
+
+ * Example: see GEOM_TestMeasures.py
+"""
def Inertia(theShape):
aTuple = MeasuOp.GetInertia(theShape)
if MeasuOp.IsDone() == 0:
print "Inertia : ", MeasuOp.GetErrorCode()
return aTuple
-# * Get minimal distance between the given shapes.
-# * \param theShape1,theShape2 Shapes to find minimal distance between.
-# * \return Value of the minimal distance between the given shapes.
-#
-# * Example: see GEOM_TestMeasures.py
-#
+"""
+ * Get minimal distance between the given shapes.
+ * \param theShape1,theShape2 Shapes to find minimal distance between.
+ * \return Value of the minimal distance between the given shapes.
+
+ * Example: see GEOM_TestMeasures.py
+"""
def MinDistance(theShape1, theShape2):
aTuple = MeasuOp.GetMinDistance(theShape1, theShape2)
if MeasuOp.IsDone() == 0:
print "MinDistance : ", MeasuOp.GetErrorCode()
return aTuple[0]
-# * Get min and max tolerances of sub-shapes of theShape
-# * \param theShape Shape, to get tolerances of.
-# * \return [FaceMin,FaceMax, EdgeMin,EdgeMax, VertMin,VertMax]
-# * FaceMin,FaceMax: Min and max tolerances of the faces.
-# * EdgeMin,EdgeMax: Min and max tolerances of the edges.
-# * VertMin,VertMax: Min and max tolerances of the vertices.
-#
-# * Example: see GEOM_TestMeasures.py
-#
+"""
+ * Get min and max tolerances of sub-shapes of theShape
+ * \param theShape Shape, to get tolerances of.
+ * \return [FaceMin,FaceMax, EdgeMin,EdgeMax, VertMin,VertMax]
+ * FaceMin,FaceMax: Min and max tolerances of the faces.
+ * EdgeMin,EdgeMax: Min and max tolerances of the edges.
+ * VertMin,VertMax: Min and max tolerances of the vertices.
+
+ * Example: see GEOM_TestMeasures.py
+"""
def Tolerance(theShape):
aTuple = MeasuOp.GetTolerance(theShape)
if MeasuOp.IsDone() == 0:
print "Tolerance : ", MeasuOp.GetErrorCode()
return aTuple
-# * Obtain description of the given shape (number of sub-shapes of each type)
-# * \param theShape Shape to be described.
-# * \return Description of the given shape.
-#
-# * Example: see GEOM_TestMeasures.py
-#
+"""
+ * Obtain description of the given shape (number of sub-shapes of each type)
+ * \param theShape Shape to be described.
+ * \return Description of the given shape.
+
+ * Example: see GEOM_TestMeasures.py
+"""
def WhatIs(theShape):
aDescr = MeasuOp.WhatIs(theShape)
if MeasuOp.IsDone() == 0:
print "WhatIs : ", MeasuOp.GetErrorCode()
return aDescr
-# * Get a point, situated at the centre of mass of theShape.
-# * \param theShape Shape to define centre of mass of.
-# * \return New GEOM_Object, containing the created point.
-#
-# * Example: see GEOM_TestMeasures.py
-#
+"""
+ * Get a point, situated at the centre of mass of theShape.
+ * \param theShape Shape to define centre of mass of.
+ * \return New GEOM_Object, containing the created point.
+
+ * Example: see GEOM_TestMeasures.py
+"""
def MakeCDG(theShape):
anObj = MeasuOp.GetCentreOfMass(theShape)
if MeasuOp.IsDone() == 0:
print "GetCentreOfMass : ", MeasuOp.GetErrorCode()
return anObj
-# * Check a topology of the given shape.
-# * \param theShape Shape to check validity of.
-# * \return TRUE, if the shape "seems to be valid" from the topological point of view.
-# * If theShape is invalid, prints a description of problem.
-#
-# * Example: see GEOM_TestMeasures.py
-#
+"""
+ * Check a topology of the given shape.
+ * \param theShape Shape to check validity of.
+ * \return TRUE, if the shape "seems to be valid" from the topological point of view.
+ * If theShape is invalid, prints a description of problem.
+
+ * Example: see GEOM_TestMeasures.py
+"""
def CheckShape(theShape):
(IsValid, Status) = MeasuOp.CheckShape(theShape)
if MeasuOp.IsDone() == 0:
# Import/Export objects
# -----------------------------------------------------------------------------
-# * Import a shape from the BREP or IGES or STEP file
-# * (depends on given format) with given name.
-# * \param theFileName The file, containing the shape.
-# * \param theFormatName Specify format for the file reading.
-# * Available formats can be obtained with InsertOp.ImportTranslators() method.
-# * \return New GEOM_Object, containing the imported shape.
-#
-# * Example: see GEOM_TestOthers.py
-#
+"""
+ * Import a shape from the BREP or IGES or STEP file
+ * (depends on given format) with given name.
+ * \param theFileName The file, containing the shape.
+ * \param theFormatName Specify format for the file reading.
+ * Available formats can be obtained with InsertOp.ImportTranslators() method.
+ * \return New GEOM_Object, containing the imported shape.
+
+ * Example: see GEOM_TestOthers.py
+"""
def Import(theFileName, theFormatName):
anObj = InsertOp.Import(theFileName, theFormatName)
if InsertOp.IsDone() == 0:
print "Import : ", InsertOp.GetErrorCode()
return anObj
-# * Shortcuts to Import() for certain formats
-#
-# * Example: see GEOM_TestOthers.py
-#
+"""
+ * Shortcuts to Import() for certain formats
+
+ * Example: see GEOM_TestOthers.py
+"""
def ImportBREP(theFileName):
return Import(theFileName, "BREP")
-#
+
def ImportIGES(theFileName):
return Import(theFileName, "IGES")
-#
+
def ImportSTEP(theFileName):
return Import(theFileName, "STEP")
-# * Export the given shape into a file with given name.
-# * \param theObject Shape to be stored in the file.
-# * \param theFileName Name of the file to store the given shape in.
-# * \param theFormatName Specify format for the shape storage.
-# * Available formats can be obtained with InsertOp.ImportTranslators() method.
-#
-# * Example: see GEOM_TestOthers.py
-#
+"""
+ * Export the given shape into a file with given name.
+ * \param theObject Shape to be stored in the file.
+ * \param theFileName Name of the file to store the given shape in.
+ * \param theFormatName Specify format for the shape storage.
+ * Available formats can be obtained with InsertOp.ImportTranslators() method.
+
+ * Example: see GEOM_TestOthers.py
+"""
def Export(theObject, theFileName, theFormatName):
InsertOp.Export(theObject, theFileName, theFormatName)
if InsertOp.IsDone() == 0:
print "Export : ", InsertOp.GetErrorCode()
-# * Shortcuts to Export() for certain formats
-#
-# * Example: see GEOM_TestOthers.py
-#
+"""
+ * Shortcuts to Export() for certain formats
+
+ * Example: see GEOM_TestOthers.py
+"""
def ExportBREP(theObject, theFileName):
return Export(theObject, theFileName, "BREP")
-#
+
def ExportIGES(theObject, theFileName):
return Export(theObject, theFileName, "IGES")
-#
+
def ExportSTEP(theObject, theFileName):
return Export(theObject, theFileName, "STEP")
# Block operations
# -----------------------------------------------------------------------------
-# * Create a quadrangle face from four edges. Order of Edges is not
-# * important. It is not necessary that edges share the same vertex.
-# * \param E1,E2,E3,E4 Edges for the face bound.
-# * \return New GEOM_Object, containing the created face.
-#
-# * Example: see GEOM_Spanner.py
-#
+"""
+ * Create a quadrangle face from four edges. Order of Edges is not
+ * important. It is not necessary that edges share the same vertex.
+ * \param E1,E2,E3,E4 Edges for the face bound.
+ * \return New GEOM_Object, containing the created face.
+
+ * Example: see GEOM_Spanner.py
+"""
def MakeQuad(E1, E2, E3, E4):
anObj = BlocksOp.MakeQuad(E1, E2, E3, E4)
if BlocksOp.IsDone() == 0:
print "MakeQuad : ", BlocksOp.GetErrorCode()
return anObj
-# * Create a quadrangle face on two edges.
-# * The missing edges will be built by creating the shortest ones.
-# * \param E1,E2 Two opposite edges for the face.
-# * \return New GEOM_Object, containing the created face.
-#
-# * Example: see GEOM_Spanner.py
-#
+"""
+ * Create a quadrangle face on two edges.
+ * The missing edges will be built by creating the shortest ones.
+ * \param E1,E2 Two opposite edges for the face.
+ * \return New GEOM_Object, containing the created face.
+
+ * Example: see GEOM_Spanner.py
+"""
def MakeQuad2Edges(E1, E2):
anObj = BlocksOp.MakeQuad2Edges(E1, E2)
if BlocksOp.IsDone() == 0:
print "MakeQuad2Edges : ", BlocksOp.GetErrorCode()
return anObj
-# * Create a quadrangle face with specified corners.
-# * The missing edges will be built by creating the shortest ones.
-# * \param V1,V2,V3,V4 Corner vertices for the face.
-# * \return New GEOM_Object, containing the created face.
-#
-# * Example: see GEOM_Spanner.py
-#
+"""
+ * Create a quadrangle face with specified corners.
+ * The missing edges will be built by creating the shortest ones.
+ * \param V1,V2,V3,V4 Corner vertices for the face.
+ * \return New GEOM_Object, containing the created face.
+
+ * Example: see GEOM_Spanner.py
+"""
def MakeQuad4Vertices(V1, V2, V3, V4):
anObj = BlocksOp.MakeQuad4Vertices(V1, V2, V3, V4)
if BlocksOp.IsDone() == 0:
print "MakeQuad4Vertices : ", BlocksOp.GetErrorCode()
return anObj
-# * Create a hexahedral solid, bounded by the six given faces. Order of
-# * faces is not important. It is not necessary that Faces share the same edge.
-# * \param F1,F2,F3,F4,F5,F6 Faces for the hexahedral solid.
-# * \return New GEOM_Object, containing the created solid.
-#
-# * Example: see GEOM_Spanner.py
-#
+"""
+ * Create a hexahedral solid, bounded by the six given faces. Order of
+ * faces is not important. It is not necessary that Faces share the same edge.
+ * \param F1,F2,F3,F4,F5,F6 Faces for the hexahedral solid.
+ * \return New GEOM_Object, containing the created solid.
+
+ * Example: see GEOM_Spanner.py
+"""
def MakeHexa(F1, F2, F3, F4, F5, F6):
anObj = BlocksOp.MakeHexa(F1, F2, F3, F4, F5, F6)
if BlocksOp.IsDone() == 0:
print "MakeHexa : ", BlocksOp.GetErrorCode()
return anObj
-# * Create a hexahedral solid between two given faces.
-# * The missing faces will be built by creating the smallest ones.
-# * \param F1,F2 Two opposite faces for the hexahedral solid.
-# * \return New GEOM_Object, containing the created solid.
-#
-# * Example: see GEOM_Spanner.py
-#
+"""
+ * Create a hexahedral solid between two given faces.
+ * The missing faces will be built by creating the smallest ones.
+ * \param F1,F2 Two opposite faces for the hexahedral solid.
+ * \return New GEOM_Object, containing the created solid.
+
+ * Example: see GEOM_Spanner.py
+"""
def MakeHexa2Faces(F1, F2):
anObj = BlocksOp.MakeHexa2Faces(F1, F2)
if BlocksOp.IsDone() == 0:
print "MakeHexa2Faces : ", BlocksOp.GetErrorCode()
return anObj
-# * Multi-transformate block and glue the result.
-# * Transformation is defined so, as to superpose direction faces.
-# * \param Block Hexahedral solid to be multi-transformed.
-# * \param DirFace1 ID of First direction face.
-# * \param DirFace2 ID of Second direction face.
-# * \param NbTimes Quantity of transformations to be done.
-# * \note Unique ID of sub-shape can be obtained, using method GetSubShapeID().
-# * \return New GEOM_Object, containing the result shape.
-#
-# * Example: see GEOM_Spanner.py
-#
-def MakeMultiTransformation1D(Block, DirFace1, DirFace2, NbTimes):
- anObj = BlocksOp.MakeMultiTransformation1D(Block, DirFace1, DirFace2, NbTimes)
+"""
+ * Get a vertex, found in the given shape by its coordinates.
+ * \param theShape Block or a compound of blocks.
+ * \param theX,theY,theZ Coordinates of the sought vertex.
+ * \param theEpsilon Maximum allowed distance between the resulting
+ * vertex and point with the given coordinates.
+ * \return New GEOM_Object, containing the found vertex.
+
+ * Example: see GEOM_TestOthers.py
+"""
+def GetPoint(theShape, theX, theY, theZ, theEpsilon):
+ anObj = BlocksOp.GetPoint(theShape, theX, theY, theZ, theEpsilon)
if BlocksOp.IsDone() == 0:
- print "MakeMultiTransformation1D : ", BlocksOp.GetErrorCode()
+ print "GetPoint : ", BlocksOp.GetErrorCode()
return anObj
-# * Multi-transformate block and glue the result.
-# * \param Block Hexahedral solid to be multi-transformed.
-# * \param DirFace1U,DirFace2U IDs of Direction faces for the first transformation.
-# * \param DirFace1V,DirFace2V IDs of Direction faces for the second transformation.
-# * \param NbTimesU,NbTimesV Quantity of transformations to be done.
-# * \return New GEOM_Object, containing the result shape.
-#
-# * Example: see GEOM_Spanner.py
-#
-def MakeMultiTransformation2D(Block, DirFace1U, DirFace2U, NbTimesU,
- DirFace1V, DirFace2V, NbTimesV):
- anObj = BlocksOp.MakeMultiTransformation2D(Block, DirFace1U, DirFace2U, NbTimesU,
- DirFace1V, DirFace2V, NbTimesV)
+"""
+ * Get an edge, found in the given shape by two given vertices.
+ * \param theShape Block or a compound of blocks.
+ * \param thePoint1,thePoint2 Points, close to the ends of the desired edge.
+ * \return New GEOM_Object, containing the found edge.
+
+ * Example: see GEOM_Spanner.py
+"""
+def GetEdge(theShape, thePoint1, thePoint2):
+ anObj = BlocksOp.GetEdge(theShape, thePoint1, thePoint2)
if BlocksOp.IsDone() == 0:
- print "MakeMultiTransformation2D : ", BlocksOp.GetErrorCode()
+ print "GetEdge : ", BlocksOp.GetErrorCode()
return anObj
-# * Get all the blocks, contained in the given compound.
-# * \param theCompound The compound to explode.
-# * \param theMinNbFaces If solid has lower number of faces, it is not a block.
-# * \param theMaxNbFaces If solid has higher number of faces, it is not a block.
-# * \note If theMaxNbFaces = 0, the maximum number of faces is not restricted.
-# * \return List of GEOM_Objects, containing the retrieved blocks.
-#
-# * Example: see GEOM_TestOthers.py
-#
-def MakeBlockExplode(theCompound, theMinNbFaces, theMaxNbFaces):
- aList = BlocksOp.ExplodeCompoundOfBlocks(theCompound, theMinNbFaces, theMaxNbFaces)
+"""
+ * Find an edge of the given shape, which has minimal distance to the given point.
+ * \param theShape Block or a compound of blocks.
+ * \param thePoint Point, close to the desired edge.
+ * \return New GEOM_Object, containing the found edge.
+
+ * Example: see GEOM_TestOthers.py
+"""
+def GetEdgeNearPoint(theShape, thePoint):
+ anObj = BlocksOp.GetEdgeNearPoint(theShape, thePoint)
if BlocksOp.IsDone() == 0:
- print "MakeBlockExplode : ", BlocksOp.GetErrorCode()
- return aList
+ print "GetEdgeNearPoint : ", BlocksOp.GetErrorCode()
+ return anObj
-# * Check, if the compound of blocks is given.
-# * To be considered as a compound of blocks, the
-# * given shape must satisfy the following conditions:
-# * - Each element of the compound should be a Block (6 faces and 12 edges).
-# * - A connection between two Blocks should be an entire quadrangle face or an entire edge.
-# * - The compound should be connexe.
-# * - The glue between two quadrangle faces should be applied.
-# * \param theCompound The compound to check.
-# * \return TRUE, if the given shape is a compound of blocks.
-# * If theCompound is not valid, prints all discovered errors.
-#
-# * Example: see GEOM_TestOthers.py
-#
+"""
+ * Returns a face, found in the given shape by four given corner vertices.
+ * \param theShape Block or a compound of blocks.
+ * \param thePoint1-thePoint4 Points, close to the corners of the desired face.
+ * \return New GEOM_Object, containing the found face.
+
+ * Example: see GEOM_Spanner.py
+"""
+def GetFaceByPoints(theShape, thePoint1, thePoint2, thePoint3, thePoint4):
+ anObj = BlocksOp.GetFaceByPoints(theShape, thePoint1, thePoint2, thePoint3, thePoint4)
+ if BlocksOp.IsDone() == 0:
+ print "GetFaceByPoints : ", BlocksOp.GetErrorCode()
+ return anObj
+
+"""
+ * Get a face of block, found in the given shape by two given edges.
+ * \param theShape Block or a compound of blocks.
+ * \param theEdge1,theEdge2 Edges, close to the edges of the desired face.
+ * \return New GEOM_Object, containing the found face.
+
+ * Example: see GEOM_Spanner.py
+"""
+def GetFaceByEdges(theShape, theEdge1, theEdge2):
+ anObj = BlocksOp.GetFaceByEdges(theShape, theEdge1, theEdge2)
+ if BlocksOp.IsDone() == 0:
+ print "GetFaceByEdges : ", BlocksOp.GetErrorCode()
+ return anObj
+
+"""
+ * Find a face, opposite to the given one in the given block.
+ * \param theBlock Must be a hexahedral solid.
+ * \param theFace Face of \a theBlock, opposite to the desired face.
+ * \return New GEOM_Object, containing the found face.
+
+ * Example: see GEOM_Spanner.py
+"""
+def GetOppositeFace(theBlock, theFace):
+ anObj = BlocksOp.GetOppositeFace(theBlock, theFace)
+ if BlocksOp.IsDone() == 0:
+ print "GetOppositeFace : ", BlocksOp.GetErrorCode()
+ return anObj
+
+"""
+ * Find a face of the given shape, which has minimal distance to the given point.
+ * \param theShape Block or a compound of blocks.
+ * \param thePoint Point, close to the desired face.
+ * \return New GEOM_Object, containing the found face.
+
+ * Example: see GEOM_Spanner.py
+"""
+def GetFaceNearPoint(theShape, thePoint):
+ anObj = BlocksOp.GetFaceNearPoint(theShape, thePoint)
+ if BlocksOp.IsDone() == 0:
+ print "GetFaceNearPoint : ", BlocksOp.GetErrorCode()
+ return anObj
+
+"""
+ * Find a face of block, whose outside normale has minimal angle with the given vector.
+ * \param theShape Block or a compound of blocks.
+ * \param theVector Vector, close to the normale of the desired face.
+ * \return New GEOM_Object, containing the found face.
+
+ * Example: see GEOM_Spanner.py
+"""
+def GetFaceByNormale(theBlock, theVector):
+ anObj = BlocksOp.GetFaceByNormale(theBlock, theVector)
+ if BlocksOp.IsDone() == 0:
+ print "GetFaceByNormale : ", BlocksOp.GetErrorCode()
+ return anObj
+
+"""
+ * Check, if the compound of blocks is given.
+ * To be considered as a compound of blocks, the
+ * given shape must satisfy the following conditions:
+ * - Each element of the compound should be a Block (6 faces and 12 edges).
+ * - A connection between two Blocks should be an entire quadrangle face or an entire edge.
+ * - The compound should be connexe.
+ * - The glue between two quadrangle faces should be applied.
+ * \param theCompound The compound to check.
+ * \return TRUE, if the given shape is a compound of blocks.
+ * If theCompound is not valid, prints all discovered errors.
+
+ * Example: see GEOM_Spanner.py
+"""
def CheckCompoundOfBlocks(theCompound):
(IsValid, BCErrors) = BlocksOp.CheckCompoundOfBlocks(theCompound)
if BlocksOp.IsDone() == 0:
print Descr
return IsValid
+"""
+ * Remove all seam and degenerated edges from \a theShape.
+ * Unite faces and edges, sharing one surface.
+ * \param theShape The compound or single solid to remove irregular edges from.
+ * \return Improved shape.
+
+ * Example: see GEOM_TestOthers.py
+"""
+def RemoveExtraEdges(theShape):
+ anObj = BlocksOp.RemoveExtraEdges(theShape)
+ if BlocksOp.IsDone() == 0:
+ print "RemoveExtraEdges : ", BlocksOp.GetErrorCode()
+ return anObj
+
+"""
+ * Check, if the given shape is a blocks compound.
+ * Fix all detected errors.
+ * \note Single block can be also fixed by this method.
+ * \param theCompound The compound to check and improve.
+ * \return Improved compound.
+
+ * Example: see GEOM_TestOthers.py
+"""
+def CheckAndImprove(theShape):
+ anObj = BlocksOp.CheckAndImprove(theShape)
+ if BlocksOp.IsDone() == 0:
+ print "CheckAndImprove : ", BlocksOp.GetErrorCode()
+ return anObj
+
+"""
+ * Get all the blocks, contained in the given compound.
+ * \param theCompound The compound to explode.
+ * \param theMinNbFaces If solid has lower number of faces, it is not a block.
+ * \param theMaxNbFaces If solid has higher number of faces, it is not a block.
+ * \note If theMaxNbFaces = 0, the maximum number of faces is not restricted.
+ * \return List of GEOM_Objects, containing the retrieved blocks.
+
+ * Example: see GEOM_TestOthers.py
+"""
+def MakeBlockExplode(theCompound, theMinNbFaces, theMaxNbFaces):
+ aList = BlocksOp.ExplodeCompoundOfBlocks(theCompound, theMinNbFaces, theMaxNbFaces)
+ if BlocksOp.IsDone() == 0:
+ print "MakeBlockExplode : ", BlocksOp.GetErrorCode()
+ return aList
+
+"""
+ * Find block, containing the given point inside its volume or on boundary.
+ * \param theCompound Compound, to find block in.
+ * \param thePoint Point, close to the desired block. If the point lays on
+ * boundary between some blocks, we return block with nearest center.
+ * \return New GEOM_Object, containing the found block.
+
+ * Example: see GEOM_Spanner.py
+"""
+def GetBlockNearPoint(theCompound, thePoint):
+ anObj = BlocksOp.GetBlockNearPoint(theCompound, thePoint)
+ if BlocksOp.IsDone() == 0:
+ print "GetBlockNearPoint : ", BlocksOp.GetErrorCode()
+ return anObj
+
+"""
+ * Find block, containing all the elements, passed as the parts, or maximum quantity of them.
+ * \param theCompound Compound, to find block in.
+ * \param theParts List of faces and/or edges and/or vertices to be parts of the found block.
+ * \return New GEOM_Object, containing the found block.
+
+ * Example: see GEOM_TestOthers.py
+"""
+def GetBlockByParts(theCompound, theParts):
+ anObj = BlocksOp.GetBlockByParts(theCompound, theParts)
+ if BlocksOp.IsDone() == 0:
+ print "GetBlockByParts : ", BlocksOp.GetErrorCode()
+ return anObj
+
+"""
+ * Return all blocks, containing all the elements, passed as the parts.
+ * \param theCompound Compound, to find blocks in.
+ * \param theParts List of faces and/or edges and/or vertices to be parts of the found blocks.
+ * \return List of GEOM_Objects, containing the found blocks.
+
+ * Example: see GEOM_Spanner.py
+"""
+def GetBlocksByParts(theCompound, theParts):
+ aList = BlocksOp.GetBlocksByParts(theCompound, theParts)
+ if BlocksOp.IsDone() == 0:
+ print "GetBlocksByParts : ", BlocksOp.GetErrorCode()
+ return aList
+
+"""
+ * Multi-transformate block and glue the result.
+ * Transformation is defined so, as to superpose direction faces.
+ * \param Block Hexahedral solid to be multi-transformed.
+ * \param DirFace1 ID of First direction face.
+ * \param DirFace2 ID of Second direction face.
+ * \param NbTimes Quantity of transformations to be done.
+ * \note Unique ID of sub-shape can be obtained, using method GetSubShapeID().
+ * \return New GEOM_Object, containing the result shape.
+
+ * Example: see GEOM_Spanner.py
+"""
+def MakeMultiTransformation1D(Block, DirFace1, DirFace2, NbTimes):
+ anObj = BlocksOp.MakeMultiTransformation1D(Block, DirFace1, DirFace2, NbTimes)
+ if BlocksOp.IsDone() == 0:
+ print "MakeMultiTransformation1D : ", BlocksOp.GetErrorCode()
+ return anObj
+
+"""
+ * Multi-transformate block and glue the result.
+ * \param Block Hexahedral solid to be multi-transformed.
+ * \param DirFace1U,DirFace2U IDs of Direction faces for the first transformation.
+ * \param DirFace1V,DirFace2V IDs of Direction faces for the second transformation.
+ * \param NbTimesU,NbTimesV Quantity of transformations to be done.
+ * \return New GEOM_Object, containing the result shape.
+
+ * Example: see GEOM_Spanner.py
+"""
+def MakeMultiTransformation2D(Block, DirFace1U, DirFace2U, NbTimesU,
+ DirFace1V, DirFace2V, NbTimesV):
+ anObj = BlocksOp.MakeMultiTransformation2D(Block, DirFace1U, DirFace2U, NbTimesU,
+ DirFace1V, DirFace2V, NbTimesV)
+ if BlocksOp.IsDone() == 0:
+ print "MakeMultiTransformation2D : ", BlocksOp.GetErrorCode()
+ return anObj
+
+"""
+ * Build all possible propagation groups.
+ * Propagation group is a set of all edges, opposite to one (main)
+ * edge of this group directly or through other opposite edges.
+ * Notion of Opposite Edge make sence only on quadrangle face.
+ * \param theShape Shape to build propagation groups on.
+ * \return List of GEOM_Objects, each of them is a propagation group.
+
+ * Example: see GEOM_TestOthers.py
+"""
+def Propagate(theShape):
+ listChains = BlocksOp.Propagate(theShape)
+ if BlocksOp.IsDone() == 0:
+ print "Propagate : ", BlocksOp.GetErrorCode()
+ return listChains
+
# -----------------------------------------------------------------------------
# Group operations
# -----------------------------------------------------------------------------
-# * Creates a new group which will store sub shapes of theMainShape
-# * \param theMainShape is a GEOM object on which the group is selected
-# * \param theShapeType defines a shape type of the group
-# * \return a newly created GEOM group
-#
-# * Example: see GEOM_TestOthers.py
-#
+"""
+ * Creates a new group which will store sub shapes of theMainShape
+ * \param theMainShape is a GEOM object on which the group is selected
+ * \param theShapeType defines a shape type of the group
+ * \return a newly created GEOM group
+
+ * Example: see GEOM_TestOthers.py
+"""
def CreateGroup(theMainShape, theShapeType):
anObj = GroupOp.CreateGroup(theMainShape, theShapeType)
if GroupOp.IsDone() == 0:
print "CreateGroup : ", GroupOp.GetErrorCode()
return anObj
-# * Adds a sub object with ID theSubShapeId to the group
-# * \param theGroup is a GEOM group to which the new sub shape is added
-# * \param theSubShapeID is a sub shape ID in the main object.
-# * \note Use method GetSubShapeID() to get an unique ID of the sub shape
-#
-# * Example: see GEOM_TestOthers.py
-#
+"""
+ * Adds a sub object with ID theSubShapeId to the group
+ * \param theGroup is a GEOM group to which the new sub shape is added
+ * \param theSubShapeID is a sub shape ID in the main object.
+ * \note Use method GetSubShapeID() to get an unique ID of the sub shape
+
+ * Example: see GEOM_TestOthers.py
+"""
def AddObject(theGroup, theSubShapeID):
GroupOp.AddObject(theGroup, theSubShapeID)
if GroupOp.IsDone() == 0:
print "AddObject : ", GroupOp.GetErrorCode()
-# * Removes a sub object with ID \a theSubShapeId from the group
-# * \param theGroup is a GEOM group from which the new sub shape is removed
-# * \param theSubShapeID is a sub shape ID in the main object.
-# * \note Use method GetSubShapeID() to get an unique ID of the sub shape
-#
-# * Example: see GEOM_TestOthers.py
-#
+"""
+ * Removes a sub object with ID \a theSubShapeId from the group
+ * \param theGroup is a GEOM group from which the new sub shape is removed
+ * \param theSubShapeID is a sub shape ID in the main object.
+ * \note Use method GetSubShapeID() to get an unique ID of the sub shape
+
+ * Example: see GEOM_TestOthers.py
+"""
def RemoveObject(theGroup, theSubShapeID):
GroupOp.RemoveObject(theGroup, theSubShapeID)
if GroupOp.IsDone() == 0:
print "RemoveObject : ", GroupOp.GetErrorCode()
-# * Returns a list of sub objects ID stored in the group
-# * \param theGroup is a GEOM group for which a list of IDs is requested
-#
-# * Example: see GEOM_TestOthers.py
-#
+"""
+ * Returns a list of sub objects ID stored in the group
+ * \param theGroup is a GEOM group for which a list of IDs is requested
+
+ * Example: see GEOM_TestOthers.py
+"""
def GetObjectIDs(theGroup):
ListIDs = GroupOp.GetObjects(theGroup)
if GroupOp.IsDone() == 0:
print "GetObjectIDs : ", GroupOp.GetErrorCode()
return ListIDs
-# Add Path to the system path
-#
+"""
+ * Returns a type of sub objects stored in the group
+ * \param theGroup is a GEOM group which type is returned.
+
+ * Example: see GEOM_TestOthers.py
+"""
+def GetType(theGroup):
+ aType = GroupOp.GetType(theGroup)
+ if GroupOp.IsDone() == 0:
+ print "GetType : ", GroupOp.GetErrorCode()
+ return aType
+
+"""
+ * Returns a main shape associated with the group
+ * \param theGroup is a GEOM group for which a main shape object is requested
+ * \return a GEOM object which is a main shape for theGroup
+
+ * Example: see GEOM_TestOthers.py
+"""
+def GetMainShape(theGroup):
+ anObj = GroupOp.GetMainShape(theGroup)
+ if GroupOp.IsDone() == 0:
+ print "GetMainShape : ", GroupOp.GetErrorCode()
+ return anObj
+
+"""
+ * Add Path to the system path
+"""
def addPath(Path):
if (sys.path.count(Path) < 1):
sys.path.append(Path)
MeasureGUI_MaxToleranceDlg.cxx \
MeasureGUI_WhatisDlg.cxx \
MeasureGUI_CheckShapeDlg.cxx \
+ MeasureGUI_CheckCompoundOfBlocksDlg.cxx \
MeasureGUI_PointDlg.cxx
LIB_MOC = \
MeasureGUI_MaxToleranceDlg.h \
MeasureGUI_WhatisDlg.h \
MeasureGUI_CheckShapeDlg.h \
+ MeasureGUI_CheckCompoundOfBlocksDlg.h \
MeasureGUI_PointDlg.h
LIB_CLIENT_IDL = SALOME_GenericObj.idl SALOME_Component.idl
#include "MeasureGUI_MaxToleranceDlg.h" // Method MAXTOLERANCE
#include "MeasureGUI_WhatisDlg.h" // Method WHATIS
#include "MeasureGUI_CheckShapeDlg.h" // Method CHECKSHAPE
+#include "MeasureGUI_CheckCompoundOfBlocksDlg.h" // Method CHECKCOMPOUND
#include "MeasureGUI_PointDlg.h" // Method POINTCOORDINATES
MeasureGUI* MeasureGUI::myGUIObject = 0;
switch ( theCommandID )
{
- case 701 : new MeasureGUI_PropertiesDlg ( parent, Sel ); break; // LENGTH, AREA AND VOLUME
- case 702 : new MeasureGUI_CenterMassDlg ( parent, Sel ); break; // CENTER MASS
- case 703 : new MeasureGUI_InertiaDlg ( parent, Sel ); break; // INERTIA
- case 7041: new MeasureGUI_BndBoxDlg ( parent, Sel ); break; // BOUNDING BOX
- case 7042: new MeasureGUI_DistanceDlg ( parent, Sel ); break; // MIN DISTANCE
- case 705 : new MeasureGUI_MaxToleranceDlg( parent, Sel ); break; // MAXTOLERANCE
- case 706 : new MeasureGUI_WhatisDlg ( parent, Sel ); break; // WHATIS
- case 707 : new MeasureGUI_CheckShapeDlg ( parent, Sel ); break; // CHECKSHAPE
- case 708 : new MeasureGUI_PointDlg ( parent, Sel ); break; // POINT COORDINATES
+ case 701 : new MeasureGUI_PropertiesDlg ( parent, Sel ); break; // LENGTH, AREA AND VOLUME
+ case 702 : new MeasureGUI_CenterMassDlg ( parent, Sel ); break; // CENTER MASS
+ case 703 : new MeasureGUI_InertiaDlg ( parent, Sel ); break; // INERTIA
+ case 7041 : new MeasureGUI_BndBoxDlg ( parent, Sel ); break; // BOUNDING BOX
+ case 7042 : new MeasureGUI_DistanceDlg ( parent, Sel ); break; // MIN DISTANCE
+ case 705 : new MeasureGUI_MaxToleranceDlg( parent, Sel ); break; // MAXTOLERANCE
+ case 706 : new MeasureGUI_WhatisDlg ( parent, Sel ); break; // WHATIS
+ case 707 : new MeasureGUI_CheckShapeDlg ( parent, Sel ); break; // CHECKSHAPE
+ case 7072 : new MeasureGUI_CheckCompoundOfBlocksDlg ( parent, Sel ); break; // CHECKCOMPOUND
+ case 708 : new MeasureGUI_PointDlg ( parent, Sel ); break; // POINT COORDINATES
default: parent->putInfo( tr( "GEOM_PRP_COMMAND" ).arg( theCommandID ) ); break;
}
--- /dev/null
+// GEOM GEOMGUI : GUI for Geometry component
+//
+// Copyright (C) 2003 OPEN CASCADE, EADS/CCR, LIP6, CEA/DEN,
+// CEDRAT, EDF R&D, LEG, PRINCIPIA R&D, BUREAU VERITAS
+//
+// This library is free software; you can redistribute it and/or
+// modify it under the terms of the GNU Lesser General Public
+// License as published by the Free Software Foundation; either
+// version 2.1 of the License.
+//
+// This library is distributed in the hope that it will be useful,
+// but WITHOUT ANY WARRANTY; without even the implied warranty of
+// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU
+// Lesser General Public License for more details.
+//
+// You should have received a copy of the GNU Lesser General Public
+// License along with this library; if not, write to the Free Software
+// Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307 USA
+//
+// See http://www.opencascade.org/SALOME/ or email : webmaster.salome@opencascade.org
+//
+//
+//
+// File : MeasureGUI_CheckCompoundOfBlocksDlg.cxx
+// Author : VKN
+// Module : GEOM
+// $Header$
+
+#include "MeasureGUI_CheckCompoundOfBlocksDlg.h"
+#include "MeasureGUI_1Sel1TextView_QTD.h"
+#include "SALOMEGUI_QtCatchCorbaException.hxx"
+
+#include "utilities.h"
+#include "QAD_Desktop.h"
+#include <TopTools_IndexedMapOfShape.hxx>
+#include <TopExp.hxx>
+#include "GEOMBase.h"
+#include "GEOMImpl_Types.hxx"
+
+#include <qtextedit.h>
+#include <qlineedit.h>
+#include <qlayout.h>
+#include <qpushbutton.h>
+#include <qradiobutton.h>
+#include <qbuttongroup.h>
+// QT Includes
+#include <qgroupbox.h>
+#include <qlabel.h>
+#include <qvaluelist.h>
+
+//VRV: porting on Qt 3.0.5
+#if QT_VERSION >= 0x030005
+#include <qlistbox.h>
+#endif
+//VRV: porting on Qt 3.0.5
+
+#define TEXTEDIT_FONT_FAMILY "Courier"
+#define TEXTEDIT_FONT_SIZE 11
+
+//=================================================================================
+// class : MeasureGUI_CheckCompoundOfBlocksDlg()
+// purpose : Constructs a MeasureGUI_CheckCompoundOfBlocksDlg which is a child of 'parent', with the
+// name 'name' and widget flags set to 'f'.
+// The dialog will by default be modeless, unless you set 'modal' to
+// TRUE to construct a modal dialog.
+//=================================================================================
+MeasureGUI_CheckCompoundOfBlocksDlg::MeasureGUI_CheckCompoundOfBlocksDlg( QWidget* parent, SALOME_Selection* Sel )
+: MeasureGUI_Skeleton( parent, "MeasureGUI_CheckCompoundOfBlocksDlg", Sel )
+{
+ QPixmap image0( QAD_Desktop::getResourceManager()->loadPixmap(
+ "GEOM",tr( "ICON_DLG_CHECK_COMPOUND_OF_BLOCKS" ) ) );
+ QPixmap image1( QAD_Desktop::getResourceManager()->loadPixmap(
+ "GEOM",tr( "ICON_SELECT" ) ) );
+
+ setCaption( tr( "GEOM_CHECK_BLOCKS_COMPOUND" ) );
+
+ /***************************************************************/
+
+ GroupConstructors->setTitle( tr( "GEOM_CHECK_BLOCKS_COMPOUND" ) );
+ RadioButton1->setPixmap( image0 );
+
+ myGrp = new MeasureGUI_1Sel1TextView_QTD( this, "myGrp" );
+ myGrp->GroupBox1->setTitle( tr( "GEOM_CHECK_INFOS" ) );
+ myGrp->TextLabel1->setText( tr( "GEOM_OBJECT" ) );
+ myGrp->TextEdit1->setReadOnly( TRUE );
+
+ QFont aFont( TEXTEDIT_FONT_FAMILY, TEXTEDIT_FONT_SIZE );
+ aFont.setStyleHint( QFont::TypeWriter, QFont::PreferAntialias );
+ myGrp->TextEdit1->setFont( aFont );
+ myGrp->PushButton1->setPixmap( image1 );
+ myGrp->LineEdit1->setReadOnly( true );
+
+
+ /***************************************************************/
+ QGridLayout* aGBLayout = new QGridLayout( myGrp->GroupBox1->layout() );
+ aGBLayout->setAlignment( Qt::AlignTop );
+ QGridLayout* Layout2 = new QGridLayout( 0, 1, 1, 0, 6, "Layout2");
+ myErrorsLbl = new QLabel( tr( "GEOM_CHECK_BLOCKS_COMPOUND_ERRORS" ), myGrp, "Errors" );
+ Layout2->addWidget( myErrorsLbl, 0, 0 );
+
+ myErrorsLBox = new QListBox( myGrp, "ListBlockCompoundErrors" );
+ myErrorsLBox->setMinimumSize( 100, 100 );
+ Layout2->addWidget( myErrorsLBox, 1, 0 );
+
+
+ mySubShapesLbl = new QLabel( tr( "GEOM_CHECK_BLOCKS_COMPOUND_SUBSHAPES" ), myGrp, "BlockCompoundSubShapes" );
+ Layout2->addWidget( mySubShapesLbl, 0, 1 );
+
+ mySubShapesLBox = new QListBox( myGrp, "ListSubShapes" );
+ mySubShapesLBox->setMinimumSize( 100, 100 );
+ mySubShapesLBox->setSelectionMode(QListBox::Extended);
+ Layout2->addWidget( mySubShapesLBox, 1, 1 );
+ aGBLayout->addLayout( Layout2, 1, 0 );
+
+ Layout1->addWidget( myGrp, 1, 0 );
+ connect( myErrorsLBox, SIGNAL( selectionChanged() ), SLOT( onErrorsListSelectionChanged() ) );
+ connect( mySubShapesLBox, SIGNAL( selectionChanged() ), SLOT( onSubShapesListSelectionChanged() ) );
+ /* Initialisation */
+ Init( Sel );
+}
+
+
+//=================================================================================
+// function : ~MeasureGUI_CheckCompoundOfBlocksDlg()
+// purpose : Destroys the object and frees any allocated resources
+//=================================================================================
+MeasureGUI_CheckCompoundOfBlocksDlg::~MeasureGUI_CheckCompoundOfBlocksDlg()
+{
+}
+
+
+//=================================================================================
+// function : Init()
+// purpose :
+//=================================================================================
+void MeasureGUI_CheckCompoundOfBlocksDlg::Init( SALOME_Selection* Sel )
+{
+ activateSelection();
+ mySelBtn = myGrp->PushButton1;
+ mySelEdit = myGrp->LineEdit1;
+ MeasureGUI_Skeleton::Init( Sel );
+}
+
+//=================================================================================
+// function : getBCErrors
+// purpose :
+//=================================================================================
+bool MeasureGUI_CheckCompoundOfBlocksDlg::getBCErrors( bool& theIsCompoundOfBlocks,
+ GEOM::GEOM_IBlocksOperations::BCErrors& theErrors)
+{
+ if ( myObj->_is_nil() )
+ return false;
+ else
+ {
+ try
+ {
+ GEOM::GEOM_IBlocksOperations::BCErrors_var aErrs;
+ theIsCompoundOfBlocks =
+ GEOM::GEOM_IBlocksOperations::_narrow( getOperation() )->CheckCompoundOfBlocks( myObj, aErrs );
+ theErrors = aErrs;
+ }
+ catch( const SALOME::SALOME_Exception& e )
+ {
+ QtCatchCorbaException( e );
+ return false;
+ }
+
+ return getOperation()->IsDone();
+ }
+}
+
+//=================================================================================
+// function : processObject
+// purpose :
+//=================================================================================
+void MeasureGUI_CheckCompoundOfBlocksDlg::processObject()
+{
+ QString aMsg ("");
+ bool isCompoundOfBlocks;
+ GEOM::GEOM_IBlocksOperations::BCErrors aErrs;
+ if ( !getBCErrors( isCompoundOfBlocks, aErrs ) )
+ {
+ myGrp->TextEdit1->setText( aMsg );
+ myErrorsLBox->clear();
+ mySubShapesLBox->clear();
+ erasePreview();
+ return;
+ }
+
+ if (isCompoundOfBlocks) {
+ aMsg += tr( "GEOM_CHECK_BLOCKS_COMPOUND_HAS_NO_ERRORS" );
+ } else {
+ aMsg += tr( "GEOM_CHECK_BLOCKS_COMPOUND_HAS_ERRORS" );
+ }
+ myGrp->TextEdit1->setText(aMsg);
+ QStringList aErrList;
+ QString aErrStr( "" );
+ QString aConSfx( " # " );
+ QString aGluedSfx( " # " );
+ int aConNum = 1;
+ int aGluedNum = 1;
+ for ( int i = 0, n = aErrs.length(); i < n; i++ )
+ {
+ aErrStr = "";
+ switch ( aErrs[i].error )
+ {
+ case GEOM::GEOM_IBlocksOperations::NOT_BLOCK :
+ aErrStr = "Not a Block";
+ break;
+ case GEOM::GEOM_IBlocksOperations::EXTRA_EDGE :
+ aErrStr = "Extra Edge";
+ break;
+ case GEOM::GEOM_IBlocksOperations::INVALID_CONNECTION :
+ aErrStr = "Invalid Connection";
+ aErrStr += aConSfx;
+ aErrStr += QString::number(aConNum);
+ aConNum++;
+ break;
+ case GEOM::GEOM_IBlocksOperations::NOT_CONNECTED :
+ aErrStr = "Not Connected";
+ break;
+ case GEOM::GEOM_IBlocksOperations::NOT_GLUED :
+ aErrStr = "Not Glued";
+ aErrStr += aGluedSfx;
+ aErrStr += QString::number(aGluedNum);
+ aGluedNum++;
+ break;
+ default :
+ aErrStr = "";
+ break;
+ }
+ if ( !aErrStr.isEmpty() )
+ aErrList.append(aErrStr);
+ }
+ myErrorsLBox->clear();
+ mySubShapesLBox->clear();
+ myErrorsLBox->insertStringList(aErrList);
+ return;
+}
+
+//=================================================================================
+// function : createOperation
+// purpose :
+//=================================================================================
+GEOM::GEOM_IOperations_ptr MeasureGUI_CheckCompoundOfBlocksDlg::createOperation()
+{
+ return getGeomEngine()->GetIBlocksOperations(getStudyId());
+}
+
+//=================================================================================
+// function : onErrorsListSelectionChanged
+// purpose :
+//=================================================================================
+void MeasureGUI_CheckCompoundOfBlocksDlg::onErrorsListSelectionChanged()
+{
+ erasePreview();
+ int aCurItem = myErrorsLBox->currentItem();
+ if ( aCurItem < 0 )
+ return;
+ bool isCompoundOfBlocks;
+ GEOM::GEOM_IBlocksOperations::BCErrors aErrs;
+ if ( !getBCErrors( isCompoundOfBlocks, aErrs ) )
+ {
+ myGrp->TextEdit1->setText( "" );
+ myErrorsLBox->clear();
+ mySubShapesLBox->clear();
+ return;
+ }
+
+ GEOM::GEOM_IBlocksOperations::BCError aErr = aErrs[aCurItem];
+ GEOM::ListOfLong aObjLst = aErr.incriminated;
+ TopoDS_Shape aSelShape;
+ TopoDS_Shape aSubShape;
+ TopTools_IndexedMapOfShape anIndices;
+ QStringList aSubShapeList;
+ QString aSubShapeName("");
+ Standard_CString aTypeString;
+ if ( !myObj->_is_nil() && GEOMBase::GetShape( myObj, aSelShape ) )
+ {
+ TopExp::MapShapes( aSelShape, anIndices);
+ for ( int i = 0, n = aObjLst.length(); i < n; i++ )
+ {
+ aSubShapeName = "";
+ aSubShape = anIndices.FindKey(aObjLst[i]);
+ if ( GEOMBase::GetShapeTypeString( aSubShape, aTypeString ) )
+ aSubShapeName = QString(aTypeString) + QString("_") + QString::number(aObjLst[i]);
+ if ( !aSubShapeName.isEmpty() )
+ aSubShapeList.append(aSubShapeName);
+ }
+ }
+ mySubShapesLBox->clear();
+ mySubShapesLBox->insertStringList(aSubShapeList);
+ return;
+}
+
+//=================================================================================
+// function : onSubShapesListSelectionChanged
+// purpose :
+//=================================================================================
+void MeasureGUI_CheckCompoundOfBlocksDlg::onSubShapesListSelectionChanged()
+{
+ erasePreview();
+ int aErrCurItem = myErrorsLBox->currentItem();
+ if ( aErrCurItem < 0 )
+ return;
+ QValueList<int> aIds;
+ for ( int i = 0, n = mySubShapesLBox->count(); i < n; i++ )
+ {
+ if ( mySubShapesLBox->isSelected( i ) )
+ aIds.append( i );
+ }
+ if ( aIds.count() < 1 )
+ return;
+ bool isCompoundOfBlocks;
+ GEOM::GEOM_IBlocksOperations::BCErrors aErrs;
+ if ( !getBCErrors( isCompoundOfBlocks, aErrs ) )
+ {
+ myGrp->TextEdit1->setText( "" );
+ myErrorsLBox->clear();
+ mySubShapesLBox->clear();
+ return;
+ }
+
+ GEOM::GEOM_IBlocksOperations::BCError aErr = aErrs[aErrCurItem];
+ GEOM::ListOfLong aObjLst = aErr.incriminated;
+ TopoDS_Shape aSelShape;
+ TopoDS_Shape aSubShape;
+ TopTools_IndexedMapOfShape anIndices;
+ if ( !myObj->_is_nil() && GEOMBase::GetShape( myObj, aSelShape ) )
+ {
+ QString aMess;
+ if ( !isValid( aMess ) )
+ {
+ return;
+ }
+ SALOME_Prs* aPrs = 0;
+ TopExp::MapShapes( aSelShape, anIndices);
+ QValueList<int>::iterator it;
+ for ( it = aIds.begin(); it != aIds.end(); ++it )
+ {
+ aSubShape = anIndices.FindKey(aObjLst[(*it)]);
+ try
+ {
+ getDisplayer()->SetColor( Quantity_NOC_RED );
+ getDisplayer()->SetToActivate( false );
+ aPrs = !aSubShape.IsNull() ? getDisplayer()->BuildPrs( aSubShape ) : 0;
+ if ( aPrs )
+ displayPreview( aPrs, true );
+ }
+ catch( const SALOME::SALOME_Exception& e )
+ {
+ QtCatchCorbaException( e );
+ }
+ }
+ }
+ return;
+}
+
+//=================================================================================
+// function : activateSelection
+// purpose : activate selection of faces, shells, and solids
+//=================================================================================
+void MeasureGUI_CheckCompoundOfBlocksDlg::activateSelection()
+{
+ TColStd_MapOfInteger aMap;
+ aMap.Add( GEOM_SOLID );
+ aMap.Add( GEOM_COMPOUND );
+ globalSelection( aMap );
+}
--- /dev/null
+// GEOM GEOMGUI : GUI for Geometry component
+//
+// Copyright (C) 2003 OPEN CASCADE, EADS/CCR, LIP6, CEA/DEN,
+// CEDRAT, EDF R&D, LEG, PRINCIPIA R&D, BUREAU VERITAS
+//
+// This library is free software; you can redistribute it and/or
+// modify it under the terms of the GNU Lesser General Public
+// License as published by the Free Software Foundation; either
+// version 2.1 of the License.
+//
+// This library is distributed in the hope that it will be useful,
+// but WITHOUT ANY WARRANTY; without even the implied warranty of
+// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU
+// Lesser General Public License for more details.
+//
+// You should have received a copy of the GNU Lesser General Public
+// License along with this library; if not, write to the Free Software
+// Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307 USA
+//
+// See http://www.opencascade.org/SALOME/ or email : webmaster.salome@opencascade.org
+//
+//
+//
+// File : MeasureGUI_CheckCompoundOfBlocksDlg.h
+// Author : VKN
+// Module : GEOM
+// $Header$
+
+#ifndef DIALOGBOX_CHECKCOMPOUNDOFBLOCKSDLG_H
+#define DIALOGBOX_CHECKCOMPOUNDOFBLOCKSDLG_H
+
+#include "MeasureGUI_Skeleton.h"
+
+class MeasureGUI_1Sel1TextView_QTD;
+class QListBox;
+class QLabel;
+
+//=================================================================================
+// class : MeasureGUI_CheckCompoundOfBlocksDlg
+// purpose :
+//=================================================================================
+class MeasureGUI_CheckCompoundOfBlocksDlg : public MeasureGUI_Skeleton
+{
+ Q_OBJECT
+
+public:
+ MeasureGUI_CheckCompoundOfBlocksDlg( QWidget* theParent,
+ SALOME_Selection* theSel );
+ ~MeasureGUI_CheckCompoundOfBlocksDlg();
+protected:
+
+ // redefined from GEOMBase_Helper and MeasureGUI_Skeleton
+ virtual GEOM::GEOM_IOperations_ptr createOperation();
+ virtual void processObject();
+
+private slots:
+
+ void onErrorsListSelectionChanged();
+ void onSubShapesListSelectionChanged();
+
+private:
+
+ void Init( SALOME_Selection* theSel );
+ bool getBCErrors( bool& theIsCompoundOfBlocks,
+ GEOM::GEOM_IBlocksOperations::BCErrors& theErrors);
+ void activateSelection();
+
+private:
+
+ MeasureGUI_1Sel1TextView_QTD* myGrp;
+ QLabel* myErrorsLbl;
+ QListBox* myErrorsLBox;
+ QLabel* mySubShapesLbl;
+ QListBox* mySubShapesLBox;
+
+};
+
+#endif // DIALOGBOX_CHECKCOMPOUNDOFBLOCKSDLG_H
//
aNbSd=aMSd.Extent();
if (!aNbSd) {
+ //modified by NIZNHY-PKV Thu Dec 23 15:07:46 2004 f
+ Standard_Boolean bFound;
+ //modified by NIZNHY-PKV Thu Dec 23 15:07:49 2004 t
TopoDS_Shape aSd;
//
const TopoDS_Shape& aFC=myImageShape.Image(aS).First();
- NMTAlgo_Tools::FindImageSolid(aFC, aMSo, aSd);
- //
- aMSd.Add(aSd);
+ //modified by NIZNHY-PKV Thu Dec 23 15:08:17 2004 f
+ //NMTAlgo_Tools::FindImageSolid(aFC, aMSo, aSd);
+ //aMSd.Add(aSd);
+ bFound=NMTAlgo_Tools::FindImageSolid(aFC, aMSo, aSd);
+ if (!aSd.IsNull()) {
+ aMSd.Add(aSd);
+ }
+ //modified by NIZNHY-PKV Thu Dec 23 15:09:02 2004 t
}
aMCS.Add(aS, aMSd);
} //for ( ;aItS.More(); aItS.Next())
if (myClosedShapes.Contains(aS)) {
//
// internal faces compound
+ //modified by NIZNHY-PKV Thu Dec 23 16:34:05 2004 f
+ Standard_Integer aNbIF;
+ //
+ aNbIF=myInternalFaces.Extent();
+ //modified by NIZNHY-PKV Thu Dec 23 16:34:07 2004 t
TopoDS_Shape aIFC=FindFacesInside(aS, Standard_True);
+ aNbIF=myInternalFaces.Extent();
aShellMaker.AddSectionFaces(aIFC);
}
//
// get data for internal faces search
// ===================================
//
- // compound of split faces of theShape
- const TopoDS_Shape& CSF = myImageShape.Image(theShape).First();
- //
TopTools_MapOfShape MSE, MFP;
TopTools_DataMapOfShapeListOfShape DMSEFP;
+ TopTools_IndexedDataMapOfShapeListOfShape DMEF;
TopTools_MapIteratorOfMapOfShape itm;
TopTools_ListOfShape EmptyL;
TopTools_ListIteratorOfListOfShape itl;
-
+ //
+ // compound of split faces of theShape
+ const TopoDS_Shape& CSF=myImageShape.Image(theShape).First();
// MSE filling: map of new section edges of CSF
expl.Init(CSF, TopAbs_EDGE);
for (; expl.More(); expl.Next()) {
}
//
// DMEF: map edge of CSF - faces of CSF
- TopTools_IndexedDataMapOfShapeListOfShape DMEF;
TopExp::MapShapesAndAncestors(CSF, TopAbs_EDGE, TopAbs_FACE, DMEF);
//
// Fill
}
}//for (;itl.More(); itl.Next())
//
- // add tool faces... (is absent)
- //
// ===========================
// find faces inside theShape
// ===========================
Standard_Boolean skipAlreadyAdded = Standard_False;
- Standard_Boolean GoodOri, inside;
+ Standard_Boolean GoodOri, inside, sameDom1, sameDom2, isSectionE;
Standard_Real dot;
+ TopoDS_Face aFace1, anOrigFace, origF1, origF2; //, anOrigFace2;
TopTools_ListOfShape KeepFaces;
TopTools_DataMapIteratorOfDataMapOfShapeListOfShape Mapit;
-
+ //
// iterate on section edges, check faces of other shapes
// sharing section edges and put internal faces to KeepFaces
Mapit.Initialize(DMSEFP);
for (; Mapit.More() ; Mapit.Next() ) {
// a new edge of theShape
const TopoDS_Edge& E = TopoDS::Edge (Mapit.Key());
- // an original edge of which E is a split
- //const TopoDS_Edge& OrigE = TopoDS::Edge (myImagesEdges.Root(E));
- // does OrigE itself splits a face
- Standard_Boolean isSectionE=IsSectionEdge(E);//(OrigE);
-
+ //
+ isSectionE=IsSectionEdge(E);
+ //
// split faces of other shapes sharing E
TopTools_ListOfShape& LSF = DMSEFP.ChangeFind(E);
+ //
itl.Initialize( LSF );
while (itl.More()) {
// a split faces of other shape
- TopoDS_Face aFace1 = TopoDS::Face(itl.Value());
+ aFace1 = TopoDS::Face(itl.Value());
// remove aFace1 form DMSEFP and MFP
LSF.Remove( itl ); // == itl.Next();
if (!MFP.Remove( aFace1 ))
continue; // was not is MFP ( i.e already checked)
+ //
// check if aFace1 was already added to 2 shells
if (!All &&
myAddedFacesMap.Contains(aFace1) &&
myAddedFacesMap.Contains(aFace1.Reversed())) {
skipAlreadyAdded = Standard_True;
- //modified by NIZNHY-PKV Wed Feb 11 16:11:53 2004 f
- //continue;
- //modified by NIZNHY-PKV Wed Feb 11 16:35:48 2004 t
}
//
// find another face which originates from the same face as aFace1:
// usually aFace2 is internal if aFace1 is not and vice versa
- TopoDS_Shape anOrigFace = aFace1;
+ anOrigFace = aFace1;
if (myImagesFaces.IsImage(aFace1)){
- anOrigFace = myImagesFaces.Root(aFace1);
+ anOrigFace = TopoDS::Face(myImagesFaces.Root(aFace1));
}
//
- TopoDS_Shape aFace2;
- if ( !isSectionE ) {
- while (itl.More()) {
- aFace2 = itl.Value();
+ //modified by NIZNHY-PKV Fri Dec 24 10:59:45 2004 f
+ /*
+ TopoDS_Face aFace2;
+ //
+ if (!isSectionE) {
+ while (itl.More()) { //#2
+ aFace2 = TopoDS::Face(itl.Value());
//
- TopoDS_Shape anOrigFace2 = aFace2;
+ anOrigFace2 = aFace2;
if (myImagesFaces.IsImage(aFace2)) {
- anOrigFace2 = myImagesFaces.Root(aFace2);
+ anOrigFace2 = TopoDS::Face(myImagesFaces.Root(aFace2));
}
//
if (!MFP.Contains( aFace2 )) {
LSF.Remove( itl );
continue;
}
- //if (anOrigFace.IsSame( myImagesFaces.Root( aFace2 )))
+ //
if (anOrigFace.IsSame(anOrigFace2)) {
break;
}
itl.Next();
- }
+ }// while (itl.More()) { #2
+ //
if (itl.More()) { // aFace2 found, remove it from maps
LSF.Remove( itl );
MFP.Remove(aFace2);
aFace2.Nullify();
}
itl.Initialize( LSF );
- }
-
+ } // if (!isSectionE) {
+ */
+ //modified by NIZNHY-PKV Fri Dec 24 10:59:52 2004 t
+ //
// check that anOrigFace is not same domain with CSF faces it intersects
-
- const TopTools_ListOfShape& FL = DMEF.FindFromKey(E); //faces of CSF sharing E
-
- const TopoDS_Shape& origF1 = myImagesFaces.IsImage(FL.First()) ?
- myImagesFaces.Root(FL.First()) : FL.First();
- const TopoDS_Shape& origF2 = myImagesFaces.IsImage(FL.Last()) ?
- myImagesFaces.Root(FL.Last()) : FL.Last();
//
- Standard_Boolean sameDom1 = anOrigFace.IsSame( origF1 );
- Standard_Boolean sameDom2 = anOrigFace.IsSame( origF2 );
-
- if (!(sameDom1 || sameDom2) && HasSameDomainF( TopoDS::Face(anOrigFace) )) {
- sameDom1 = IsSameDomainF( TopoDS::Face(anOrigFace), TopoDS::Face(origF1));
+ //faces of CSF sharing E
+ //
+ const TopTools_ListOfShape& FL = DMEF.FindFromKey(E);
+ const TopoDS_Face& aFE1=TopoDS::Face(FL.First());
+ const TopoDS_Face& aFE2=TopoDS::Face(FL.Last());
+ //
+ origF1=aFE1;
+ if (myImagesFaces.IsImage(aFE1)) {
+ origF1=TopoDS::Face(myImagesFaces.Root(aFE1));
+ }
+ origF2=aFE2;
+ if (myImagesFaces.IsImage(aFE2)) {
+ origF2=TopoDS::Face(myImagesFaces.Root(aFE2));
+ }
+ //
+ sameDom1 = anOrigFace.IsSame( origF1 );
+ sameDom2 = anOrigFace.IsSame( origF2 );
+ //
+ if (!(sameDom1 || sameDom2) && HasSameDomainF(anOrigFace)) {
+ sameDom1 = IsSameDomainF(anOrigFace, origF1);
if (origF1 == origF2) {
sameDom2 = sameDom1;
}
- else{
- IsSameDomainF( TopoDS::Face(anOrigFace), TopoDS::Face(origF2));
- }
}
+ //
if (sameDom1 && sameDom2){
continue;
}
+ //
if (sameDom1 || sameDom2) {
- inside = NMTAlgo_Loop3d::IsInside (E,
- TopoDS::Face(FL.First()),
- TopoDS::Face(FL.Last()),
- 1, dot, GoodOri);
- if (inside || (dot + Precision::Angular() >= 1.0))
+ inside = NMTAlgo_Loop3d::IsInside (E, aFE1, aFE2, 1, dot, GoodOri);
+ if (inside || (dot + Precision::Angular() >= 1.0)) {
continue; // E is convex between origF1 and origF2 or they are tangent
+ }
}
//
- // keep one of found faces
-
+ // Keep one of found faces
+ //
//face of CSF sharing E
- const TopoDS_Shape& aShapeFace = sameDom1 ? FL.Last() : FL.First();
+ const TopoDS_Face& aShapeFace = sameDom1 ? aFE2 : aFE1;
// analyse aFace1 state
- inside = NMTAlgo_Loop3d::IsInside (E, TopoDS::Face(aShapeFace), aFace1,
- 1, dot, GoodOri);
-// if (inside && isSectionE) {
+ inside = NMTAlgo_Loop3d::IsInside (E, aShapeFace, aFace1, 1, dot, GoodOri);
if (inside) { //IFV 27.08.04
// aFace1 must be tested with both adjacent faces of CSF
- const TopoDS_Shape& aShapeFace2 = sameDom1 ? FL.First() : FL.Last();
+ const TopoDS_Face& aShapeFace2 = sameDom1 ? aFE1 : aFE2;
if (aShapeFace2 != aShapeFace){
- inside = NMTAlgo_Loop3d::IsInside (E, TopoDS::Face(aShapeFace2), aFace1,
- 1, dot, GoodOri);
+ inside =
+ NMTAlgo_Loop3d::IsInside(E, aShapeFace2, aFace1, 1, dot, GoodOri);
}
}
//
// store internal face
- if (inside)
- KeepFaces.Append(aFace1);
-
+ if (inside) {
+ KeepFaces.Append(aFace1);
+ }
+ //
+ //modified by NIZNHY-PKV Fri Dec 24 11:02:55 2004 f
+ /*
else if (!aFace2.IsNull()) {
if (dot + Precision::Angular() >= 1.0) {
- // aFace2 state is not clear, it will be analysed alone,
- // put it back to the maps
- MFP.Add( aFace2 );
- LSF.Append( aFace2 );
+ // aFace2 state is not clear, it will be analysed alone, put it back to the maps
+ MFP.Add(aFace2);
+ LSF.Append(aFace2);
}
- else
- KeepFaces.Append(aFace2);
+ else {
+ KeepFaces.Append(aFace2);
+ }
}
- }
- }
-
+ */
+ //modified by NIZNHY-PKV Fri Dec 24 11:03:03 2004 t
+ }// while (itl.More()) {
+ }// for (; Mapit.More() ; Mapit.Next() ) {
+ //
// ===================================================
// add not distributed faces connected with KeepFaces
// ===================================================
-
// ultimate list of internal faces
TopTools_ListOfShape KeptFaces;
//
- // add to MFP not split tool faces as well, they may be connected with
- // tool faces interfering with theShape
- /*
- itm.Initialize(myMapTools);
- for (; itm.More(); itm.Next() ) {
- const TopoDS_Shape& aToolFace = itm.Key();
- if (!myImageShape.HasImage(aToolFace)){
- MFP.Add (aToolFace);
- }
- }
- */
- //
if (MFP.IsEmpty())
KeptFaces.Append (KeepFaces);
//
//=======================================================================
//function : KeepShapesInside
-//purpose : remove shapes that are outside of S from resul
+//purpose : remove shapes that are outside of S from result
//=======================================================================
void NMTAlgo_Splitter::KeepShapesInside (const TopoDS_Shape& S)
{
//=======================================================================
//function : RemoveShapesInside
-//purpose : remove shapes that are inside S from resul
+//purpose : remove shapes that are inside S from result
//=======================================================================
- void NMTAlgo_Splitter::RemoveShapesInside (const TopoDS_Shape& S)
+ void NMTAlgo_Splitter::RemoveShapesInside (const TopoDS_Shape& aS)
{
TopoDS_Iterator it;
- if (S.ShapeType() < TopAbs_SOLID) { // compound or compsolid
- for (it.Initialize( S ); it.More(); it.Next())
- RemoveShapesInside( it.Value());
+ TopAbs_ShapeEnum aTypeS;
+ //
+ aTypeS=aS.ShapeType();
+ if (aTypeS < TopAbs_SOLID) { // compound or compsolid
+ it.Initialize(aS);
+ for (; it.More(); it.Next()) {
+ const TopoDS_Shape& aSx=it.Value();
+ RemoveShapesInside(aSx);
+ }
return;
}
- Standard_Boolean isTool = Standard_False;
- if (!myImageShape.HasImage( S )) {
- //isTool = CheckTool( S );
- //if (!isTool) return;
+ //
+ Standard_Boolean bFromTool, bIsClosed;
+ Standard_Integer i, aNbE;
+ TopoDS_Shape aIntFacesComp;
+ TopoDS_Compound aC;
+ TopTools_IndexedMapOfShape MIF; // map of internal faces
+ TopTools_MapOfShape RFM;
+ TopTools_MapIteratorOfMapOfShape itF;
+ TopTools_IndexedDataMapOfShapeListOfShape aMEF;
+ //
+ bFromTool=myToolShapes.Contains(aS);
+ //
+ if (!myImageShape.HasImage(aS)) {
+ return;
+ }
+ //
+ aIntFacesComp = FindFacesInside(aS, Standard_False, Standard_True);
+ //
+ TopExp::MapShapes(aIntFacesComp, TopAbs_FACE, MIF);
+ if (MIF.IsEmpty()) {
return;
}
-
- TopoDS_Shape IntFacesComp = FindFacesInside( S, Standard_False, Standard_True);
- TopTools_IndexedMapOfShape MIF; // map of internal faces
- TopExp::MapShapes( IntFacesComp, TopAbs_FACE, MIF);
-
- if (MIF.IsEmpty()) return;
-
// add to MIF split faces of S
- if (myImageShape.HasImage(S))
- TopExp::MapShapes( myImageShape.Image(S).First(), TopAbs_FACE, MIF);
-
+ const TopoDS_Shape& aSIm=myImageShape.Image(aS).First();
+ TopExp::MapShapes(aSIm, TopAbs_FACE, MIF);
+ //
// leave in the result only those shapes not having all face in MIF
-
- TopoDS_Compound C;
- myBuilder.MakeCompound(C);
-
- // RMF : faces of removed shapes that encounter once
- TopTools_MapOfShape RFM;
-
- for (it.Initialize( myShape ); it.More(); it.Next()) {
-
- TopExp_Explorer expResF( it.Value(), TopAbs_FACE );
- for (; expResF.More(); expResF.Next())
- if (!MIF.Contains( expResF.Current()))
+ myBuilder.MakeCompound(aC);
+ //
+ // RFM : faces of removed shapes that encounter once
+ it.Initialize(myShape);
+ for (; it.More(); it.Next()) {
+ TopExp_Explorer expResF;
+ //
+ const TopoDS_Shape& aSR=it.Value();
+ //
+ expResF.Init(aSR, TopAbs_FACE);
+ for (; expResF.More(); expResF.Next()) {
+ const TopoDS_Shape& aFR=expResF.Current();
+ if (!MIF.Contains(aFR)) {
break;
-
- if (expResF.More())
+ }
+ }
+ //
+ if (expResF.More()) {
// add shape to result
- myBuilder.Add( C, it.Value() );
- else
+ myBuilder.Add(aC, aSR);
+ }
+ else {
// add faces of a removed shape to RFM
- for (expResF.ReInit(); expResF.More(); expResF.Next()) {
- const TopoDS_Shape& F = expResF.Current();
- if ( ! RFM.Remove ( F ))
- RFM.Add( F );
- }
+ if (!bFromTool) { //modified by NIZNHY-PKV Thu Dec 23 09:55:39 2004 ft
+ for (expResF.ReInit(); expResF.More(); expResF.Next()) {
+ const TopoDS_Shape& aF = expResF.Current();
+ if (!RFM.Remove(aF)) {
+ RFM.Add(aF);
+ }
+ }
+ }//modified by NIZNHY-PKV Thu Dec 23 09:55:29 2004 ft
+ }
+ }// for (; it.More(); it.Next())
+ //
+ if (bFromTool) {
+ myShape=aC;
+ return;
}
-
- if (!isTool) {
-
- // rebuild S, it must remain in the result
-
- Standard_Boolean isClosed = Standard_False;
- switch (S.ShapeType()) {
- case TopAbs_SOLID :
- isClosed = Standard_True; break;
- case TopAbs_SHELL: {
- TopTools_IndexedDataMapOfShapeListOfShape MEF;
- TopExp::MapShapesAndAncestors(S, TopAbs_EDGE, TopAbs_FACE, MEF);
- Standard_Integer i;
- for (i=1; isClosed && i<=MEF.Extent(); ++i)
- isClosed = ( MEF(i).Extent() != 1 );
- break;
+ //
+ // bIsClosed
+ bIsClosed = Standard_False;
+ if (aTypeS==TopAbs_SOLID) {
+ bIsClosed = Standard_True;
+ }
+ else if (aTypeS==TopAbs_SHELL) {
+ aMEF.Clear();
+ TopExp::MapShapesAndAncestors(aS, TopAbs_EDGE, TopAbs_FACE, aMEF);
+ aNbE=aMEF.Extent();
+ for (i=1; bIsClosed && i<=aNbE; ++i) {
+ bIsClosed=(aMEF(i).Extent()!=1);
}
- default:
- isClosed = Standard_False;
+ }
+ //
+ // rebuild S, it must remain in the result
+ if (bIsClosed) {
+ // add to a new shape external faces of removed shapes, ie those in RFM
+ TopoDS_Shell aShell;
+ //
+ myBuilder.MakeShell(aShell);
+ // exclude redundant internal face with edges encounterd only once
+ aMEF.Clear();
+ itF.Initialize (RFM);
+ for (; itF.More(); itF.Next()) {
+ const TopoDS_Shape& aF=itF.Key();
+ TopExp::MapShapesAndAncestors(aF, TopAbs_EDGE, TopAbs_FACE, aMEF);
}
- if (isClosed) {
-
- // add to a new shape external faces of removed shapes, ie those in RFM
-
- TopoDS_Shell Shell;
- myBuilder.MakeShell( Shell );
-
- // exclude redundant internal face with edges encounterd only once
- TopTools_IndexedDataMapOfShapeListOfShape MEF;
- TopTools_MapIteratorOfMapOfShape itF (RFM);
- for ( ; itF.More(); itF.Next())
- TopExp::MapShapesAndAncestors(itF.Key(), TopAbs_EDGE, TopAbs_FACE, MEF);
-
- // add only faces forming a closed shell
- for (itF.Reset() ; itF.More(); itF.Next())
- {
- TopExp_Explorer expE (itF.Key(), TopAbs_EDGE);
- for (; expE.More(); expE.Next())
- if (MEF.FindFromKey(expE.Current()).Extent() == 1)
- break;
- if (!expE.More())
- myBuilder.Add( Shell, itF.Key());
+ // add only faces forming a closed shell
+ for (itF.Reset() ; itF.More(); itF.Next()) {
+ const TopoDS_Shape& aF=itF.Key();
+ TopExp_Explorer expE (aF, TopAbs_EDGE);
+ for (; expE.More(); expE.Next()) {
+ if (aMEF.FindFromKey(expE.Current()).Extent()==1) {
+ break;
+ }
}
-
- if (S.ShapeType() == TopAbs_SOLID) {
- TopoDS_Solid Solid;
- myBuilder.MakeSolid( Solid );
- myBuilder.Add (Solid, Shell);
- myBuilder.Add (C, Solid);
+ if (!expE.More()) {
+ myBuilder.Add(aShell, aF);
}
- else
- myBuilder.Add (C, Shell);
+ }
+ //
+ if (aTypeS==TopAbs_SOLID) {
+ TopoDS_Solid aSolid;
+ //
+ myBuilder.MakeSolid(aSolid);
+ myBuilder.Add (aSolid, aShell);
+ myBuilder.Add (aC, aSolid);
}
else {
- if (myImageShape.HasImage( S )) {
- for (it.Initialize( myImageShape.Image(S).First()); it.More(); it.Next())
- myBuilder.Add (C, it.Value());
- }
+ myBuilder.Add (aC, aShell);
+ }
+ } // if (bIsClosed) {
+ //
+ else {
+ it.Initialize(aSIm);
+ for (; it.More(); it.Next()) {
+ const TopoDS_Shape& aSx=it.Value();
+ myBuilder.Add (aC, aSx);
}
}
-
- myShape = C;
+ //
+ myShape=aC;
}
//=======================================================================
GEOM_InteractiveObject.cxx \
GEOM_AISTrihedron.cxx \
GEOM_VTKTrihedron.cxx
-
+
LIB_CLIENT_IDL =
# Executables targets
CPPFLAGS+=$(QT_INCLUDES) $(PYTHON_INCLUDES) $(OCC_INCLUDES) $(VTK_INCLUDES) $(OGL_INCLUDES) -I${KERNEL_ROOT_DIR}/include/salome
CXXFLAGS += -I${KERNEL_ROOT_DIR}/include/salome
-LDFLAGS+=$(QT_MT_LIBS) $(VTK_LIBS) $(OGL_LIBS) $(PYTHON_LIBS) -lSalomeObject -L${KERNEL_ROOT_DIR}/lib/salome
+LDFLAGS+=$(PYTHON_LIBS) $(QT_MT_LIBS) $(VTK_LIBS) $(OGL_LIBS) -lSalomeObject -L${KERNEL_ROOT_DIR}/lib/salome
%_moc.cxx: %.h
$(MOC) $< -o $@
RepairGUI_RemoveHolesDlg.cxx \
RepairGUI_DivideEdgeDlg.cxx \
RepairGUI_FreeBoundDlg.cxx \
+ RepairGUI_FreeFacesDlg.cxx \
RepairGUI_GlueDlg.cxx
LIB_MOC = \
RepairGUI_RemoveHolesDlg.h \
RepairGUI_DivideEdgeDlg.h \
RepairGUI_FreeBoundDlg.h \
+ RepairGUI_FreeFacesDlg.h \
RepairGUI_GlueDlg.h
LIB_CLIENT_IDL = SALOME_GenericObj.idl SALOME_Component.idl
#include "RepairGUI_RemoveIntWiresDlg.h"// Method REMOVE INTERNAL WIRES
#include "RepairGUI_DivideEdgeDlg.h" // Method DEVIDE EDGE
#include "RepairGUI_FreeBoundDlg.h" // Method FREE BOUNDARIES
+#include "RepairGUI_FreeFacesDlg.h" // Method FREE FACES
#include "RepairGUI_GlueDlg.h" // Method GLUE FACES
#include "utilities.h"
case 609: // FREE BOUNDARIES
aDlg = new RepairGUI_FreeBoundDlg( parent, Sel );
break;
+ case 610: // FREE FACES
+ aDlg = new RepairGUI_FreeFacesDlg( parent, "", Sel );
+ break;
default:
parent->putInfo(tr("GEOM_PRP_COMMAND").arg(theCommandID));
break;
--- /dev/null
+// GEOM GEOMGUI : GUI for Geometry component
+//
+// Copyright (C) 2003 OPEN CASCADE, EADS/CCR, LIP6, CEA/DEN,
+// CEDRAT, EDF R&D, LEG, PRINCIPIA R&D, BUREAU VERITAS
+//
+// This library is free software; you can redistribute it and/or
+// modify it under the terms of the GNU Lesser General Public
+// License as published by the Free Software Foundation; either
+// version 2.1 of the License.
+//
+// This library is distributed in the hope that it will be useful,
+// but WITHOUT ANY WARRANTY; without even the implied warranty of
+// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU
+// Lesser General Public License for more details.
+//
+// You should have received a copy of the GNU Lesser General Public
+// License along with this library; if not, write to the Free Software
+// Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307 USA
+//
+// See http://www.opencascade.org/SALOME/ or email : webmaster.salome@opencascade.org
+//
+//
+//
+// File : RepairGUI_FreeFacesDlg.cxx
+// Author : VKN
+// Module : GEOM
+// $Header$
+
+using namespace std;
+#include "RepairGUI_FreeFacesDlg.h"
+
+#include "QAD_Desktop.h"
+#include "QAD_WaitCursor.h"
+
+#include "SALOME_ListIteratorOfListIO.hxx"
+
+#include "GEOMImpl_Types.hxx"
+#include <TopTools_IndexedMapOfShape.hxx>
+#include <TopExp.hxx>
+#include "GEOMBase.h"
+#include "GeometryGUI.h"
+#include "GEOM_Displayer.h"
+#include "SALOMEGUI_QtCatchCorbaException.hxx"
+#include "SALOME_Selection.h"
+#include "SALOME_Prs.h"
+
+
+#include <qlineedit.h>
+#include <qlabel.h>
+#include <qlayout.h>
+#include <qgroupbox.h>
+#include <qpushbutton.h>
+#define SPACING 5
+#define MARGIN 10
+#define MIN_WIDTH 200
+
+
+//=================================================================================
+// class : RepairGUI_FreeFacesDlg()
+// purpose : Constructs a RepairGUI_FreeFacesDlg which is a child of 'parent', with the
+// name 'name' and widget flags set to 'f'.
+// The dialog will by default be modeless, unless you set 'modal' to
+// TRUE to construct a modal dialog.
+//=================================================================================
+RepairGUI_FreeFacesDlg::RepairGUI_FreeFacesDlg(QWidget* parent, const char* name, SALOME_Selection* theSelection, bool modal, WFlags fl)
+:QDialog( parent, "RepairGUI_FreeBoundDlg", false,
+ WStyle_Customize | WStyle_NormalBorder | WStyle_Title | WStyle_SysMenu | WDestructiveClose )
+{
+ myDisplayer = 0;
+
+ setSizeGripEnabled( TRUE );
+ QPixmap image1(QAD_Desktop::getResourceManager()->loadPixmap("GEOM",tr("ICON_SELECT")));
+
+ setCaption(tr("GEOM_FREE_FACES_TITLE"));
+
+ /***************************************************************/
+
+ QGroupBox* aMainGrp = new QGroupBox( 1, Qt::Horizontal, tr( "GEOM_SELECTED_SHAPE" ), this );
+
+
+ QGroupBox* aSelGrp = new QGroupBox( 1, Qt::Vertical, aMainGrp );
+
+ aSelGrp->setInsideMargin( 0 );
+ aSelGrp->setFrameStyle( QFrame::NoFrame );
+ new QLabel( tr( "GEOM_OBJECT" ), aSelGrp );
+ mySelBtn = new QPushButton( aSelGrp );
+ mySelBtn->setPixmap( image1 );
+ myEdit = new QLineEdit( aSelGrp );
+ myEdit->setReadOnly( true );
+ myEdit->setSizePolicy( QSizePolicy( QSizePolicy::Expanding, QSizePolicy::Fixed ) );
+ myEdit->setMinimumWidth( MIN_WIDTH );
+
+ QFrame* aFrame = new QFrame( this );
+ aFrame->setFrameStyle( QFrame::Box | QFrame::Sunken );
+ QPushButton* aCloseBtn = new QPushButton( tr( "GEOM_BUT_CLOSE" ), aFrame );
+ QHBoxLayout* aBtnLay = new QHBoxLayout( aFrame, MARGIN, SPACING );
+ aBtnLay->addItem( new QSpacerItem( 0, 0, QSizePolicy::Expanding, QSizePolicy::Minimum ) );
+ aBtnLay->addWidget( aCloseBtn );
+ aBtnLay->addItem( new QSpacerItem( 0, 0, QSizePolicy::Expanding, QSizePolicy::Minimum ) );
+
+ QVBoxLayout* aLay = new QVBoxLayout( this );
+ aLay->setSpacing( SPACING );
+ aLay->setMargin( MARGIN );
+ aLay->addWidget( aMainGrp );
+ aLay->addItem( new QSpacerItem( 0, 0, QSizePolicy::Expanding, QSizePolicy::Minimum ) );
+ aLay->addWidget( aFrame );
+
+ connect( aCloseBtn, SIGNAL( clicked() ), SLOT( onClose() ) );
+ connect( mySelBtn, SIGNAL( clicked() ),
+ this, SLOT ( onSetEditCurrentArgument() ) );
+ /***************************************************************/
+
+ Init( theSelection );
+}
+
+
+//=================================================================================
+// function : ~RepairGUI_FreeFacesDlg()
+// purpose : Destroys the object and frees any allocated resources
+//=================================================================================
+RepairGUI_FreeFacesDlg::~RepairGUI_FreeFacesDlg()
+{
+}
+
+
+//=================================================================================
+// function : onClose
+// purpose : SLOT. Called when "close" button pressed. Close dialog
+//=================================================================================
+void RepairGUI_FreeFacesDlg::onClose()
+{
+ globalSelection();
+ disconnect( mySelection, 0, this, 0 );
+ GeometryGUI::GetGeomGUI()->SetActiveDialogBox( 0 );
+ reject();
+ erasePreview();
+}
+
+//=================================================================================
+// function : onDeactivate
+// purpose : Deactivate this dialog
+//=================================================================================
+void RepairGUI_FreeFacesDlg::onDeactivate()
+{
+ setEnabled(false);
+ globalSelection();
+ disconnect( mySelection, 0, this, 0 );
+ GeometryGUI::GetGeomGUI()->SetActiveDialogBox( 0 );
+}
+
+//=================================================================================
+// function : onActivate
+// purpose : Activate this dialog
+//=================================================================================
+void RepairGUI_FreeFacesDlg::onActivate()
+{
+ GeometryGUI::GetGeomGUI()->EmitSignalDeactivateDialog();
+ setEnabled( true );
+ GeometryGUI::GetGeomGUI()->SetActiveDialogBox( this );
+ connect( mySelection, SIGNAL( currentSelectionChanged() ), SLOT ( onSelectionDone() ) );
+ activateSelection();
+}
+
+//=================================================================================
+// function : Init()
+// purpose :
+//=================================================================================
+void RepairGUI_FreeFacesDlg::Init(SALOME_Selection* theSel)
+{
+ myObj = GEOM::GEOM_Object::_nil();
+
+ mySelection = theSel;
+
+ /* signals and slots connections */
+ GeometryGUI* aGeomGUI = GeometryGUI::GetGeomGUI();
+ connect( aGeomGUI, SIGNAL( SignalDeactivateActiveDialog() ), SLOT ( onDeactivate() ) );
+ connect( mySelection, SIGNAL( currentSelectionChanged() ), SLOT ( onSelectionDone() ) );
+
+ activateSelection();
+ onSelectionDone();
+}
+
+//=================================================================================
+// function : onSelectionDone
+// purpose : SLOT. Called when selection changed.
+//=================================================================================
+void RepairGUI_FreeFacesDlg::onSelectionDone()
+{
+ erasePreview();
+ if( mySelection->IObjectCount() != 1 )
+ {
+ myEdit->setText( "" );
+ return;
+ }
+
+ Standard_Boolean isOk = Standard_False;
+ GEOM::GEOM_Object_var anObj =
+ GEOMBase::ConvertIOinGEOMObject( mySelection->firstIObject(), isOk );
+
+ if ( !isOk || anObj->_is_nil() || !GEOMBase::IsShape( anObj ) )
+ {
+ myEdit->setText( "" );
+ return;
+ }
+ else
+ {
+ myObj = anObj;
+ displayPreview( false, true, true, 3 );
+ }
+}
+
+//=================================================================================
+// function : enterEvent()
+// purpose : Mouse enter onto the dialog to activate it
+//=================================================================================
+void RepairGUI_FreeFacesDlg::enterEvent(QEvent* e)
+{
+ onActivate();
+}
+
+//=================================================================================
+// function : activateSelection
+// purpose : activate selection of faces, shells, and solids
+//=================================================================================
+void RepairGUI_FreeFacesDlg::activateSelection()
+{
+ TColStd_MapOfInteger aMap;
+ aMap.Add( GEOM_SOLID );
+ aMap.Add( GEOM_COMPOUND );
+ globalSelection( aMap );
+}
+
+//=================================================================================
+// function : closeEvent()
+// purpose :
+//=================================================================================
+void RepairGUI_FreeFacesDlg::closeEvent(QCloseEvent* e)
+{
+ onClose();
+}
+
+//=================================================================================
+// function : createOperation
+// purpose :
+//=================================================================================
+GEOM::GEOM_IOperations_ptr RepairGUI_FreeFacesDlg::createOperation()
+{
+ return getGeomEngine()->GetIShapesOperations( getStudyId() );
+}
+
+//=================================================================================
+// function : isValid
+// purpose :
+//=================================================================================
+bool RepairGUI_FreeFacesDlg::isValid( QString& msg )
+{
+ return !myObj->_is_nil() ;
+}
+
+//=================================================================================
+// function : execute
+// purpose :
+//=================================================================================
+bool RepairGUI_FreeFacesDlg::execute( ObjectList& objects )
+{
+ bool aResult = false;
+ GEOM::ListOfLong_var aFaceLst =
+ GEOM::GEOM_IShapesOperations::_narrow( getOperation() )->GetFreeFacesIDs( myObj );
+ TopoDS_Shape aSelShape;
+ TopoDS_Shape aFace;
+ TopTools_IndexedMapOfShape anIndices;
+ if ( !myObj->_is_nil() && GEOMBase::GetShape( myObj, aSelShape ) )
+ {
+ myEdit->setText( GEOMBase::GetName( myObj ) );
+ QString aMess;
+ if ( !isValid( aMess ) )
+ {
+ erasePreview( true );
+ return false;
+ }
+
+ TopExp::MapShapes( aSelShape, anIndices);
+ SALOME_Prs* aPrs = 0;
+ QAD_WaitCursor wc;
+
+ for ( int i = 0, n = aFaceLst->length(); i < n; i++ )
+ {
+ aFace = anIndices.FindKey( aFaceLst[i] );
+ try
+ {
+ getDisplayer()->SetColor( Quantity_NOC_RED );
+ getDisplayer()->SetToActivate( false );
+ aPrs = !aFace.IsNull() ? getDisplayer()->BuildPrs( aFace ) : 0;
+ if ( aPrs )
+ displayPreview( aPrs, true );
+ }
+ catch( const SALOME::SALOME_Exception& e )
+ {
+ QtCatchCorbaException( e );
+ }
+ }
+ }
+ return aResult;
+}
+
+//================================================================
+// Function : getDisplayer
+// Purpose :
+//================================================================
+GEOM_Displayer* RepairGUI_FreeFacesDlg::getDisplayer()
+{
+ if ( !myDisplayer )
+ myDisplayer = new GEOM_Displayer();
+ return myDisplayer;
+}
+
+//=================================================================================
+// function : SetEditCurrentArgument
+// purpose :
+//=================================================================================
+void RepairGUI_FreeFacesDlg::onSetEditCurrentArgument()
+{
+ myEdit->setFocus();
+ onSelectionDone();
+}
+
--- /dev/null
+// GEOM GEOMGUI : GUI for Geometry component
+//
+// Copyright (C) 2003 OPEN CASCADE, EADS/CCR, LIP6, CEA/DEN,
+// CEDRAT, EDF R&D, LEG, PRINCIPIA R&D, BUREAU VERITAS
+//
+// This library is free software; you can redistribute it and/or
+// modify it under the terms of the GNU Lesser General Public
+// License as published by the Free Software Foundation; either
+// version 2.1 of the License.
+//
+// This library is distributed in the hope that it will be useful,
+// but WITHOUT ANY WARRANTY; without even the implied warranty of
+// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU
+// Lesser General Public License for more details.
+//
+// You should have received a copy of the GNU Lesser General Public
+// License along with this library; if not, write to the Free Software
+// Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307 USA
+//
+// See http://www.opencascade.org/SALOME/ or email : webmaster.salome@opencascade.org
+//
+//
+//
+// File : RepairGUI_FreeFacesDlg.h
+// Author : VKN
+// Module : GEOM
+// $Header$
+
+#ifndef DIALOGBOX_FreeFaces_H
+#define DIALOGBOX_FreeFaces_H
+
+#include <qdialog.h>
+#include "GEOMBase_Helper.h"
+
+class GEOM_Displayer;
+class SALOME_Selection;
+class SALOME_Prs;
+class QPushButton;
+class QLineEdit;
+
+//=================================================================================
+// class : RepairGUI_FreeFacesDlg
+// purpose :
+//=================================================================================
+class RepairGUI_FreeFacesDlg : public QDialog,
+ public GEOMBase_Helper
+{
+ Q_OBJECT
+
+public:
+ RepairGUI_FreeFacesDlg(QWidget* parent = 0, const char* name = 0, SALOME_Selection* Sel = 0, bool modal = FALSE, WFlags fl = 0);
+ ~RepairGUI_FreeFacesDlg();
+
+protected:
+ // redefined from GEOMBase_Helper
+ virtual GEOM::GEOM_IOperations_ptr createOperation();
+ virtual bool isValid( QString& );
+ virtual bool execute( ObjectList& objects );
+
+private :
+
+ void Init(SALOME_Selection*);
+ void enterEvent(QEvent* e);
+ void closeEvent(QCloseEvent* e);
+ void activateSelection();
+ GEOM_Displayer* getDisplayer();
+
+private slots:
+
+ void onClose();
+ void onDeactivate();
+ void onActivate();
+ void onSelectionDone();
+ void onSetEditCurrentArgument();
+
+private :
+
+ GEOM_Displayer* myDisplayer;
+ GEOM::GEOM_Object_var myObj;
+ SALOME_Selection* mySelection;
+ QPushButton* mySelBtn;
+ QLineEdit* myEdit;
+
+};
+
+#endif // DIALOGBOX_FreeFaces_H
using namespace std;
#include "RepairGUI_GlueDlg.h"
+#include "DlgRef_1Sel_Ext.h"
+
#include "QAD_Desktop.h"
#include "QAD_SpinBoxDbl.h"
+#include "QAD_MessageBox.h"
+#include "QAD_WaitCursor.h"
#include "OCCViewer_Viewer3d.h"
-#include "DlgRef_1Sel_Ext.h"
#include "SALOME_ListIteratorOfListIO.hxx"
+#include "SALOMEGUI_QtCatchCorbaException.hxx"
#include "GEOMImpl_Types.hxx"
//=================================================================================
bool RepairGUI_GlueDlg::ClickOnApply()
{
- if ( !onAccept() )
+ if ( !onAcceptLocal() )
return false;
initName();
bool RepairGUI_GlueDlg::execute( ObjectList& objects )
{
bool aResult = false;
- GEOM::GEOM_Object_var anObj = GEOM::GEOM_IShapesOperations::_narrow( getOperation() )->MakeGlueFaces( myObject, myTolEdt->value() );
+ GEOM::GEOM_Object_var anObj = GEOM::GEOM_IShapesOperations::_narrow
+ ( getOperation() )->MakeGlueFaces( myObject, myTolEdt->value() );
aResult = !anObj->_is_nil();
if ( aResult )
objects.push_back( anObj._retn() );
return aResult;
}
+
+//================================================================
+// Function : clearShapeBufferLocal
+// Purpose :
+//================================================================
+void RepairGUI_GlueDlg::clearShapeBufferLocal( GEOM::GEOM_Object_ptr theObj )
+{
+ if ( CORBA::is_nil( theObj ) )
+ return;
+
+ string IOR = GeometryGUI::GetORB()->object_to_string( theObj );
+ TCollection_AsciiString asciiIOR( strdup( IOR.c_str() ) );
+ GeometryGUI::GetGeomGUI()->GetShapeReader().RemoveShapeFromBuffer( asciiIOR );
+
+ if ( !getStudy() || CORBA::is_nil( getStudy()->getStudyDocument() ) )
+ return;
+
+ SALOMEDS::Study_var aStudy = getStudy()->getStudyDocument();
+ SALOMEDS::SObject_var aSObj = aStudy->FindObjectIOR( IOR.c_str() );
+ if ( CORBA::is_nil( aSObj ) )
+ return;
+
+ SALOMEDS::ChildIterator_var anIt = aStudy->NewChildIterator( aSObj );
+ for ( anIt->InitEx( true ); anIt->More(); anIt->Next() ) {
+ SALOMEDS::GenericAttribute_var anAttr;
+ if ( anIt->Value()->FindAttribute(anAttr, "AttributeIOR") ) {
+ SALOMEDS::AttributeIOR_var anIOR = SALOMEDS::AttributeIOR::_narrow(anAttr);
+ TCollection_AsciiString asciiIOR( anIOR->Value() );
+ GeometryGUI::GetGeomGUI()->GetShapeReader().RemoveShapeFromBuffer( asciiIOR );
+ }
+ }
+}
+
+//================================================================
+// Function : onAccept
+// Purpose : This method should be called from dialog's slots onOk() and onApply()
+// It perfroms user input validation, then it
+// performs a proper operation and manages transactions, etc.
+//================================================================
+bool RepairGUI_GlueDlg::onAcceptLocal( const bool publish, const bool useTransaction )
+{
+ QAD_Study* aDoc = QAD_Application::getDesktop()->getActiveStudy();
+ SALOMEDS::Study_var aStudy = aDoc->getStudyDocument();
+
+ bool aLocked = aStudy->GetProperties()->IsLocked();
+ if ( aLocked ) {
+ MESSAGE("GEOMBase_Helper::onAccept - ActiveStudy is locked");
+ QAD_MessageBox::warn1 ( (QWidget*)QAD_Application::getDesktop(),
+ QObject::tr("WRN_WARNING"),
+ QObject::tr("WRN_STUDY_LOCKED"),
+ QObject::tr("BUT_OK") );
+ return false;
+ }
+
+ QString msg;
+ if ( !isValid( msg ) ) {
+ showError( msg );
+ return false;
+ }
+
+ erasePreview( false );
+
+ try {
+ if ( ( !publish && !useTransaction ) || openCommand() ) {
+ QAD_WaitCursor wc;
+ QAD_Application::getDesktop()->putInfo( "" );
+ ObjectList objects;
+ // JFA 28.12.2004 if ( !execute( objects ) || !getOperation()->IsDone() ) {
+ if ( !execute( objects ) ) { // JFA 28.12.2004 // To enable warnings
+ wc.stop();
+ abortCommand();
+ showError();
+ }
+ else {
+ const int nbObjs = objects.size();
+ bool withChildren = false;
+ for ( ObjectList::iterator it = objects.begin(); it != objects.end(); ++it ) {
+ if ( publish ) {
+ QString aName("");
+ if ( nbObjs > 1 )
+ aName = strlen( getNewObjectName() ) ? GEOMBase::GetDefaultName( getNewObjectName() ) : GEOMBase::GetDefaultName( getPrefix( *it ) );
+ else {
+ aName = getNewObjectName();
+ // PAL6521: use a prefix, if some dialog box doesn't reimplement getNewObjectName()
+ if ( aName.isEmpty() )
+ aName = GEOMBase::GetDefaultName( getPrefix( *it ) );
+ }
+ addInStudy( *it, aName.latin1() );
+ withChildren = false;
+ display( *it, false );
+ }
+ else { // asv : fix of PAL6454. If publish==false, then the original shape was modified, and need to be re-cached in GEOM_Client
+ // before redisplay
+ clearShapeBufferLocal( *it );
+ withChildren = true;
+ redisplay( *it, withChildren, false );
+ }
+ }
+
+ if ( nbObjs ) {
+ commitCommand();
+ updateObjBrowser();
+ QAD_Application::getDesktop()->putInfo( QObject::tr("GEOM_PRP_DONE") );
+ }
+ else {
+ abortCommand();
+ }
+
+ // JFA 28.12.2004 BEGIN // To enable warnings
+ if ( !getOperation()->_is_nil() ) {
+ if ( !getOperation()->IsDone() ) {
+ wc.stop();
+ QString msgw = QObject::tr( getOperation()->GetErrorCode() );
+ QAD_MessageBox::warn1(QAD_Application::getDesktop(),
+ QObject::tr( "WRN_WARNING" ),
+ msgw,
+ QObject::tr( "BUT_OK" ));
+ }
+ }
+ // JFA 28.12.2004 END
+ }
+ }
+ }
+ catch( const SALOME::SALOME_Exception& e ) {
+ QtCatchCorbaException( e );
+ abortCommand();
+ }
+
+ updateViewer();
+
+ return true;
+}
void closeEvent(QCloseEvent* e);
void initSelection();
+ bool onAcceptLocal( const bool publish = true, const bool useTransaction = true );
+ void clearShapeBufferLocal( GEOM::GEOM_Object_ptr );
+ // Reimplementation of onAccept for local case of this class.
+
GEOM::GEOM_Object_var myObject;
DlgRef_1Sel_Ext* GroupPoints;
